


Systematic List of Minerals

(Strunz VIII th ed.)


Class I - Elements

Mineral Formula System
1/A.01 to 08 Metals and intermetallic alloys
SILVER (-3C,-2H,-4H) Ag C/H
GOLDAMALGAM = GOLD containing Hg, Ag (Au,Ag)Hg C
BRASS (?) Cu3Zn2 C (?)
FERCHROMIDE Cr3Fe1-x (x=0,6) C
CHROMFERIDE Fe3Cr1-x (x=0,6) C
1/A.09 to 12 Carbides, nitrides, phosphides, silicides
PERRYITE (Ni,Fe)8(Si,P)3 H
RHENIUM (?) Re H (?)
1/A.15 to 17 Pt, Fe alloys with Sn, Pb, and related
1/B. Semi-metals and non-metals
1/B.01- Arsenic group
MOISSANITE (-5H,-6H,-10R,-15R,-33R) SiC H/R

Class II - Sulfides and sulfosalts

Mineral Formula System
2/A. Alloys and alloy-like compounds
2/A.01 to 04 Alloys and alloy-like compounds with Cu, Ag, Au, Ni
NOVAKITE (Cu,Ag)21As10 M ps Q
KUTINAITE (K,Tl)0,25Cu14Ag6As6,75 Q
2/A.05 to 07 Alloys and alloy-like compounds with Pt, Pd, etc.
ATHENEITE Pd2(As0,75Hg0,25) H
VINCENTITE (Pd,Pt)3(As,Sb,Te) (?)
MERTIEITE-I Pd11(Sb,As)4 ps H
VASILITE (Pd,Cu)16(S,Te)7 C
KOJONENITE Pd7-xSnTe2 (x between 0,3 and 0,8) Q
OULANKAITE (Pd,Pt)5(Cu,Fe)4SnTe2S2 Q
2/B. Sulfides, selenides, tellurides (M:S,Se,Te higher than 1:1)
2/B.01- Cu sulfides
2/B.02- Complex Cu, Fe Sulfides
2/B.03- Cu selenides
2/B.05 to 08 Sulfides, selenides, tellurides with Ag/Au
HENRYITE (Cu,Ag)3,4Te2 C
2/B.09 to 11 Complex sulfides and selenides with Cu, Hg, Tl
2/B.12 to 17 Sulfides with Ni, Co, Rh, Pd
2/B.15- Hauchecornite group
2/B.16- Pentlandite group
2/C. Sulfides (M:S,Se,Te = 1:1)
2/C.01- Sphalerite group
2/C.03- Chalcopyrite group
PUTORANITE Cu16-18(Fe,Ni)18-19S32 C
ISOCHALCOPYRITE (?) Cu16Fe17S32 or (Fe,Cu)S or Cu8Fe9S16 C
2/C.06 to 10 Stannite group
PETRUKITE (Cu,Fe,Zn)2(Sn,In)S4 O
MAWSONITE Cu+6Fe+++2Sn++++S8 Q
HEMUSITE Cu+4Cu++Sn++++Mo++++S8 C
RENIERITE (Cu,Zn)11(Ge,As)2Fe4S16 Q ps C
VINCIENNITE Cu10Fe4Sn(As,Sb)S16 Q ps C
COLUSITE Cu26V2(As,Sn,Sb)6S32 C
MAIKAINITE Cu10(Fe,Cu)3Mo(Ge,As)3S16 C
OVAMBOITE Cu10(Fe,Zn,Cu)3W(Ge,As)3S16 C
POLKOVICITE (Fe,Pb)3(Ge,Fe)1-xS4 C
2/C.11- Tetrahedrite group
GIRAUDITE (Cu,Zn,Ag)12(As,Sb)4(Se,S)13 C
FREIBERGITE (Ag,Cu)6(Cu,Ag)4(Fe,Zn)2Sb4S12-13 C
GOLDFIELDITE Cu10-12(Te,Sb,As,Bi)4-2S13 C
HAKITE Cu10(Hg,Zn,Cd)2(Sb,As)4(Se,S)13 C
CRERARITE (Pt,Pb)Bi3(S,Se)4-x (x=0,7) C
LEVYCLAUDITE Pb8Sn7Cu3(Bi,Sb)3S28 M ps Q/H
INCAITE (Pb,Ag)4Sn4FeSb2S15 M
COIRAITE (Pb,Sn++)12,5Fe++Sn++++5As3S28 M ps Q/H
FRANCKEITE (Pb,Sn++)6Sn++++2FeSb2S14 A
CYLINDRITE Pb4Fe++Sn++++4Sb+++2S16 A
PYRRHOTITE Fe1-xS (x=0-0,17) M/H
SMYTHITE (Fe,Ni)9S11 or (Fe,Ni)13S16 R
HEIDEITE (Fe,Cr)1+x(Ti,Fe)2S4 M
2/C.20- Nickeline group
IMGREITE (?) NiTe (?) H
IDAITE Cu3FeS4 (?) H
EKPLEXITE (Nb,Mo,W)S2.(Mg1-xAlx)(OH)2+x R
KASKASITE (Mo,Nb)S2.(Mg1-xAlx)(OH)2+x R
VALLERIITE 4(Fe,Cu)S.3(Mg,Al)(OH)2 H
HAAPALAITE 4(Fe,Ni)S.3(Mg,Fe++)(OH)2 H
TOCHILINITE 2(Fe,Ni,Cu)S.1-2(Mg,Fe,Al,Ca)(OH,CO3)1-2 A
2/D. Sulfides (M:S,Se,Te smaller than 1:1)
2/D.01- Linnaeite group
XINGZHONGITE (?) (Pb,Cu,Fe)(Ir,Pt,Rh)2S4 (?) C
BOWIEITE (Rh,Ir,Pt)1,77S3 O
PAXITE Cu2As3 M ps O
2/D.09- Tetradymite group
2/D.14 to 16 Tellurides with Cu, Ag, Au
CAMERONITE Cu5-x(Cu,Ag)3+xTe10 (x = 0,43) Q
MONTBRAYITE (Au,Ag,Sb,Bi,Pb)23(TeSb,Bi,Pb)38 A
NAGYAGITE (Au,Te)3Pb3(Pb,Sb,Bi)3S6 M
2/D.17- Pyrite group
2/D.18- Cobaltite group
2/D.20- Marcasite group
BORISHANSKIITE Pd1+x(As,Pb)2 (x=0-0,2) O
2/D.22- Arsenopyrite group
2/D.23- Lollingite group
DZHEZKAZGANITE (?) Lead or copper rhenium sulfide (?) am.
2/D.28- Melonite group
IRIDISITE (?) (Ir,Cu,Rh,Ni,Pt)S2 ps C
2/E. Sulfosalts (MmXnYp X=As,Sb,Bi Y=S,Se,Te)
2/E.01 to 04 Fe/Cu Sulfosalts (S:As,Sb,Bi = 2)
LAROSITE (Cu,Ag)21(Pb,Bi)2S13 O
KUPCIKITE Cu3,4Fe0,6Bi5S10 M
2/E.05 to 09 Ag Sulfosalts (S:As,Sb,Bi = 6-1,6)
PEARCEITE [(Ag8CuS4)][(AgCu)6(As,Sb)2S7] M
POLYBASITE [(Ag8CuS4)][(AgCu)6(Sb,As)2S7] M ps H
FETTELITE Ag164HgAs4S15 R ps H
MUMMEITE (Ag,Cu)9Pb2Bi13S26 M
DANTOPAITE (Ag,Cu)5(Bi,Pb)13S22 M
PAVONITE (Ag,Cu)(Bi,Pb)3S5 M
MAKOVICKYITE (Ag,Cu)1,5(Bi,Pb)5,5S9 M
2/E.10 to 14 Tl/Hg Sulfosalts (S:As,Sb,Bi = 4-1,6)
GALKHAITE (Cs,Tl)(Hg,Cu,Zn)6(As,Sb)4S12 C
STALDERITE (Tl,Cu)(Zn,Fe,Hg)2As2S6 Q
DALNEGROITE Tl5-xPb2x(As,Sb)21-xS34 A
CHABOURNEITE (Tl,Pb)23(Sb,As)91S147 A
PROTOCHABOURNEITE Tl3,5Pb3(Sb,As)19,5S34 (x about 1,2-1,5) A
2/E.15- Pb Sulfosalts with As/Sb (S:As,Sb,Bi = 3,8-3,1)
2/E.16 to 18 Pb Sulfosalts with As/Sb (S:As,Sb,Bi = 3,0-2,5)
2/E.19 to 21 Pb Sulfosalts with Sb (S:As,Sb,Bi = 3,0-1,9)
ARDAITE Pb19Sb13S35Cl7 M
JASKOLSKIITE Pb2+xCux(Sb,Bi)2-xS5 (x=0,2) O
MADOCITE Pb17(Sb,As)16S41 O
MEERSCHAUTITE Pb42(Ag,Cu)6(Sb,As)45S112 M
CIRIOTTIITE Cu(Cu,Ag)3Pb19(Sb,As)22(As2)S56 M
STERRYITE Ag2Pb10(Sb,As)12S29 O
SORBYITE Pb19(Sb,As)20S49 M
DADSONITE Pb23Sb25S60Cl A ps M
RAYITE (Ag,Tl)2Pb8Sb8S21 M
CHOVANITE Pb14,6Sb14,4S36O0,2 M
2/E.22 to 23 Pb-Fe/Mn, Pb-Ag Sulfosalts with Sb (S:As,Sb,Bi = 2,3-2,0)
FIZELYITE Pb14Ag5Sb21S48 (?) M
RAMDOHRITE CdAg5,5Pb12Sb21,5S48 M
ARSENQUATRANDORITE Ag17,6Pb12,8Sb38,1As11,5S96 M
ROSHCHINITE Ag19Pb10Sb51S96 or Pb(Ag,Cu)2(Sb,As)5S10 O
2/E.24 to 27 Pb Sulfosalts with As/Sb (S:As,Sb,Bi = 2,3-1,8)
RATHITE (Pb,Tl)3As5S10 M
TAZIEFFITE Pb20Cd2(As,Bi)22S50Cl10 M
VURROITE Pb10Sn(Bi,As)11S27Cl3 ps O
TAZIEFFITE Pb10Cd(As,Bi)11S25Cl5 M
2/E.28 to 35 Pb Sulfosalts with Bi (S:As,Sb,Bi = 6,0-1,6)
PAARITE Cu1,7Pb1,7Bi6,3S12 O
SALZBURGITE Cu1,6Pb1,6Bi6,4S12 O
EMILITE Cu2,68Pb2,68Bi5,32S12 O
PEKOITE PbCuBi11(S,Se)18 O
OURAYITE-P (?) (P-OURAYITE) Pb14Ag18Bi28S65 (?) O
SCHIRMERITE PbAgBi3S6 - Pb3Ag1,5Bi3,5S9 O
OYONITE Ag3Mn2Pb4Sb7As4S24 M
NEYITE Pb7(Cu,Ag)2Bi6S17 M
IZOKLAKEITE Pb27(Cu,Fe)2(Sb,Bi)19S57 O
GIESSENITE 2(Cu2Pb26(Bi,Sb)20S57) M
TINTINAITE Pb22Cu+4(Sb,Bi)30S69 O
KOBELLITE Pb22Cu4(Bi,Sb)30S69 O
ROUXELITE Cu2HgPb22Sb28S64(O,S)2 M
ECLARITE Pb9(Cu,Fe)Bi12S28 O
PROUDITE (Pb,Cu)8Bi9-10(S,Se)22 M
WEIBULLITE (Pb,Ag)6Bi8(S,Se)18 O
JUNOITE Pb3Cu2Bi8(S,Se)16 M
USTARASITE Pb(Bi,Sb)6S10 O (?)
2/F.01- Sulfides with non-metallic characteristics
2/F.02 to 03 As sulfides
2/F.04 to 10 Alcali sulfides
OWENSITE (Ba,Pb)6(Cu,Fe,Ni)25S27 C
2/F.11 to 12 Oxysulfides, Hydroxysulfides
OTTENSITE Na3(Sb2O3)3(SbS3).3H2O H
CETINEITE (K,Na)3-3,5(Sb2O3)(SbS3)(OH)x.2,5-3H2O (x = less than 0,5) H
2/F.13 to 15 Halogensulfides/Sulfohalides with Hg/Pb and related compounds
KENHSUITE gamma-Hg3S2Cl2 O

Class III - Halides (Fluorides, Chlorides, Bromides, Iodides)

Mineral Formula System
3/A. Simple halides
3/A.01 to 05 Anhydrous halides (M:H = 1:1)
TOCORNALITE (?) (Ag,Hg)I (?) (?)
3/A.06 to 11 Anhydrous halides (M:H = 1:2, 1:3)
TVEITITE-(Y) Ca1-xYxF2+x M ps C
3/A.12 to 13 Hydrous halides (M:H = 1:1 to 1:3)
LESUKITE (Al,Fe+++)2(OH)5Cl.2H2O C
HYDROMOLYSITE (?) FeCl3.6H2O (?) (?)
3/B. Anhydrous double halides
3/B.01 to 03 Anhydrous double halides with [BF4]-, [SiF6]--, [AlF6]---
JORGENSENITE Na2(Sr,Ba)14Na2Al12F64(OH,F)4 M
JARLITE Na(Sr,Na)7MgAl6F32(OH,H2O)2 M
3/C. Hydrous double halides
3/C.01 to 05 Fluorides
CHUKHROVITE-(Ca) Ca4,5Al2(SO4)F13.12H2O C
CHUKHROVITE-(Y) Ca3(Y,Ce)Al2(SO4)F13.10H2O C
CHUKHROVITE-(Ce) Ca3(Ce,Y)Al2(SO4)F13.10H2O C
CHUKHROVITE-(Nd) Ca3(Nd,Y)Al2(SO4)F13.12H2O C
3/C.06 to 08 Chlorides
3/D. Oxyhalides, hydroxyhalides
3/D.01 to 05 Oxyhalides with Mg, Mn, Cu, Zn, Sn
CENTENNIALITE CaCu3Cl2(OH)6.nH2O (n near 0.7) R
ZIRKLERITE (Fe++,Mg)9Al4Cl18(OH)12.14H2O (?) R
ABHURITE Sn++21Cl16(OH)14O6 R
3/D.06 to 07 Oxyhalides with Hg
COMANCHEITE Hg++55N---24(NH2,OH)4(Cl,Br)34 O
3/D.08 to 10 Oxyhalides with Pb, Bi, Sb and related compounds
3/D.08 Cotunnite series
3/D.09 Matlockite series
ARGESITE (NH)4Bi3Cl16 R ps H
3/D.10 Nadorite series
THORIKOSITE Pb3(Sb+++,As+++)O3(OH)Cl2 Q
MEREHEADITE Pb47(BO3)2(CO3)O24(OH)13Cl25 M
PHILOLITHITE Pb12O6Mn(Mg,Mn++)2(Mn,Mg)4(SO4)(CO3)4Cl4(OH)12 Q
SYMESITE Pb10(SO4)O7Cl4.H2O A ps Q
JANCHEVITE Pb7V+++++(O8,5[]0,5)Cl2 Q
HEREROITE [Pb32(O,[])21](AsO4)2[(Si,As,V,Mo]O4)2Cl10 M
BOLEITE KPb26Ag9Cu24Cl62(OH)48 C
CUMENGEITE Pb21Cu20Cl42(OH)40.6H2O Q

Class IV - Oxides, hydroxides

Mineral Formula System
4/A. Oxides M:O = 2:1 and 1:1 [M2O], [MO]
4/A.04- Periclase group
MURDOCHITE PbCu++6O8-x(Cl,Br)2x (x smaller or = 0,5) C
BITIKLEITE {Ca3}[Sb+++++Sn++++](Al3)O12 C
DZHULUITE {Ca3}[Sb+++++Sn++++](Fe+++3)O12 C
USTURITE {Ca3}[Sb+++++Zr](Fe+++3)O12 C
ELBRUSITE {Ca3}[U+++++0,5Zr1,5](Fe+++3)O12 C
4/B. Oxides M:O = 3:4 [M3O4], spinel type and related compounds
4/B.01 to 04 Spinel group
GALAXITE (Mn++,Fe++,Mg)(Al,Fe+++)2O4 C
4/B.01- Aluminate spinel subgroup
4/B.02- Ferrite spinel subgroup
JACOBSITE (Mn++,Fe++,Mg)(Fe+++,Mn+++)2O4 C
GUITE Co++Co+++2O4 Co++Co+++2O4 C
FRANKLINITE (Zn,Mn++,Fe++)(Fe+++,Mn+++)2O4 C
4/B.03- Chromite spinel subgroup
MANGANOCHROMITE (Mn++,Fe++)(Cr+++,V+++)2O4 C
COCHROMITE (Co,Ni,Fe++)(Cr,Al)2O4 C
NICHROMITE (Ni,Co,Fe++)(Cr+++,Fe+++,Al)2O4 C
4/B.04- V/Ti/Ge spinel subgroup
VUORELAINENITE (Mn++,Fe++)(V+++,Cr+++)2O4 C
QANDILITE (Mg,Fe++)2(Ti,Fe+++,Al)O4 C
TSCHAUNERITE (Fe++)(Fe++Ti++++)O4 O
IWAKIITE Mn++(Fe+++,Mn+++)2O4 Q
DONATHITE (?) (Fe++,Mg)(Cr,Fe+++)2O4 Q
WERNERKRAUSEITE Ca(Fe+++,Mn+++)2Mn++++O6 O
TEGENGRENITE (Mg,Mn++)2Sb+++++0,5(Mn+++,Si,Ti)0,5O4 R ps C
FILIPSTADITE (Mn,Mg)2Sb+++++Fe+++O8 O
APUANITE Fe++Fe+++4Sb+++4O12S Q
MINIUM Pb++2Pb++++O4 Q
4/C. Oxides M:O = 2:3 [M2O3] and related compounds
SILLENITE Bi+++12(SiO4)O16 C
DUKEITE Bi+++24Cr++++++8O57(OH)6.3H2O R
KANGITE (Sc,Ti,Al,Zr,Mg,Ca,[])2O3 C
BIXBYITE (Mn+++,Fe+++)2O3 C
PANGUITE (Ti++++,Sc,Al,Mg,Zr,Ca)1,8O3 O
4/C.04- Hematite group
HEMATITE alpha-Fe2O3 R
4/C.05- Ilmenite group
MAGHEMITE gamma-Fe+++2O3  
ZINCOVELESITE-6N6S Zn3(Fe+++,Mn+++,Al,Ti)8O15(OH) R
FERROHOGBOMITE-2N2S (Fe++,Zn,Mg)3(Al,Fe+++,Ti++++)8O15(OH) H
NOLANITE (V+++,Fe++,Fe+++,Ti)10O14(OH)2 H
RINMANITE (Zn,Mn++)2Sb+++++2Mg2Fe+++4O14(OH)2 H
MAGNESIONIGERITE-6N6S (Mg,Fe++)18(Al42Sn6)[]48O90(OH)6 R
MAGNESIONIGERITE-2N1S (Mg,Fe++)4(Al10Sn2)[]12O22(OH)2 R
FERRONIGERITE-2N1S (Fe,Mg)4(Al10Sn2)O22(OH)2 R
FERRONIGERITE-6N6S (Fe,Mg)18(Al42Sn6)O90(OH)6 R
MENGXIANMINITE (?) (Ca,Na)3(Fe++,Mn++)2Mg2(Sn++++,Zn)5Al8O29 (?) O
YIMENGITE K(Cr+++,Ti,Fe+++,Mg)12O19 H
HAWTHORNEITE Ba[Ti3Cr4Fe++2Fe+++2Mg]O19 H
HAGGERTYITE (Ba,K)(Mg,Cr+++)Fe++4Fe+++2Ti++++5O19 H
BATIFERRITE Ba[Ti2Fe+++8Fe++2]O19 H
HIBONITE (Ca,Ce)(Al,Ti,Mg)12O19 H
HIBONITE-(Fe) (Fe++,Mg)Al12O19 H
NEZILOVITE PbZn2(Mn++++,Ti++++)2Fe+++8O19 H
ZENZENITE Pb3(Fe+++,Mn+++)4Mn++++3O15 H
LINDQVISTITE Pb2(Mn++,Mg)Fe+++16O27 H
PLUMBOFERRITE Pb2(Mn++,Mg)0,33Fe+++0,67O18,33 H
4/C.09- Crichtonite group
LANDAUITE NaMn++Zn2(Ti,Fe+++)6Ti12O38 M ps R
MATHIASITE (K,Ca,Sr)(Ti,Cr,Fe,Mg)21O38 R
LOVERINGITE (Ca,Ce)(Ti,Fe+++,Cr,Mg)21O38 R
CRICHTONITE (Sr,La,Ce,Y)(Ti,Fe+++,Mn)21O38 R
DESSAUITE (Sr,Pb)(Y,U)(Ti,Fe+++)20O38 R ps H
MAPIQUIROITE (Sr,Pb)(U,Y)Fe2(Ti,Fe+++,Cr+++)18O38 R
LINDSLEYITE (Ba,Sr)(Ti,Cr,Fe,Mg,Zr)21O38 R
ALMEIDAITE PbZn2(Mn,Y)(Ti,Fe+++)18O37(OH,O) R
PASEROITE PbMn++(Fe+++,[])2(V+++++,Ti,[])18O38 R
SENAITE Pb(Ti,Fe,Mn)21O38 R
GRAMACCIOLIITE-(Y) (Pb,Sr)(Y,Mn)(Ti,Fe+++)18Fe+++2O38 R ps H
CLEUSONITE (Pb,Sr)(U++++,U++++++)(Fe+++,Zn)2(Ti,Fe++,Fe+++)18(O,OH)38 R
DAVIDITE-(Y) (?) (Y,Ce,La)2Fe+++2(Ti,Fe+++)18O38 (?) R
DAVIDITE-(La) (La,Ce)(Y,U,Fe++)(Ti,Fe+++)20(O,OH)38 R
DAVIDITE-(Ce) (Ce,La)(Y,U,Fe++)(Ti,Fe+++)20(O,OH)38 R
4/C.10- Perovskite group
NATALIAKULIKITE Ca4Ti2(Fe+++,Fe++)(Si,Fe+++,Al)O11 O
LOPARITE-(Ce) (Na,Ce,Ca)(Ti,Nb)O3 Q/O ps Q
4/C.11 to 20 Pyrochlore group
4/C.11- Betafite subgroup
4/C.12- Pyrochlore subgroup
BISMUTOPYROCHLORE = OXYNATROPYROCHLORE or zero-valent-dominant PYROCHLORE (Bi,U,Ca,Pb)1+x(Nb,Ta)2O6(OH).nH2O (?) C
HYDROKENOPYROCHLORE ([],Sb+++,Na,Ca)2(Nb,Ta,W0,Sb+++++Si)2O6 [(H2 O)0,55 Cs0,45] C
CERIOPYROCHLORE-(Ce) = FLUORKENOPYROCHLORE or Ca-/zero-valent-dominant PYROCHLORE (Ce,Ca,Y)2(Nb,Ta)2O6(OH,F) (?) C
4/C.13 to 15 Microlite subgroup
STANNOMICROLITE = OXYSTANNOMICROLITE or Ca- or zero-valrnt-dominant MICROLITE (Sn++,Fe++,Mn++)(Ta,Nb,Sn++++)2(O,OH)7 (?) C
MURATAITE-(Y) (Y,Na)6(Zn,Fe+++)5Ti12O29(O,F)10F4 C
SCHETELIGITE (Ca,Y,Sb,Mn)2(Ti,Ta,Nb,W)2O6(O,OH) O (?)
TAZZOLIITE Ba2CaSr0.5Na0.5Ti2Nb3SiO17[PO2(OH)2]0.5 O
4/C.16 to 17 Romeite group
CUPROROMEITE Cu++2Sb2(O,OH)7 (?) C (?)
OXYCALCIOROMEITE (Ca,Fe++,Sb+++,Na)2Sb+++++2O7 C
INGERSONITE Ca3Mn++Sb+++++4O14 H
4/C.18 to 19 Elsmoreite subgroup
HYDROXYKENOELSMOREITE ([],Pb)2(W,Fe+++,Al)2(O,OH)6(OH) ([],Pb)2(W,Fe+++,Al)2(O,OH)6(OH) R
PITTONGITE Na2(W,Fe+++)9(O,OH)27.4H2O H
ZIRKELITE (Ca,Th,Ce)Zr(Ti,Nb)2O7 C
LAACHITE (Ca,Mn)2Zr2Nb2TiFeO14 M
ASPEDAMITE []12(Fe+++,Fe++)3Nb4[Th(Nb,Fe+++)12O42]{(H2O),(OH)}12 C
4/C.23- Derbylite group
HEMLOITE (As,Sb)2(Ti,V,Fe,Al)12O23OH A
GRAESERITE Fe+++4Ti3As+++O13(OH) M
ZOLTAIITE BaV+++12(Ti,V++++)2(Si2O8)O19 R
GREENWOODITE Ba2-x(V+++OH)xV9(Fe+++,Fe++)2Si2O22 R
BATISIVITE Ba(V+++,Cr+++)8Ti++++6(Si2O7)O22 A
PSEUDOBROOKITE (Fe+++,Fe++)2(Fe++,Ti)O5 O
MONGSHANITE (?) (Mg,Cr,Fe++)2(Ti,Zr,Cr,Fe+++)5O12 H
OXYVANITE (V+++,Cr+++)2(V++++,Ti++++)O5 M
OLKHONSKITE (Cr+++,V+++)2Ti3O9 M (?)
VESTAITE (Ti++++Fe++)Ti++++3O9 M
STIBIVANITE (-2M,-2O) Sb+++2V++++O5 O/M
4/D. Oxides M:O = 1:2 [MO2] and related compounds
4/D.01- Quartz series
LECHATELIERITE (natural fused silica) SiO2  
OPAL SiO2.nH2O am.
CHIBAITE SiO2.0,15(CH4,C2H6,C3H8) C
4/D.02- Rutile group
TRIPUHYITE Fe+++(Sb+++++,Sn,W++++++,Ti++++)O4 Q
4/D.04- Tapiolite group
TAPIOLITE-(Fe) (Fe++,Mn++)(Ta,Nb)2O6 Q
TAPIOLITE-(Mn) (Mn++,Fe++)(Ta,Nb)2O6 Q
BELYANKINITE Ca1-2(Ti,Zr,Nb)5O12.9H2O (?) am.
GERASIMOVSKITE (Mn,Ca)(Nb,Ti)5O12.9H2O (?) am.
JEPPEITE (K,Ba)2(Ti,Fe+++)6O13 M
4/D.08- Cryptomelane group
MANJIROITE (Na,K)(Mn++++,Mn++)8O16.nH2O Q
CRYPTOMELANE K(Mn++++,Mn++)8O16 M ps Q
PRIDERITE (K,Ba)(Ti,Fe+++)8O16 Q
FERRIHOLLANDITE BaMn++++6(Fe+++,Mn+++)2O16 M
HOLLANDITE BaMn++++6Mn++2O16 M
CORONADITE Pb(Mn++++,Mn++)8O16 M ps Q
CESAROLITE PbH2Mn++++3O8 (?)
TODOROKITE (Mn++,Ca,Mg)Mn++++3O7.H2O M
WOODRUFFITE Zn++(Mn++++,Mn+++)5O10.3,5H2O M ps Q
ROMANECHITE (Ba,H2O)2(Mn++++,Mn+++)5O10 M
AKHTENSKITE epsilon-Mn++++O2 H
NSUTITE (gamma-MnO2)Mn++xMn++++1-xO2-2x(OH)2x (x is small) H
VERNADITE (MnO2)(Mn++++,Fe+++,Ca,Na)(O,OH)2.nH2O H
RANCIEITE (Ca,Mn++)Mn++++4O9.3H2O H (?)
TAKANELITE (Mn++,Ca)Mn++++4O8.H2O H
JANGGUNITE Mn++++5-x(Mn++,Fe+++)1+xO8(OH)6 (x=0,2) O
KURANAKHITE PbMn++++Te++++++O6 O
HEFTETJERNITE (Sc,Sn++++,Mn++)(Ta,Nb)O4 M
KORAGOITE (Mn++,Mn+++,Fe++)3(Nb,Ta,Ti)3(Nb,Mn)2(W,Ta)2O20 M
QITIANLINGITE (Fe++,Mn)2(Nb,Ta)2W++++++O10 O
IXIOLITE (Ta,Nb,Sn,Fe,Mn)4O8 M
TITANOWODGINITE (Mn++,Fe++)(Ti,Sn,Ta,Sc)(Ta,Nb)2O8 M
WODGINITE (Ta,Nb,Sn,Mn,Fe)16O32 M
FERROTITANOWODGINITE (Fe++,Mn++)(Ti,Sn++++,Ta,Fe+++)(Ta,Nb)2O8 M
ACHALAITE (Fe++,Mn)(Ti,Fe+++,Ta)(Nb,Ta)2O8 M
FERROWODGINITE (Fe++,Mn++)(Sn,Ti,Fe+++,Ta)(Ta,Nb)2O8 M
COLUMBITE-(Mg) (Mg,Fe++,Mn)(Nb,Ta)2O6 O
COLUMBITE-(Mn) (Mn,Fe++)(Nb,Ta)2O6 O
TANTALITE-(Mg) (Mg,Fe++)(Ta,Nb)2O6 O
POLYCRASE-(Y) (Y,Ca,Ce,U,Th)(Ti,Nb,Ta)2O6 O
YTTROCRASITE-(Y) (Y,Th,Ca,U)(Ti,Fe+++)2(O,OH)6 O
FERSMITE (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 O
EUXENITE-(Y) (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 O
TANTEUXENITE-(Y) (Y,Ce,Ca)(Ta,Nb,Ti)2(O,OH)6 O
SAMARSKITE-(Yb) (Yb,Y,U,Th,Ca,Fe)(Nb,Ta)O4 M ps O
SAMARSKITE-(Y) (Y,Ce,U,Fe+++)3(Nb,Ta,Ti)5O16 M
ISHIKAWAITE (U,Y,Fe+++,Fe++)(Nb,Ti)O4 O
LORANSKITE-(Y) (Y,Ce,Ca)ZrTaO6 (?) O (?)
KOBEITE-(Y) (Y,U)(Ti,Nb)2(O,OH)6 (?) am.
LUCASITE-(Ce) (Ce,La)Ti2(O,OH)6 M
AESCHYNITE-(Y) (Y,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 O
AESCHYNITE-(Ce) (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 O
AESCHYNITE-(Nd) (Nd,Ce,Ca)(Ti,Nb)2(O,OH)6 O
VIGEZZITE (Ca,Ce)(Nb,Ta,Ti)2O6 O
NIOBOAESCHYNITE-(Y) (Y,Ce,Nd)0,5(Ca,Th)0,5(Nb,Ti)2(O,OH)6 O
NIOBOAESCHYNITE-(Nd) (?) (Nd,Ce)(Nb,Ti)2(O,OH)6 O
FERGUSONITE-(Ce) (Ce,Nd,La)NbO4.0,3H2O M
FERGUSONITE-(Nd) (?) (Nd,Ce)(Nb,Ti)O4 M
CHILUITE Bi6Te++++++2Mo++++++2O21 H
GELOSAITE Bi(Mo++++++,Mo+++++)2-2,5O7(OH).H2O M
CESPLUMTANTITE (Cs,Na)2(Pb,Sb+++)3Ta8O24 Q
BAHIANITE Al5Sb+++++3O14(OH)2 M
RANKAMAITE (Na,K,Pb,Li)3(Ta,Nb,Al)11(O,OH)30 O
SOSEDKOITE (K,Na)5Al2(Ta,Nb)22O60 O
HIARNEITE (Ca,Mn++,Na)2(Zr,Mn+++)5(Sb+++++,Ti,Fe+++)2O16 Q
CERIANITE-(Ce) (Ce++++,Th)O2 C
VORLANITE (CaU++++++)O4 C ps H
4/E.01- Oxides M:O smaller than 1:2 [M2O5], [MO3], etc.
MPOROROITE W++++++AlO3(OH)3.2H2O A (?)
ILSEMANNITE Mo3O8.nH2O (?) am.
4/F.01- Hydroxides and hydrated oxides
4/F.03- Brucite series
BOTTINOITE NiSb+++++2(OH)12.6H2O H
DRONINOITE Ni6Fe+++2(OH)16Cl2.4H2O R
WOODALLITE Mg6(Cr,Fe+++)2(OH)16Cl2.4H2O R
IOWAITE Mg6Fe+++2(OH)16Cl2.4H2O H
MUSKOXITE Mg7Fe+++4(OH)13.10H2O H
GOETHITE alpha-Fe+++O(OH) O
AKAGANEITE beta-Fe+++(O,OH,Cl) M ps Q
LITHIOPHORITE Li6Al14Mn++3Mn++++18O42(OH)42 H or M
ASBOLANE (Co,Ni)1-y(Mn++++O2)2-x(OH)2-2y+2x.nH2O H
BYRUDITE (Be,[])(V3+++,Ti++++,Cr)3O6 O
JIANSHUIITE (Mg,Mn++)Mn++++3O7.3H2O A
AURORITE (Mn,Ag,Ca)Mn++++3O7.3H2O A (?)
CHALCOPHANITE (Zn,Fe++,Mn++)Mn++++3O7.3H2O R
CIANCIULLIITE Mn++++(Mg,Mn++)2Zn+2(OH)10.2-4H2O M
OMSITE (Ni, Cu)2Fe+++(OH)6[Sb(OH)6] R
4/F.16- Schoenfliesite group
NATANITE Fe++Sn++++(OH)6 C
MUSHISTONITE (Cu++,Zn,Fe++)Sn++++(OH)6 C
4/F.17- Stottite group
JEANBANDYITE (Fe+++,[])(Sn++++,[])(OH)6 Q ps C
EYSELITE Fe+++Ge++++3O7(OH) O
4/G. Vanadium oxides (V++++/V+++++)
4/G.01- Sorovanadates
POSTITE Mg(H2O)6Al2(OH)2(H2O)8(V10O28).13H2O O
GUNTERITE Na4(H2O)16(H2V10O28).6H2O M ps H
LASALITE Na2Mg2(V10O28).20H2O M
HUEMULITE Na4MgV+++++10O28.24H2O A
BLUESTREAKITE K4Mg2(V++++2V+++++8O28).14H2O M
KOKINOSITE Na2Ca2(V+++++10O28).24H2O A
RAKOVANITE Na3H3V+++++10O28.15H2O M
WERNERBAURITE (NH4)4Ca[V+++++10O28].16H2O A
SCHINDLERITE (NH4)4Na2[V+++++10O28].10H2O A
BURROITE Ca2(NH4)2(V10O28).15H2O A
NASHITE Na3Ca2[(V++++V+++++9)O28].24H2O M
SHERWOODITE Ca9Al2V++++4V+++++24O80.56H2O Q
4/G.02 to 06 Unclassified vanadium oxides
VANOXITE V++++4V+++++2O13.8H2O (?) R (?)
KAZAKHSTANITE Fe+++5V++++3V+++++12O39(OH)9.9H2O M
SCHUBNELITE Fe+++2-x(V+++++,V++++)2O4(OH)4 A
UVANITE U++++++2V+++++6O21.15H2O (?) O (?)
RAUVITE Ca(UO2)2V+++++10O28.16H2O  
4/G.07- Inovanadates [V2O6]--
NAVAJOITE (V+++++,Fe+++)10O24.12H2O M
ALVANITE ZnAl4(VO3)2(OH)12(H2O)2 M
METAMUNIRITE Na2[V+++++2O6] or NaVO3 O
ANSERMETITE Mn++(V+++++2O6).4H2O M
4/G.08- Phyllovanadates
LENOBLITE V++++2O4.2H2O O (?)
4/G.09 12 Phyllovanadates "Vanadiumbronze"
MELANOVANADITE Ca(V+++++2V++++2)O10.5H2O A
BARIANDITE Al3(V+++++,V++++)40O100.45H2O M
BOKITE (Al,Fe+++)1,3(V+++++,V++++,Fe+++)8O20.7,4H2O M
STRACZEKITE (Ca,K,Ba)(V+++++,V++++)8O20.3H2O M
FERNANDINITE Ca(V+++++,V++++,Fe++)80O20.4H2O M
CORVUSITE (Na,Ca,K)(V+++++,V++++,Fe++)8O20.4H2O M
BARNESITE (Na,Ca)2V+++++6O16.3H2O M
GRANTSITE (NaCa)x(V+++++,V++++)6O16.4H2O (x = about 2,3) M
HENDERSONITE (Ca,Sr)x(V+++++,V++++)12O32.12H2O (x = about 2,6) O
4/G.13- Tectovanadates
BANNERMANITE (Na,K)xV++++xV+++++6-xO15 (x=0,7) M
PHOSPHOVANADYLITE (Ba,Ca,K,Na)0,66[P2(V++++,Al)4(O,OH)16].12H2O C
KEGGINITE Pb3Ca3[AsV12O40(VO)].20H2O R
GATEWAYITE Ca6(As+++V++++3V+++++9As+++++6O51).31H2O M
MORRISONITE Ca11(As3+V4+2V5+10As5+6O51)2.78H2O M
PACKRATITE Ca11(As+++V+++++10V++++2As+++++6O51)2.83H2O A
VANARSITE NaCa12(As+++V+++++8,5V4++++3,5As+++++6O51)2.78H2O M
4/H.01 to 08 Uranyl hydroxides and hydrates, with [UO2]++
NOLLMOTZITE Mg[U+++++(U++++++O2)2O4F3].4H2O M
SCHOEPITE [(UO2)8O2(OH)12](H2O)12 O
METASCHOEPITE UO3.nH2O (n smaller than 2 ) O
LEESITE K(H2O)2[(UO2)4O2(OH)5].3H2O O
METAVANDENDRIESSCHEITE PbU7O22.nH2O (n smaller than 12) O
CURITE Pb3(UO2)8O8(OH)6.2H2O O
RICHETITE PbU++++++4O13.4H2O A
HOLFERTITE U++++++1,75Ti++++Ca0,25O7,5(H2O)3 or U++++++1,75Ti++++Ca0,25O7,17(OH)0,67(H2O)3 H
4/J. Arsenites
4/J.01 to 05 Arsenites with [AsO3]--- (isolated groups)
NANLINGITE NaLiCa5Mg12Fe++(AsO3)8F14 R
FREEDITE Pb8Cu+(As+++O3)2O3Cl5 M
TRIGONITE Pb3Mn(As+++O3)2(As+++O2OH) M
ROUSEITE Pb2Mn++(As+++O3)2.2H2O A
NEALITE Pb4Fe++(As+++++O3)2Cl4.2H2O A
ZIMBABWEITE (Na,K)2PbAs+++4(Ta,Nb,Ti)4O18 O
EKATITE (Fe+++,Fe++,Zn)12(OH)6(AsO3)6[AsO3,HOSiO3]2 H
TOOELEITE Fe+++6(As+++O3)4SO4(OH)4.4H2O O
SEELITE Mg(UO2)(AsO4)0,6(AsO3)1,4.7H2O M
CAFARSITE (Ca,Na,[])19Ti8Fe+++4Fe++4(AsO3)28F C
DYMKOVITE (Ni,Mg)(UO2)2(As+++O3).7H2O M
ARMANGITE Mn++26As+++18O50(OH)4(CO3) R
4/J.06- Arsenites with [As2O5]---- groups
FETIASITE (Fe++,Fe+++,Ti++++)3O2(As+++2O5) M
VAJDAKITE [(Mo++++++O2)2(H2O)2As+++2O5)].H2O M
4/J.07- Arsenites with [AsxOy]---- groups
LUDLOCKITE Pb++Fe+++4As+++10O22 A
4/J.08- Arsenites (unclassified)
KARIBIBITE Fe+++2As+++4(O,OH)9 O
LAZARENKOITE (Ca,Fe++)Fe+++As+++3O7.3H2O O
4/J.09- Arsenites with [As4O8]---- (ring arsenites)
GAJARDOITE KCa0,5As+++4O6Cl2.5H2O H / A
STENHUGGARITE CaFe+++(As+++O2)(As+++Sb+++O5) Q
4/J.10- Arsenites with [As2O4]-- (chain arsenites)
4/K. Sulfites, selenites, tellurites
4/K.01 to 10 Sulfites, selenites, tellurites with [XO3]-- and related structures
PINGGUITE Bi+++6Te++++2O13 O
CHOLOALITE PbCu++(Te++++O3)2.H2O C
SOFIITE Zn2(Se++++O3)Cl2 O ps H
JUABITE CaCu10(Te++++O3)4(As+++++O4)4(OH)2.4H2O A
MILLSITE Cu++(Te++++O3).2H2O M
BLAKEITE (?) Fe+++2(TeO3)3 (?)
EMMONSITE Fe+++2Te++++3O9.2H2O A
POUGHITE Fe+++2(TeO3)2(SO4).3H2O O
KEYSTONEITE Mg0,5[Ni++Fe+++(TeO3)3].4,5H2O H
KINICHILITE Mg0,5[Mn++Fe+++(TeO3)3].4,5H2O H
ILIRNEYITE Mg0,5[ZnMn+++(TeO3)3].4,5H2O H
ZEMANNITE Mg0,5[Zn++Fe+++(Te++++O3)3].4,5H2O H
4/K.11- Uranylselenites with [UO2]++ and [SeO3]--
LARISAITE (H3O)(Na,K)(UO2)3O2(SeO3)2.4H2O M
PIRETITE Ca(UO2)3(SeO3)2(OH)4.4H2O O
4/K.12- Tellurates with [Te2O5]--
RAJITE CuTe++++2O5 M
DENNINGITE (Ca,Mn)(Mn,Zn)(Te2O5)2 Q
4/K.13 to 14 Tellurates with [Te3O8]----
CARLFRIESITE CaTe++++2Te++++++O8 M
WALFORDITE (Fe+++,Te++++++)(Te++++3O8) C
4/K.15 to 19 Tellurates with [TeO6]------
RAISAITE Cu++Mg[Te++++++O4(OH)2].6H2O M
ECKHARDITE (Ca,Pb)Cu++Te++++++O5(H2O) M
OTTOITE Pb2Te++++++O5 M
BRUMADOITE Cu3Te++++++O4(OH)4.5H2O M
CESBRONITE Cu++3Te++++++O4(OH)4 O
JENSENITE Cu++3Te++++++O6.2H2O M
MOJAVEITE Cu6[Te++++++O4(OH)2](OH)7Cl R
LEISINGITE (Cu,Mg,Zn)2(Mg,Fe)Te++++++O6.6H2O R
UTAHITE Cu5Zn3(Te++++++O4)4(OH)8.7H2O A
CUZTICITE Fe+++2Te++++++O6.3H2O H
YAFSOANITE {Ca3}[Te++++++2](Zn3)O12 C
XOCOLATLITE Ca2Mn++++2Te++++++2O12.H2O M
FUETTERERITE Pb3Cu++6Te++++++O6(OH)7Cl5 R ps H
KHINITE-4O Pb++Cu++3Te++++++O6(OH)6 O
KHINITE-3T Pb++Cu++3Te++++++O6(OH)2 R
TIMROSEITE Pb2Cu++5(Te++++++O6)2(OH)2 O
PARATIMROSEITE Pb2Cu++4(Te++++++O6)2(H2O)2 O
BAIRDITE Pb2Cu++4Te++++++2O10(OH)2(SO4)(H2O) M
AGAITE Pb3Cu++Te++++++O5(OH)2(CO3) O
BACKITE Pb2AlTe++++++O6Cl R
MONTANITE Bi2Te++++++O6.2H2O M (?)
4/K.16 to 19 Tellurates[TeO6] + groups[(S/P/As/V)O4] or + tellurite[TeO3]--
JOELBRUGGERITE Pb3Zn3(Sb+++++,Te++++++)As2O13(OH,O) H
DUGGANITE Pb3Zn3Te(As,V,Si)2(O,OH)14 H
KUKSITE (Pb,Ca)3Zn3Te++++++O6(PO4,VO4)2 O
TLALOCITE (Cu,Zn)16(Te++++O3)(Te++++++O4)2Cl(OH)25.27H2O M (?)
EUREKADUMPITE (Cu,Zn)16(Te++++O3)2(AsO4)3Cl(OH)18.7H2O O ps H
TLAPALLITE H6(Ca,Pb)2(Cu,Zn)3(SO4)(Te++++O3)4(Te++++++O6) M
YECORAITE Bi5Fe+++3(Te++++O3)(Te++++++O4)2O9.9H2O (?) Q or H
OBOYERITE Pb6H6(Te++++O3)3(Te++++++O6)2.2H2O A
EZTLITE Pb++2Fe+++3(Te++++O3)3(SO4)O2Cl M
THORNEITE Pb6(Te++++++2O10)(CO3)Cl2(H2O) M
4/L. Iodates
4/L.01 to 03 Iodates with [IO3]-

Class V - Nitrates, carbonates, borates

Mineral Formula System
5/A. Nitrates with [NO3]-
SVEITE KAl7(NO3)4Cl2(OH)16.8H2O M
5/B. Anhydrous carbonates [CO3]--, without additional anion
5/B.02- Calcite group
5/B.03- Dolomite group
ANKERITE Ca(Fe++,Mg,Mn)(CO3)2 R
KUTNOHORITE Ca(Mn++,Mg,Fe++)(CO3)2 R
BENSTONITE (Ba,Sr)6(Ca,Mn)6Mg(CO3)13 R
5/B.04- Aragonite group
SAHAMALITE-(Ce) (Mg,Fe++)Ce2(CO3)4 M
REMONDITE-(Ce) Na3(Ce,La,Ca,Na,Sr)3(CO3)5 M ps H
REMONDITE-(La) Na3(La,Ce,Ca)3(CO3)5 M ps H
PETERSENITE-(Ce) (Na,Ca)4(Ce,La,Nd,Sr,Pr,Sm,Ba)2(CO3)5 M
BURBANKITE (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 H
KHANNESHITE (NaCa)3(Ba,Sr,Ce,Ca)3(CO3)5 H
PARATOOITE-(La) (REE,Ca,Na,Sr)6Cu(CO3)8 or REE3(Ca,Sr)2NaCu(CO3)8 O
5/C. Anhydrous carbonates [CO3]--, with additional anions
5/C.01- Azurite - rosasite series
GEORGEITE Cu++5(CO3)3(OH)4.6H2O am.
KOLWEZITE (Cu++,Co)2(CO3)(OH)2 A
ROSASITE (Cu++,Zn)2(CO3)(OH)2 M
LOSEYITE (Mn,Zn)7(CO3)2(OH)10 M
SCLARITE (Zn,Mg,Mn++)4Zn3(CO3)2(OH)10 M
MANGANOTYCHITE Na6(Mn++,Fe++,Mg)2(SO4)(CO3)4 C
DEFERNITE Ca6(CO3)2-x(SiO4)x(OH)7(Cl,OH)1-2x (x=0,5) O
KOZOITE-(Nd) (Nd,La)(CO3)(OH) O
KOZOITE-(La) (La,Ce,Nd)(CO3)(OH) O
PARISITE-(La) Ca(La,Nd,Ce)2F2(CO3)3 M ps R ?
PARISITE-(Nd) Ca(Nd,Ce,La)2(CO3)3F2 R
RONTGENITE-(Ce) Ca2(Ce,La)3(CO3)5F3 R
SYNCHYSITE-(Nd) Ca(Nd,La)(CO3)2F M ps H
CEBAITE-(Ce) Ba3Ce2(CO3)5F2 M
CEBAITE-(Nd) (?) Ba3(Nd,Ce)2(CO3)5F2 M
CORDYLITE-(La) (Na,Ca)Ba(La,Ce,Sr)2(CO3)4F H
ARISITE-(La) NaLa2(CO3)2[F2x(CO3)1-x]F H
ARISITE-(Ce) NaCe2(CO3)2[(CO3)1-xF2x]F H
MINEEVITE-(Y) Na25Ba(Y,Gd,Dy)2(HCO3)4(CO3)11(SO4)2ClF2 H
REEDERITE-(Y) (Na,Al,Mn,Ca)15(Y,Ce,Nd,La)2(CO3)9(SO3F)(Cl,F) H
5/D. Hydrous carbonates [CO3]--, without additional anion
CALKINSITE-(Ce) (Ce,La)2(CO3)3.4H2O O
LANTHANITE-(La) (La,Ce)2(CO3)3.8H2O O
LANTHANITE-(Ce) (Ce,La)2(CO3)3.8H2O O
LANTHANITE-(Nd) (Nd,La)2(CO3)3.8H2O O
EWALDITE (Ba,Sr)(Ca,Na,Y,Ce)(CO3)2.10-12H2O H
DONNAYITE-(Y) Sr3NaCaY(CO3)6.3H2O A ps R
MCKELVEYITE-(Y) Ba3Na(Ca,U)Y(CO3)6.3H2O A ps R
MCKELVEYITE-(Nd) (?) Na(Ba,Sr)3Ca(Nd,Ce,La)(CO3)6.3H2O (?) A
5/E. Hydrous carbonates [CO3]--, with additional anions
DYPINGITE Mg5(CO3)4(OH)2.5H2O M (?)
GIORGIOSITE Mg5(CO3)4(OH)2.5H2O (?) (?)
INDIGIRITE Mg2Al2(CO3)4(OH)2.15H2O M (?)
COALINGITE Mg10Fe+++2(CO3)(OH)24.2H2O R
5/E.02- Manasseite group
QUINTINITE (-2H,-3T) (Mg,Fe++)4Al2(OH)12(CO3).3H2O H/R
CARESITE (-3T) (Fe++,Mg)4Al2(OH)12(CO3).3H2O R
CHARMARITE (-2H,-3T) Mn++4Al2(OH)12(CO3).3H2O H/R
5/E.03- Hydrotalcite group
STICHTITE Mg6Cr+++2(CO3)(OH)16.4H2O R
PYROAURITE Mg6Fe+++2(CO3)(OH)16.4H2O R
REEVESITE Ni6Fe+++2(CO3)(OH)16.4H2O R
COMBLAINITE Ni++6Co+++2(CO3)(OH)16.4H2O R
FOUGERITE Fe++4Fe+++2(OH)12[CO3].3H2O R
SERGEEVITE Ca2Mg11(CO3)13-x(HCO3)x(OH)x.10-xH2O (x=4) R
KARCHEVSKYITE [Mg18Al9(OH)54][Sr2(CO3,PO4)9(H2O,H3O)11] R
PUTNISITE SrCa4Cr+++8(CO3)8SO4(OH)16.25H2O O
SZYMANSKIITE Hg+16(Ni,Mg)6(CO3)12(OH)12(H3O8).3H2O H
DECRESPIGNYITE-(Y) (Y,Gd,Dy)4Cu(CO3)4Cl(OH)5.2H2O M ps H
ANCYLITE-(La) Sr(La,Ce)(CO3)2(OH).H2O O
GYSINITE-(Nd) Pb(Nd,La)(CO3)2(OH).H2O O
MONTROYALITE Sr4Al8(CO3)3(OH,F)26.10-11H2O A (?)
SCHUILINGITE-(Nd) PbCu(Nd,Gd,Sm,Y)(CO3)3(OH).1,5H2O O
5/F. Uranylcarbonates with [UO2]++ and [CO3]--
ZNUCALITE CaZn11(UO2)(CO3)3(OH)20.4H2O A
VOGLITE Ca2Cu++(UO2)(CO3)4.6H2O (?) M
EWINGITE Mg8Ca8(UO2)24(CO3)30O4(OH)12(H2O)138 Q
RABBITTITE Ca3Mg3(UO2)2(CO3)6(OH)4.18H2O M
WYARTITE CaU+++++(UO2)2(CO3)O4(OH).7H2O O
ASTROCYANITE-(Ce) Cu+2(Ce,Nd,La,Pr,Sm,Ca,Y)2(UO2)(CO3)5(OH)2.3H2O H
SHABAITE-(Nd) Ca(Nd,Ce,Sm,Gd,Y)2[(UO2)(CO3)3](CO3)2(H2O)10,5 M
KAMOTOITE-(Y) (Y,Nd,Gd)2U++++++4(CO3)3O12.14,5H2O M
BIJVOETITE-(Y) [(Y,REE)8(H2O)25(UO2)16O8(OH)8(CO3)16](H2O)14 M ps O
5/G. Nesoborates
5/G.01 to 06 Nesoborates with [BO3]---
TUSIONITE Mn++Sn++++(BO3)2 R
PERTSEVITE-(F) Mg2(BO3,SiO4)(F,OH)0,5-1 O
PERTSEVITE-(OH) Mg2(BO3,SiO4)(OH,F)0,5-1 O
YUANFULIITE Mg(Fe+++,Fe++,Al,Ti,Mg)(BO3)O O
PINAKIOLITE (Mg,Mn++)2(Mn+++,Sb+++)BO5 M
MAGNESIOHULSITE (Mg,Fe++)2(Fe+++,Sn++++,Mg)BO5 M
HULSITE (Fe++,Mg)2(Fe+++,Sn)BO5 M
5/G.04- Ludwigite group
AZOPROITE (Mg,Fe++)2(Fe+++,Ti,Mg)BO5 O
ORTHOPINAKIOLITE Mn+++7[(Mn++,Mg)xFe+++y[]z](BO3)8O16 (sum x,y,z=17) O
CHESTERMANITE Sb+++++(Mn+++,Fe+++)5[(Mn++,Mg)xFe+++y](BO3)8O16 (sum x,y=18) O
TAKEUCHIITE Mn+++11[(Mn++,Mg)xFe+++y[]z](BO3)12O24 (sum x,y,z=25) O
BLATTERITE Sb+++++3(Mn+++,Fe+++)9(Mn++,Mg)35(BO3)16O32 O
GAUDEFROYITE Ca4Mn+++3-x(BO3)3(CO3)(O,OH)3 H
KARLITE (Mg,Al)6(BO3)3(OH,Cl)4 O
BERBORITE (-1T,-2T,-3H) Be2(BO3)(OH,F).H2O R
BERBORITE (-1T,-2T,-2H,-3H) Be2(BO3)(OH,F).H2O H
BERBORITE (-1T,-2T,-3H) Be2(BO3)(OH,F).H2O R
SAKHAITE Ca12Mg4(BO3)7(CO3)4Cl(OH)2.H2O C
5/G.07 to 12 Nesoborates with [BO4]-----
5/H. Soroborates
5/H.01 to 04 Soroborates with [B2O5]---- to [B2O7]--
SHIMAZAKIITE-4M Ca2B2-xO5-3x(OH)3x (x=0-0,06) M
SHIMAZAKIITE-4O Ca2B2-xO5-3x(OH)3x (x=0-0,06) O
WISERITE (Mn++,Mg)14B8(Si,Mg)O22(OH)10Cl Q
5/H.05 to 18 Soroborates with [B3O5]- to [B6O10]--
TERTSCHITE Ca4B10O19.20H2O M (?)
TERUGGITE Ca4MgAs2B12O22(OH)12.12H2O M
5/J. Inoborates [B2O4]-- to [B6O10]--
ALDZHANITE (?) CaMgB2O4Cl.7H2O (?) O
5/K. Phylloborates with complex [Bx(O,OH)y] groups
WALKERITE Ca16(Mg,Li)2Cl6B52O68(OH)56.28H2O O
BRAITSCHITE-(Ce) (Ca,Na)7(Ce,La,Nd)2[B6O7(OH)3(O,OH)3]4.(H2O) H
PEPROSSIITE-(Ce) (Ce,La)Al2(B4O10)O0,5 H
5/L. Tectoborates with [BO2]- to [B6O10]--
RHODIZITE (K,Cs)Al4Be4(B,Be)12O28 C
LONDONITE (Cs,K,Rb)Al4Be4(B,Be)12O28 C
ERICAITE (Fe++,Mg,Mn)3B7O13Cl O
CONGOLITE (Fe++,Mg,Mn)3B7O13Cl R
SATIMOLITE KNa2(Al5Mg2)[B12O18(OH)12](OH)6Cl4.4H2O R

Class VI - Sulfates, Chromates, Molybdates, Tungstates, (SO4)--, etc

Mineral Formula System
6/A. Anhydrous sulfates [SO4]--, without additional anion
6/A.01 to 02 Medium cations
MIKASAITE (Fe+++,Al)2(SO4)3 R
6/A.03 to 05 Medium and very large cations
PYRACMONITE (NH4)3Fe+++(SO4)3 R ps H
6/A.06 to 09 Very large cations
6/A.09 Baryte group
6/B. Anhydrous sulfates [SO4]--, with additional anions
6/B.01 to 10 Medium cations
COQUANDITE Sb6+xO8+x(SO4)(OH)x.(H2O)1-x (x = 0.3) A
DANSITE-Fe (D'ANSITE-Fe) Na21Fe++(SO4)10Cl3 C
DANSITE-Mn (D'ANSITE-Mn) Na21Mn++(SO4)10Cl3 C
ADRANOSITE-(Al) (NH4)4NaAl2(SO4)4(OH)2Cl Q
ADRANOSITE-(Fe) (NH4)4NaFe2(SO4)4Cl(OH)2 Q
THERASIAITE (NH4)3KNa2Fe++Fe+++(SO4)3Cl5 M
NABOKOITE Cu++7Te++++O4(SO4)5.KCl Q
ATLASOVITE Cu6Fe+++Bi+++O4(SO4)5.KCl Q
STEVERUSTITE Pb++5Cu+(S++++++O3S--)3(OH)5.2H2O M
SCHMIEDERITE Pb2Cu++2(Se++++O3)(Se++++++O4)(OH)4 M
MAMMOTHITE Pb6Cu4AlSb+++++O2(SO4)2Cl4(OH)16 M
6/B.11 to 14 Large cations
6/B.11- Alunite group
JAROSITE K2Fe+++6(SO4)4(OH)12 R
BEAVERITE-Cu Pb(Cu++,Fe+++,Al)6(SO4)4(OH)12 R
CARACOLITE Na2(Pb2Na)(SO4)3Cl M ps H
6/C. Hydrous sulfates [SO4]--, without additional anion
6/C.01 to 11 Medium cations
6/C.01- Kieserite group
6/C.03- Rozenite group
ILESITE (Mn++,Zn,Fe++)SO4.4H2O M
6/C.04- Chalcanthite group
6/C.05- Hexahydrite group
6/C.06- Melanterite group
ROMERITE Fe++Fe+++2(SO4)4.14H2O A
6/C.12 to 20 Medium and very large cations
6/C.12- Halotrichite group
WUPATKIITE (Co,Mg,Ni)Al2(SO4)4.22H2O M
DIETRICHITE (Zn,Fe++,Mn++)Al2(SO4)4.22H2O M
REDINGTONITE (Fe++,Mg,Ni)(Cr,Al)2(SO4)4.22H2O M
BILINITE Fe++Fe+++2(SO4)4.22H2O M
KALINITE KAl(SO4)2.11H2O M (?)
ALUM-(Na) NaAl(SO4)2.12H2O C
ALUM-(K) KAl(SO4)2.12H2O C
LONECREEKITE (NH4)(Fe+++,Al)(SO4)2.12H2O C
PERTLIKITE K2(Fe++,Mg,Mn++)2(Mg,Fe+++)4Fe+++2Al(SO4)12.18H2O Q ps C
VOLTAITE K2Fe++5Fe+++4(SO4)12.18H2O C
LOWEITE Na12Mg7(SO4)13.15H2O R
6/C.19- Picromerite group
MOHRITE (NH4)2Fe++(SO4)2.6H2O M
6/C.21 to 22 Very large cations
OMONGWAITE (Na,K)2Ca5(SO4)6.3H2O M ps H
WATTEVILLITE Na2Ca(SO4)2.4H2O (?) O (?)
6/D. Hydrous sulfates [SO4]--, with additional anions
6/D.01 to 10 Medium cations
NAMUWITE (Zn,Cu)4(SO4)(OH)6.4H2O H
GUARINOITE (Zn,Co,Ni)6(SO4)(OH,Cl)10.5H2O H
MINOHLITE (Cu,Zn)7(SO4)2(OH)10.8H2O R ps H
KTENASITE (Cu,Zn)5(SO4)2(OH)6.6H2O M
RAMSBECKITE (Cu,Zn)15(SO4)4(OH)22.6H2O M
MOOREITE (Mg,Zn,Mn)15(SO4)2(OH)26.8H2O M
TORREYITE (Mg,Mn)9Zn4(SO4)2(OH)22.8H2O M
HAUCKITE (Mg,Mn++)24Zn18Fe+++3(SO4)4(CO3)2(OH)81 (?) H
ZAHERITE Al12(SO4)5(OH)26.20H2O A
SVYAZHINITE (Mg,Mn)(Al,Fe+++)(SO4)2F.14H2O A
COSSAITE (Mg0,5,[])Al6(SO4)6(HSO4)F6.36H2O R ps H
CAMEROLAITE Cu6Al3(OH)18(H2O)2[Sb(OH)6](SO4) M
WOODWARDITE Cu4Al2(SO4)(OH)12.2-4H2O (?) H
HYDROWOODWARDITE [Cu1-xAlx(OH)2][(SO4)0,5x(H2O)n] (x lower than 0,67; n = about 1,5x) R
ZINCOWOODWARDITE (Zn,Cu)5,5-4Al2,5-4(SO4)1,5-2(OH)16.5-8H2O R ps H
MBOBOMKULITE (Ni,Cu)Al4[(NO3)2,(SO4)](OH)12.3H2O M
HYDROMBOBOMKULITE (Ni,Cu)Al4[(NO3)2,(SO4)](OH)12.13-14H2O M (?)
CARRBOYDITE (Ni,Cu)14Al9(SO4,CO3)6(OH)43.7H2O (?) H
HONESSITE Ni6Fe+++2(SO4)(OH)16.4H2O R
MOUNTKEITHITE (Mg,Ni)11(Fe+++,Cr,Al)3(OH)24(SO4,CO3)3,5.11H2O H
6/D.10- Copiapite group
COPIAPITE Fe++Fe+++4(SO4)6(OH)2.20H2O A
FERRICOPIAPITE (Fe+++,Al,Mg)Fe+++5(SO4)6(OH)2.20H2O A
6/D.11 to 19 Medium and very large cations
MALLESTIGITE Pb3Sb+++++(SO4)(AsO4)(OH)6.3H2O H
PERETAITE CaSb+++4O4(OH)2(SO4)2.2H2O M
6/D.13- Ettringite group
BENTORITE Ca6(Cr,Al)2(SO4)3(OH)12.26H2O H
THAUMASITE Ca6Si2(CO3)2(SO4)2(OH)12.24H2O H
JOURAVSKITE Ca6Mn++++2(SO4,CO3)4(OH)12.26H2O H
CARRARAITE Ca3Ge++++(OH)6(SO4)(CO3).12H2O H
CHARLESITE Ca6(Al,Si)2(SO4)2B(OH)4(OH,O)12.26H2O H
STURMANITE Ca6(Fe+++,Al,Mn++)2(SO4)2[B(OH)4](OH)12.25H2O H
BURYATITE Ca3(Si,Fe+++,Al)(SO4)[B(OH)4](O,OH)5O.12H2O R ps H
METAVOLTINE K2Na6Fe++Fe+++6(SO4)12O2.18H2O H
NATROGLAUCOCERINITE (Na,Zn,Cu)10Al6(SO4)3(OH)32.18(H2O) (?)  
SHIGAITE NaMn++6Al3(SO4)2(OH)18.12H2O R
WERMLANDITE (Ca,Mg)Mg7(Al,Fe+++)2(SO4)2(OH)18.12H2O (?) R
SLAVIKITE (H3O+)3Mg6Fe15(SO4)21(OH)18.98H2O R
CLAIRITE (NH4)2(Fe+++,Mn+++)3(SO4)4(OH)3.3H2O A
HUIZINGITE-(Al) (NH4)9Al3(SO4)8(OH)2.4H2O A
FUENZALIDAITE K6(Na,K)4Na6Mg10(SO4)12(IO3)12.12H2O R
CARLOSRUIZITE K6(Na,K)4Na6Mg10(Se++++++O4)12(IO3)12.12H2O R
NASLEDOVITE PbMn3Al4(CO3)4(SO4)O5.5H2O (?)
EDWARDSITE Cd2(Cu,Zn)3(SO4)2(OH)3.4H2O M
ALDRIDGEITE (Cd,Ca)(Cu,Zn)4(SO4)2(OH)6.3H2O M
TATARSKITE Ca6Mg2(SO4)2(CO3)2Cl4(OH)4.7H2O O
6/D.20 to 21 Uranylsulfates with [UO2]++ and [SO4]--
JACHYMOVITE (UO2)8(SO4)(OH)14.13H2O M (?)
JEZEKITE Na8[UO2(CO3)3(SO4)2].2H2O H
ZIPPEITE K1,85H+0,15[(UO2)4O2(SO4)2(OH)2](H2O)4 M
PLAVNOITE K0,8Mn0,6[(UO2)2O2(SO4)].3,5H2O M
MARECOTTITE Mg3(H2O)18[(UO2)4O3(OH)(SO4)2]2.10H2O A
SEJKORAITE-(Y) (Y1,98Dy0,24)H+0,34[(UO2)8O88O7OH(SO4)4](OH)(H2O)26 A
RABEJACITE Ca2[(UO2)4O4(SO4)2](H2O)8 A
6/F.01 to 05 Chromates [CrO4]--
WATTERSITE Hg+4Hg++Cr++++++O6 M
EDOYLERITE Hg++3Cr++++++O4S2 M
FORNACITE (Pb,Cu++)3[(Cr,As)O4]2(OH) M
IQUIQUEITE K3Na4Mg(Cr++++++O4)B24O39(OH).12H2O H
6/G.01 to 02 Molybdates [MoO4]--, Wolframates (tungstates) [WO4]--
BIEHLITE (Sb+++,As+++)2(MoO6) M
FERRIMOLYBDITE Fe+++2(MoO4)3.8H2O (?) O (?)
TANCAITE-(Ce) Fe+++(Ce,La,Nd)(MoO4)3.3H2O R ps C
OPHIRITE Ca2Mg4[Zn2Mn+++2(H2O)2(Fe+++W9O34)2].46H2O A
6/G.04 to 07 Uranylmolybdates with [UO2]++ and [MoO4]--
MOURITE U++++Mo++++++5O12(OH)10 M
MOLURANITE H4U++++(UO2)3(MoO4)7.18H2O am.
DELORYITE Cu++4(UO2)(MoO4)2(OH)6 M
CALCURMOLITE (Ca,Na)2(UO2)3(MoO4)2(O,OH)3.10-15H2O M
TENGCHONGITE CaU++++++6Mo++++++2O25.12H2O O
COUSINITE MgU2Mo2O13.6H2O (?) (?)

Class VII - Phosphates, Arsenates, Vanadates (PO4)---, etc.

Mineral Formula System
7/A. Anhydrous phosphates [PO4]--- without additional anion
7/A.01- Very small cations: Li, Be, Al
7/A.02 to 05 Medium cations: mainly Fe, Mn
SIMFERITE Li0,5(Mg,Mn+++)5(PO4)3 O
CHOPINITE (Mg,Fe++)3(PO4)2 M
SARCOPSIDE (Fe++,Mn,Mg)3(PO4)2 M
BEUSITE Mn++Mn++2(PO4)2 M
ZAVALIAITE (Mn++,Fe++,Mg)3(PO4)2 M
PANETHITE (Na,Ca,K)2(Mg,Fe++,Mn)2(PO4)2 M
TUITE gamma-(Ca,Mg,Na)3(PO4)2 R
7/A.06 to 11 Medium and large cations: Mg, Mn, Fe, Cu, Zn and Ca, Na
QINGHEIITE-(Fe++) Na2Fe++Mg(Al,Fe+++)(PO4)3 M
QINGHEIITE Na2NaMn++2Mg2(Al,Fe+++)2(PO4)6 M
MANITOBAITE (Na,Ca)3(Mn++,Fe++)5(Al,Fe+++)1,5(PO4)6 M
FERROWYLLIEITE (Na,Ca,Mn)(Fe++,Mn)(Fe++,Fe+++,Mg)Al(PO4)3 M
WYLLIEITE (Na,Ca,Mn++)(Mn++,Fe++)(Fe++,Fe+++,Mg)Al(PO4)3 M
ROSEMARYITE (Na,Ca,Mn++)(Mn++,Fe++)(Fe+++,Fe++,Mg)Al(PO4)3 M
FERROALLUAUDITE NaCaFe++(Fe++,Mn++,Fe+++)2(PO4)3 M
ALLUAUDITE NaCaFe++(Mn++,Fe++,Fe+++,Mg)2(PO4)3 M
FERROHAGENDORFITE (Na,Ca)2Fe++(Fe++,Fe+++)2(PO4)3 (?) M
HAGENDORFITE NaCaMn++(Fe++,Fe+++,Mg)2(PO4)3 M
VARULITE (Na,Ca)Mn++(Mn++,Fe++,Fe+++)2(PO4)3 M
CANUTITE NaMn++3[AsO4]2[AsO2(OH)2] M
CARYINITE Na(Ca,Pb)(Ca,Mn)(Mn,Mg)2(AsO4)3 M
HATERTITE Na2(Ca, Na)(Fe+++, Cu)2(AsO4)3 M
7/A.06- Hagendorfite-Wyllieite groups
YAZGANITE Na(Mg,Mn)Fe+++2(AsO4)3.H2O M
NICKENICHITE Na0,8Ca0,4(Mg,Fe+++,Al)3Cu0,4(AsO4)3 M
YURMARINITE Na7(Fe+++,Mg,Cu)4(AsO4)6 R
GALILEIITE (Na,K)12(Fe++,Mn++,Cr)48(PO4)36 R
CHLADNIITE Na12Ca5(Mg,Fe++)43(PO4)36 R
FILLOWITE Na12Ca4(Mn++,Fe++)44(PO4)36 M
STORNESITE-(Y) (Y,Ca)[]2Na6(Ca,Na)8(Mg,Fe)43(PO4)36 R
BERZELIITE {Ca2Na}[Mg2](As+++++3)O12 C
MANGANBERZELIITE {Ca2Na}[Mn++2](As+++++3)O12 C
SCHAFERITE {Ca2Na}[Mg2](V+++++3)O12 C
PALENZONAITE {Ca2Na}[Mn++2](V+++++3)O12 C
LAMMERITE-beta Cu3(AsO4)2 M
LYONSITE Cu++3Fe+++4(VO4)6 O
7/A.12 to 15 Very large cations: Ca, Na, etc.
OLGITE Na(Na,Sr)2(Ba,Sr)(PO4)2 H
7/A.14- Xenotime series
CHERNOVITE-(Ce) (?) (Ce,Y)(AsO4) Q
WAKEFIELDITE-(Ce) (Ce,La,Nd,Y,Pr,Sm)(V,As)O4 Q
7/A.15- Monazite group
MONAZITE-(Ce) (Ce,La,Nd,Th)PO4 M
MONAZITE-(Nd) (Nd,Ce,Sm)(PO4) M
MONAZITE-(Sm) (Sm,Gd,Ce,Th,Ca)(PO4) M
VITUSITE-(Ce) Na3(Ce,La,Nd)(PO4)2 O
KOSNARITE KZr++++2(PO4)3 R ps C
7/A.18- Rooseveltite series
7/A.19- Clinobisvamite series
7/A.20- Anhydrous divanadates [V+++++2O7]----
ZIESITE Cu2V+++++2O7 M
7/B. Anhydrous phosphates with additional anions: F, Cl, O, OH
7/B.01- Very small cations: Li, Be
7/B.02 to 19 Medium cations: Mg, Mn, Fe, Cu, Zn
GRIPHITE Na4Ca6(Mn,Fe++,Mg)19Li2Al8(PO4)24(F,OH)8 C
7/B.02- Amblygonite group
TRIPLITE (Mn,Fe++,Mg,Ca)2(PO4)(F,OH) M
WOLFEITE (Fe++,Mn++)2(PO4)(OH) M
STANEKITE Fe+++(Mn++,Fe++,Mg)(PO4)O M
JOOSTEITE Mn++(Mn+++,Fe+++)(PO4)O M
SATTERLYITE (Fe++,Mg,Fe+++)2(PO4)(OH) H
PARWELITE (Mn,Mg)5Sb(As,Si)2O12 M
AURIACUSITE Fe+++Cu++(AsO4,Sb+++++O4)(O,OH) O
AVERIEVITE Cu++5O2(VO4)2.n(CuCl) or Cu++5O2(VO4)2.n(CuCl2) or Cu++5O2(VO4)2.n(K,Rb,Cs)Cl M
7/B.08- Lazulite group
LAZULITE (Mg,Fe)Al2(PO4)2(OH)2 M
SCORZALITE (Fe++,Mg)Al2(PO4)2(OH)2 M
LIPSCOMBITE (Fe++,Mn++)Fe+++2(PO4)2(OH)2 Q
RICHELLITE Ca3Fe+++10(PO4)8(OH,F)12.nH2O (?) am.
ROCKBRIDGEITE (Fe++,Mn)Fe+++4(PO4)3(OH)5 O
FERROROCKBRIDGEITE (Fe++,Mn++)2(Fe+++)3(PO4)3(OH)4(H2O) O
FERRIROCKBRIDGEITE (Fe+++0,67[]0,33)2(Fe+++)3(PO4)3(OH)4(H2O) O
FRONDELITE Mn++Fe+++4(PO4)3(OH)5 O
FLINKITE Mn++2Mn+++(AsO4)(OH)4 O
RETZIAN-(La) (Mn,Mg)2(La,Ce,Nd)(AsO4)(OH)4 O
RETZIAN-(Ce) Mn2Ce(AsO4)(OH)4 O
RETZIAN-(Nd) Mn2(Nd,Ce,La)(AsO4)(OH)4 O
GERDTREMMELITE (Zn,Fe++)(Al,Fe+++)2(AsO4)(OH)5 A
SABELLIITE (Cu,Zn)2Zn[(As,Sb)O4](OH)3 R
THEISITE Cu5Zn5(As+++++,Sb+++++)2O8(OH)14 O
HEMATOLITE (Mn,Mg,Al)15(AsO3)(AsO4)2(OH)23 R
ARAKIITE (Zn,Mn++)(Mn++,Mg)12(Fe+++,Al)2(As+++O3)(As+++++O4)2(OH)23 M
7/B.20 to 40 Medium and large cations: Mg, Cu, Zn and Ca, Na, K, Ba, Pb
ARROJADITE-(KNa) KNa5CaFe++13Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(KFeNa) (?) {KNa}{Fe++[]}{Ca}{Na3}{Fe++13}{Al}(PO4)11(HPO4)(OH)2 M
ARROJADITE-(KFe) KNa3CaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(NaFe) (?) {Na2}{Fe++[]}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)(OH)2 M
ARROJADITE-(BaNa) BaNa3(NaCa)Fe++13Al(PO4)11(PO3OH)(OH) M
FERRIARROJADITE-(BaNa) (?) {Ba[]}{Na2}{Ca}{Na2[]}{Fe++13}{Fe+++}(PO4)11(HPO4)(OH)2 M
ARROJADITE-(BaFe) Na2BaCaFe++14Al(PO4)11(PO3OH)(OH)2 M
FLUORARROJADITE-(KNa) (?) {KNa}{Na2}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)F2 M
FLUORARROJADITE-(NaFe) (?) {Na2}{Fe++[]}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)F2 M
ARROJADITE-(SrFe) Na2SrCaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(PbFe) Na2PbCaFe++14Al(PO4)11(PO3OH)(OH)2 M
FLUORCARMONITE-(BaNa) Ba[]Na2Na2[]CaMg13Al(PO4)11(PO3OH)F2 M
SAMUELSONITE (Ca,Ba)Ca8(Fe++,Mn++)4Al2(PO4)10(OH)2 M
7/B.24- Bearthite-Brackebuschite-Tsumebite group
GAMAGARITE Ba2(Fe+++,Mn+++)(VO4)2(OH) M
BUSHMAKINITE Pb2(Al,Cu++)PO4(V+++++,Cr++++++)O4(OH) M
FEINGLOSITE Pb2(Zn,Fe++)[(As,S)O4]2.H2O M
LULZACITE Sr2Fe++(Fe++,Mg)2Al4(PO4)4(OH)10 A
JAMESITE Pb2ZnFe+++2(Fe+++2,8Zn1,2)(AsO4)4(OH)8[(OH)1,2O0,8] A
MAXWELLITE (Na,Ca)(Fe+++,Al,Mg)(AsO4)(F,O) M
THADEUITE (Ca,Mn++)(Mg,Fe++,Mn+++)3(PO4)2(OH,F)2 O
7/B.26- Adelite group
7/B.27- Descloizite group
CECHITE Pb(Fe++,Mn)(VO4)(OH) O
PALERMOITE (Sr,Ca)(Li,Na)2Al4(PO4)4(OH)4 O
PEATITE-(Y) Li4Na12(Y,Na,Ca,HREE)12(PO4)12(CO3)4(F,OH)8 O ps C
RAMIKITE-(Y) Li4Na12(Y,Ca,HREE)6Zr6(PO4)12(CO3)4O4(OH,F)4 A ps C
ATTAKOLITE (Ca,Sr)Mn++(Al,Fe+++)4[(Si,P)O4]H(PO4)3(OH)4 M
SEWARDITE Ca2Fe+++2(AsO4)2(OH)2 O
CARMINITE PbFe+++2(AsO4)2(OH)2 O
PAGANOITE (Ni,Co)Bi+++As+++++O5 A
KHORIXASITE (Bi0,67[]0,33)Cu(VO4)(OH) M
7/B.29- Bjarebyite group
PENIKISITE Ba(Mg,Fe++)2Al2(PO4)3(OH)3 A
KULANITE Ba(Fe++,Mn,Mg)2Al2(PO4)3(OH)3 A
BJAREBYITE (Ba,Sr)(Mn++,Fe++,Mg)2Al2(PO4)3(OH)3 M
JOHNTOMAITE Ba(Fe++,Ca,Mn++)2Fe3+++2(PO4)3(OH)3 M
PERLOFFITE Ba(Mn,Fe++)2Fe+++2(PO4)3(OH)3 M
DRUGMANITE Pb2(Fe+++,Al)H(PO4)2(OH)2 M
ARTSMITHITE Hg+4Al(PO4)2-x(OH)1+3x (x = 0,26) M
HEYITE Pb5Fe++2(VO4)2O4 M
7/B.35- Beudantite group
CORKITE PbFe+++3(PO4)(SO4)(OH)6 R
7/B.36- Crandallite group
VISEITE Ca10Al24(SiO4)6(PO4)7O22F3.72H2O (?) C
GALLOPLUMBOGUMMITE Pb(Ga,Al)3-xGexH1-x(PO4)2(OH)6 (x between 0 and 1) R
EYLETTERSITE (Th,Pb)1-xAl3(PO4,SiO4)2(OH)6 (?) R
FLORENCITE-(La) (La,Ce)Al3(PO4)2(OH)6 R
FLORENCITE-(Sm) (Sm,Nd)Al3(PO4)2(OH)6 R
ARSENOFLORENCITE-(Nd) (?) (Nd,La,Ce,Ba)(Al,Fe+++)3(AsO4,PO4)2(OH)6 (?) R
FLORENCITE-(Nd) (Nd,Ce)Al3(PO4)2(OH)6 A
GRAULICHITE-(Ce) (Ce,Ba)(Fe+++,Al)3(AsO4)2(OH,H2O)6 A
BENAUITE (Sr,Ba)(Fe+++,Al)3(PO4)2(SO4)2(OH,H2O)6 R
KOLITSCHITE Pb[Zn0,5[]0,5]Fe3(AsO4)2(OH)6 M ps R
ZAIRITE Bi(Fe+++,Al)3(PO4)2(OH)6 R
BRENDELITE (Bi+++,Pb++)2(Fe+++,Fe++)O2(OH)(PO4) M
NEUSTADTELITE Bi2Fe+++(Fe+++,Co++)O2(OH)2(AsO4)2 A
MEDENBACHITE Bi2Fe+++(Cu,Fe++)O2(OH)2(AsO4)2 A
DAQINGSHANITE-(Ce) (Sr,Ca,Ba)3(Ce,La)(PO4)(CO3)3-x(OH,F)x H
7/B.39- Apatite group
DELONEITE (Na,Ca,Ce)2Sr3(Ca,Ce)5(PO4)6(OH)F R
BELOVITE-(Ce) Sr3Na(Ce,La)(PO4)3(F,OH) R
BELOVITE-(La) Sr3Na(La,Ce)(PO4)3(F,OH) R
KUANNERSUITE-(Ce) NaBa3(Ce,Nd,La)(PO4)3(F,Cl) R ps H
MORELANDITE (Ba,Pb)3(Ca,Pb)2(AsO4,PO4)3Cl H
MIMETITE-M Pb5(AsO4)3Cl M ps H
7/C. Hydrous phosphates without additional anion
7/C.01 to 15 Small and medium cations: Be and Mn, Fe, Cu, Zn, Mg
PAHASAPAITE (Ca5,5Li3,6K1,2Na0,2[]13,5)Li8[Be24P24O96].38H2O C
WILANCOOKITE (Ba,K,Na)8(Ba,Li,[])6Be24P24O96.32H2O C
FAHEYITE (Mn,Mg)Fe+++2Be2(PO4)4.6H2O H
GAINESITE Na(Na,K)(Be,Li)(Zr,Zn)2(PO4)4.1-2H2O Q
CHONGITE Ca3Mg2(AsO4)2(AsO3OH)2.4H2O M
KAATIALAITE Fe+++As+++++3O9.6-8H2O M
GEMINITE Cu++(As+++++O3OH).H2O A
CHUDOBAITE (Mg,Zn)5H2(AsO4)4.10H2O A
HLOUSEKITE (Ni,Co)Cu4(AsO4)2(AsO3OH)2.9H2O A
KLAJITE MnCu4(AsO4)2(AsO3OH)2.9-10H2O A
GEIGERITE Mn5(H2O)8(AsO3OH)2(AsO4)2.2H2O A
KOLOVRATITE Hydrous vanadate of Ni and Zn (?)
GARYANSELLITE (Mg,Fe+++)3(PO4)2(OH,O).1,5H2O O
7/C.09- Variscite group
LUDLAMITE (Fe++,Mg,Mn)3(PO4)2.4H2O M
SWITZERITE (Mn++,Fe++)3(PO4)2.7H2O M
RADOVANITE Cu2Fe+++(As+++O2)(As+++++O4)(OH)2.H2O O
SMOLIANINOVITE (Co,Ni,Mg,Ca)3(Fe+++,Al)2(AsO4)4.11H2O O
FAHLEITE Zn5CaFe+++2(AsO4)6.14H2O O
BARAHONAITE-(Al) (Ca,Cu,Na,Al)6Al(AsO4)4.6-6,5(H2O,OH) M
BARAHONAITE-(Fe) (Ca,Cu,Na,Fe+++,Al)6Fe+++(AsO4)4.6(H2O,OH,Cl) M
KANKITE Fe+++AsO4.3,5H2O M
7/C.13- Vivianite group
BARICITE (Mg,Fe++,Fe+++)3(PO4)2.8(H2O,OH) M
ARUPITE (Ni,Fe++)3(PO4)2.8H2O M
BABANEKITE (Cu,Zn,Co,Ni)3(AsO4)2.8H2O M
METAKOTTIGITE (Zn,Fe+++,Fe++)3(AsO4)2.8(H2O,OH) A
7/C.16 to 34 Medium and large cations: Fe, Mn, Zn, Mg and Ca, (NH4)+
7/C.17- Fairfieldite - roselite series
COLLINSITE Ca2(Mg,Fe++)(PO4)2.2H2O A
HILLITE Ca2(Zn,Mg)(PO4)2.2H2O A
MESSELITE Ca2(Fe++,Mn)(PO4)2.2H2O A
ROSELITE Ca2(Co++,Mg)(AsO4)2.2H2O M
BRANDTITE Ca2(Mn++,Mg)(AsO4)2.2H2O M
WICKSITE NaCa2(Fe++,Mn++)4MgFe+++(PO4)6.2H2O O
TASSIEITE (Na,[])Ca2(Mg,Fe++,Fe+++)2(Fe+++,Mg)2(Fe++,Mg)2(PO4)6.2H2O O
BEDERITE []Ca2Mn++2Fe+++2Mn++2(PO4)6.2H2O O
GRISCHUNITE NaCa2Mn++5Fe+++(AsO4)6.2H2O O
WALENTAITE Fe+++3(P0,84As0,16O4)2(O,OH)6As+++2,56Ca0,42Na0,28Mn++0,35Fe++0,30O6,1(OH)0,9(H2O)5,2 O
NATROWALENTAITE [Fe+++0,5Na0,5(H2O)6][NaAs+++2(Fe+++2,33W++++++0,67)(PO4)2O7] O
RIMKOROLGITE (Mg,Mn)5(Ba,Sr,Ca)(PO4)4.8H2O M ps H
JUANSILVAITE Na5Al3[AsO3(OH)]4[AsO2(OH)2]2(SO4)2.4H2O M
FRANCOANELLITE H6(K,Na)3(Al,Fe+++)5(PO4)8.13H2O R
NIAHITE (NH4)(Mn++,Mg,Ca)PO4.H2O O
CHURCHITE-(Dy) (?) (Dy,Sm,Gd,Nd)(PO4).2H2O M
MACHATSCHKIITE (Ca,Na)6(As+++++O4)(As+++++O3OH)3(PO4,SO4).15H2O R
7/C.29- Rhabdophane group
TRISTRAMITE (Ca,U++++,Fe+++)(PO4,SO4).2H2O H
GRAYITE (Th,Pb,Ca)PO4.H2O ps H
NINGYOITE (U,Ca,Ce)2(PO4)2.1-2H2O O ps H
VYSOKYITE U++++[As+++++O2(OH)2]4.4H2O A
KEYITE Cu++3(Zn,Cu++)4Cd2(AsO4)6(H2O)2 M
ERIKAPOHLITE Cu3(Zn,Cu,Mg)4Ca2(AsO4)6.2H2O M
SCHNEEBERGITE (Bi+++,Ca)(Co,Ni,Fe+++)2(AsO4)2[(H2O)(OH)] M
NICKELSCHNEEBERGITE (Bi+++,Ca)(Ni,Co,Fe+++)2(AsO4)2[(H2O)(OH)] M
CABALZARITE Ca(Mg,Al,Fe+++)2(AsO4)2(H2O,OH)2 M
THOMETZEKITE Pb(Cu,Zn)2(AsO4)2(OH,H2O)2 M/A (?)
TSUMCORITE Pb(Zn,Fe+++)2(AsO4)2(OH,H2O)2 M
MAWBYITE Pb(Fe+++,Zn)2(AsO4)2(OH,H2O)2 M
LUKRAHNITE Ca(Cu,Zn)(Fe+++,Zn)(AsO4)2.2(H2O,OH) A
RAPPOLDITE Pb(Co,Ni,Zn)2(AsO4)2.2H2O A ps M
7/C.33 to 34 Molybdophosphates with [MoO4]-- [PO4]--- and similar compounds
MELKOVITE CaFe+++H6(MoO4)4(PO4).6H2O M
BETPAKDALITE-NaNa [Na2(H2O)16Na(H2O)6][Mo8As2Fe+++3O33(OH)4] M
BETPAKDALITE-NaCa (Na,Ca)3Fe+++2(As2O4)(MoO4)6.15H2O M
BETPAKDALITE-CaMg [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe+++3O36(OH)] M
BETPAKDALITE-CaCa MgCa2Fe+++3(Mo++++++8O28)(AsO4)2(OH).23H2O M
MENDOZAVILITE-NaFe (Na,K)(Ca,Mg)2Fe+++3(PO4)2(Mo++++++8O28)(OH).9H2O M
MENDOZAVILITE-KCa [K2(H2O)15Ca(H2O)6][Mo8P2Fe+++3O34(OH)3] M
PARAMENDOZAVILITE NaAl4Fe+++7(PO4)5(P+++++Mo++++++12O40)(OH)16.56H2O M/A
OBRADOVICITE-NaCu Na2(H2O)17Cu(H2O)6][Mo8As2Fe+++3O34(OH)3] O
OBRADOVICITE-KCu H4(K,Na)Cu++Fe+++2(AsO4)(MoO4)5.12H2O O
RANKACHITE CaFe++V+++++4W++++++8O36.12H2O O
7/C.35- Hydrous diphosphates [P2O7]---
FIANELITE Mn++2V+++++(V+++++,As+++++)O7.2H2O M
RUDLINGERITE Mn++2V+++++As+++++O7.2H2O M
7/D. Hydrous phosphates with additional anions
7/D.01 to 02 Small cations: Be, Li
GLUCINE CaBe4(PO4)2(OH)4.0,5H2O (?)
ATENCIOITE Ca2Mg2Fe++2-3Be4(PO4)6(OH)4.6H2O A
ZANAZZIITE Ca2Be4(Mg,Fe++)5(PO4)6(OH)4.6(H2O) M
GUIMARAESITE Ca2(Zn,Mg,Fe++)5Be4(PO4)6(OH)4.6H2O M
ROSCHERITE Ca2Be4(Mn,Fe++)5(PO4)6(OH)4.6H2O M/A
OKRUSCHITE Ca2Mn++5Be4(AsO4)6(OH)4.6H2O M
GREIFENSTEINITE Ca2Be4(Fe++,Mn)5(PO4)6(OH)4.6(H2O) M
TIPTOPITE [(Li,Na,Ca,[])6](OH)2(H2O)(K2)(Be6P6O24) H
7/D.03 to 24 Medium cations: Cu, Zn, Mn, Al, Fe
GLADIUSITE (Fe++,Mg)4Fe+++2(PO4)(OH)11.H2O M ps O
GINIITE Fe++Fe+++4(PO4)4(OH)2.2H2O M
KALUGINITE (Mn++,Ca)MgFe+++(PO4)2(OH).4H2O O
LANDESITE Fe+++Mn++2(PO4)2(OH).2H2O O
SCHMIDITE [Zn2(Fe+++,Mn++)2Fe+++(PO4)3(OH)3(H2O)6].2H2O  
FLURLITE Zn3(Zn,Mn++)Fe+++(PO4)3(OH)2.9H2O M
MANGANFLURLITE ZnMn++3Fe+++(PO4)3(OH)2(H2O)7.2H2O ZnMn++3Fe+++(PO4)3(OH)2(H2O)7.2H2O M
SCHOONERITE [ZnMnFe++2Fe+++(PO4)3(OH)2(H2O)7].2H2O O
WILDENAUERITE Zn(Fe+++,Mn++)2MnFe+++(PO4)3(OH)3(H2O)6.2H2O O
PITTICITE Hydrous ferric arsenate sulfate am.
ZYKAITE Fe+++4(AsO4)3(SO4)(OH).15H2O O
SATPAEVITE Al12V++++2V+++++6O37.30H2O O (?)
CLONCURRYITE Cu0,5Al2(VO)0,5(PO4)2(F,OH)2.5H2O M
NEVADAITE (Cu++,Al,V+++)2-3Al4(PO4)4(OH)F4.11H2O M
WHITECAPSITE H16Fe2++5Fe+++14Sb+++6(AsO4)18O16.120H2O H
7/D.08- Arthurite group
WHITMOREITE Fe++Fe+++2(PO4)2(OH)2.4H2O M
EARLSHANNONITE (Mn++,Fe++)Fe+++2(PO4)2(OH)2.4H2O M
KUNATITE CuFe+++2(PO4)2(OH)2.4H2O M
CORALLOITE Mn++Mn+++2(AsO4)2(OH)2.4H2O M
ARTHURITE Cu++Fe+++2(AsO4,PO4,SO4)2(O,OH)2.4H2O M
COBALTARTHURITE (Co++,Mg)Fe+++2(AsO4)2(OH)2.4H2O M
BENDADAITE Fe++Fe+++2(AsO4)2(OH)2.4H2O M
OJUELAITE ZnFe+++2(AsO4)2(OH)2.4H2O M
MAPIMITE Zn2Fe+++3(AsO4)3(OH)4.10H2O M
VAUXITE Fe++Al2(PO4)2(OH)2.6H2O A
KASTNINGITE (Mn++,Fe++,Mg)Al2(PO4)2(OH)2.8H2O A
STEWARTITE Mn++Fe+++2(PO4)2(OH)2.8H2O A
PSEUDOLAUEITE Mn++Fe+++2(PO4)2(OH)2.7-8H2O M
7/D.10- Paravauxite group
USHKOVITE MgFe+++2(PO4)2(OH)2.8H2O A
SIGLOITE Fe+++Al2(PO4)2(OH)3.7H2O A
LAUEITE Mn++Fe+++2(PO4)2(OH)2.8H2O A
KUMMERITE Mn++Fe+++Al(PO4)2(OH)2.8H2O A
STRUNZITE Mn++Fe+++2(PO4)2(OH)2.6H2O A ps M
BERMANITE Mn++Mn+++2(PO4)2(OH)2.4H2O M
CACOXENITE (Fe+++,Al)25(PO4)17O6(OH)12.75H2O H
TINTICITE Fe+++11(PO4,VO4)8(OH)8.13H2O A
BERAUNITE Fe++Fe+++5(PO4)4(OH)5.4H2O M
TVRDYITE Fe++Fe+++2Al3(PO4)4(OH)5(H2O)4.2H2O M
SOUZALITE (Mg,Fe++)3(Al,Fe+++)4(PO4)4(OH)6.2H2O M
GORMANITE Fe++3Al4(PO4)4(OH)6.2H2O A
DUFRENITE Fe++Fe+++4(PO4)3(OH)5.2H2O M
MATIOLIITE Na(Mg,Fe++)Al5(PO4)4(OH)6.2H2O M
BURANGAITE (Na,Ca)2(Fe++,Mg)2Al10(PO4)8(OH,O)12.4H2O M
NATRODUFRENITE Na(Fe+++,Fe++)(Fe+++,Al)5(PO4)4(OH)6.2H2O M
GAYITE NaMn++Fe+++5(PO4)4(OH)6.2H2O M
ERCITITE Na(Mn+++,Fe+++)(PO4)(OH).2H2O M
KIDWELLITE NaFe+++9(PO4)6(OH)10.5H2O M
MEURIGITE-Na Na(Fe+++,Al)8(PO4)6(OH)7.6,5H2O M
MEURIGITE-K KFe+++8(PO4)6(OH)7.6,5H2O M
PHOSPHOFIBRITE [K0,5(H2O)3][(Fe+++,Cu)8(PO4)6(OH)7(H2O)4] M
SASAITE (Al,Fe+++)6[(PO4),(SO4)]5(OH)3.35-36H2O O
VASHEGYITE Al11(PO4)9(OH)6.38H2O or Al6(PO4)5(OH)3.23H2O O
KRIBERGITE Al5(PO4)3(SO4)(OH)4.2H2O (?) A
ERNSTITE (Mn++1-xFe+++x)Al(PO4)(OH)2-xOx M
7/D.15- Turquoise group
AHEYLITE (Fe++,Zn)Al6(PO4)4(OH)8.4H2O A
TURQUOISE Cu++(Al,Fe+++)6(PO4)4(OH)8.4H2O A
FAUSTITE (Zn,Cu++)Al6(PO4)4(OH)8.4H2O A
CHALCOSIDERITE Cu++(Fe+++,Al)6(PO4)4(OH)8.4H2O A
CLARAITE (Cu,Zn)15(AsO4)2(CO3)4(SO4)(OH)14.7H2O A
GUANACOITE Cu2(Mg,Cu)Mg2(AsO4)2(OH)4.4H2O M
PARNAUITE Cu9(AsO4)2(SO4)(OH)10.7H2O O
CHALCOPHYLLITE Cu++18Al2(AsO4)3(SO4)3(OH)27.33H2O R
BARROTITE Cu9Al(HSiO4)2[(SO4)(HAsO4)0,5](OH)12.8H2O R
RUSAKOVITE (Fe+++,Al)5(VO4,PO4)2(OH)9.3H2O (?)
ROSIERESITE [Pb,Cu,Al,(PO4),H2O] (?) am.
EVANSITE Al3(PO4)(OH)6.6H2O (?) am.
LISKEARDITE [(Al,Fe)32(AsO4)18(OH)42(H2O)22].52H2O O (?)
7/D.25 to 57 Medium and very large cations: Al, Mg and Ca, Na, K
ZDENEKITE Na(Pb,Ca)Cu++5(AsO4)4Cl.5H2O Q
MAHNERTITE (Na,Ca,K)Cu++3(AsO4)2Cl.5H2O Q
BRAITHWAITEITE NaCu++5(Sb+++++Ti4++++)O2(AsO4)4(AsO3OH)2(H2O)8 A
SHUBNIKOVITE Ca2Cu++8(AsO4)6Cl(OH).7H2O (?) O (?)
ENGLISHITE K3Na2Ca10Al15(PO4)21(OH)7.26H2O O
KAPUNDAITE (Na,Ca)2Fe+++4(PO4)4(OH)3.5H2O A
7/D.28- Overite group
LUNOKITE (LUN'OKITE) (Mn++,Ca)(Mg,Fe++,Mn++)Al(PO4)2(OH).4H2O O
MANGANOSEGELERITE (Mn++,Ca)(Mn++,Fe++,Mg)Fe+++(PO4)2(OH).4H2O O
7/D.29- Whiteite group
WHITEITE-(CaFeMg) Ca(Fe++,Mn++)Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(CaMnMg) CaMn++Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(CaMnMn) CaMnMn2Al2[PO4]4(OH)2.8H2O M
WHITEITE-(MnFeMg) (Mn++,Ca)(Fe++,Mn++)Mg2Al2(PO4)4(OH)2.8H2O M
RITTMANNITE (Mn++,Ca)Mn++(Fe++,Mn++)2(Al,Fe+++)2(PO4)4(OH)2.8H2O M
JAHNSITE-(NaMnMg) {(Na,Ca)}{(Mn++,Fe+++)}{(Mg,Fe+++)2}{Fe+++2}(PO4)4(OH)2.8H2O M
JAHNSITE-(NaFeMg) NaMg2Fe+++3(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnMg) CaMn++(Mg,Fe++)2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnFe) CaMn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaFeFe) (?) CaFe++2(Fe++)2(Fe+++)2(PO4)4(OH)2.8H2O (?) M
JAHNSITE-(CaFeMg) CaFe++Mg2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnMn) CaMn++Mn++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnMg) Mn++Mn++Mg2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnMn) (Mn++,Ca)Mn++(Mn++,Fe++)2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnFe) Mn++Mn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnFe++) MnMn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnZn) Mn++Mn++Zn2Fe+++2(PO4)4(OH)2.8H2O M
KECKITE CaMn(Fe+++,Mn)2Fe+++2(PO4)4(OH)3.7H2O M
FERRAIOLOITE MgMn++4(Fe++0,5Al+++0,5)4Zn4(PO4)8(OH)4(H2O)20 M
FALSTERITE Ca2MgMn++2(Fe++0,5Fe+++0,5)4Zn4(PO4)8(OH)4(H2O)14 M
KOLFANITE Ca2Fe+++3O2(AsO4)3.2H2O M
SAILAUFITE NaCaMn+++3O2(AsO4)2(CO3).3H2O M
ROBERTSITE Ca6Mn+++9(PO4)9O6(H2O)6.3H2O M
7/D.31- Montgomeryite group
KINGSMOUNTITE (Ca,Mn++)4(Fe++,Mn++)Al4(PO4)6(OH)4.12H2O M
CALCIOFERRITE Ca4Fe++(Fe+++,Al)4(PO4)6(OH)4.13H2O M
ZODACITE Ca4Mn++Fe+++4(PO4)6(OH)4.12H2O M
GIRVASITE NaCa2Mg3(PO4)2[PO2(OH)2](CO3)(OH)2.4H2O M
MANTIENNEITE (H2O,K)2(Mg,Fe++)2(Al,Fe+++)2Ti(PO4)4(O,F)2.14H2O O
PAULKERRITE (H2O,K)2(Mg,Mn++)2(Fe+++,Al)2Ti(PO4)4(O,F)2.14H2O O
BENYACARITE (H2O,K)2(Mn++,Fe++)2(Fe+++,Ti)2Ti(PO4)4(O,F)2.14H2O O
JOTEITE Ca2CuAl[AsO4][AsO3(OH)]2(OH)2.5H2O A
TAPIAITE Ca5Al2(AsO4)4(OH)4.12H2O M
JUNGITE Ca2Zn4Fe+++8(PO4)9(OH)9.16H2O O
PARWANITE (Na,K)(Mg,Ca)4Al8(CO3)(PO4)8(OH)7.30H2O M ps H
ANGARFITE NaFe+++5(PO4)4(OH)4.4H2O O
JOHNWALKITE K(Mn++,Fe+++,Fe++)2(Nb,Ta)(PO4)2O2(H2O,OH)2 O
SANTAFEITE (Na,Ca,Sr)3(Mn++,Fe+++)2Mn++++2(VO4)4(OH,O)5.2H2O O
PEISLEYITE Na3Al16(SO4)2(PO4)10(OH)17.20H2O M
GUTSEVICHITE (?) (Al,Fe+++)3(PO4,VO4)2(OH)3.8H2O (?) (?)
YUKONITE Ca2Fe+++3(AsO4)4(OH).12H2O (?) am.
OGDENSBURGITE Ca2(Zn,Mn)Fe+++4(AsO4)4(OH)6.6H2O O ps H
MATULAITE Fe+++Al7(PO4)4(PO3OH)2(OH)8(H2O)8.8H2O M
WALLKILLDELLITE-Fe (Ca,Cu)4Fe6[(As,Si)O4]4(OH)8.18H2O H
WALLKILLDELLITE Ca4Mn++6As+++++4O16(OH)8.18H2O H
7/D.53- Mixite group
PETERSITE-(Y) (Y,Ce,Nd,Ca)Cu++6(PO4)3(OH)6.3H2O H
PETERSITE-(La) Cu6La(PO4)3(OH)6.3H2O H
PETERSITE-(Ce) Cu6Ce(PO4)3(OH)6.3H2O H
PETERSITE-(Nd) (?)    
GOUDEYITE (Al,Y)Cu6(AsO4)3(OH)6.3H2O H
ZALESIITE CaCu++6(AsO4)2(AsO3OH)(OH)6.3H2O H
AGARDITE-(Y) (Y,Ca)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(La) (La,Ca)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(Ce) (Ce,Ca,La)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(Nd) (Nd,La,Y)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(Dy) (?) (Dy,La,Ca)Cu6(AsO4)3(OH)6.3H2O (?) H
MIXITE BiCu++6(AsO4)3(OH)6.3H2O H
JUANITAITE (Cu,Ca,Fe++)10Bi(AsO4)4(OH)11.H2O Q
MRAZEKITE Bi+++2Cu++3(PO4)2O2(OH)2.2H2O M
BLEASDALEITE (Ca,Fe+++)2Cu5(Bi+++,Cu++)(PO4)4(H2O,OH,Cl)13 M ps Q
TYROLITE CaCu5(AsO4)2(CO3)(OH)4.6H2O O
TANGDANITE Ca2Cu9(AsO4)4(SO4)0.5(OH)9.9H2O M
DELVAUXITE CaFe+++4(PO4,SO4)2(OH)8.4-6H2O (?) am.
SYNADELPHITE (Mn,Mg,Ca,Pb)9(As+++O3)(As+++++O4)2(OH)9.2H2O (?) A ps O
BOUAZZERITE Mg5,5Bi3Fe+++7(AsO4)9O6(OH)2.43H2O M
VOLBORTHITE Cu++3V+++++2O7(OH)2.2H2O M
MARTYITE (Zn,Co)3(V2O7)(OH)2.2H2O R ps H
7/E. Uranylphosphates/vanadates [UO2]and[PO4]/[AsO4], [UO2]and[V2O8]
7/E.01 Autunite group
TROGERITE (UO2)3(AsO4)2.12H2O (?) Q (?)
SABUGALITE H0,5Al0,5(UO2)2(PO4)2.8H2O M ps Q
SALEEITE Mg(UO2)2(PO4)2.10H2O M ps Q
NOVACEKITE I Mg(UO2)2(AsO4)2.10-12H2O Q
NOVACEKITE Mg(UO2)2(AsO4)2.10-12H2O Q
KAHLERITE Fe++(UO2)2(AsO4)2.10-12H2O Q
FRITZSCHEITE Mn++(UO2)2[(P,V)O4]2.10H2O (?) Q
RAUCHITE (Ni,Mg)(UO2)2(AsO4)2.10H2O A
TORBERNITE Cu++(UO2)2(PO4)2.8-12H2O Q
ZEUNERITE Cu++(UO2)2(AsO4)2.10-16H2O Q
AUTUNITE Ca(UO2)2(PO4)2.10-12H2O Q
7/E.02 Metaautunite group
LEHNERITE Mn++U++++++(PO4)2O.8H2O M
URAMPHITE (NH4)(UO2)(PO4).3H2O O (?)
PSEUDOAUTUNITE (?) (H3O)4Ca2(UO2)2(PO4)4.5H2O (?) Q
SINCOSITE CaV++++2(PO4)2(OH)4.3H2O Q
URANOSPATHITE Al0,5-1(UO2)2(PO4)2F.20-21H2O O ps Q
FURONGITE Al4[(UO2)4(PO4)6](OH)2(H2O)19,5H2O A
VOCHTENITE (Fe++,Mg)Fe+++[(UO2)(PO4)]4(OH).12-13H2O M
COCONINOITE Fe+++2Al2(UO2)2(PO4)4(SO4)(OH)2.20H2O M (?)
XIANGJIANGITE (Fe+++,Al)(UO2)4(PO4)2(SO4)2(OH).22H2O Q
LAKEBOGAITE NaCa(Fe+++,Al)2H(UO2)2(PO4)4(OH)2.8H2O M
MUNDITE Al(UO2)3(PO4)2(OH)3,5.5H2O O
BERGENITE Ba4Ca2(UO2)6(PO4)6O6.16H2O M
FRANCOISITE-(Ce) (Ce,Nd,Ca)(UO2)3(PO4)2O(OH).6H2O M
FRANCOISITE-(Nd) (Nd,Y,Sm,Ce)(UO2)3(PO4)2O(OH).6H2O M
DEWINDTITE Pb3[H(UO2)3O2(PO4)2]2.12H2O O
HUGELITE Pb2(UO2)3(AsO4)2O2.5H2O M
KAMITUGAITE PbAl(UO2)5[(P,As)O4]2(OH)9.9.5H2O A
KIVUITE (Th,Ca,Pb)H2(UO2)4(PO4)2(OH)8.7H2O (?) O (?)
SODIUMKOMAROVITE Na6Ca(Nb,Ti)6(Si4O12)(O,OH)14(F,OH)2.3-4H2O O
KOMAROVITE (Ca,Sr,Na)2(Nb,Ti)6(Si4O12)(O,OH)14(F,OH)2.6-7H2O O
SREINITE (BiO)3Pb(UO2)4(OH)7(PO4,AsO4)2.4H2O C
ASSELBORNITE (BiO)3(Pb,Ba)(UO2)4(OH)7(AsO4)2.4H2O C
7/E.11- Uranyl nesovanadates with [UO2]++++ [V2O8]------
VANURALITE Al(UO2)2(V+++++O4)2(OH).11H2O M
VANURANYLITE (H3O,Ba,Ca,K)1,6(UO2)2V2O8.4H2O (?) O (?)

Class VIII - Silicates

Mineral Formula System
8/A. Nesosilicates: isolated tetrahedrons [SiO4]----, Si:O = 1:4
8/A.01 to 03 Cations in tetrahedral coordination [4]
8/A.04 to 07 Cations in octahedral coordination [6]
8/A.04- Olivine group
LAIHUNITE Fe++Fe+++2(SiO4)2 M
8/A.08 to 12 Cations in cubic and octahedral coordination [8+6]
8/A.08- Garnet group
PYROPE {Mg3}[Al2](Si3)O12 C
ALMANDINE {Fe++3}[Al2](Si3)O12 C
SPESSARTINE {Mn++3}[Al2](Si3)O12 C
CALDERITE {Mn++3}[Fe+++2](Si3)O12 C
KNORRINGITE {Mg3}[Cr+++2](Si3)O12 C
MAJORITE {Mg3}[SiMg](Si3)O12 C
MENZERITE-(Y) {Y2Ca}[Mg2](Si3)O12 C
GROSSULAR {Ca3}[Al2](Si3)O12 C
ANDRADITE {Ca3}[Fe+++2](Si3)O12 C
SCHORLOMITE {Ca3}[Ti2](SiFe+++2)O12 C
MORIMOTOITE {Ca3}[TiFe++](Si3)O12 C
RUBINITE Ca3Ti+++2Si3O12 C
UVAROVITE {Ca3}[Cr+++2](Si3)O12 C
MOMOIITE {Mn++3}[V+++2](Si3)O12 C
GOLDMANITE {Ca3}[V+++2](Si3)O12 C
ERINGAITE {Ca3}[Sc2](Si3)O12 C
KIMZEYITE {Ca3}[Zr2](SiAl2)O12 C
IRINARASSITE {Ca3}[Sn++++2](SiAl2)O12 C
TOTURITE {Ca3}[Sn++++2](SiFe+++2)O12 C
KERIMASITE {Ca3}[Zr2](SiFe+++2)O12 C
WADALITE Ca12Al010Si4O32Cl6 C
ELTYUBYUITE Ca12Fe+++10Si4O32Cl6 C
HOLTSTAMITE Ca3(Al,Mn+++)2(SiO4)2(OH)4 Q
KATOITE Ca3Al2(SiO4)3-x(OH)4x (x = 1,5-3) C
HENRITERMIERITE {Ca3}[Mn+++2](Si2)( [])O8(OH)4 Q
MONTENEVEITE Ca3Sb+++++2(Fe+++2Fe++)O12 C
KHOHARITE Mg3Fe+++2(SiO4)3 C
UMBOZERITE Na3Sr4ThSi8(O,OH)24 am.
8/B. Nesosilicates with tetrahedron's additional anion
8/B.01 to 08 Cations in tetrahedral or octahedral coordination [4/6]
MULLITE Al8(Si,Al)4O16(O,OH,F)4 O
YODERITE (Mg,Al,Fe+++)8Si4(O,OH)20 M
MAGNESIOSTAUROLITE []4Mg4Al16(Al2[]2)Si8O40[(OH)2O6] M
STAUROLITE (Fe++,Mg,Zn)2Al9(Si,Al)4O22(OH)2 M ps O
8/B.04- Humite group
CHONDRODITE (Mg,Fe++)5(SiO4)2(F,OH)2 M
HUMITE (Mg,Fe++)7(SiO4)3(F,OH)2 O
CLINOHUMITE (Mg,Fe++)9(SiO4)4(F,OH)2 M
RIBBEITE (Mn++,Mg)5(SiO4)2(OH)2 O
SONOLITE Mn++9(SiO4)4(OH,F)2 M
CHAPMANITE Sb+++Fe+++2(SiO4)2(OH) M
BRAUNITE Mn++Mn+++6SiO12 Q
BRAUNITE II (?) Ca(Mn+++,Fe+++)14SiO24 Q
OREBROITE Mn++3(Sb+++++,Fe+++)Si(O,OH)7 H
WELINITE Mn++3(W++++++,Mg)0,7SiO4(O,OH)3 H
LANGBANITE (Mn++,Ca)4(Mn+++,Fe+++)9Sb+++++Si2O24 R
YEATMANITE Mn++9Zn6Sb+++++2Si4O28 A
KATOPTRITE (Mn,Mg)13(Al,Fe+++)4Sb+++++2Si2O28 M
HOLDENITE (Mn,Mg)6Zn3(AsO4)2(SiO4)(OH)8 O
KOLICITE Mn7Zn4(AsO4)2(SiO4)2(OH)8 O
MANGANOSTIBITE (Mn++,Fe++)7(SbO4)(AsO4,SiO4)O4 O
DIXENITE Cu+Mn++14Fe+++(As+++O3)5(SiO4)2(As+++++O4)(OH)6 R
TURTMANNITE (Mn,Mg)22,5Mg33x[(V,As)O4]3[SiO4]3[AsO3]xO55x(OH)20+x R ps H
MCGOVERNITE (Mn,Mg,Zn)22(AsO3)(AsO4)3(SiO4)3(OH)20 R
CARLFRANCISITE Mn++3(Mn++,Mg,Fe+++,Al)42[As+++O3]2(As+++++O4)4[(Si,As+++++)O4]6[(As+++++,Si)O4]2(OH)42 R
WIKLUNDITE Pb2(Mn++,Zn)3(Fe+++,Mn++)2(Mn++,Mg)19(As+++O3)2(Si,As+++++O4)6(OH)18Cl6 R
KRAISSLITE (Mn++,Mg)24Zn3Fe+++(As+++O3)2(As+++++O4)3(SiO4)6(OH)18 H
ASBECASITE Ca3(Ti,Fe,Sn)(Be,B,Al)2(As+++,Sb+++)3O6(SiO4)2 R
8/B.12 to 38 Cations with coordination number between [8] and [12]
TRIMOUNSITE-(Y) (Y,Dy,Er,Yb,Gd,Ho,Tb,Sm)2Ti2SiO9 M
IVANYUKITE-Cu Cu[Ti4(OH)2O2(SiO4)3].7H2O C
IVANYUKITE-Na-C Na2[Ti4O2(OH)2(SiO4)3].6H2O C
IVANYUKITE-Na-T Na3[Ti4(OH)O3(SiO4)3].7H2O R
YFTISITE-(Y) (Y,Dy,Er)4(Ti,Sn++++)O(SiO4)2(F,OH)6 O
MONGOLITE Ca4Nb6Si5O24(OH)10.5-6H2O Q
ILMAJOKITE (Na,Ce,Ba)2TiSi3O5(OH)10.nH2O M
TUNDRITE-(Ce) Na2(Ce,La,Nd)2(Ti,Nb)(O,OH)2(SiO4)(CO3)2 A
TUNDRITE-(Nd) Na3(Nd,La)4(Ti,Nb)2(SiO4)2(CO3)3O4(OH).2H2O A
KULIOKITE-(Y) (Y,Yb,Er,Dy,Lu,Gd,Tm,Ho)4Al(SiO4)2(OH)2F5 A
ALUMINOCERITE-(Ce) (Ce,Ca,La,Nd)9(Al,Fe+++)(SiO4)3[SiO3(OH)]4(OH)3 R
CERITE-(Ce) Ce+++9Fe+++(SiO4)6[(SiO3)(OH)](OH)3 R
CERITE-(La) (La,Ce,Ca)9(Fe,Ca,Mg)(SiO4)3[(SiO3)(OH)]4(OH)3 R ps H
SARYARKITE-(Y) Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7.6H2O H
KITTATINNYITE Ca4Mn++2Mn+++4Si4O16(OH)8.18H2O H
NAGELSCHMIDTITE Ca3(PO4)2.2(alpha-Ca2SiO4) H
HARRISONITE Ca(Fe++,Mg)6(PO4)2(SiO4)2 R
CEBOLLITE Ca2(Mg,Fe++,Al)Si2(O,OH)7 O
CHLORITOID (Fe++,Mg,Mn)2Al4Si2O10(OH)4 M/A
OTTRELITE (Mn,Fe++,Mg)2Al4Si2O10(OH)4 M/A
CHESSEXITE Na4Ca2(Mg,Zn)3Al8(SiO4)2(SO4)10(OH)10.40H2O O
8/B.27 to 28 Nesosilicates with [SO4]--, [CrO4]--, [PO4]---
BRITHOLITE-(Ce) (Ce,Ca)5(SiO4,PO4)3(OH,F) H
IRANITE Pb10Cu(CrO4)6(SiO4)2(F,OH)2 A
WHERRYITE Pb7Cu2(SO4)4(SiO4)2(OH)2 M
8/B.29 to 33 Be and B nesosilicates
8/B.29- Datolite - gadolinite group
HOMILITE Ca2(Fe++,Mg)B2Si2O10 M
GADOLINITE-(Ce) (Ce,La,Nd,Y)2Fe++Be2Si2O10 M
GADOLINITE-(Nd) Nd2Fe++Be2O2(SiO4)2 M
KORNERUPINE Mg4(Al,Fe+++)6(Si,B)4O21(OH) O
PRISMATINE (Mg,Al,Fe++)5-6Al4((Si,Al)O4)4(BO3)(O,OH,F)3 O
MAGNESIODUMORTIERITE (Mg,Ti,-)(Al,Mg)2Al4Si3O18-y(OH)yB (y=2-3) O
TITANOHOLTITE (Ti0,75[]0,25)Al6BSi3O18 O
HOLTITE Al6(Al,Ta)(Si,Sb)3BO15(O,OH)2 O
NIOBOHOLTITE (Nb0,6[]0,4)Al6BSi3O18 O
WERDINGITE (Mg,Fe)2Al12(Al,Fe)2Si4B2(B,Al)2O37 A
HARKERITE Ca24Mg8Al2(SiO4)8(BO3)6(CO3)10.2H2O C
OKANOGANITE-(Y) Na(Y,Ce,Nd,Ca,Na)15Fe+++(Si3B3O18)(SiO4)4F10(OH)4 R
VICANITE-(Ce) (Ca,REE,Th)15Fe+++(SiO4)3(Si3B3O18)(BO3)(As+++++O4)(As+++O3)x(NaF3)1-xF7.0,2H2O (x=0.4) R
PROSHCHENKOITE-(Y) (Y,REE,Ca,Na,Mn)15(Fe++,Mn)Ca(P,Si)Si6B3O34F14 R
LAPTEVITE-(Ce) Ca6(Fe++,Mn++)Y3REE7(SiO4)3(PO4)(B3Si3O18)(BO3)F11 H
HUNDHOLMENITE-(Y) (Y,REE,Ca,Na)15(Al,Fe+++)(CaxAs+++1-x)(Si,As+++++)Si6B3(O,F)48 (x = 0,78) R
TRITOMITE-(Y) Y5(SiO4,BO4)3(O,OH,Cl) R (?)
8/B.34 to 38 Uranyl nesosilicates with [UO2]++ and [SiO4]----
OURSINITE (Co,Mg)(UO2)2Si6(OH)2.6H2O O
SWAMBOITE-(Nd) Nd0.33[(UO2)(SiO3OH)].2,5(H2O) M
LEPERSONNITE-(Gd) CaO.(Gd,Dy)2O3.24UO3.8CO2.4SiO2.60H2O O
8/C. Sorosilicates: paired tetrahedrons, Si:O = 2:7
8/C.01 to 06 Sorosilicates [Si2O7]------ without tetrahedron's additional anion
KEIVIITE-(Yb) (Yb,Y)2Si2O7 M
YTTRIALITE-(Y) (Y,Th)2Si2O7 H (?)
PERCLEVEITE-(Ce) (Ce,La,Nd)2(Si2O7) Q
CERVANDONITE-(Ce) (Ce,Nd,La)(Fe+++,Fe++,Ti++++,Al)3O2(Si2O7)1-x+y(AsO3)1+x-y(OH)3x-3y (x=0,47 y=0,31) M
8/C.02- Melilite group
MELILITE (Ca,Na)2(Al,Mg)(Si,Al)2O7 Q
JEFFREYITE (Ca,Na)2(Be,Al)Si2(O,OH)7 O ps Q
8/C.07 to 20 Sorosilicates [Si2O7]6- with tetrahedron's additional anion: O,OH,F
KILLALAITE Ca6,4[H0,6Si2O7]2(OH)2 M
ILVAITE CaFe++2Fe+++Si2O7O(OH) O
MANGANILVAITE CaFe++Fe+++(Mn,Fe++)(Si2O7)O(OH) M
WOHLERITE Na4Ca8(Zr,Nb)4(Si2O7)4(O,OH,F)8 M
MARIANOITE Na2Ca4Nb(Nb,Zr)(Si2O7)2(O,F)4 M
JANHAUGITE Na6Mn++6Ti4(Si2O7)4[O2(OH,F,O)6] M
NORMANDITE NaCa(Mn++,Fe++)(Zr,Ti)(Si2O7)OF M
LAVENITE (Na,Ca)8(Mn++,Fe++)4(Zr,Ti)4(Si2O7)4(O,OH,F)8 M
BAGHDADITE Ca12(Zr,Ti)4(Si2O7)4(O,F)8 M
ROUMAITE (Ca,Na,Ce,La)6-7(Nb,Ti++++)(Si2O7)(OH)F3 M
NIOCALITE Ca14Nb2(Si2O7)4(O6F2) M
HIORTDAHLITE-I (Na3Ca)Ca8Zr2(Y,Zr,REE,Na)+++2(Si2O7)4(O3F5) (?) A
HIORTDAHLITE-II (Na,Ca)4Ca8Zr2(Y,Zr,REE,Na)2(Si2O7)4(O3F5) A
8/C.12- Mosandrite-Rosenbuschite series
MOSANDRITE-(Ce) (Ca3REE)[(H2O)2Ca0,5[]0,5]Ti(Si2O7)2(OH)2(H2O)2 M
RINKITE-(Ce) (Ca3Ce)Na(NaCa)Ti(Si2O7)2(OF)F2 M
NACARENIOBSITE-(Ce) Na3Ca3(Ce,La,Pr,Nd)(Nb,Ti)(Si2O7)2OF3 M
ROSENBUSCHITE (Ca,Na)12(Zr,Ti)4(Si2O7)4(O4F4) A
GOTZENITE Na(Na,Ca)4Ca2Ti(Si2O7)2(O,F)2 A
KOCHITE Na2(Na,Ca)4Ca4(Mn,Ca)2Zr2(Si2O7)4(O,F)4F4 A
HAINITE-(Y) Na2Ca4(Y,REE)Ti(Si2O7)2OF3 A
FOGOITE-(Y) Na3Ca2Y2Ti(Si2O7)2OF3 A
BATIEVAITE-(Y) Y2Ca2Ti(Si2O7)2(OH)2(H2O)4 A
8/C.13- Lamprophyllite series
GRENMARITE (Na,Ca)4(Mn,Na)(Zr,Mn)2(Zr,Ti)(Si2O7)2(O,F)2 M
LILEYITE Ba2(Na,Fe,Ca)3MgTi2(Si2O7)2O2F2 M
EMMERICHITE Ba2Na(Na,Fe++)2(Fe+++,Mg)Ti2(Si2O7)2O2F2 M
ERICSSONITE (-2O) BaMn2(Fe+++O)Si2O7(OH) O
8/C.14- Murmanite-Lomonosovite series
SHKATULKALITE Na10(Mn++,Ca,Sr)Ti3Nb3(Si2O7)6(OH)2F.12H2O M
JINSHAJIANGITE (Na,Ca)(Ba,K)(Fe++,Mn++)4(Ti,Fe+++)2(Si2O7)2O2(F,O,OH)2-3 M
PERRAULTITE (Na,Ca)(Ba,K)(Mn++,Fe++)4(Ti,Zr)2(Si2O7)2O2(OH,F,O)3 M
BOBSHANNONITE Na2KBa(Mn++,Na)8(Nb,Ti)4(Si2O7)4O4(OH)4(O,F)2 A
SURKHOBITE (Ba,K)2CaNa(Mn,Fe++,Fe+++)8Ti4(Si2O7)4O4(F,OH,O)6 M
MURMANITE Na4Ti++++Nb2(Si2O7)2O4.4H2O A
CALCIOMURMANITE (Na,[])2Ca(Ti,Mg,Nb)4[Si2O7]2O2(OH,O)2(H2O)4 A
ZVYAGINITE NaZnNb2Ti[Si2O7]2O(OH,F)3(H2O)4+x (x less than 1) A
EPISTOLITE Na4Ti++++4(Si2O7)2O2(OH,F)2.4H2O A
BORNEMANITE (Na,Ba)4(Na,Ti,Mn++)4(Ti,Nb)2(PO4)(Si2O7)2O2(OH,F,O)2 M
LOMONOSOVITE Na8Mn++Ti++++3Si4O12(PO4)2O4 A
VUONNEMITE Na11Ti++++Nb2(Si2O7)2(PO4)2O3(F,OH) A
INNELITE-1A (Ba,K)4(Na,Ca)3Ti3(Si2O7)(SO4)O4 A
YOSHIMURAITE (Ba,Sr)2(Mn++,Fe++)2(Ti++++,Fe+++)(PO4,SO4,SiO4)(Si2O7)(O,OH) A
BUSSENITE Na2(Ba,Sr)2(Fe++,Mn++)TiSi2O7(CO3)(OH)3F A
QUADRUPHITE Na14Ca(Mg,Mn)(Ti,Mn,Zr,Nb)4Si4O12(PO4)4O6F2 A
SOBOLEVITE Na12Ca(NaCaMn)Ti2(TiMn)[Si2O7]2(PO4)4O3F3 M
POLYPHITE Na5(Na4Ca2)Ti2[Si2O7](PO4)3O2F2 A
8/C.15- Bafertisite series
HEJTMANITE Ba(Mn,Fe++)2TiO(Si2O7)(OH,F)2 M
DELINDEITE (Na,K)3Ba2(Ti,Fe+++)3(Si2O7)2(O,OH,H2O)6 A
CAMARAITE Ba3NaTi4(Fe++,Mn)8(Si2O7)4O4(OH,F)7 A
SCHULLERITE (Na,Ca,Mn)2Ba2(Mg,Fe++)2(Ti,Fe+++)2(Si2O7)2O2F2 A
BYKOVAITE (Ba,Na,K)2{(Na,Ti,Mn)4[(Ti,Nb)2O2Si4O14](H2O,F,OH)2}.3,5H2O M
NECHELYUSTOVITE (Ba,Sr,K)2{(Na,Ti,Mn)4[(Ti,Nb)2O2Si4O14](O,H2O,F)2}.4,5H2O M
KAZANSKYITE Ba[]TiNbNa3Ti(Si2O7)2O2(OH)2(H2O)4 A
LAURENTIANITE [NbO(H2O)]3(Si2O7)2[Na(H2O)2]3 R
FERSMANITE (Ca,Na)8(Ti,Nb)4(Si4O12)O10(F,OH)4 M
BELKOVITE Ba3(Nb,Ti)6(Si2O7)2O12 H
PERRIERITE-(Ce) (Ce,La,Ca,Sr)4(Fe++,Mg,Mn++)(Ti,Fe+++)4Si4O22 M
PERRIERITE-(La) (La,Ce,Ca)4(Fe++,Mn++,Mg)(Ti,Fe)4Si4O22 M
HEZUOLINITE (Sr,REE)4Zr(Ti,Fe+++,Fe++)2Ti2O8(Si2O7)2 M
RENGEITE (Sr,Ce)4Zr(Ti++++,Al)4Si4O22 M
CHEVKINITE-(Ce) (Ca,Ce,La)4(Fe++,Mg)2(Ti,Fe+++)3O8(Si2O7)2 M
DINGDAOHENGITE-(Ce) Ce4Fe++(Ti,Fe++,Mg,Fe+++)2Ti2Si4O22 M
POLYAKOVITE-(Ce) (Ce,La,Nd,Ca)4(Mg,Fe++)(Cr+++,Fe+++)2(Ti,Nb)2Si4O22 M
CHRISTOFSCHAFERITE-(Ce) (Ce,La,Ca)4Mn(Ti,Fe)3(Fe,Ti)(Si2O7)2O8 M
STRONTIOCHEVKINITE (Sr,La,Ce,Ca)4Zr(Ti++++,Fe++,Fe+++)2Ti2O4(Si2O7)2 M
MAONIUPINGITE-(Ce) (Ca,Ce)4(Fe+++,Ti,Fe++,[])(Ti,Fe+++,Fe++,Nb)4Si4O22 M
STAVELOTITE-(La) La3Mn++3Cu++(Mn+++,Fe+++,Mn++++)26[Si2O7]6O30 R
BIRAITE-(Ce) (Fe++,Mg)(Ce,La,Nd)2(CO3)(Si2O7) M
ROWLANDITE-(Y) Y4Fe++Si4O14F2 am.
KARNASURTITE-(Ce) (Ce,La,Th)(Ti,Nb)(Al,Fe+++)(Si,P)2O7(OH)4.3H2O (?) H (?)
8/C.21 to 27 Structures with neso-[SiO4]-- and soro-[Si2O7]------
HARSTIGITE Ca6MnBe4(SiO4)2(Si2O7)2(OH)2 O
DELLAITE Ca6Si3O11(OH)2 M (?)
RUSTUMITE Ca10(Si2O7)2(SiO4)Cl2(OH)2 M
8/C.23- Epidote group
EPIDOTE Ca2Al2Fe+++[Si2O7][SiO4]O(OH) M
EPIDOTE-(Sr) CaSr(Al,Fe+++,Mn+++)3(Si2O7)(SiO4](OH) M
PIEMONTITE Ca2(Al,Mn+++,Fe+++)3Si3O11O(OH) M
PIEMONTITE-(Sr) CaSr(Al,Mn+++,Fe+++)3Si3O11O(OH) M
TWEDDILLITE CaSr(Mn+++,Fe+++)2Al(SiO4)(Si2O7)O(OH) M
PIEMONTITE-(Pb) CaPbAl2Mn+++[Si2O7][SiO4]O(OH) M
ALLANITE-(Y) Ca(Y,Ce,La)(Al,Fe++,Fe+++)3(SiO4)3(OH) M
ALLANITE-(La) Ca(La,REE,Ca)Al2(Fe2+,Fe3+)(SiO4)(Si2O7)O(OH) M
ALLANITE-(Ce) (Ce,Ca,Y)2(Al,Fe++,Fe+++)3(SiO4)3(OH) M
ALLANITE-(Nd) CaNdAl2Fe++(SiO4)(Si2O7)O(OH) M
FERRIALLANITE-(La) Ca(La,Ce,Th)(Fe+++,Al)(Al,Fe+++)(Fe++,Mn,Ti,Mg)(SiO4)(Si2O7)O(OH) M
FERRIALLANITE-(Ce) CaCeFe+++AlFe++[Si2O7][SiO4]O(OH) M
DISSAKISITE-(La) Ca(La,Ce,Th)(Mg,Fe++)(Al,Fe+++,Cr)2(SiO4)(Si2O7)O(OH) M
DISSAKISITE-(Ce) Ca(Ce,La)(Mg,Fe++)(Al,Fe+++)2(SiO4)3(OH) M
UEDAITE-(Ce) (Mn++,Ca,Fe++)(Ce,Nd)Fe++(Al,Fe+++)2(Si2O7)(SiO4)OOH M
ASKAGENITE-(Nd) Mn++NdAl2Fe+++(Si2O7)(SiO4)O2 M
MANGANIANDROSITE-(La) (Mn++,Ca)(La,Ce,Ca,Nd)AlMn+++Mn++(SiO4)(Si2O7)O(OH) M
MANGANIANDROSITE-(Ce) (Mn++,Ca)(Ce,La)Mn++(Mn+++,Fe+++)Al(SiO4)(Si2O7)O(OH) M
VANADOANDROSITE-(Ce) (Mn++,Ca)(Ce,La)Mn++(V+++,Mg,Al)Al(SiO4)(Si2O7)(O,F)(OH) M
KHRISTOVITE-(Ce) (Ca,REE)REE(Mg,Fe++)AlMn++Si3O11(OH)(F,O) M
VASTMANLANDITE-(Ce) (Ce,La)3CaAl2Mg2[Si2O7][SiO4]3F(OH)2 M
GATELITE-(Ce) Ca(Ce,Nd,La,Pr)3(Mg,Fe++,Al)(Al,Mg)3(SiO4)3(Si2O7)(O,F)(OH,O)2 M
PERBOEITE-(Ce) Ca(Ce,Nd,La)3Al3Fe++Si2O7[SiO4]3O(OH)2 M
ALNAPERBOEITE-(Ce) Na0,5Ca(Ce,Nd,La)2,5Al4Si2O7[SiO4]3O(OH)2 M
FERRIPERBOEITE-(La) (CaLa3)(Fe+++Al2Fe++)[Si2O7][SiO4]3O(OH)2 M
FERRIPERBOEITE-(Ce) (CaCe3)(Fe+++Al2Fe++)(Si2O7)(SiO4)3O(OH)2 M
ZOISITE Ca2Al3[Si2O7][SiO4]O(OH) O
8/C.24- Pumpellyite group
MACFALLITE Ca2Mn+++3(SiO4)(Si2O7)(OH)3 M
SURSASSITE Mn++2Al3(SiO4)(Si2O7)(OH)3 M
PUMPELLYITE-(Mg) Ca2MgAl2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Fe++) Ca2Fe++Al2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Mn++) Ca2(Mn++,Mg)(Al,Mn+++,Fe)2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Al) Ca2(Al,Fe++,Mg)Al2(SiO4)(Si2O7)(O,OH)2.H2O M
PUMPELLYITE-(Fe+++) Ca2(Fe+++,Mg,Fe++)(Al,Fe+++)2(SiO4)(Si2O7)(OH)2.H2O M
POPPIITE Ca2(V+++,Fe+++,Mg)(V+++,Al)2(SiO4)(Si2O7)(O,OH)3 M
JULGOLDITE-(Mg) Ca2(Mg,Fe++)(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
JULGOLDITE-(Fe++) Ca2Fe++(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
JULGOLDITE-(Fe+++) Ca2Fe+++(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
SHUISKITE Ca2(Mg,Al)(Cr,Al)2(SiO4)(Si2O7)(OH)2.H2O M
OKHOTSKITE-(Mn++) Ca2(Mn++,Mg)(Mn+++,Al,Fe+++)2Si3O10(OH)4 M
SAMFOWLERITE Ca28Mn++6Zn4(Be,Zn)4Be12(SiO4)12(Si2O7)8(OH)12 M
FLUORVESUVIANITE Ca19(Al,Mg,Fe++)13(SiO4)10(Si2O7)4(F,OH,O)10 Q
VESUVIANITE Ca10Mg2Al4(SiO4)5(Si2O7)2(OH)4 Q
MANAEVITE-(Ce) Ca11(Ce,H2O,Ca)8Mg(Al,Fe)4(Mg,Ti,Fe+++)8[Si2O7]4[(SiO4)8(H4O4)2](OH)9 Q
CYPRINE Ca19Cu++(Al10Mg2)Si18O68(OH)10 Q
WILUITE Ca19(Al,Mg,Fe,Ti)13(B,Al,[])5Si18O68(O,OH)10 Q
MANGANVESUVIANITE Ca19Mn+++(Al,Mn+++,Fe+++)10(Mg,Mn++)2Si18O69(OH)9 Q
MILANRIEDERITE Ca19Fe3+Al4(Mg4Al4)Si18O67(OH)11 Q
QUEITITE Pb4Zn2(SiO4)(Si2O7)(SO4) M
8/C.28 to 33 Sorosilicates with [Si3O10]--------
8/C.34 to 36 Other sorosilicates
KANNANITE Ca4Al4(MgAl)(VO4)(SiO4)2(Si3O10)(OH)6 Ca4Al4(MgAl)(VO4)(SiO4)2(Si3O10)(OH)6 O
ARDENNITE-(As) Mn4[Al4(AlMg)][Si5As]O22(OH)6 O
ARDENNITE-(V) Mn4[Al4(AlMg)][Si5V]O22(OH)6 O
LAVOISIERITE Mn++8[Al10(Mn+++Mg)][Si11P]O44(OH)12 O
ALPEITE Ca4Mn+++2Al2(Mn+++Mg)(SiO4)2(Si3O10)(VO4)(OH)6 O
HUBEITE Ca2Mn++Fe+++Si4O12(OH).2H2O A
CASSAGNAITE (Ca,Mn++)4(Fe+++,Mn+++,Al)4(V+++,Mg,Al)2(SiO4)2(Si3O10)(OH,O)8 O
AKATOREITE (Mn++,Fe++)9Al2Si8O24(OH)8 A
MEDAITE (Mn,Ca)6(V+++++,As)Si5O18(OH) M
SCHEUCHZERITE Na(Mn,Mg,Zn)9V+++++Si9O28(OH)4 A
BRACCOITE NaMn++5[Si5O14(OH)](AsO3)(OH) A
SANEROITE Na2(Mn++,Mn+++)10Si11VO34(OH)4 A
ORIENTITE Ca2Mn++Mn+++2Si3O10(OH)4 O
ZUNYITE Al13Si5O20(OH,F)18Cl C
8/D. Unclassified silicates
8/D.02 to 11 Small cations: Mg, Fe, Mn, Cu
AJOITE (K,Na)Cu++7AlSi9O24(OH)6.3H2O A
AERINITE (Ca5,1Na0,5)(Fe+++AlFe++1,7Mg0,3)(Al5,1Mg0,7)[Si12O36(OH)12H].[(CO3)1,2(H2O)12] H
ALMBOSITE Fe++5Fe+++4V+++++4Si3O27 (?)
KURUMSAKITE (Zn,Ni,Cu)8Al8V2Si5O35.27H2O (?) O (?)
8/D.12 to 22 Large cations: Na, K, Ca, Sr, Pb
TIETTAITE (Na,K)17Fe+++TiSi16O29(OH)30.2H2O O
JUANITE Ca10Mg4Al2Si11O39.4H2O (?) O (?)
JENNITE Ca9[Si6O18(OH)6].8H2O A
OYELITE Ca10B2Si8O29.12H2O O
WAWAYANDAITE Ca12Mn++4B2Be18Si12O46(OH,Cl)30 M
CREASEYITE Pb2Cu2Fe+++2Si5O17.6H2O O
8/E. Cyclosilicates: SiO3 rings, Si:O = 1:3
8/E.01 to 05 Three tetrahedrons rings [Si3O9]6-
BOBTRAILLITE (Na,Ca)13Sr11(Zr,Y,Nb)14Si42B6O132(OH)12.12H2O R
ROGERMITCHELLITE Na12(Sr,Na)24Ba4Zr26Si78(B,Si)12O246(OH)24.18H2O R ps H
ROEBLINGITE Pb2Ca6Mn++(Si6O18)2(SO4)2(OH)2.4H2O M
JONESITE Ba4(K,Na)2Ti4Al2Si10O36.6H2O O
DIVERSILITE-(Ce) Na2(Ba,K)6CeFe++2Ti3[Si3O9]3[SiO3OH]3.9(OH,H2O) R
8/E.06 to 08 Four tetrahedrons rings [Si4O12]8-
8/E.06- Axinite group
AXINITE-(Mg) Ca2MgAl2BO3Si4O12(OH) A
AXINITE-(Fe) Ca2Fe++Al2BO3Si4O12(OH) A
AXINITE-(Mn) Ca2Mn++Al2BO3Si4O12(OH) A
TINZENITE Ca2Mn++4Al4[B2Si8O30](OH)2 A
BOBMEYERITE Pb4(Al3Cu)(Si4O12)(S0,5Si0,5O4)(OH)7Cl(H2O)3 O
8/E.07- Labuntsovite Group
TSEPINITE-Na Na(Na,H3O,K,Sr,Ba)12-xTi8(Si4O12)4(OH,O)8.nH2O (x=0-6, n=12-16) M
TSEPINITE-K (K,Ba,Na)4(Ti,Nb)4(Si4O12)2(OH,O)4.6H2O M
TSEPINITE-Ca (Ca,K,Na)4(Ti,Nb)4(Si4O12)2(OH,O)4.8H2O M
TSEPINITE-Sr (Sr,Ba,K)2-x(Ti,Nb)4(Si4O12)(OH,O)2.5-6H2O M
PARATSEPINITE-Ba (Ba,Na,K)2-x(Ti,Nb)2(Si4O12)(OH,O)2.4H2O M
PARATSEPINITE-Na Na(NaSrKCa)7(TiNb)8(Si4O12)4(O,OH)8.H2O M
VUORIYARVITE-K (K,Na)12-xNb8(Si4O12)4(O)8.nH2O (x=0-6, n=12-16) M
KUZMENKOITE-Zn K2Zn(Ti,Nb)4(Si4O12)2(OH,O)4.6-8H2O M
KUZMENKOITE-Mn K4Mn2Ti8(Si4O12)4(OH)8.nH2O (n=10-12) M
GJERDINGENITE-Fe K2(Fe++,Mn++)(Nb,Ti)4(Si4O12)2(O,OH)4.7-8H2O M ps O
GJERDINGENITE-Mn (K,Na)2(Mn++,Fe++)(Nb,Ti)4(Si4O12)2(O,OH)4.6H2O M ps O
GJERDINGENITE-Na (K,Na,Sr)2Na(Nb,Ti)4(Si4O12)2(O,OH)2.5H2O M
GJERDINGENITE-Ca (K,Na,Sr)2Ca(Nb,Ti)4(Si4O12)2(O,OH)2.6H2O M
BUROVAITE-Ca (K,Na)4Ca2(Ti,Nb)8[Si4O12]4(OH,O)8.12H2O M
KARUPMOLLERITE-Ca (Na,Ca,K)2Ca2(Nb,Ti)4(Si4O12)2(O,OH)4.7H2O M
LEMMLEINITE-K Na4K4K4Ti8(Si4O12)4(O,OH)8.8H2O M ps O
LEMMLEINITE-Ba Na4K4Ba2+xTi8(Si4O12)4(O,OH)8.8H2O M
PARALABUNTSOVITE-Mg Na8K8Mg4Ti16(Si4O12)8(O,OH)8.nH2O (n=20-24) M
LABUNTSOVITE-Mg Na4K4Mg2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
LABUNTSOVITE-Fe Na4K4Fe2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
LABUNTSOVITE-Mn Na4K4Mn2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
PARAKUZMENKOITE-Fe (K,Ba)8Fe4Ti16(Si4O12)8(OH,O)16.nH2O (n=20-28) M
ORGANOVAITE-Zn K8Zn4Nb16(Si4O12)8O16.nH2O (n=20-28) M
ORGANOVAITE-Mn K8Mn4Nb16(Si4O12)8O16.nH2O (n=20-28) M
GUTKOVAITE-Mn CaK2Mn(Ti,Nb)4(Si4O12)2(O,OH)4.5H2O M
NESKEVAARAITE-Fe K3Na2Fe++(Ti,Nb)4(Si4O12)2(O,OH)4.5-6H2O M
ALSAKHAROVITE-Zn (Na,Ca)Sr(K,Ba)Zn(Ti,Nb)4(Si4O12)2(O,OH)4.7H2O M
LEPKHENELMITE-Zn (Ba,K)2Zn(Ti,Nb)4Si8O24(O,OH)4.7H2O M
8/E.08- Joaquinite group
BAOTITE Ba4(Ti,Nb)8Si4O28Cl Q
CERCHIARAITE-(Al) Ba4(Al,Fe+++)4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl Q
CERCHIARAITE-(Fe) Ba4(Fe+++,Al)4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl Q
CERCHIARAITE-(Mn) Ba4(Mn+++,Fe+++,Al)4(Si6O18)(OH)7Cl Q
TITANTARAMELLITE Ba4(Ti,Fe+++,Fe++,Mg)4(B2Si8O27)O2Clx O
TARAMELLITE Ba4(Fe+++,Ti,Fe++,Mg)4(B2Si8O27)O2Clx O
JOAQUINITE-(Ce) Ba2NaCe2Fe++(Ti,Nb)2Si8O26(OH,F).H2O M
BYELORUSSITE-(Ce) NaMn++Ba2(Ce,La)2Ti2Si8O26(F,OH).H2O O
ORTHOJOAQUINITE-(La) Ba2Na(La,Ce)2Fe++(Ti,Nb)2Si8O26(O,OH,F).H2O O
8/E.09 to 10 Double rings of four tetrahedrons [Si8O20]8-
KAINOSITE-(Y) Ca2(Y,Ce)2Si4O12(CO3).H2O O
PHOSINAITE-(Ce) Na13Ca2(Ce,La,Th,Nd,Pr)(Si4O12)(PO4)4 O
IRAQITE-(La) K(La,Ce,Th)2(Ca,Na)4(Si,Al)16O40 Q
STEACYITE Th(Ca,Na)2K1-xSi8O20 Q
TURKESTANITE Th(Ca,Na)2(K1-x[]x)Si8O20.nH2O Q
ARAPOVITE (U,Th)(Ca,Na)2(K1-x[]x)Si8O20.H2O (x=0,5) Q
8/E.11- Combination of four-membered rings and pairs
HYALOTEKITE (Ba,Pb,Ca,K)6(B,Si,Al)2(Si,Be)10O28(F,Cl) A ps M
KAPITSAITE-(Y) (Ba,K,Pb++)4(Y,Ca,Na)2Si8(B,Si)4O28F A ps Q
8/E.12 to 21 Six-membered rings [Si6O18]12-
BERYL Be3Al2Si6O18 H
BAZZITE Be3(Sc,Al)2Si6O18 H
STOPPANIITE (Fe,Al,Mg)4(Be6Si12O36)(H2O)2(Na,[]) H
GERENITE-(Y) (Ca,Na)2(Y,REE)3(Si6O18).2H2O A
BARATOVITE KCa7(Ti,Zr)2Li3Si12O36F2 M ps H
8/E.16- Lovozerite group
IMANDRITE Na6Ca1,5Fe+++Si6O18 O
KAPUSTINITE Na5(Na,Mn++)Zr(Si6O16)(OH)2 M
LITVINSKITE Na2([],Na,Mn++)ZrSi6O12(O,OH)6 M
KOASHVITE Na6(Ca,Mn)(Ti,Fe)Si6O18.H2O O
TISINALITE Na3H3(Mn++,Ca,Fe)TiSi6(O,OH)18.2H2O R
ABENAKIITE-(Ce) Na26(Ce,Nd,La,Pr,Th,Sm)6(SiO3)6(PO4)6(CO3)6(S++++O2)O R
STEENSTRUPINE-(Ce) Na14Mn++2(Fe+++,Mn+++)2Ce6(Zr,Th)(Si6O18)2(PO4)6(HPO4)(OH)2.2H2O R
8/E.19- Tourmaline group
OXYROSSMANITE [](LiAl2)Al6(Si6O18)(BO3)3(OH)3O R
ROSSMANITE [](LiAl2)Al6(Si6O18)(BO3)3(OH)3OH R
FLUORELBAITE Na(Li1,5Al1,5)Al6(Si6O18)(BO3)3(OH)3F R
ELBAITE Na(Li1,5Al1,5)Al6(Si6O18)(BO3)3(OH)3OH R
MAGNESIOFOITITE [](Mg2Al)Al6(Si6O18)(BO3)3(OH)3OH R ps H
MARUYAMAITE K(MgAl2)(Al5Mg)(BO3)3(Si6O18)(OH)3O R ps H
OXYDRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3FNa(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O R
DRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3OH R
FOITITE [](Fe++2Al)Al6(Si6O18)(BO3)3(OH)3OH R
OXYFOITITE [](Fe++Al2)Al6(Si6O18)(BO3)3(OH)3O R
OXYSCHORL Na(Fe++Al)3Al6(Si6O18)(BO3)3(OH)3O R
FLUORSCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3F R
SCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3OH R
OLENITE NaAl3Al6(Si6O18)(BO3)3(O3)OH R
LUINAITE-(OH) (Na,[](Fe++,Mg)3Al6(BO3)3Si6O18(OH)4 R
POVONDRAITE NaFe+++3(Fe+++4Mg2)(Si6O18)(BO3)3(OH)3O R
FLUORUVITE CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F R
FERUVITE CaFe++3(Al5Mg)(Si6O18)(BO3)3(OH)3OH R
LUCCHESIITE CaFe++3Al6(Si6O18)(BO3)3(OH)3O R
ADACHIITE CaFe++3Al6(Si5AlO18)(BO3)3(OH)3(OH) R
ODINTSOVITE K2(Na,Li)4Ca3Ti2Be4Si12O38 O
TIENSHANITE KNa3(Na,K,[])6(Ca,Y,REE)2Ba6(Mn++,Fe++,Zn,Ti)6(Ti,Nb)6Si36B12O114[O5,5(OH,F)3,5]F2 H
VERPLANCKITE Ba2(Mn,Fe++,Ti)Si2O6(O,OH,Cl,F)2.3H2O H
8/E.22- Double six-membered rings [Si12O30]12- Milarite-osumilite group
MILARITE KCa2AlBe2Si12O30.0,5H2O H
OFTEDALITE (Sc,Ca,Mn++)2K(Be,Al)3Si12O30 H
FRIEDRICHBECKEITE K([]0,5Na0,5)2(Mg0,8Mn0,1Fe0,1)2(Be0,6Mg0,4)3[Si12O30] H
ALMARUDITE (K,Na)(Mn++,Fe++,Mg)2(Be,Al)3(Si12O30) H
TRATTNERITE (Mg,Fe++)3Fe+++2(Si12O30) H
ROEDDERITE (Na,K)2(Mg,Fe++)5Si12O30 H
CHAYESITE K(Mg,Fe++)4Fe+++Si12O30 H
MERRIHUEITE (K,Na)2(Fe++,Mg)5Si12O30 H
KLOCHITE ([]1Na1)KFe2Zn3(Si12O30) H
YAGIITE (Na,K)1,5Mg2(Al,Mg)3(Si,Al)12O30 H
OSUMILITE-(Mg) KMg2Al3(Al2Si10)O30 H
OSUMILITE (K,Na)(Fe++,Mg)2(Al,Fe+++)3(Si,Al)12O30 H
LIPUITE KNa8Mn+++5Mg0,5[Si12O30(OH)4](PO4)O2(OH)2.4H2O O
EMELEUSITE Na4Li2Fe+++2Si12O30 O ps H
SUGILITE KNa2(Fe++,Mn++,Al)2Li3Si12O30 H
SOGDIANITE (Zr,Ti++++,Fe+++,Al)2([],Na)2K[Li3Si12O30] H
DARAPIOSITE NaxK(Li,Zn,Fe++)2(Mn,Zr,Y)2(Si12O30) (x = less than 2) H
DUSMATOVITE K(K,Na,[])(Mn++,Y,Zr)2(Zn,Li)3Si12O30 H
SHIBKOVITE K(Ca,Mn,Na)2(K2-x[]x)2Zn3Si12O30 H
FAIZIEVITE K2Li6Na(Ca6Na)Ti4[Si6O18]2[Si12O30]F2 A
8/E.23- Eight-membered rings
MUIRITE Ba10Ca2MnTiSi10O30(OH,Cl,F)10 Q
8/E.24- Nine-membered rings
8/E.25- Nine-membered rings. Eudialyte group.
AQUALITE (H3O)8(Na,K,Sr)5Ca6Zr3Si26O66(OH)9Cl R
ILYUKHINITE (H3O,Na)14Ca6Mn2Zr3Si26O72(OH)2.3H2O R
FENGCHENGITE Na12[]3(Ca,Sr)6Fe+++3Zr3Si(Si25O73)(H2O,OH)3(OH,Cl)2 R
EUDIALYTE Na15Ca6(Fe++,Mn)3Zr3(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
IKRANITE (Na,H3O)15(Ca,Mn,REE)6Fe+++2Zr3([],Zr)([],Si)Si24O66(O,OH)6Cl.nH2O R
RASLAKITE Na15Ca3Fe3(Na,Zr)3Zr3Nb0,5(Si3O9)2(Si9O27)2(SiO)(Cl,OH).3(OH,H2O) R
KENTBROOKSITE (Na,REE)15(Ca,REE)6(Mn++,Fe++)3Zr3Nb(Si25O73)(O,OH,H2O)3(F,Cl)2 R
CARBOKENTBROOKSITE (Na,[])12(Na,Ce)3Ca6Mn3Zr3Nb(Si25O73)(OH)3(CO3).H2O R
ANDRIANOVITE Na12(K,Sr,Ce)3Ca6Mn3Zr3Nb(Si25O73)(O,H2O,OH)5 R
VORONKOVITE Na15(Na,Ca,Ce)3(Mn,Ca)3Fe3Zr3Si26O72(OH,O)4Cl.H2O R
ONEILLITE Na15Ca3Mn3Fe3Zr3Nb(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
DAVINCIITE Na12K3Ca6Fe++3Zr3(Si26O73OH)Cl2 R
MOGOVIDITE Na9(Ca,Na)5Ca6Zr3Fe2(Si,Nb)[(OH,H2O)3|Cl0,3|CO3|(Si3O9)2(Si9O27)2] R
GOLYSHEVITE [Na10Ca3]Ca6Zr3Fe2SiNb[(OH)3|CO3|(Si3O9)2|(Si9O27)2].H2O R
FEKLICHEVITE Na11Ca9(Fe+++,Fe++)2Zr3Nb[Si25O73](OH,H2O,Cl,O)5 R
ZIRSILITE-(Ce) Na11-12Ca6(Ce,Na)3Mn3Zr3Nb(CO3)2(Si3O9)4(Si9O27)2(SiO)(OH)6.H2O R
JOHNSENITE-(Ce) Na12(Ce,La,Sr,Ca,M)3Ca6Mn3Zr3W(Si25O73)(CO3)(OH,Cl)2 R
TASEQITE Na12Sr3Ca6Fe3Zr3NbSi25O73(O,OH,H2O)3Cl2 R
KHOMYAKOVITE Na12Sr3Ca6Fe++3Zr3W(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
ALLUAIVITE Na19(Ca,Mn++)6(Ti,Nb)3(Si3O9)2(Si10O28)2Cl.2H2O R
RASTSVETAEVITE Na27K8Ca12Fe3Zr6Si4[Si3O9]4[Si9O27]4(O,OH,H2O)6Cl2 R
DUALITE Na30(Ca,Na,Ce,Sr)12(Na,Mn,Fe,Ti)6Zr3Ti3MnSi51O144(OH,H2O,Cl)9 R
LABYRINTHITE (Na,K,Sr)35Ca12Fe3Zr6TiSi51O144(O,OH,H2O)9Cl3 R
8/E.26- Twelve-membered and larger rings
TRASKITE Ba9Fe++2Ti2(SiO3)12(OH,Cl,F)6.6H2O H
8/F. Inosilicates: chains and ribbons, Si:O=1:3 or 4:11
8/F.01 to 06 Infinite single chains [Si2O6]----
8/F.01 to- 02 Pyroxenes group
KANOITE (Mn++,Mg)2Si2O6 M
PIGEONITE (Mg,Fe++,Ca)(Mg,Fe++)Si2O6 M
PETEDUNNITE Ca(Zn,Mn++,Fe++,Mg)Si2O6 M
AUGITE (Ca,Na)(Mg,Fe,Al,Ti)(Si,Al)2O6 M
OMPHACITE (Ca,Na)(Mg,Fe++,Fe+++,Al)Si2O6 M
JADEITE Na(Al,Fe+++)Si2O6 M
JERVISITE (Na,Ca,Fe++)(Sc,Mg,Fe++)Si2O6 M
NATALYITE Na(V+++,Cr+++)Si2O6 M
8/F.01- Clinopyroxenes
8/F.02- Orthopyroxenes
ELISEEVITE Na1,5Li[Ti2Si4O12,5(OH)1,5].2H2O M
VINOGRADOVITE Na8Ti8O8(Si2O6)4[(Si3Al)O10]2[(H2O),(Na,K)2] M
LAVINSKYITE-1M K(LiCu)Cu6(Si4 O11)2(OH)4 M
8/F.07 to 13 Infinite double bands [Si4O11]6-
8/F.07 to- 12 Amphibole group
GRUNERITE []Fe++7Si8O22(OH)2 M
8/F.07- Amphibole with Mg, Fe, Mn
8/F.08- Alcali amphiboles
GLAUCOPHANE []Na2(Mg3Al2)Si8O22(OH)2 M
RIEBECKITE []Na2(Fe++3Fe+++2)Si8O22(OH)2 M
NYBOITE NaNa2(Mg3Al2)Si7AlO22(OH)2 M
FLUORONYBOITE Na(Na,Ca)2(Mg,Fe++)3(Al,Mg,Fe+++)2Si7AlO22(F,OH)2 M
FERRICNYBOITE (?) NaNa2(Mg3Fe+++2)Si7AlO22(OH)2 (?) M
FERRONYBOITE (?) NaNa2(Fe++3Al2)Si7AlO22(OH)2 (?) M
FERRICFERRONYBOITE (?) NaNa2(Fe++3Fe+++2)Si7AlO22(OH)2 (?) M
FERROFERRINYBOITE NaNa2(Fe++3 Fe+++2)(Si7Al)O22(OH)2 M
FERRIPEDRIZITE NaLi3(Mg,Fe++)2Fe+++2Si8O22(OH,F)2 M
PEDRIZITE Li2(Li,MgFe++Al)5(Si,Al)8O22(OH,F)2 M
SODICPEDRIZITE (?) NaLi2(LiMg2Fe+++Al)(Si8O22)(OH,F)2 M
OTTOLINIITE []Na,Li(Mg3Fe+++Al)(Si8O22)(OH)2 M
FERRIOTTOLINIITE Na0,5(Na,Li)2Li0,5(Mg,Fe++,Zn)3Fe+++2(Si8O22)(OH,F)2 M
FERROOTTOLINIITE (?) []NaLi(Fe++3Fe+++Al)Si8O22(OH)2 M
WHITTAKERITE Na(NaLi)(Mg2AlFe+++Li)(Si8O22)(OH)2 M
FERROWHITTAKERITE (?) Na(NaLi)2(Fe++2AlFe+++Li)(Si8O22)(OH)2 M
LEAKEITE NaNa2(Mg2Fe+++2Li)Si8O22(OH)2 M
FERROLEAKEITE (?) NaNa2(Fe++2Fe+++2Li)Si8O22(OH)2 (?) M
KORNITE (Na,K)Na2(Mg2Mn+++2Li)Si8O22(OH)2 M
UNGARETTIITE NaNa2(Mn++2Mn+++3)Si8O22O2 M
OBERTIITE NaNa2(Mg3Fe+++Ti++++)Si8O22O2 M
FERRIOBERTIITE Na(Na2)(Mg3Fe+++Ti)(Si8O22)O2 M
ARFVEDSONITE NaNa2(Fe++,Mg)4Fe+++Si8O22(OH)2 M
KOZULITE NaNa2Mn++4(Fe+++,Al)Si8O22(OH)2 M
8/F.09- Na, Ca Amphiboles
KATOPHORITE Na(CaNa)Fe++4(Al,Fe+++)Si7AlO22(OH)2 M
FERRIKATOPHORITE (?) Na2Ca(Fe++,Mg)4Fe+++(Si7Al)O22(OH)2 (?) M
ALUMINOTARAMITE Na2Ca(Fe++,Mg)3Al2(AlSi3O11)2(OH)2 M
POTASSICALUMINOTARAMITE (K,Na)2(Ca,Na)(Fe++,Mg)3(Al,Fe+++)2(AlSi3O11)2(OH)2 M
TARAMITE Na(CaNa)Fe++3AlFe+++Si6Al2O22(OH)2 M
FERRITARAMITE (?) Na(CaNa)Fe++3Fe+++2Si6Al2O22(OH)2 (?) M
PARVOWINCHITE Na(Na,Mn++)2Mg4Fe+++Si8O22(OH,F)2 M
WINCHITE [](CaNa)Mg4(Al,Fe+++)Si8O22(OH)2 M
FERROWINCHITE (?) [](CaNa)Fe++4(Al,Fe+++)Si8O22(OH)2 M
FERRIWINCHITE []NaCa(Mg,Fe++)4Fe+++Si8O22(OH)2 M
ALUMINOBARROISITE (?) [](CaNa)Mg3Al2Si7AlO22(OH)2 (?) M
BARROISITE [](CaNa)Mg3AlFe+++Si7AlO22(OH)2 M
FERRIFERROBARROISITE (?) [](CaNa)Fe++3Fe+++2Si7AlO22(OH)2 (?) M
8/F.10- Ca2 amphiboles
PARVOMANGANOTREMOLITE Nax(CaMn++)2Mg5Si8O22(OH)2 (x = less than 0,5) M
ACTINOLITE []Ca2(Mg,Fe++)5Si8O22(OH)2 M
FERROHORNBLENDE []Ca2[Fe++4(Al,Fe+++)]Si7AlO22(OH)2 M
ALUMINOTSCHERMAKITE (?) []Ca2(Mg3Al2)Si6Al2O22(OH)2 (?) M
TSCHERMAKITE []Ca2(Mg3AlFe+++)Si6Al2O22(OH)2 M
FERRITSCHERMAKITE (?) []Ca2(Mg3Fe+++2)Si6Al2O22(OH)2 (?) M
FERRIFERROTSCHERMAKITE (?) []Ca2(Fe++3Fe+++2)Si6Al2O22(OH)2 (?) M
EDENITE NaCa2(Mg,Fe++)5(Si7Al)O22(OH)2 M
CANNILLOITE (?) CaCa2(Mg4Al)Si5Al3O22(OH)2 (?) M
PARGASITE NaCa2(Mg4Al)Si6Al2O22(OH)2 M
POTASSICPARGASITE (K,Na)Ca2(Mg,Fe++,Al,Fe+++)5(Si,Al)8O22(OH,F)2 M
HASTINGSITE NaCa2(Fe++4Fe+++)Si6Al2O22(OH)2 M
POTASSICSADANAGAITE (K,Na)Ca2[Fe++3(Al,Fe+++)2]Si5Al3O22(OH)2 M
MAGNESIOSADANAGAITE NaCa2Mg3(Al,Fe++,Ti)2(Al,Si)4(Si2O11)2(OH)2 M
SADANAGAITE NaCa2[Fe++3(Al,Fe+++)2]Si5Al3O22(OH)2 (?) M
8/F.11- Pb, Ca amphiboles
JOESMITHITE PbCa2(Mg,Fe++,Fe+++)5Si6Be2O22(OH)2 M
8/F.12- Orthorhombic amphiboles
GEDRITE [](Mg,Fe++)5Al2Si6Al2O22(OH)2 O
FERROGEDRITE [](Fe++,Mg)5Al2Si6Al2O22(OH)2 O
PROTOFERROSUENOITE (Mn++,Fe++)2(Fe++,Mg)5(Si4O11)2(OH)2 O
8/F.14 to 17 Modified double bands
8/F.14- Aenigmatite group
AENIGMATITE Na2Fe++5Ti++++Si6O20 A
HOGTUVAITE (Ca,Na)2(Fe++,Fe+++,Ti,Mg,Sn,Mn)6(Si,Be,Al)6O20 A
DORRITE Ca2Mg2Fe+++4Si2Al4O20 A
RHONITE Ca2(Mg,Fe++)4Fe+++Ti++++Si3Al3O20 A
KURATITE Ca2(Fe++5Ti)O2[Si4Al2O18] A
SERENDIBITE Ca2Mg3Al3Si3Al1,5B1,5O20 A
WELSHITE Ca4Mg9Sb+++++3Be3Si6(Fe+++,Al)3O20 A
SAPPHIRINE (-1A,-2A,-2M,-4M,-5A) (Mg,Al)8(Al,Si)6O20 M/A
KHMARALITE Mg5,5Al14Fe2Si5Be1,5O40 M
SURINAMITE (Mg,Fe+++)3(Al,Fe+++)3BeSi3O16 M
MESAITE CaMn++5(V2O7)3.12H2O M
DEERITE (Fe++,Mn)6(Fe+++,Al)3Si6O20(OH)5 M ps O
HOWIEITE Na(Fe++,Mn)10(Fe+++,Al)2Si12O31(OH)13 A
TANEYAMALITE Na(Mn++,Mg,Fe++)12Si12(O,OH)44 A
JOHNINNESITE Na2Mn++9(Mg,Mn++)7(OH)8(AsO4)2(Si6O17)2 A
8/F.18 to 20 Three chains [Si3O9]6-
WOLLASTONITE (1A, 1T, 2M, 3A, 4A, 5A, 7A, 7T polytypes) CaSiO3 M/A
VISTEPITE (Mn++,Ca)4Sn++++B2(SiO7)(Si3O9)(OH)2 A
SCHIZOLITE NaCaMnSi3O8(OH) 8/F.18-078
CHESTERITE (Mg,Fe++)17Si20O54(OH)6 O
TOBERMORITE [Ca4Si6O17.2H2O].(Ca.3H2O) O
WHELANITE Cu2Ca6[Si6O17(OH)](CO3)(OH)3(H2O)2 O
8/F.21 to 23 Three bands [Si6O15]6-, [Si6O17]10- and modified
ZORITE Na2Ti(Si,Al)3O9.nH2O O
HAINEAULTITE (Na,Ca)5Ca(Ti,Nb)5(Si12O34)(OH,F)4.5H2O O
ESCHEITE Ca2NaMnTi5[Si12O34]O2(OH)3.12H2O O
CHIVRUAIITE Ca4(Ti,Nb)5[(Si6O17)2[(OH,O)5].13-14H2O O
TINAKSITE K2Na(Ca,Fe++,Mn++,Mg)2(Ti,Fe)Si7O19(OH) A
8/F.24 to 26 Four chains [Si4O12]8-
BALANGEROITE (Mg,Fe+++,Fe++,Mn++)42Si16O54(OH)40 M
GAGEITE (-1A,-2M) (Mn,Mg,Zn)42Si16O54(OH)40 M/A
BATISITE (Ba,K,Na)3Ti2Si4O14 O
TAIKANITE (Ba,Sr)2Mn+++2Si4O12 M
OHMILITE Sr3(Ti,Fe+++)(Si2O6)2(O,OH).2-3H2O M
HARADAITE Sr2V++++2O2(Si4O12) O
8/F.27- Five chains [Si5O15]10-
RHODONITE (Mn++,Fe++,Mg,Ca)SiO3 A
BABINGTONITE Ca2(Fe++,Mn)Fe+++Si5O14(OH) A
NAMBULITE (Li,Na)(Mn,Ca)4Si5O14(OH) A
INESITE Ca2Mn7Si10O28(OH)2.5H2O A
8/F.28 to 30 Six chains [Si6O18]12- and six bands [Si12O30]12-
PYATENKOITE-(Y) Na5(Y,Dy,Gd)(Ti,Nb)Si6O18.6H2O R
SAZYKINAITE-(Y) (Na,K)5Y(Zr,Ti)Si6018.6H2O R
TUHUALITE (Na,K)Fe++Fe+++Si6O15 O
PELLYITE Ba2Ca(Fe++,Mg)2Si6O17 O
8/F.31- Seven chains [Si7O21]14-
PLUMALSITE (?) Pb4Al2(SiO3)7 (?) O
8/F.32- Twelve chains [Si12O36]24-
8/F.33- Chains and pairs combinations
STRAKHOVITE NaBa3(Mn++,Mn+++)4Si6O19(OH)3 M
8/F.34 to 38 Complex chain structures (cylinders, etc)
NARSARSUKITE Na2(Ti,Fe+++)Si4(O,F)11 Q
PENKVILKSITE Na4(Ti++++,Zr)Si8O22.4H2O M
YUKSPORITE K4(Sr,Ba)2(Ca,Na)14(Mn,Fe)0.5(Ti,Nb)4(Si2O7)3(Si6O17)2(O,OH)4.3(OH,H2O) M
CHAROITE (K,Sr,Ba,Mn)15-16(Ca,Na)32[(Si70(O,OH)180)](OH,F)4.nH2O M
EVESLOGITE (Ca,K,Na,Sr,Ba)48[(Ti,Nb,Fe,Mn)12(OH)12Si48O144](F,OH,Cl)14 M
CAYSICHITE-(Y) Y4(Ca3REE)(OH)(H2O)5(Si8O20)(CO3)6.2H2O O
HELLANDITE-(Yb) (Ca,Y)4(Yb,Y)2(Al,Fe+++,Ti++++)(Be,Li)2B4Si4O22(O,F,OH)2 (?) M
HELLANDITE-(Y) (Ca3REE)4Y2Al[]2[Si4B4O22](OH)2 M
HELLANDITE-(Gd) (Ca,Y)4(Gd,Y)2(Al,Fe+++,Ti++++)(Be,Li)2B4Si4O22(O,F,OH)2 (?) M
HELLANDITE-(Ce) (Ca3REE)4Ce2Al[]2[Si4B4O22](OH)2 M
TADZHIKITE-(Ce) Ca4Ce2Ti[]2[Si4B4O22](OH)2 M
ASHCROFTINE-(Y) K5Na5(Y,Ca)12Si28O70(OH)2(CO3)8.8H2O Q
MOTTANAITE-(Ce) Ca4Ce2Al(Be1,5[]0,5)[B4Si4O22]O2 M
FERRIMOTTANAITE-(Ce) Ca4Ce2Fe+++(Be1,5[]0,5)[Si4B4O22]O2 M
CIPRIANIITE Ca4[(Th,U)Ca]2Al(Be0,5[]1,5)[B4Si4O22](OH)2 M
PIERGORITE-(Ce) Ca8Ce2(Al0,5Fe3+++0,5)([],Li,Be)2Si6B8O36(OH,F)2 M
NEPTUNITE KNa2Li(Fe++,Mn)2Ti2Si8O24 M
8/G. Transition inosilicates - phyllosilicates
BUSSYITE-(Ce) (Ce,REE)3(Na,H2O)6MnSi9Be5(O,OH)30F4 M
BUSSYITE-(Y) (Y,REE,Ca)3(Na,Ca)6MnSi9Be5(O,OH,F)34 M
SEMENOVITE-(Ce) (Ca,Ce,La,Na)10-12(Fe++,Mn)(Si,Be)20(O,OH,F)48 O
NORDITE-(La) Na3SrLaZnSi6O17 O
NORDITE-(Ce) Na3SrCeZnSi6O17 O
FERRONORDITE-(La) Na3Sr(La,Ce)Fe++Si6O17 O
VLADYKINITE Na3Sr4(Fe++Fe+++)Si8O24 M
BOHSEITE Ca4Be3+xAl1-xSi9O25-x(OH)3+x (x=0-1) O
TVEDALITE (Ca,Mn++)4Be3Si6O17(OH)4.3H2O O
RUDENKOITE Sr3Al3(Si,Al)4O10(OH,O)8Cl2.H2O M
CHIAPPINOITE-(Y) (Y,Ce)2(Mn++,Ca)(Si3O7)4 O
PERETTIITE-(Y) Y+++2Mn++4Fe++[Si2B8O24] O?
LEMOYNITE (Na,K)2CaZr2Si10O26.5-6H2O M
LOUDOUNITE NaCa5Zr4Si16O40(OH)11.8H2O (?)
8/G.12- Astrophyllite group
NALIVKINITE Li2Na(Fe++,Mn++)7Ti2Si8O26(OH)4F A
BULGAKITE Li2(Ca,Na)Fe++7Ti2(Si4O12)2O2(OH)4(F,O)(H2O)2 A
LOBANOVITE K2Na2(Fe++,Fe+++,Mn)4Mg2Ti2Si8O26(OH)4 M
TARBAGATAITE (K,[])2(Ca,Na)(Fe++,Mn)7Ti2(Si4O12)2O2(OH)4(OH,F) A
KUPLETSKITE K2Na(Mn,Fe++)7(Ti,Nb)2Si8O26(OH)4F A
KUPLETSKITE-(Cs) (Cs,K)2Na(Mn,Fe,Li)7(Ti,Nb)2Si8O26(OH)4F A
NIOBOKUPLETSKITE K2Na(Mn++,Zn,Fe++)7(Nb,Zr,Ti)2Si8O26(OH)4(O,F) A
ZIRCOPHYLLITE K2(Na,Ca)(Fe++,Mn)7(Zr,Nb)2Si8O26(OH)4F A
NIOBOPHYLLITE K2Na(Mn,Fe++)7(Nb,Ti)2Si8O26(OH)4(F,O) A
SVEINBERGITE Ca(Fe++6Fe+++)Ti2(Si4O12)2O2(OH)5(H2O)4 A
DEVITOITE [Ba6(PO4)2(CO3)][Fe++7(OH)4Fe+++2O2(SiO3)8] A
NAFERTISITE Na3Fe++10Ti2(Si6O17)2O2(OH)6F(H2O)2 M
CARYOCHROITE (Na,Sr,Ca,Mn,K)3(Fe+++,Mg,Mn,Fe++)10Ti2Si12O37(H2O,O,OH)17 M
VEBLENITE KNa(Fe++5Fe+++4Mn7)Nb4(Si2O7)2(Si8O22)2O6(OH)10(H2O)3 A
8/H. Phyllosilicates: layers Si2O5, Si:O = 2:5
8/H.01 to 08 Tetragonal or pseudotetragonal layer structures [Si4O10]4-, etc.
WESSELSITE (Sr,Ba)Cu++(Si4O10) Q
FENAKSITE (K,Na,Ca)4(Fe++,Fe+++,Mn)2Si8O20(OH,F) A
ERSHOVITE Na4K3(Fe++,Mn++,Ti)2Si8O20(OH)4.4H2O A
LATIUMITE (Ca,K)8(Al,Mg,Fe)(Si,Al)10O25(SO4) M
TUSCANITE K(Ca,Na)6(Si,Al)10O22(SO4,CO3,(OH)2).H2O M
8/H.09 to 27 Mica-like phyllosilicates with [Si4O10] and related structures
MACAULAYITE (Fe+++,Al)24Si4O43(OH)2 M
TALC Mg3Si4O10(OH)2 M/A
KEGELITE Pb8Al4Si8(SO4)2(CO3)4(OH)8O20 M ps H
8/H.10 to 14 Mica group
CELADONITE KFe+++(Mg,Fe++)[]Si4O10(OH)2 M
MUSCOVITE KAl2[]AlSi3O10(OH)2 M ps H
GANTERITE (Ba,Na,K)(Al,Mg)2(Al,Si)AlSi3O10(OH)2 M
TOBELITE (NH4)Al2[]AlSi3O10(OH)2 M
8/H.10- Celadonite-Muscovite series
8/H.11- Lithionite-Biotite series
MONTDORITE KFe++1,5Mn++0,5Mg0,5[]0,5Si4O10F2 M
ANNITE KFe++3AlSi3O10(OH)2 M
8/H.12- Brittle micas. Margarite series
ANANDITE (-2O) BaFe++3Fe+++Si3O10S(OH) M
BITYITE LiCaAl2(AlBeSi2O10)(OH)2 M
HANJIANGITE (1M, 2M, 3T) Ba2Ca(V+++Al)[Si3AlO10(OH)2]F(CO3)2 M
8/H.13- Interlayer-deficient micas
WONESITE Na0,5[]0,5Mg2,5Al0,5AlSi3O10(OH)2 M
BRAMMALLITE Na0,65Al2[]Al0,65Si3,35O10(OH)2 M
ILLITE K0,65Al2[]Al0,65Si3,35O10(OH)2 M
GLAUCONITE (K,Na)(Mg,Fe++,Fe+++)(Fe+++,Al)(Si,Al)4O10(OH)2 M
ERLIANITE (Fe++,Fe+++,Mg)24(Fe+++V)6Si36O90(OH,O)48 O
BANNISTERITE KCa(Mn,Fe++,Zn)21(Si,Al)32O76(OH)16.12H2O M
BARIUMBANNISTERITE (?) (K,H3O)(Ba,Ca)(Mn++,Fe++,Mg)21(Si,Al)32O80(O,OH)16.4-12H2O M
LENNILENAPEITE K6-7(Mg,Mn,Fe++,Fe+++,Zn)48(Si,Al)72(O,OH)216.16H2O A
STILPNOMELANE K(Fe++,Mg,Fe+++,Al)8(Si,Al)12(O,OH)27.2H2O M/A
FRANKLINPHILITE (K,Na)4(Mn++,Mg,Zn,Fe+++)48(Si,Al)72(O,OH)216.6H2O A ps H
PARSETTENSITE (K,Na,Ca)(Mn,Al)7Si8O20(OH)8.2H2O (?) M ps H
EGGLETONITE (Na,K,Ca)2(Mn,Fe)8(Si,Al)12O29(OH)7.11H2O M
TAMAITE (Ca,K,Ba,Na)3-4Mn++24(Si,Al)40(O,OH)112.21H2O M
GANOPHYLLITE (K,Na)2(Mn,Al,Mg)8(Si,Al)12O29(OH)7.8-9H2O M
EKMANITE (?) (Fe++,Mg,Mn,Fe+++)3(Si,Al)4O10(OH)2.2H2O (?) O
8/H.18 to 22 Clay minerals, regularly stratified
8/H.18 to- 20 Smectite - montmorillonite group
SALIOTITE Li0,5Na0,5Al3AlSi3O10(OH)5 M
KULKEITE Na0,35Mg8Al(AlSi7)O20(OH)10 M
ALIETTITE Ca0,2Mg6(Si,Al)8O20(OH)4.4H2O  
RECTORITE (Na,Ca)Al4(Si,Al)8O20(OH)4.2H2O M
TOSUDITE Na0,5(Al,Mg)6(Si,Al)8O18(OH)12.5H2O M (?)
CORRENSITE (Mg,Fe,Al)9(Si,Al)8O20(OH)10.nH2O O
BRINROBERTSITE Na0,3Al4(Si4O10)2(OH)4.3,5H2O M ps H
MONTMORILLONITE (Na,Ca)0,3(Al,Mg)2Si4O10(OH)2.nH2O M
BEIDELLITE (Na,Ca0,5)0,3Al2(Si,Al)4O10(OH)2.nH2O M
NONTRONITE Na0,3Fe+++2(Si,Al)4O10(OH)2.nH2O M
VOLKONSKOITE Ca0,3(Cr+++,Mg,Fe+++)2(Si,Al)4O10(OH)2.4H2O M
SWINEFORDITE (Ca,Na)0,3(Al,Li,Mg)2(Si,Al)4O10(OH,F)2.2H2O M
YAKHONTOVITE (Ca,Na)0,5(Cu++Fe++Mg)2Si4O10(OH)2.3H2O M
HECTORITE Na0,3(Mg,Li)3Si4O10(F,OH)2 M
SAPONITE (Ca0,5,Na)0,3(Mg,Fe++)3(Si,Al)4O10(OH)2.4H2O M
FERROSAPONITE Ca0,3(Fe++,Mg,Fe+++)3(Si,Al)4O10(OH)2.4H2O M
SPADAITE MgSiO2(OH)2.H2O (?) (?)
STEVENSITE (Ca,Na)xMg3-x(Si4O10)(OH)2 M
SAUCONITE Na0,3Zn3(Si,Al)4O10(OH)2.4H2O M
ZINCSILITE Zn3Si4O10(OH)2.4H2O (?) M
VERMICULITE (Mg,Fe++,Al)3(Al,Si)4O10(OH)2.4H2O M
RILANDITE (Cr+++,Al)6SiO11.5H2O (?) (?)
8/H.23- Chlorite group
SUDOITE Mg2(Al,Fe+++)3Si3AlO10(OH)8 M
CLINOCHLORE (Mg,Fe++)5Al(Si3Al)O10(OH)8 M
CHAMOSITE (Fe++,Mg,Fe+++)5Al(Si3Al)O10(OH,O)8 M
ORTHOCHAMOSITE (Fe++,Mg,Fe+++)5Al(Si3Al)O10(OH,O)8 O
BAILEYCHLORE (Zn,Fe++,Al,Mg)6(Si,Al)4O10(OH)8 A
NIMITE (Ni,Mg,Fe++)5Al(Si3Al)O10(OH)8 M
GONYERITE (Mn++,Mg)5Fe+++(Si3Fe+++)O10(OH)8 O (?)
BOROCOOKEITE Li1+3xAl4-x(B,Al)Si3O10(OH,F)8 M
NIKSERGIEVITE [Ba1,33Ca0,67Al(CO3)(OH)4][Al2(AlSi3O10)(OH)2].nH2O M
BRITVINITE Pb8Mg9[Si10O30(OH)8(CO3)3].H2O A
SURITE Pb2Ca(Al,Mg)2(Si,Al)4O10(OH)2(CO3,OH)3.0,5H2O M
FERRISURITE Pb2Ca(Fe+++,Al)2(Si,Al)4O10(OH,F)2(CO3,OH)3.0,5H2O M
8/H.25- Kaolinite group
ALLOPHANE Al2O3.(SiO2)1,3-2.(H2O)2,5-3 am.
PIANLINITE (?) Al2Si2O6(OH)2 (?) am. (?)
IMOGOLITE (?) Al2SiO3(OH)4 (?)
ODINITE (1M,-2R,-1T) (Fe+++,Mg,Al,Fe++,Ti,Mn)2,5(SiAl)O5(OH)4 M/R
NEOTOCITE (Mn,Fe++)SiO3.H2O (?) am. or M
8/H.27- Serpentine group
LIZARDITE (-1T,-2H) Mg3Si2O5(OH)4 R/H
CARYOPILITE (1M,-1Q) (Mn++,Mg)3Si2O5(OH)4 M
GREENALITE (Fe++,Fe+++)2-3Si2O5(OH)4 M
BERTHIERINE (-1M,-1H) (Fe++,Fe+++,Mg)2-3(Si,Al)2O5(OH)4 M
DOZYITE (Mg7Al2)(Si4Al2)O15(OH)12 M
KELLYITE (Mn++,Mg,Al)3(Si,Al)2O5(OH)4 H
CRONSTEDTITE Fe++2Fe+++(SiFe+++)O5(OH)4 M
GUIDOTTIITE (Mn2Fe+++)(SiFe+++)O5(OH)4 H
KARPINSKITE (Mg,Ni)2Si2O5(OH)2 (?) M (?)
BRINDLEYITE (Ni,Mg,Fe++)2Al(SiAl)O5(OH)4 M
CARLOSTURANITE (Mg,Fe++,Ti)21(Si,Al)12O28(OH)34.H2O M
8/H.28 to 37 Phyllosilicates with other simple layers [Si6O15], etc.
PYROSMALITE-(Fe) (Fe++,Mn++)8Si6O15(OH,Cl)10 H
PYROSMALITE-(Mn) (Mn++,Fe++)8Si6O15(OH,Cl)10 H
BROKENHILLITE (Mn++,Fe++)8(Si6O15)(OH,Cl)10 H
NELENITE (Mn++,Fe++)16Si12As+++3O36(OH)17 R
SCHALLERITE (Mn++,Fe++)16Si12As+++3O36(OH)17 R
FRIEDELITE Mn8Si6O15(OH,Cl)10 M ps R
MCGILLITE (Mn,Fe++)8Si6O15(OH)8Cl2 R
INNSBRUCKITE Mn++33(Si2O5)14(OH)38 M
VARENNESITE Na8Mn++2Si10O25(OH,Cl)2.12H2O O
SPODIOPHYLLITE (Na,K)4(Mg,Fe++)3(Fe+++,Al)2(Si8O24) M (?)
SAZHINITE-(La) Na3(La,Ce)Si6O15.2H2O O ps Q
SAZHINITE-(Ce) Na2CeSi6O14(OH).nH2O (n = about 5) O
WINDHOEKITE (Ca,Mn++)2Fe+++3(Si8O20)(OH)4.10H2O M
FERRISEPIOLITE (Fe+++,Fe++,Mg)4(Si,Fe+++)6O15(O,OH)2.6H2O O
RAITE Na3Mn++3Ti++++0,25[Si4O10(OH)]2.10H2O M
INTERSILITE (Na,K)Na5Mn++(Ti,Nb)[Si10O24(OH)4].4H2O M
KALIFERSITE (K,Na)5Fe+++7(Si20O50)(OH)6.12H2O A ps O
MINEHILLITE (K,Na)2-3Ca28(Zn4Al4Si40)O112(OH)16 H
TRUSCOTTITE (Ca,Mn)14Si24O58(OH)8.2H2O H
FEDORITE (Na,K)2-3(Ca,Na)7(Si4O8)(Si4O10)3(F,Cl,OH)2.3,5H2O A
MARTINITE (Na,[],Ca)12Ca4(Si,S,B)14B2O38(OH,Cl)2F2.4H2O A ps H
REYERITE (Na,K)4Ca14Si22Al2O58(OH)8.6H2O R
LALONDEITE (Na,Ca)6(Ca,Na)3Si16O38(F,OH)2.3H2O A
GYROLITE NaCa16AlSi23O60(OH)8.14H2O A ps H
TUNGUSITE Ca14(OH)8(Si8O20)Fe++9(OH)14 A (?)
JAGOITE Pb3Fe+++Si4O12(Cl,OH) H
HYTTSJOITE Pb18Ba2Ca5Mn++2Fe+++2Si30O90Cl.6H2O R
MARICOPAITE (Pb7Ca2)[Al12Si36(O,OH)100].n(H2O,OH) (n=near 32) O
WEEKSITE K2(UO2)2(Si5O13).4H2O M
COUTINHOITE (Th,Ba)0,5(UO2)2Si5O13.1-3,5H2O O
HAIWEEITE Ca(UO2)2Si5O12(OH)2.4,5H2O O
8/H.38 to 40 Two layers of tetrahedrons and related structures
MONTEREGIANITE-(Y) (Na,K)6(Y,Ca)2Si16O38.10H2O M
RHODESITE (Ca,Na2,K2)8Si16O40.11H2O O
GUNTERBLASSITE (?,??)3-xF?[(Si,?l)13O25(??,O)4].7?2O O
HILLESHEIMITE (K,Ca,[])2(Mg,Fe,Ca,[])2[(Si,Al)13O23(OH)6](OH).8H2O O
FIVEGITE K4Ca2[AlSi7O17(O2-xOHx)][(H2O)2-xOHx]Cl (x = 0-2) O
UMBRIANITE K7Na2Ca2[Al3Si10O29]F2Cl2 O
DELHAYELITE (Na,K)10Ca5Al6Si32O80(Cl2,F2,SO4)3.18H2O O
SEIDITE-(Ce) Na4(Ce,Sr)2TiSi8O18(O,OH,F)5(OH).5H2O M
ILIMAUSSITE-(Ce) (Na,K)7-8(Ba,K)10Ce5(Nb,Ti)6(Si12O36)(Si9O18)(O,OH)24O6 R ps H
CYMRITE BaAl2Si2(O,OH)8.H2O M ps O
KAMPFITE Ba6[(Si,Al)O2]8(CO3)2Cl2.(Cl,H2O)2 H
LOURENSWALSITE (K,Ba)2(Ti,Mg,Ca,Fe)4(Si,Al,Fe)6O14(OH)12 H
BURCKHARDTITE Pb2(Fe+++Te++++++)[AlSi3O8]O6 M ps H
VERTUMNITE Ca2Al[(OH)6AlSiO2-3(OH)4-3].2,5H2O M ps H
ZUSSMANITE K(Fe++,Mg,Mn)13(Si,Al)18O42(OH)14 R
COOMBSITE K(Mn++,Fe++,Mg)13(Si,Al)18O42(OH)14 R
SHAFRANOVSKITE K2Na3(Mn,Fe,Na)4[Si9(O,OH)27](OH)2.nH2O (n=2,33) R
8/J. Tectosilicates: frames (Si,Al)O2, Si:O = 1:2
8/J.01 to 08 Tectosilicates without tetrahedron's additional anion
8/J.06 to 07 Feldspar group
ANDESINE (a variety of albite) (Na,Ca)[Al(Si,Al)Si2O8] A
LABRADORITE (a variety of anorthite) (Ca,Na)[Al(Al,Si)Si2O8] A
BYTOWNITE (a variety of anorthite) (Ca,Na)[Al(Al,Si)Si2O8] A
FILATOVITE K(Al,Zn)2(As+++++,Si)2O8 M
8/J.09 to 14 Tectosilicates with tetrahedron's additional anions
KYANOXALITE Na7(Al5-6Si6-7O24)(C2O4)0,5-1.5H2O H
DEPMEIERITE Na8[Al6Si6O24](PO4,CO3)1-x.3H2O (x smaller than 0,5) H
DAVYNE (Na,Ca,K)8Al6Si6O24(Cl,SO4,CO3)2-3 H
QUADRIDAVYNE [(Na,K)6Cl2](Ca2Cl2)Al6Si6O24 H
BALLIRANOITE (Na,K)6Ca2(Si6Al6O24)Cl2(CO3) H
MICROSOMMITE (Na,Ca,K)7-8(Si,Al)12O24(Cl,SO4,CO3)2-3 H
KIRCHERITE [Na90Ca36K18]sigma=144(Si108Al108O432)(SO4)36.6H2O R ps H
FANTAPPIEITE [Na82.5Ca33K16.5](Si99Al99O396)(SO4)33.6H2O R
FARNESEITE [(Na,K)46Ca10](Si42Al42O168)(SO4)12.6H2O H
BIACHELLAITE (Na,Ca,K)8Al6Si6O24(SO4)2(OH)0,5.H2O R
GIUSEPPETTITE (Na,K,Ca)7-8(Si,Al)12O24(SO4,Cl)1-2 H
BYSTRITE Ca(Na,K)7Si6Al6O24(S--)1,5.H2O R
ALLORIITE (Na,Ca,K)13Ca2(Al6Si6O24)2(SO4)3Cl2.2H2O R ps H
AFGHANITE (Na,Ca,K)8(Si,Al)12O24(SO4,Cl,CO3)3.H2O H
TOUNKITE (Na,Ca,K)8Al6Si6O24(SO4)2Cl.H2O H
SACROFANITE (Na,Ca,K)9(Si,Al)12O24[(OH)2,(SO4),(CO3),Cl2)]3.nH2O H
MARINELLITE (Na,K,Ca)48(SO4)8(Al6Si6O24)6Cl2.3H2O H
VISHNEVITE (Na,Ca,K)6(Si,Al)12O24[(SO4),(CO3),Cl2]2-4.nH2O H
FRANZINITE (Na,K)6Ca2(SO4)2Al6Si6O24.0,5H2O H
LIOTTITE (Ca,Na,K)8(Si,Al)12O24[(SO4),(CO3),Cl,OH]4.H2O H
WENKITE Ba4Ca6(Si,Al)20O41(OH)2(SO4)3.H2O H
8/J.09- Cancrinite group
LEIFITE Na2(Si,Al,Be)7(O,OH,F)14 R
8/J.11- Sodalite group (complex feldspathoids)
TSAREGORODTSEVITE N(CH3)4[Si2(Si0,5Al0,5)O6]2 O ps C
NOSEAN Na8Al6Si6O24(SO4).H2O C
HAUYNE (Na,Ca,K)8-4(SO4)2-1(AlSiO4)6 C
LAZURITE (Na,Ca)7-8(Al,Si)12(O,S)24[(SO4),Cl2,(OH)2] C M A
8/J.15 to 20 Tectosilicates with zeolite structure
LOVDARITE K4Na12[Be8Si28O72].18H2O O
GAULTITE Na4[Zn2Si7O18].5H2O O
PARTHEITE Ca2[Al4Si4O15(OH)2].4H2O M
ROGGIANITE Ca2[Be(OH)2Al2Si4O13].2,5H2O Q
KRASNOITE Ca3Al7,7Si3P4O23,5(OH)12,1F2.8H2O R ps H
PERHAMITE (Ca,Sr)3Al7,7Si3P4O23,5(OH)14,1.8H2O R ps H
TSCHORTNERITE Ca4(K,Ca,Sr,Ba)3Cu3(OH)8(Si12Al12O48).nH2O (n more than 20) C
THORNASITE Na12Th3(Si8O19)4.18H2O R
MENDELEEVITE-(Ce) (Cs6[]6)([]10K2)(REE22Ca6)(Si70O175)(OH,F)16(H2O)19 C
MENDELEEVITE-(Nd) Cs6[(Nd,REE)23Ca7](Si70O175)(OH,F)19(H2O)16 C
8/J.21 to 27 Zeolite group
8/J.21 to- 22 Fibrous zeolites
GONNARDITE (Na,Ca)6-8[(Al,Si)20O40].12H2O O
MESOLITE Na16Ca16[Al48Si72O240].64H2O O
THOMSONITE-Sr (Sr,Ca)2Na[Al5Si5O20].6-7H2O O
FERRIERITE-NH4 (NH4,Mg0,5)5(Al5Si31O72).22H2O O
FERRIERITE-Na (Na,K,Mg0,5,Ca0,5)6[Al6Si30O72].18H2O M
FERRIERITE-K (K,Na,Mg0,5,Ca0,5)6[Al6Si30O72].18H2O O
FERRIERITE-Mg (Mg0,5,K,Na,Ca0,5)6[Al6Si30O72].18H2O O
MUTINAITE Na3Ca4[Al11Si85O192].60H2O O
GOTTARDIITE Na3Mg3Ca5[Al19Si117O272].93H2O O ps H
BOGGSITE Ca8Na3[Al19Si77O192].70H2O O
DACHIARDITE-Na (Na,K,Ca0,5)4-5[Al4-5Si20-19O48].12-13H2O M
DACHIARDITE-Ca (Ca0,5,K,Na)4-5[Al4-5Si20-19O48].12-13H2O M
DIRENZOITE K6Na(Ca,Mg)3(Si,Al)60O120.36H2O O
MORDENITE (Na2,Ca,K2)4[Al8Si40O96].28H2O O
LAUMONTITE Ca4[Al8Si16O48].18H2O M
8/J.23 to 25 Lamellar zeolites
HEULANDITE-Na (Na,Ca0,5,K)9[Al9Si27O72].24H2O M
HEULANDITE-K (K,Ca0,5,Na,Mg0,5,Sr0,5)9[Al9Si27O72].24H2O M
HEULANDITE-Ca (Ca0,5,Na,K)9[Al9Si27O72].24H2O M
HEULANDITE-Sr (Sr0,5,Ca0,5,Na,K)9[Al9Si27O72].24H2O M
HEULANDITE-Ba (Ba,Ca,Sr,K,Na)5Al9Si27O72.22H2O M
CLINOPTILOLITE-Na (Na,K,Ca0,5)6[Al6Si30O72].20H2O M
CLINOPTILOLITE-Ca (Ca0,5,Na,K)6[Al6Si30O72].20H2O M
STILBITE-Na (Na,Ca0,5,K)9[Al9Si27O72].28H2O M
STILBITE-Ca (Ca0,5,Na,K)9[Al9Si27O72].28H2O M
EPISTILBITE (Ca,Na2)[Al2Si6O16].5H2O M/A
BREWSTERITE-Sr (Sr,Ba)2[Al4Si12O32].10H2O M/A
BREWSTERITE-Ba (Ba,Sr)2[Al4Si12O32].10H2O M
COWLESITE Ca[Al2Si3O10].5,3H2O O
AMICITE K4Na4[Al8Si8O32].10H2O M
GOBBINSITE Na5[Al5Si11O32].12H2O O ps Q
GARRONITE-Ca Na2Ca5Al12Si20O64.27H2O Q/O
PHILLIPSITE-Na (Na,K,Ca0,5,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M
PHILLIPSITE-K (K,Na,Ca0,5,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M
PHILLIPSITE-Ca (Ca0,5,K,Na,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M ps O
FLORKEITE K3NaCa2(Al8Si8O32) A ps M
HARMOTOME Ba2(Ca0,5,Na)Al6Si10O32.12H2O M
MERLINOITE K5Ca2[Al9Si23O64].22H2O O
8/J.26 to 27 Cubic and pseudocubic zeolites
CHABAZITE-Na (Na,K,Ca0,5)4[Al4Si8O24].12H2O R
CHABAZITE-K (K,Na,Ca0,5)4[Al4Si8O24].12H2O R
CHABAZITE-Mg Mg0,7K0,5Ca0,5Na0,1)[Al3Si9O24].10H2O R
CHABAZITE-Ca (Ca0,5,K,Na)4[Al4Si8O24].12H2O R ps H/A
CHABAZITE-Sr (Sr,Ca)[Al2Si4O12].6H2O R
GMELINITE-Na (Na,K,Ca0,5)4[Al8Si16O48].22H2O H
GMELINITE-K (K,Na,Ca)6[Al7Si17O48].22H2O H
GMELINITE-Ca (Ca0,5,Sr0,5,Na,K)4[Al8Si16O48].22H2O H
LEVYNE-Na (Na,Ca0,5,K)6[Al6Si12O36].17H2O R
LEVYNE-Ca (Ca0,5,Na,K)6[Al6Si12O36].17H2O R
MAZZITE-Mg (Mg2,5K2Ca1,5)[Al10Si26O72].30H2O H
MAZZITE-Na Na4[Al4Si14O36].15H2O H
ERIONITE-Na (Na,K,Ca0,5)10[Al10Si26O72].30H2O H
ERIONITE-K (K,Na,Ca0,5)10[Al10Si26O72].30H2O H
ERIONITE-Ca (Ca0,5,K,Na)10[Al10Si26O72].30H2O H
BELLBERGITE (K,Ba,Sr)2Sr2Ca2(Ca,Na)4[Al18Si18O72].30H2O H
PERLIALITE K9Na(Ca,Sr)[Al12Si24O72].15H2O H
ANALCIME (-1C,-1Q,-1O,-1M) Na[AlSi2O6].H2O C Q O M
POLLUCITE (Cs,Na)[AlSi2O6].nH2O (Cs+n=1) C
FAUJASITE-Na (Na,Ca0,5,Mg0,5,K)3-4[Al3-4Si9-8O24].16H2O C
FAUJASITE-Mg (Mg0,5,Ca0,5,Na,K)3-4[Al3-4Si9-8O24].16H2O C
FAUJASITE-Ca (Ca0,5,Na,Mg0,5,K)3-4[Al3-4Si9-8O24].16H2O C
PAULINGITE-K (K,Ca0,5,Na)10[Al10Si32O84].27-44H2O C
PAULINGITE-Ca (Ca0,5,K,Na)10[Al10Si32O84].27-44H2O C

Class IX - Organic compounds

Mineral Formula System
9/A. Salts of organic acids
9/A.01- Oxalates [C2O4]--
DEVEROITE-(Ce) (Ce,Nd,La)2(C2O4)3.10H2O M
COSKRENITE-(Ce) (Ce,Nd,La)2(SO4)2(C2O4).8H2O A
LEVINSONITE-(Y) (Y,Nd,Ce)Al(SO4)2(C2O4).12H2O M
ZUGSHUNSTITE-(Ce) (Ce,Nd,La)Al(SO4)2(C2O4).12H2O M
9/A.02- Other organic salts: mellates, citrates, etc.
CALCLACITE (?) CaCl2.Ca(C2H3O2)2.10H2O M/A
9/B. Hydrocarbon without N
9/B.01- Chain structures
EVENKITE CxH2x+2 (x=19 to 28) O
9/B.02- Ringstructures
9/C. Resins compounds
AMBER [C,H,O] am.
9/D. Hydrocarbons with N


[Mineral Search]     [Abbreviations]     [Pictures]     [Athena]


Send comments on page to mail pp

Copyright © 1986, 1994, 2014 ATHENA - Pierre Perroud. All Rights Reserved.