owl  

ATHENA

MINERALOGY


Systematic List of Minerals

(Strunz VIII th ed.)

mlevy


Class I - Elements

Mineral Formula System
1/A.01 to 08 Metals and intermetallic alloys
COPPER Cu C
SILVER (-3C,-2H,-4H) Ag C/H
SILVER-2H Ag H
SILVER-4H Ag H
GOLD Au C
AURICUPRIDE Cu3Au O
TETRAAURICUPRIDE (TETRA-AURICUPRIDE) AuCu Q
BOGDANOVITE (Au,Te,Pb)3(Cu,Fe) C
HUNCHUNITE (Au,Ag)2Pb C
ANYUIITE Au(Pb,Sb)2 Q
SOROSITE Cu(Sn,Sb) H
YUANJIANGITE AuSn H
MERCURY Hg R
KOLYMITE Cu7Hg6 C
BELENDORFFITE Cu7Hg6 R ps C
EUGENITE Ag11Hg2 C
MOSCHELLANDSBERGITE Ag2Hg3 C
LUANHEITE Ag3Hg H
SCHACHNERITE Ag1,1Hg0,9 H
PARASCHACHNERITE Ag3Hg2 O
GOLDAMALGAM = GOLD containing Hg, Ag (Au,Ag)Hg C
WEISHANITE (Au,Ag)3Hg2 H
POTARITE PdHg Q
LEADAMALGAM HgPb2 Q
ALUMINIUM Al C
STEINHARDITE Al C
CUPALITE (Cu,Zn)Al O
KHATYRKITE (Cu,Zn)Al2 Q
ICOSAHEDRITE Al63Cu24Fe13 ps C
ZINC Zn H
BRASS (?) Cu3Zn2 C (?)
TONGXINITE Cu2Zn C
ZHANGHENGITE (Cu,Zn,Fe,Al,Cr) C
DANBAITE CuZn2 C
CADMIUM Cd H
INDIUM In Q
LEAD Pb C
TIN Sn Q
TITANIUM (?) Ti H
CHROMIUM Cr C
FERCHROMIDE Cr3Fe1-x (x=0,6) C
CHROMFERIDE Fe3Cr1-x (x=0,6) C
MANGANESE Mn C
IRON Fe C
WAIRAUITE CoFe C
JEDWABITE Fe7(Ta,Nb)3 H
NICKEL Ni C
TAENITE (Ni,Fe) C
TETRATAENITE FeNi Q
AWARUITE Ni2Fe to Ni3Fe H
NISNITE Ni3Sn C
1/A.09 to 12 Carbides, nitrides, phosphides, silicides
KHAMRABAEVITE (Ti,V,Fe)C C
TONGBAITE Cr3C2 O
YARLONGITE (Cr,Fe,Ni)9C4 H
ISOVITE (Cr,Fe)23C6 C
HAXONITE (FeNi)23C6 C
COHENITE (Fe,Ni,Co)3C O
NIOBOCARBIDE (Nb,Ta)C C
TANTALCARBIDE (Ta,Nb)C C
QUSONGITE WC H
OSBORNITE TiN C
CARLSBERGITE CrN C
QINGSONGITE BN C
ROALDITE Fe4N C
SIDERAZOT Fe5N2 H
NIERITE Si3N4 R
SINOITE Si2N2O O
FLORENSKYITE Fe(Ti,Ni)P O
ANDREYIVANOVITE Fe(Cr,Fe)P O
BARRINGERITE (Fe,Ni)2P H
MONIPITE MoNiP H
ALLABOGDANITE (Fe,Ni)2P O
TRANSJORDANITE Ni2P H
SCHREIBERSITE (Fe,Ni)3P Q
NICKELPHOSPHIDE (Ni,Fe)3P Q
NEGEVITE NiP2 C
PALLADOSILICIDE Pd2Si H
PERRYITE (Ni,Fe)8(Si,P)3 H
SUESSITE (Fe,Ni)3Si C
GUPEIITE Fe3Si C
HAPKEITE Fe2Si C
MAVLYANOVITE (Mn,Fe)5Si3 H
XIFENGITE Fe5Si3 H
BROWNLEEITE MnSi C
NAQUITE FeSi C
LINZHIITE FeSi2 Q
LUOBUSAITE Fe3Si7 O
ZANGBOITE TiFeSi2 O
RHENIUM (?) Re H (?)
HEXAMOLYBDENUM (Mo,Ru,Fe,Ir,Os) H
HEXAFERRUM (Fe,Ru,Os,Ir) H
GARUTIITE (Ni,Fe,Ir) H
OSMIUM (Os,Ir) H
RUTHENIUM (Ru,Ir,Os) H
RUTHENIRIDOSMINE (Ir,Os,Ru) H
RHODIUM (Rh,Pt) C
PALLADIUM Pd or (Pd,Hg) C
IRIDIUM (Ir,Os,Ru) C
PLATINUM Pt C
YIXUNITE Pt3In C
DAMIAOITE PtIn2 C
KITAGOHAITE Pt7Cu C
HONGSHIITE PtCu (?) R
SKAERGAARDITE PdCu C
1/A.15 to 17 Pt, Fe alloys with Sn, Pb, and related
CHENGDEITE Ir3Fe C
ISOFERROPLATINUM (Pt,Pd)3(Fe,Cu) C
TETRAFERROPLATINUM PtFe Q
TULAMEENITE Pt2CuFe Q
FERRONICKELPLATINUM Pt(Ni,Fe) Q
NIELSENITE PdCu3 Q
BORTNIKOVITE Pd3Cu3Zn Q
ZVYAGINTSEVITE (Pd,Pt,Au)3(Pb,Sn) C
ATOKITE (Pd,Pt)3Sn C
RUSTENBURGITE (Pt,Pd)3Sn C
NIGGLIITE PtSn H
STANNOPALLADINITE (Pd,Cu)3Sn2 (?) H
PALARSTANIDE Pd8(Sn,As)3 H
PLUMBOPALLADINITE Pd3Pb2 H
PAOLOVITE Pd2Sn O
CABRIITE Pd2SnCu O
TAIMYRITE (Pd,Cu,Pt)3Sn O
TATYANAITE (Pt,Pd,Cu)9Cu3Sn4 O
1/B. Semi-metals and non-metals
1/B.01- Arsenic group
ARSENIC As R
STIBARSEN SbAs R
ANTIMONY Sb R
BISMUTH Bi R
ARSENOLAMPRITE As O
PARARSENOLAMPRITE As O
PARADOCRASITE Sb2(Sb,As)2 M
GRAPHITE C H/R
CHAOITE C H
MOISSANITE (-5H,-6H,-10R,-15R,-33R) SiC H/R
DIAMOND C C
LONSDALEITE C H
FULLERITE C60 Q
SULFUR S O
ROSICKYITE gamma-S M
SELENIUM Se R
TELLURIUM Te R
SELENTELLURIUM (?) (Se,Te) R
SILICON Si C

Class II - Sulfides and sulfosalts

Mineral Formula System
2/A. Alloys and alloy-like compounds
2/A.01 to 04 Alloys and alloy-like compounds with Cu, Ag, Au, Ni
ALGODONITE Cu6As H
DOMEYKITE Cu3As C
KOUTEKITE Cu5As2 H
NOVAKITE (Cu,Ag)21As10 M ps Q
CUPROSTIBITE Cu2(Sb,Tl) Q
KUTINAITE (K,Tl)0,25Cu14Ag6As6,75 Q
ALLARGENTUM Ag1-xSbx H
DYSCRASITE Ag3Sb O
BEZSMERTNOVITE Au4Cu(Te,Pb) O
BILIBINSKITE Au3Cu2PbTe2 ps C
MALDONITE Au2Bi C
ORCELITE Ni5As2 H
MAUCHERITE Ni11As8 Q
2/A.05 to 07 Alloys and alloy-like compounds with Pt, Pd, etc.
ATHENEITE Pd2(As0,75Hg0,25) H
VINCENTITE (Pd,Pt)3(As,Sb,Te) (?)
STILLWATERITE Pd8As3 H
ARSENOPALLADINITE Pd8(As,Sb)3 A
ISOMERTIEITE Pd11Sb2As2 C
TORNROOSITE Pd11As2Te2 C
MIESSIITE Pd11Te2Se2 C
MERTIEITE-I Pd11(Sb,As)4 ps H
MERTIEITE-II Pd8(Sb,As)3 R
STIBIOPALLADINITE Pd5Sb2 H
CHENGUODAITE Ag9FeTe2S4 O
PALLADOARSENIDE Pd2As M
PALLADOBISMUTHARSENIDE Pd2(As,Bi) O
PALLADODYMITE (Pd,Rh)2As O
RHODARSENIDE (Rh,Pd)2As O
NALDRETTITE Pd2Sb O
ZACCARINIITE RhNiAs Q
MAJAKITE PdNiAs H
MENSHIKOVITE Pd3Ni2As3 H
POLKANOVITE (Rh,Ni)12As7 H
GENKINITE (Pt,Pd)4Sb3 Q
UNGAVAITE Pd4Sb3 Q
VASILITE (Pd,Cu)16(S,Te)7 C
OOSTERBOSCHITE (Pd,Cu)7Se3 O
LUBEROITE Pt5Se4 M
JAGUEITE Cu2Pd3Se4 M
CHRISSTANLEYITE Ag2Pd3Se4 M
TISCHENDORFITE Pd8Hg3Se9 O
JACUTINGAITE (Pt,Pd)2HgSe3 R
TELARGPALITE (Pd,Ag)3Te (?) C
KEITHCONNITE Pd20Te7 R
TELLUROPALLADINITE Pd9Te4 M
KOJONENITE Pd7-xSnTe2 (x between 0,3 and 0,8) Q
OULANKAITE (Pd,Pt)5(Cu,Fe)4SnTe2S2 Q
SOPCHEITE Ag4Pd3Te4 O
TEMAGAMITE Pd3HgTe3 O
BOROVSKITE Pd3SbTe4 C
2/B. Sulfides, selenides, tellurides (M:S,Se,Te higher than 1:1)
2/B.01- Cu sulfides
CHALCOCITE Cu2S M
DJURLEITE Cu31S16 M
DIGENITE Cu9S5 C
ROXBYITE Cu9S5 M
ANILITE Cu7S4 O
GEERITE Cu8S5 ps C
SPIONKOPITE Cu39S28 H
YARROWITE Cu9S8 H
2/B.02- Complex Cu, Fe Sulfides
BETEKHTINITE Cu10(Fe,Pb)S6 O
GORTDRUMITE (Cu,Fe)6Hg2S5 O
BORNITE Cu5FeS4 O ps C
CALVERTITE Cu5Ge0,5S4 C
2/B.03- Cu selenides
BERZELIANITE Cu2Se C
BELLIDOITE Cu2Se Q
CROOKESITE Cu7(Tl,Ag)Se4 Q
SABATIERITE Cu6TlSe4 O
UMANGITE Cu3Se2 Q
ATHABASCAITE Cu5Se4 O
WEISSITE Cu2-xTe H ps C
RICKARDITE Cu7Te5 O ps Q
2/B.05 to 08 Sulfides, selenides, tellurides with Ag/Au
ACANTHITE Ag2S M
NAUMANNITE Ag2Se O ps C
HESSITE Ag2Te M
AGUILARITE Ag4SeS O
CERVELLEITE Ag4TeS C
TSNIGRIITE Ag9SbTe3(S,Se)3 M
STUTZITE Ag7Te4 H
EMPRESSITE AgTe O
JALPAITE Ag3CuS2 Q
SELENOJALPAITE CuAg3Se2 Q
MCKINSTRYITE (Ag,Cu)2S O
STROMEYERITE AgCuS O
EUCAIRITE CuAgSe O
HENRYITE (Cu,Ag)3,4Te2 C
BRODTKORBITE Cu2HgSe2 M
IMITERITE Ag2HgS2 M
PETROVSKAITE AuAg(S,Se) M
UYTENBOGAARDTITE Ag3AuS2 Q
CRIDDLEITE TlAg2Au3Sb10S10 M ps Q
PENZHINITE (Ag,Cu)4Au(S,Se)4 H
FISCHESSERITE Ag3AuSe2 C
PETZITE Ag3AuTe2 C
KURILITE Ag8Te3Se R
MUTHMANNITE (Ag,Au)Te O (?)
PUTZITE (Cu,Ag)8GeS6 C
ARGYRODITE Ag8GeS6 O ps C
CANFIELDITE Ag8SnS6 O ps C
ALBURNITE Ag8GeTe2S4 C
2/B.09 to 11 Complex sulfides and selenides with Cu, Hg, Tl
DANIELSITE (Cu,Ag)14HgS8 O
BALKANITE Cu9Ag5HgS8 O
BAYANKHANITE (?) Cu6HgS4 H?
FURUTOBEITE (Cu,Ag)6PbS4 M
SCHLEMAITE (Cu,Ag)6(Pb,Bi)Se4 M
MAZZETTIITE Ag3HgPbSbTe5 O
PETROVICITE PbHgCu3BiSe5 O
ELDRAGONITE Cu6BiSe6 O
CARLINITE Tl2S R
2/B.12 to 17 Sulfides with Ni, Co, Rh, Pd
RHODPLUMSITE Pb2Rh3S2 R
SHANDITE Pb2Ni3S2 R ps C
LAFLAMMEITE Pd3Pb2S2 M
PASAVAITE Pd3Pb2Te2 O
PARKERITE Ni3(Bi,Pb)2S2 M
HEAZLEWOODITE Ni3S2 R
OREGONITE Ni2FeAs2 H
VOZHMINITE (Ni,Co)4(As,Sb)S2 H
DONHARRISITE Ni8Hg3S9 M
2/B.15- Hauchecornite group
TUCEKITE Ni9Sb2S8 Q
HAUCHECORNITE Ni9Bi(Sb,Bi)S8 Q
ARSENOHAUCHECORNITE Ni9BiAsS8 Q
TELLUROHAUCHECORNITE Ni9BiTeS8 Q
BISMUTOHAUCHECORNITE Ni9Bi2S8 Q
2/B.16- Pentlandite group
PENTLANDITE (Fe,Ni)9S8 C
COBALTPENTLANDITE (Co,Ni,Fe)9S8 C
ARGENTOPENTLANDITE Ag(Fe,Ni)8S8 C
GEFFROYITE (Ag,Cu,Fe)9(Se,S)8 C
MANGANESESHADLUNITE (Mn,Pb,Cd)(Cu,Fe)8S8 C
SHADLUNITE (Pb,Cd)(Fe,Cu)8S8 C
PALLADSEITE Pd17Se15 C
MIASSITE Rh17S15 C
SAMANIITE Cu2(Fe,Ni)7S8 Q
SUGAKIITE Cu(Fe,Ni)8S8 Q
HOROMANITE (Fe,Ni,Co,Cu)9S8 Q
MACKINAWITE (Fe,Ni)9S8 Q
GODLEVSKITE (Ni,Fe)7S6 O
KHARAELAKHITE (Pt,Cu,Pb,Fe,Ni)9S8 O
2/C. Sulfides (M:S,Se,Te = 1:1)
2/C.01- Sphalerite group
RUDASHEVSKYITE (Fe,Zn)S C
SPHALERITE (Zn,Fe)S C
BROWNEITE MnS C
HAWLEYITE CdS C
METACINNABAR HgS C
STILLEITE ZnSe C
TIEMANNITE HgSe C
COLORADOITE HgTe C
POLHEMUSITE (Zn,Hg)S Q ps C
LAUTITE CuAsS O
2/C.03- Chalcopyrite group
CHALCOPYRITE CuFeS2 Q
ESKEBORNITE CuFeSe2 Q
LENAITE AgFeS2 Q
LAFORETITE AgInS2 Q
ROQUESITE CuInS2 Q
GALLITE CuGaS2 Q
MOOIHOEKITE Cu9Fe9S16 Q
HAYCOCKITE Cu4Fe5S8 O
PUTORANITE Cu16-18(Fe,Ni)18-19S32 C
ISOCHALCOPYRITE (?) Cu16Fe17S32 or (Fe,Cu)S or Cu8Fe9S16 C
TALNAKHITE Cu9(Fe,Ni)8S16 C
ISOCUBANITE CuFe2S3 C
ORICKITE 2CuFeS2.H2O H
WILHELMRAMSAYITE Cu3FeS3.2H2O O
RAGUINITE TlFeS2 O ps H
PICOTPAULITE TlFe2S3 O
2/C.06 to 10 Stannite group
LUZONITE Cu3AsS4 Q
FAMATINITE Cu3SbS4 Q
PERMINGEATITE Cu3SbSe4 Q
BRIARTITE Cu2(Zn,Fe)GeS4 Q
BARQUILLITE Cu2(Cd,Fe)GeS4 Q
KURAMITE Cu3SnS4 Q
STANNITE Cu2FeSnS4 Q
FERROKESTERITE Cu2(Fe,Zn)SnS4 Q
KESTERITE Cu2(Zn,Fe)SnS4 Q
CERNYITE Cu2CdSnS4 Q
VELIKITE Cu2HgSnS4 Q
HOCARTITE Ag2FeSnS4 Q
PIRQUITASITE Ag2ZnSnS4 Q
SAKURAIITE (Cu,Zn,Fe)3(In,Sn)S4 Q
PETRUKITE (Cu,Fe,Zn)2(Sn,In)S4 O
RHODOSTANNITE Cu2FeSn3S8 Q
TOYOHAITE Ag2FeSn3S8 Q
STANNOIDITE Cu8(Fe,Zn)3Sn2S12 O
CHATKALITE Cu6Fe++Sn2S8 Q
MAWSONITE Cu+6Fe+++2Sn++++S8 Q
HEMUSITE Cu+4Cu++Sn++++Mo++++S8 C
KIDDCREEKITE Cu6SnWS8 C
CATAMARCAITE Cu6GeWS8 H
RENIERITE (Cu,Zn)11(Ge,As)2Fe4S16 Q ps C
VINCIENNITE Cu10Fe4Sn(As,Sb)S16 Q ps C
GERMANITE Cu26Fe4Ge4S32 C
NEKRASOVITE Cu26V2(Sn,As,Sb)6S32 C
COLUSITE Cu26V2(As,Sn,Sb)6S32 C
STIBIOCOLUSITE Cu26V2(Sb,Sn,As)6S32 C
GERMANOCOLUSITE Cu26V2(Ge,As)6S32 C
MAIKAINITE Cu10(Fe,Cu)3Mo(Ge,As)3S16 C
OVAMBOITE Cu10(Fe,Zn,Cu)3W(Ge,As)3S16 C
ARSENOSULVANITE Cu3(As,V)S4 C
SULVANITE Cu3VS4 C
POLKOVICITE (Fe,Pb)3(Ge,Fe)1-xS4 C
MOROZEVICZITE (Pb,Fe)3Ge1-xS4 C
2/C.11- Tetrahedrite group
TENNANTITE Cu10(Fe,Zn)2As4S13 C
ARGENTOTENNANTITE (Ag,Cu)10(Zn,Fe)2(As,Sb)4S13 C
GIRAUDITE (Cu,Zn,Ag)12(As,Sb)4(Se,S)13 C
TETRAHEDRITE Cu10(Fe,Zn)2Sb4S13 C
FREIBERGITE (Ag,Cu)6(Cu,Ag)4(Fe,Zn)2Sb4S12-13 C
GOLDFIELDITE Cu10-12(Te,Sb,As,Bi)4-2S13 C
HAKITE Cu10(Hg,Zn,Cd)2(Sb,As)4(Se,S)13 C
MGRIITE Cu3AsSe3 C
CHAMEANITE (Cu,Fe)4As(Se,S)4 C
WATANABEITE Cu4(As,Sb)2S5 O ps C
SINNERITE Cu6As4S9 A
NOWACKIITE Cu6Zn3As4S12 R
AKTASHITE Cu6Hg3As4S12 A
GRUZDEVITE Cu6Hg3Sb4S12 R
WURTZITE (Zn,Fe)S H
BUSECKITE (Fe,Zn,Mn)S H
GREENOCKITE CdS H
CADMOSELITE CdSe H
RAMBERGITE gamma-MnS H
ENARGITE Cu3AsS4 O
STIBIOENARGITE (?) Cu3(Sb,As)S4 O
CUBANITE CuFe2S3 O
STERNBERGITE AgFe2S3 O
ARGENTOPYRITE AgFe2S3 O
KEILITE (Fe,Mg)S C
NININGERITE (Mg,Fe++,Mn)S C
OLDHAMITE (Ca,Mg,Fe,Mn)S C
ALABANDITE Mn++S C
GALENA PbS C
CLAUSTHALITE PbSe C
ALTAITE PbTe C
CRERARITE (Pt,Pb)Bi3(S,Se)4-x (x=0,7) C
CUBOARGYRITE AgSbS2 C
MIARGYRITE AgSbS2 M
BAUMSTARKITE Ag3Sb2SbS6 A
ARAMAYOITE Ag3Sb2BiS6 A
MATILDITE AgBiS2 H
SCHAPBACHITE AgBiS2 C
BOHDANOWICZITE AgBiSe2 H
VOLYNSKITE AgBiTe2 O
HERZENBERGITE SnS O
STISTAITE SnSb C
MOHITE Cu2SnS3 A
TEALLITE PbSnS2 O
SUREDAITE PbSnS3 O
LEVYCLAUDITE Pb8Sn7Cu3(Bi,Sb)3S28 M ps Q/H
INCAITE (Pb,Ag)4Sn4FeSb2S15 M
COIRAITE (Pb,Sn++)12,5Fe++Sn++++5As3S28 M ps Q/H
FRANCKEITE (Pb,Sn++)6Sn++++2FeSb2S14 A
CYLINDRITE Pb4Fe++Sn++++4Sb+++2S16 A
ABRAMOVITE Pb2SnInBiS7 A ps Q
MERELANIITE Mo4Pb4VSbS15 A (?)
CINNABAR HgS R
HYPERCINNABAR HgS H
TROILITE FeS H
PYRRHOTITE Fe1-xS (x=0-0,17) M/H
JAIPURITE (?) CoS H
WESTERVELDITE (Fe,Ni,Co)As O
MODDERITE (Co,Fe)As O (?)
SMYTHITE (Fe,Ni)9S11 or (Fe,Ni)13S16 R
ACHAVALITE (?) FeSe R
MURCHISITE Cr5S6 R
HEIDEITE (Fe,Cr)1+x(Ti,Fe)2S4 M
2/C.20- Nickeline group
LANGISITE (Co,Ni)As H
NICKELINE NiAs H
BREITHAUPTITE NiSb H
FREBOLDITE CoSe H
SEDERHOLMITE beta-NiSe H
VAVRINITE Ni2SbTe2 H
IMGREITE (?) NiTe (?) H
HEXATESTIBIOPANICKELITE (Ni,Pd)(Te,Sb) H
KOTULSKITE Pd(Te,Bi) H
SUDBURYITE (Pd,Ni)Sb H
STUMPFLITE Pt(Sb,Bi) H
POLARITE Pd(Bi,Pb) O
SOBOLEVSKITE Pd(Bi,Te) H/M
RUTHENARSENITE (Ru,Ni)As O
CHEREPANOVITE RhAs O
WASSONITE TiS R
LAPIEITE CuNiSbS3 O
MUCKEITE CuNiBiS3 O
MALYSHEVITE PdCuBiS3 O
ZLATOGORITE CuNiSb2 R
LISIGUANGITE CuPtBiS3 O
MILLERITE NiS R
MAKINENITE gamma-NiSe R
COVELLITE CuS H
KLOCKMANNITE CuSe H
IDAITE Cu3FeS4 (?) H
NUKUNDAMITE (Cu,Fe)4S4 H
YUSHKINITE VS2(Mg,Al)(OH)2 H
EKPLEXITE (Nb,Mo,W)S2.(Mg1-xAlx)(OH)2+x R
KASKASITE (Mo,Nb)S2.(Mg1-xAlx)(OH)2+x R
MANGANOKASKASITE (Mo,Nb)S2.(Mn1-xAlx)(OH)2+x R
VALLERIITE 4(Fe,Cu)S.3(Mg,Al)(OH)2 H
FERROVALLERIITE (Fe,Cu)4S4.3[Fe++(OH)2] R
HAAPALAITE 4(Fe,Ni)S.3(Mg,Fe++)(OH)2 H
TOCHILINITE 2(Fe,Ni,Cu)S.1-2(Mg,Fe,Al,Ca)(OH,CO3)1-2 A
FERROTOCHILINITE (FeS)6.5[Fe++(OH)2] M
VYALSOVITE FeS.Ca(OH)2.Al(OH)3 O
VULCANITE CuTe O
VYSOTSKITE (Pd,Ni)S Q
BRAGGITE (Pt,Pd,Ni)S Q
COOPERITE (Pt,Pd,Ni)S Q
2/D. Sulfides (M:S,Se,Te smaller than 1:1)
2/D.01- Linnaeite group
GREIGITE Fe++Fe+++2S4 C
LINNAEITE Co++Co+++2S4 C
POLYDYMITE NiNi2S4 C
CARROLLITE Cu(Co,Ni)2S4 C
FLETCHERITE Cu(Ni,Co)2S4 C
FLORENSOVITE (Cu,Zn)(Cr,Sb)2S4 C
VIOLARITE Fe++Ni+++2S4 C
SIEGENITE (Ni,Co)3S4 C
INDITE Fe++In2S4 C
CADMOINDITE CdIn2S4 C
JOEGOLDSTEINITE MnCr2S4 C
DAUBREELITE Fe++Cr2S4 C
KALININITE ZnCr2S4 C
CUPROKALININITE Cu(Cr,V+++)2S4 C
BORNHARDTITE Co++Co+++2Se4 C
TRUSTEDTITE Ni3Se4 C
TYRRELLITE (Cu,Co,Ni)3Se4 C
CUPRORHODSITE CuRh2S4 C
CUPROIRIDSITE CuIr2S4 C
MALANITE Cu(Pt,Ir)2S4 C
FERRORHODSITE (Fe,Cu)(Rh,Pt,Ir)2S4 C
XINGZHONGITE (?) (Pb,Cu,Fe)(Ir,Pt,Rh)2S4 (?) C
KINGSTONITE (Rh,Ir,Pt)3S4 M
INAGLYITE PbCu3(Ir,Pt)8S16 H
KONDERITE PbCu3(Rh,Pt,Ir)8S16 H
BREZINAITE Cr3S4 M
WILKMANITE Ni3Se4 M
KASHINITE (Ir,Rh)2S3 O
BOWIEITE (Rh,Ir,Pt)1,77S3 O
DAOMANITE CuPtAsS2 O
PAXITE Cu2As3 M ps O
PAAKKONENITE Sb2AsS2 M
STIBNITE Sb2S3 O
ANTIMONSELITE Sb2Se3 O
METASTIBNITE Sb2S3 am.
BISMUTHINITE Bi2S3 O
GUANAJUATITE Bi2Se3 O
OTTEMANNITE Sn2S3 O
2/D.09- Tetradymite group
TELLURANTIMONY Sb2Te3 R
TELLUROBISMUTHITE Bi2Te3 R
PARAGUANAJUATITE Bi2(Se,S)3 R
SKIPPENITE Bi2Se2Te R
TETRADYMITE Bi2Te2S R
KAWAZULITE Bi2(Te,Se,S)3 R
INGODITE Bi(S,Te) H
NEVSKITE Bi(Se,S) R
SULPHOTSUMOITE Bi3Te2S R
TSUMOITE BiTe R
SZTROKAYITE (?) Bi3TeS2  
YEOMANITE Pb2O(OH)Cl O
TELLURONEVSKITE Bi3Te(Se,S)2 R
VIHORLATITE Bi24Se17Te4 R
PROTOJOSEITE (?) Bi4TeS2 (?) H
BAKSANITE Bi6(Te2S3) R
IKUNOLITE Bi4(S,Se)3 R
LAITAKARITE Bi4(Se,S)3 R
JOSEITE-A Bi4TeS2 R
JOSEITE-B Bi4Te2S R
PILSENITE Bi4Te3 R
KOCHKARITE PbBi4Te7 R
ALEKSITE PbBi2Te2S2 R
POUBAITE PbBi2(Te,S)2Se2 R
RUCKLIDGEITE (Bi,Pb)3Te4 R
SADDLEBACKITE Pb2Bi2Te2S3 H
BABKINITE Pb2Bi2(S,Se)3 R
HEDLEYITE Pb7Te3 (?) R
2/D.14 to 16 Tellurides with Cu, Ag, Au
CAMERONITE Cu5-x(Cu,Ag)3+xTe10 (x = 0,43) Q
TARKIANITE (Cu,Fe)(Re,Mo)4S8 C
MONTBRAYITE (Au,Sb)2Te3 A
MUSEUMITE AuTe2Pb5SbS12 M
NAGYAGITE (Au,Te)3Pb3(Pb,Sb,Bi)3S6 M
BUCKHORNITE AuTe2Pb2BiS3 O
JASZCZAKITE [Bi3S3][AuS2] O
JONASSONITE Au(Bi,Pb)5S4 M
KOSTOVITE CuAuTe4 O
SYLVANITE (Au,Ag)2Te4 M
KRENNERITE Au3AgTe8 O
CALAVERITE AuTe2 M
2/D.17- Pyrite group
FUKUCHILITE (Cu,Fe)S2 C
VILLAMANINITE (Cu,Ni,Co,Fe)S2 C
PYRITE FeS2 C
CATTIERITE CoS2 C
VAESITE NiS2 C
HAUERITE MnS2 C
DZHARKENITE FeSe2 C
KRUTAITE CuSe2 C
TROGTALITE CoSe2 C
PENROSEITE (Ni,Co,Cu)Se2 C
LAURITE RuS2 C
ERLICHMANITE OsS2 C
SPERRYLITE PtAs2 C
AUROSTIBITE AuSb2 C
GEVERSITE Pt(Sb,Bi)2 C
INSIZWAITE Pt(Bi,Sb)2 C
CHANGCHENGITE IrBiS C
MAYINGITE IrBiTe C
MASLOVITE (Pt,Pd)(Bi,Te)2 C
TESTIBIOPALLADITE Pd(Sb,Te)Te C
PADMAITE PdBiSe C
MICHENERITE (Pd,Pt)BiTe C
2/D.18- Cobaltite group
COBALTITE CoAsS C
GERSDORFFITE NiAsS C
JOLLIFFEITE (Ni,Co)AsSe C
WILLYAMITE (Co,Ni)SbS M/A
ULLMANNITE NiSbS A ps C
KALUNGAITE PdAsSe C
MILOTAITE PdSbSe C
HOLLINGWORTHITE (Rh,Pt,Pd)AsS C
IRARSITE (Ir,Ru,Rh,Pt)AsS C
PLATARSITE (Pt,Rh,Ru)AsS C
TOLOVKITE IrSbS C
KRUTOVITE NiAs2 C
2/D.20- Marcasite group
MARCASITE FeS2 O
FERROSELITE FeSe2 O
KULLERUDITE NiSe2 O
FROHBERGITE FeTe2 O
MATTAGAMITE CoTe2 O
ANDUOITE (Ru,Os)As2 O
OMEIITE (Os,Ru)As2 O
IRIDARSENITE (Ir,Ru)As2 M
BORISHANSKIITE Pd1+x(As,Pb)2 (x=0-0,2) O
FROODITE PdBi2 M
URVANTSEVITE Pd(Bi,Pb)2 Q
2/D.22- Arsenopyrite group
ARSENOPYRITE FeAsS M ps O
GLAUCODOT (Co,Fe)AsS O ps C
GUDMUNDITE FeSbS M
RUARSITE RuAsS M
OSARSITE (Os,Ru)AsS M
ALLOCLASITE (Co,Fe)AsS M
2/D.23- Lollingite group
LOLLINGITE FeAs2 O
SAFFLORITE (Co,Fe++)As2 O
RAMMELSBERGITE NiAs2 O
SEINAJOKITE (Fe,Ni)(Sb,As)2 O
NISBITE NiSb2 O
COSTIBITE CoSbS O
OENITE CoSbAs O
CLINOSAFFLORITE (Co,Fe,Ni)As2 M
PARARAMMELSBERGITE NiAs2 O
PARACOSTIBITE CoSbS O
RHENIITE ReS2 A ps H
MOLYBDENITE-2H MoS2 H/R
MOLYBDENITE-3R MoS2 R
JORDISITE MoS2 am.
DRYSDALLITE Mo(Se,S)2 H
TUNGSTENITE (-2H,-3R) WS2 H/R
CASTAINGITE (?) CuMo2S5 H
DZHEZKAZGANITE (?) Lead or copper rhenium sulfide (?) am.
BAMBOLLAITE Cu(Se,Te)2 Q
2/D.28- Melonite group
BERNDTITE (-2T,-4H) SnS2 R/H
KITKAITE NiTeSe R
MELONITE NiTe2 R
SUDOVIKOVITE PtSe2 R
MERENSKYITE (Pd,Pt)(Te,Bi)2 R
SHUANGFENGITE IrTe2 R
MONCHEITE (Pt,Pd)(Te,Bi)2 R
VERBEEKITE PdSe2 M
FERROSKUTTERUDITE (FeCo)As3 C
SKUTTERUDITE (Co,Ni)As3-x C
NICKELSKUTTERUDITE (Ni,Co,Fe)As3 C
KIEFTITE CoSb3 C
IRIDISITE (?) (Ir,Cu,Rh,Ni,Pt)S2 ps C
GAOTAIITE Ir3Te8 C
2/E. Sulfosalts (MmXnYp X=As,Sb,Bi Y=S,Se,Te)
2/E.01 to 04 Fe/Cu Sulfosalts (S:As,Sb,Bi = 2)
GRATIANITE MnBi2S4 M
CLERITE MnSb2S4 O
BERTHIERITE FeSb2S4 O
GARAVELLITE FeSbBiS4 O
LAROSITE (Cu,Ag)21(Pb,Bi)2S13 O
SKINNERITE Cu3SbS3 M
WITTICHENITE Cu3BiS3 O
CHALCOSTIBITE CuSbS2 O
EMPLECTITE CuBiS2 O
GRUNDMANNITE CuBiSe2 O
KUPCIKITE Cu3,4Fe0,6Bi5S10 M
CUPROBISMUTITE Cu10Bi12S23 M
HODRUSITE Cu8Bi12S22 M
PIZGRISCHITE Cu14(Cu,Fe)PbBi17S35 M
2/E.05 to 09 Ag Sulfosalts (S:As,Sb,Bi = 6-1,6)
BILLINGSLEYITE Ag7AsS6 C
CUPROPEARCEITE Ag9Cu7(As,Sb)2S11 R
PEARCEITE [(Ag8CuS4)][(AgCu)6(As,Sb)2S7] M
CUPROPOLYBASITE Ag9Cu7(Sb,As)2S11 R
POLYBASITE [(Ag8CuS4)][(AgCu)6(Sb,As)2S7] M ps H
SELENOPOLYBASITE Cu(Ag,Cu)6Ag9(Sb,As)2(S,Se)9Se2 R
BENLEONARDITE Ag15Cu(Sb,As)2S7Te4 Q
STEPHANITE Ag5SbS4 O
SELENOSTEPHANITE Ag5Sb(Se,S)4 O
ARCUBISITE Ag6CuBiS4 (?)
PROUSTITE Ag3AsS3 R
PYRARGYRITE Ag3SbS3 R
PYRARGYRITE Ag3SbS3 R
ECKERITE Ag2CuAsS3 M
XANTHOCONITE Ag3AsS3 M
PYROSTILPNITE Ag3SbS3 M
SAMSONITE Ag4MnSb2S6 M
MANGANOQUADRATITE AgMnAsS3 Q
QUADRATITE Ag(Cd,Pb)(As,Sb)S3 Q
DEBATTISTIITE Ag9Hg0,5As6S12Te2 A
TRECHMANNITE AgAsS2 R
SMITHITE AgAsS2 M
DERVILLITE Ag2AsS2 M
FETTELITE Ag164HgAs4S15 R ps H
BORODAEVITE Ag5(Bi,Sb)9S16 M
BENJAMINITE (Ag,Cu)3(Bi,Pb)7S12 M
MUMMEITE (Ag,Cu)9Pb2Bi13S26 M
DANTOPAITE (Ag,Cu)5(Bi,Pb)13S22 M
PAVONITE (Ag,Cu)(Bi,Pb)3S5 M
CUPROPAVONITE AgPbCu2Bi5S10 M
MAKOVICKYITE (Ag,Cu)1,5(Bi,Pb)5,5S9 M
CUPROMAKOPAVONITE Cu8Ag3Pb4Bi19S38 M
2/E.10 to 14 Tl/Hg Sulfosalts (S:As,Sb,Bi = 4-1,6)
FANGITE Tl3AsS4 O
GALKHAITE (Cs,Tl)(Hg,Cu,Zn)6(As,Sb)4S12 C
VORONTSOVITE (Hg5Cu)TlAs4S12 C
LAFFITTITE AgHgAsS3 M
ROUTHIERITE TlCu(Hg,Zn)2(As,Sb)2S6 Q
ARSICCIOITE AgHg2Tl(As,Sb)2S6 Q
RALPHCANNONITE AgZn2TlAs2S6 Q ps C
STALDERITE (Tl,Cu)(Zn,Fe,Hg)2As2S6 Q
CHRISTITE TlHgAsS3 M
ELLISITE Tl3AsS3 R
ERNIGGLIITE Tl2SnAs2S6 H
WALLISITE PbTl(Cu,Ag)As2S5 A
HATCHITE (Pb,Tl)2AgAs2S5 A
RABERITE Tl5Ag4As6SbS15 A
SICHERITE TlAg2(As,Sb)3S6 O
LIVINGSTONITE HgSb4S8 M
RICHARDSOLLYITE TlPbAsS3 M
GRUMIPLUCITE HgBi2S4 M
SIMONITE TlHgAs3S6 M
VRBAITE Tl4Hg3Sb2As8S20 O
EDENHARTERITE TlPbAs3S6 O
JENTSCHITE TlPbAs2SbS6 M
HUTCHINSONITE (Pb,Tl)2As5S9 O
LORANDITE TlAsS2 M
WEISSBERGITE TlSbS2 A
TVALCHRELIDZEITE Hg3SbAsS3 A
VAUGHANITE TlHgSb4S7 A
REBULITE Tl5Sb5As8S22 M
JANKOVICITE Tl5Sb9(As,Sb)4S22 A
PHILROTHITE TlAs3S5 M
IMHOFITE Tl6CuAs16S40 M
BERNARDITE Tl(As,Sb)5S8 M
GILLULYITE Tl2(As,Sb)8S13 M
PIERROTITE Tl2Sb6As4S16 O
PARAPIERROTITE Tl(Sb,As)5S8 M
DALNEGROITE Tl5-xPb2x(As,Sb)21-xS34 A
CHABOURNEITE (Tl,Pb)23(Sb,As)91S147 A
PROTOCHABOURNEITE Tl3,5Pb3(Sb,As)19,5S34 (x about 1,2-1,5) A
BOSCARDINITE (Tl,Ag)Pb4Sb7As2S18 A
GABRIELITE Tl2AgCu2As3S7 A ps H
2/E.15- Pb Sulfosalts with As/Sb (S:As,Sb,Bi = 3,8-3,1)
JORDANITE Pb14(As,Sb)6S23 M
GEOCRONITE Pb14(Sb,As)6S23 M
GRATONITE Pb9As4S15 R
MENEGHINITE Pb13CuSb7S24 O
TSUGARUITE Pb4As2S7 O
LENGENBACHITE Pb6(Ag,Cu)2As4S13 A
2/E.16 to 18 Pb Sulfosalts with As/Sb (S:As,Sb,Bi = 3,0-2,5)
SELIGMANNITE PbCuAsS3 O
BOURNONITE PbCuSbS3 O
MARRITE PbAgAsS3 M
FREIESLEBENITE AgPbSbS3 M
DIAPHORITE Pb2Ag3Sb3S8 M
ZOUBEKITE AgPb4Sb4S10 O
OWYHEEITE Pb7Ag2(Sb,Bi)8S20 O
DUFRENOYSITE Pb2As2S5 M
VEENITE Pb2(Sb,As)2S5 O
2/E.19 to 21 Pb Sulfosalts with Sb (S:As,Sb,Bi = 3,0-1,9)
FALKMANITE Pb5Sb4S11 M
ARDAITE Pb19Sb13S35Cl7 M
BOULANGERITE Pb5Sb4S11 M
MOELOITE Pb6Sb6S14(S3) O
PILLAITE Pb9Sb10S23ClO0,5 M
JASKOLSKIITE Pb2+xCux(Sb,Bi)2-xS5 (x=0,2) O
MADOCITE Pb17(Sb,As)16S41 O
LAUNAYITE Pb22Sb26S61 M
MEERSCHAUTITE Pb42(Ag,Cu)6(Sb,As)45S112 M
PELLOUXITE (Cu,Ag)2Pb21Sb23S55OCl M
STERRYITE Ag2Pb10(Sb,As)12S29 O
PARASTERRYITE Pb20Ag4(Sb,As)24S58 M
PLAYFAIRITE Pb16Sb18S43 M
SORBYITE Pb19(Sb,As)20S49 M
DISULFODADSONITE Pb11Sb13S30(S2)0,5 A
DADSONITE Pb23Sb25S60Cl A ps M
RAYITE (Ag,Tl)2Pb8Sb8S21 M
SEMSEYITE Pb9Sb8S21 M
CHOVANITE Pb14,6Sb14,4S36O0,2 M
HETEROMORPHITE Pb7Sb8S19 M
PLAGIONITE Pb5Sb8S17 M
FULOPPITE Pb3Sb8S15 M
2/E.22 to 23 Pb-Fe/Mn, Pb-Ag Sulfosalts with Sb (S:As,Sb,Bi = 2,3-2,0)
JAMESONITE Pb4FeSb6S14 M
BENAVIDESITE Pb4(Mn,Fe)Sb6S14 M
UCHUCCHACUAITE AgPb3MnSb5S12 M ps O
FIZELYITE Pb14Ag5Sb21S48 (?) M
MENCHETTIITE Pb5Ag2Mn3As4Sb6S24 M
RAMDOHRITE CdAg5,5Pb12Sb21,5S48 M
ANDORITE IV Jamesonite series M
ANDORITE VI PbAgSb3S6 O
ARSENQUATRANDORITE Ag17,6Pb12,8Sb38,1As11,5S96 M
ROSHCHINITE Ag19Pb10Sb51S96 or Pb(Ag,Cu)2(Sb,As)5S10 O
2/E.24 to 27 Pb Sulfosalts with As/Sb (S:As,Sb,Bi = 2,3-1,8)
BAUMHAUERITE Pb3As4S9 A
ARGENTOBAUMHAUERITE Ag1,5Pb22As33,5S72 A
ROBINSONITE Pb4Sb6S13 A
MARUMOITE Pb8As10S23 M ps O
LIVEINGITE Pb9As13S28 M
RATHITE (Pb,Tl)3As5S10 M
CARDUCCIITE Pb6Ag(As,Sb)9S20 M
BARIKAITE Pb10Ag3As11Sb8S40 M
SARTORITE PbAs2S4 M
GUETTARDITE Pb(Sb,As)2S4 M
TWINNITE Pb(Sb,As)2S4 O
TUBULITE Ag2Pb22Sb20S53 M
ZINKENITE Pb9Sb22S42 H
SCAINIITE Pb14Sb30S54O5 M
KIRKIITE Pb10Bi3As3S19 O/M
TAZIEFFITE Pb20Cd2(As,Bi)22S50Cl10 M
VURROITE Pb10Sn(Bi,As)11S27Cl3 ps O
TAZIEFFITE Pb10Cd(As,Bi)11S25Cl5 M
MUTNOVSKITE Pb2AsS3(I,Cl,Br) O
2/E.28 to 35 Pb Sulfosalts with Bi (S:As,Sb,Bi = 6,0-1,6)
MIHARAITE PbCu4FeBiS6 O
ANGELAITE Cu2AgPbBiS4 M
ASCHAMALMITE Pb6Bi2S9 M
HEYROVSKYITE Pb10AgBi5S18 O
AIKINITE PbCuBiS3 O
SOUCEKITE PbCuBi(S,Se)3 O
FRIEDRICHITE Pb5Cu5Bi7S18 O
HAMMARITE Pb2Cu2Bi4S9 (?) O
PAARITE Cu1,7Pb1,7Bi6,3S12 O
SALZBURGITE Cu1,6Pb1,6Bi6,4S12 O
EMILITE Cu2,68Pb2,68Bi5,32S12 O
LINDSTROMITE Cu3Pb3Bi7S15 O
KUDRIAVITE (Cd,Pb)Bi2S4 M
KRUPKAITE PbCuBi3S6 O
GLADITE CuPbBi5S9 O
PEKOITE PbCuBi11(S,Se)18 O
XILINGOLITE Pb3Bi2S6 M
LILLIANITE Pb3Bi2S6 O
OURAYITE Ag3Pb4Bi5S13 O
OURAYITE-P (?) (P-OURAYITE) Pb14Ag18Bi28S65 (?) O
ESKIMOITE Ag7Pb10Bi15S36 M
VIKINGITE Ag5Pb8Bi13S30 M
SCHIRMERITE Ag3Pb3-6Bi7-9S18 O
TREASURITE Ag7Pb6Bi15S32 M
TERRYWALLACEITE AgPb(Sb,Bi)3S6 M
GUSTAVITE PbAgBi3S6 (?) O
NEYITE Pb7(Cu,Ag)2Bi6S17 M
CUPRONEYITE Cu7Pb27Bi25S68 M
IZOKLAKEITE Pb27(Cu,Fe)2(Sb,Bi)19S57 O
GIESSENITE 2(Cu2Pb26(Bi,Sb)20S57) M
DALIRANITE PbHgAs2S6 M
MARRUCCIITE Pb16Hg3Sb18S46 M ps H
TINTINAITE Pb22Cu+4(Sb,Bi)30S69 O
KOBELLITE Pb22Cu4(Bi,Sb)30S69 O
ROUXELITE Cu2HgPb22Sb28S64(O,S)2 M
ECLARITE Pb9(Cu,Fe)Bi12S28 O
NUFFIELDITE Pb2Cu(Pb,Bi)Bi2S7 O
BERRYITE Cu3Ag2Pb3Bi7S16 M
GALENOBISMUTITE PbBi2S4 O
MOZGOVAITE PbBi4(S,Se)7 O
COSALITE Pb2Bi2S5 O
PROUDITE (Pb,Cu)8Bi9-10(S,Se)22 M
WEIBULLITE (Pb,Ag)6Bi8(S,Se)18 O
CANNIZZARITE Pb4Bi5S11 M
WITTITE Pb3Bi4(S,Se)9 M
NORDSTROMITE Pb3CuBi7(S10Se4) M
JUNOITE Pb3Cu2Bi8(S,Se)16 M
FELBERTALITE Cu2(Pb,Ag)6Bi8S19 M
WATKINSONITE Cu2PbBi4Se8 M
LITOCHLEBITE PbAg2Bi4Se8 M
PADERAITE AgPb2Cu6Bi11S22 M
USTARASITE Pb(Bi,Sb)6S10 O (?)
2/F.01- Sulfides with non-metallic characteristics
PATRONITE VS4 M
2/F.02 to 03 As sulfides
DURANUSITE As4S O
DIMORPHITE As4S3 O
BONAZZIITE As4S4 M
REALGAR AsS M
PARAREALGAR AsS M
ALACRANITE As8S9 M
UZONITE As4S5 M
ANORPIMENT As2S3 A
ORPIMENT As2S3 M
LAPHAMITE As2(Se,S)3 M
GETCHELLITE AsSbS3 M
WAKABAYASHILITE As4(As,Sb)6S14 M
2/F.04 to 10 Alcali sulfides
ROHAITE Tl2Cu8,5Sb2S4 O
CHALCOTHALLITE (Tl,K)2Cu5,5(Fe,Ag)SbS4 O ps Q
COLIMAITE K3VS4 O
MURUNSKITE K2Cu3FeS4 Q
BUKOVITE Tl2Cu3FeSe4 Q
THALCUSITE TlCu3FeS4 Q
CHVILEVAITE Na(Cu,Fe,Zn)2S2 H
DJERFISHERITE K6(Cu,Fe,Ni)24S26Cl C
THALFENISITE (Tl,K)6Na(Fe,Ni,Cu)25S26Cl C
OWENSITE (Ba,Pb)6(Cu,Fe,Ni)25S27 C
RASVUMITE KFe2S3 O
PAUTOVITE CsFe2S3 O
BARTONITE K3Fe10S14 Q
CHLORBARTONITE K6Fe24S26(Cl,S) Q
CASWELLSILVERITE NaCrS2 R
SCHOLLHORNITE Na0,3CrS2.H2O R
CRONUSITE Ca0,2(H2O)2CrS2 R
ERDITE NaFeS2.2H2O M
COYOTEITE NaFe3S5.2H2O A
GERSTLEYITE Na2(Sb,As)8S13.2H2O M
AMBRINOITE (K,NH4)2(As,Sb)8S13.H2O A
2/F.11 to 12 Oxysulfides, Hydroxysulfides
KERMESITE Sb2S2O A ps M
SARABAUITE CaSb10O10S6 M
OTTENSITE Na3(Sb2O3)3(SbS3).3H2O H
CETINEITE (K,Na)3-3,5(Sb2O3)(SbS3)(OH)x.2,5-3H2O (x = less than 0,5) H
VIAENEITE (Fe,Pb)4S8O M
BAZHENOVITE CaS5.CaS2O3.6Ca(OH)2.20H2O M
2/F.13 to 15 Halogensulfides/Sulfohalides with Hg/Pb and related compounds
CAPGARONNITE HgSAg(Cl,Br,I) O
PERROUDITE Hg5Ag4S5(I,Br)2Cl2 O
ILTISITE HgSAg(Cl,Br) H
KENHSUITE gamma-Hg3S2Cl2 O
CORDEROITE Hg3S2Cl2 C
GRECHISHCHEVITE Hg3S2(Br,Cl,I)2 Q
RADTKEITE Hg3S2ClI O
LAVRENTIEVITE Hg3S2(Cl,Br)2 M/A
ARZAKITE Hg3S2(Br,Cl)2 M/A
KOLARITE PbTeCl2 O
RADHAKRISHNAITE PbTe3(Cl,S)2 Q
DEMICHELEITE-(Cl) BiS(Cl,Br)5 O ps Q
DEMICHELEITE-(Br) BiS(Br,Cl)5 O ps Q
DEMICHELEITE-(I) BiS(I,Br)5 O ps Q

Class III - Halides (Fluorides, Chlorides, Bromides, Iodides)

Mineral Formula System
3/A. Simple halides
3/A.01 to 05 Anhydrous halides (M:H = 1:1)
NANTOKITE CuCl C
MARSHITE CuI C
MIERSITE (Ag,Cu)I C
GRICEITE LiF C
VILLIAUMITE NaF C
CAROBBIITE KF C
HALITE NaCl C
SYLVITE KCl C
CHLORARGYRITE AgCl C
BROMARGYRITE AgBr C
IODARGYRITE AgI H
TOCORNALITE (?) (Ag,Hg)I (?) (?)
SALAMMONIAC NH4Cl C
LAFOSSAITE Tl(Cl,Br) C
CALOMEL Hg2Cl2 Q
KUZMINITE Hg2(Br,Cl)2 Q
MOSCHELITE Hg+2I2 Q
3/A.06 to 11 Anhydrous halides (M:H = 1:2, 1:3)
SELLAITE MgF2 Q
CHLOROMAGNESITE MgCl2 Q
LAWRENCITE (Fe++,Ni)Cl2 R
SCACCHITE MnCl2 R
TOLBACHITE CuCl2 M
FLUORITE CaF2 C
STRONTIOFLUORITE (Sr,Ca)F2 C
FRANKDICKSONITE BaF2 C
FLUOROCRONITE PbF2 C
HALENIUSITE-(La) (La,Ce)OF C
TVEITITE-(Y) Ca1-xYxF2+x M ps C
GAGARINITE-(Y) NaCaY(F,Cl)6 H
GAGARINITE-(Ce) NaCaCeF6 R
POLEZHAEVAITE-(Ce) NaSrCeF6 H
LAURELITE Pb7F12Cl2 H
CHLOROCALCITE KCaCl3 O ps C
OSKARSSONITE AlF3 R
MOLYSITE Fe+++Cl3 H
FLUOCERITE-(La) (La,Ce)F3 H
FLUOCERITE-(Ce) (Ce,La)F3 H
GANANITE BiF3 C
3/A.12 to 13 Hydrous halides (M:H = 1:1 to 1:3)
HYDROHALITE NaCl.2H2O M
ERIOCHALCITE CuCl2.2H2O O
BISCHOFITE MgCl2.6H2O M
NICKELBISCHOFITE NiCl2.6H2O M
ROKUHNITE Fe++Cl2.H2O M
SINJARITE CaCl2.2H2O Q
ANTARCTICITE CaCl2.6H2O R
LESUKITE (Al,Fe+++)2(OH)5Cl.2H2O C
CADWALADERITE Al(OH)2Cl.4H2O am.
CHLORALUMINITE AlCl3.6H2O R
HYDROMOLYSITE (?) FeCl3.6H2O (?) (?)
3/B. Anhydrous double halides
3/B.01 to 03 Anhydrous double halides with [BF4]-, [SiF6]--, [AlF6]---
FERRUCCITE NaBF4 O
AVOGADRITE (K,Cs)BF4 O
BARBERIITE (NH4)BF4 O
KNASIBFITE K3Na4BF4(SiF6)3 O
MALLADRITE Na2SiF6 R
HEKLAITE KNaSiF6 O
HIERATITE K2SiF6 C
DEMARTINITE K2SiF6 H
CRYPTOHALITE (NH4)2SiF6 C
BARARITE (NH4)2SiF6 H
CRYOLITHIONITE {Na3}[Al2](Li3)F12 C
COLQUIRIITE CaLiAlF6 R
SIMMONSITE Na2LiAlF6 M (?)
CRYOLITE Na3AlF6 M
ELPASOLITE K2NaAlF6 C
COULSELLITE CaNa3AlMg3F14 R ps C
BOGVADITE Na2SrBa2Al4F20 O
JORGENSENITE Na2(Sr,Ba)14Na2Al12F64(OH,F)4 M
JARLITE Na(Sr,Na)7MgAl6F32(OH,H2O)2 M
CALCJARLITE Na(Ca,Sr)3Al3(F,OH)16 M
3/C. Hydrous double halides
3/C.01 to 05 Fluorides
LEONARDSENITE MgAlF5(H2O)2 M
JAKOBSSONITE CaAlF5 M
GEARKSUTITE CaAlF4(OH).H2O M
ACUMINITE SrAlF4(OH).H2O M
TIKHONENKOVITE SrAlF4(OH).H2O M
ARTROEITE PbAlF3(OH)2 A
CREEDITE Ca3Al2(SO4)(F,OH)10.2H2O M
CHUKHROVITE-(Ca) Ca4,5Al2(SO4)F13.12H2O C
CHUKHROVITE-(Y) Ca3(Y,Ce)Al2(SO4)F13.10H2O C
CHUKHROVITE-(Ce) Ca3(Ce,Y)Al2(SO4)F13.10H2O C
CHUKHROVITE-(Nd) Ca3(Nd,Y)Al2(SO4)F13.12H2O C
MENIAYLOVITE Ca4AlSi(SO4)F13.12H2O C
PACHNOLITE NaCaAlF6.H2O M
THOMSENOLITE NaCaAlF6.H2O M
YAROSLAVITE Ca3Al2F10(OH)2.H2O O
PROSOPITE CaAl2(F,OH)8 M
CHIOLITE Na5Al3F14 Q
WEBERITE Na2MgAlF7 O
USOVITE Ba2CaMgAl2F14 M
KARASUGITE SrCaAl(F,OH)7 M
CARLHINTZEITE Ca2AlF7.H2O A ps M
ROSENBERGITE AlF3.3H2O Q
RALSTONITE NaxMgxAl2-x(F,OH)6.H2O C
NEIGHBORITE NaMgF3 O
ARAVAIPAITE Pb3AlF9.H2O M
CALCIOARAVAIPAITE PbCa2AlF6(F,OH)3 A
STENONITE (Sr,Ba,Na)2Al(CO3)F5 M
BOGGILDITE Sr2Na2Al2(PO4)F9 M
3/C.06 to 08 Chlorides
RINNEITE K3NaFe++Cl6 R
CHLORMANGANOKALITE K4MnCl6 R
MITSCHERLICHITE K2CuCl4.2H2O Q
DOUGLASITE K2Fe++Cl4.2H2O M
ERYTHROSIDERITE K2Fe+++Cl5.H2O O
KREMERSITE (NH4,K)2Fe+++Cl5.H2O O
CARNALLITE KMgCl3.6H2O O
KOENENITE Na4Mg9Al4Cl12(OH)22 R
TACHYHYDRITE CaMg2Cl6.12H2O R
3/D. Oxyhalides, hydroxyhalides
3/D.01 to 05 Oxyhalides with Mg, Mn, Cu, Zn, Sn
KORSHUNOVSKITE Mg2Cl(OH)3.3,5-4H2O A
NEPSKOEITE Mg4(OH)7Cl.6H2O O
HIBBINGITE (Fe,Mg)2(OH)3Cl O
KEMPITE Mn2Cl(OH)3 O
BELLOITE Cu(OH)Cl M
ATACAMITE Cu2Cl(OH)3 O
CLINOATACAMITE Cu++2Cl(OH)3 M
BOTALLACKITE Cu2Cl(OH)3 M
IYOITE MnCuCl(OH)3 M
HAYDEEITE Cu3MgCl2(OH)6 R
GILLARDITE Cu3NiCl2(OH)6 R
LEVERETTITE Cu3(Co,Cu)(OH)6Cl2 R
PARATACAMITE-(Mg) Cu3(Mg,Cu)(OH)6Cl2 R
PARATACAMITE-(Ni) Cu3(Ni,Cu)(OH)6Cl2 R
PARATACAMITE Cu3(Cu,Zn)(OH)6Cl2 R
TONDIITE Cu3MgCl2(OH)6 R
HERBERTSMITHITE Cu3Zn(OH)6Cl2 R
KAPELLASITE Cu3Zn(OH)6Cl2 R
MISAKIITE Cu3Mn(OH)6Cl2 R
MELANOTHALLITE Cu2OCl2 O
CALUMETITE Cu(OH,Cl)2.2H2O O
ANTHONYITE Cu(OH,Cl)2.3H2O M
BOBKINGITE Cu++5Cl2(OH)8.2H2O M
FLINTEITE K2ZnCl4 O
MELLINZINKALITE K3Zn2Cl7 A
PONOMAREVITE K4Cu++4OCl10 M
AVDONINITE K2Cu5(OH)4Cl8.H2O M
BARLOWITE Cu4BrF(OH)6 H
CLARINGBULLITE Cu4(OH)6FCl H
THERMESSAITE-(NH4) (NH4)2AlF3(SO4) O
THERMESSAITE K2Al(SO4)F3 O
SIMONKOLLEITE Zn5(OH)8Cl2.H2O H
THERESEMAGNANITE Na(Co,Zn,Ni)6(SO4)(OH)6Cl.6H2O H
GORDAITE NaZn4Cl(OH)6(SO4).6H2O R
CHRYSOTHALLITE K6Cu6Tl+++Cl17(OH)4.H2O Q
BUTTGENBACHITE Cu19Cl4(NO3)2(OH)32.2H2O H
CONNELLITE Cu19Cl4(SO4)(OH)32.2H2O H
AMMINEITE Cu(NH3)2Cl2 O
KHAIDARKANITE Cu4Al3(OH)14F3.2H2O M
ZHARCHIKHITE AlF(OH)2 M
ZIRKLERITE (Fe++,Mg)9Al4Cl18(OH)12.14H2O (?) R
ABHURITE Sn++21Cl16(OH)14O6 R
PANICHIITE (NH4)2Sn++++Cl6 C
3/D.06 to 07 Oxyhalides with Hg
TERLINGUAITE Hg+Hg++ClO M
AURIVILLIUSITE Hg+2Hg++2I2O2 O
HANAWALTITE Hg+6Hg++(Cl,OH)2O3 O
TEDHADLEYITE Hg+10Hg++I2(Cl,Br)2O4 A
TERLINGUACREEKITE Hg++3O2Cl2 O
PINCHITE Hg++5O4Cl2 O
POYARKOVITE Hg3ClO M
KADYRELITE Hg4(Br,Cl)2O C
EGLESTONITE Hg+6Cl3O(OH) (?) C
VASILYEVITE Hg++2I3Br2Cl(CO3)O6 A
MOSESITE Hg2N(Cl,SO4,MoO4,CO3).H2O C
GIANELLAITE Hg4(SO4)N2 C
KLEINITE Hg2N(Cl,SO4).nH2O H
COMANCHEITE Hg++55N---24(NH2,OH)4(Cl,Br)34 O
KELYANITE [Hg2]6(SbO)6BrCl2 R
3/D.08 to 10 Oxyhalides with Pb, Bi, Sb and related compounds
3/D.08 Cotunnite series
COTUNNITE PbCl2 O
PARALAURIONITE PbCl(OH) M
LAURIONITE PbCl(OH) O
FIEDLERITE (-2M1) Pb3Cl4F(OH).H2O M
CHALLACOLLOITE KPb2Cl5 M
PSEUDOCOTUNNITE K2PbCl4 (?) O (?)
BRONTESITE (NH4)3PbCl5 O
HEPHAISTOSITE (Tl,K)Pb2(Cl,Br)5 M
STEROPESITE Tl3Bi(Cl,Br)6 M
3/D.09 Matlockite series
RORISITE (Ca,Mg)FCl Q
ZHANGPEISHANITE BaFCl Q
MATLOCKITE PbFCl Q
ZAVARITSKITE BiOF Q
BISMOCLITE BiOCl Q
DAUBREEITE BiO(OH,Cl) Q
ARGESITE (NH)4Bi3Cl16 R ps H
3/D.10 Nadorite series
SEELIGERITE Pb3I+++++O4Cl3 O
SCHWARTZEMBERGITE Pb++5I+++O6H2Cl3 Q
NADORITE PbSbO2Cl O
PERITE PbBiO2Cl O
MENDIPITE Pb3Cl2O2 O
DAMARAITE Pb3O2(OH)Cl O
BLIXITE Pb2Cl(O,OH)2 M
RUMSEYITE [Pb2OF]Cl Q ps C
PENFIELDITE Pb2Cl3(OH) H
TELLUROPERITE Pb3(Te++++O4)Cl2 O
THORIKOSITE Pb3(Sb+++,As+++)O3(OH)Cl2 Q
ECDEMITE Pb6As+++2O7Cl4 Q
HELIOPHYLLITE Pb6As2O7Cl4 (?) O
VLADKRIVOVICHEVITE [Pb32O18][Pb4Mn2O]Cl14(BO3)8.2H2O O
MEREHEADITE Pb47(BO3)2(CO3)O24(OH)13Cl25 M
RICKTURNERITE Pb7O4[Mg(OH)4](OH)Cl3 O
PHILOLITHITE Pb12O6Mn(Mg,Mn++)2(Mn,Mg)4(SO4)(CO3)4Cl4(OH)12 Q
SUNDIUSITE Pb10(SO4)O8Cl2 M
SYMESITE Pb10(SO4)O7Cl4.H2O A ps Q
PARKINSONITE (Pb,Mo)O8Cl2 Q
PINALITE Pb3WO5Cl2 O
SAHLINITE Pb14(AsO4)2O9Cl4 M
KOMBATITE Pb14(VO4)2O9Cl4 M
ASISITE Pb9(SiO4)O6Cl2 Q
HEREROITE [Pb32(O,[])21](AsO4)2[(Si,As,V,Mo]O4)2Cl10 M
ONORATOITE Sb8O11Cl2 M
BIDEAUXITE Pb++2Ag+Cl3F(OH) C
BOLEITE KPb26Ag9Cu24Cl62(OH)48 C
PSEUDOBOLEITE Pb5Cu4Cl10(OH)8.2H2O Q
CUMENGEITE Pb21Cu20Cl42(OH)40.6H2O Q
DIABOLEITE Pb2CuCl2(OH)4 Q
CHLOROXIPHITE Pb3CuCl2(OH)2O2 M
HEMATOPHANITE Pb4Fe+++3O8(OH,Cl) Q
YEDLINITE Pb6CrCl6(O,OH)8 R

Class IV - Oxides, hydroxides

Mineral Formula System
4/A. Oxides M:O = 2:1 and 1:1 [M2O], [MO]
ICE H2O H
CUPRITE Cu2O C
BROMELLITE BeO H
ZINCITE (Zn,Mn)O H
4/A.04- Periclase group
PERICLASE MgO C
WUSTITE Fe++O C
HONGQUIITE (?) TiO (?) C
BUNSENITE NiO C
MANGANOSITE Mn++O C
MONTEPONITE CdO C
LIME CaO C
MURDOCHITE PbCu++6O8-x(Cl,Br)2x (x smaller or = 0,5) C
TENORITE CuO M
PARAMELACONITE Cu+2Cu++2O3 Q
DELAFOSSITE Cu+Fe+++O2 R
MCCONNELLITE CuCrO2 R
CREDNERITE CuMnO2 M
MONTROYDITE HgO O
LITHARGE PbO Q
MASSICOT PbO O
BROWNMILLERITE Ca2(Al,Fe+++)2O5 O
SREBRODOLSKITE Ca2Fe+++2O5 O
SHULAMITITE Ca3Fe+++AlTi++++O8 O
FLUORMAYENITE Ca12Al14O32F2 C
CHLORMAYENITE Ca12Al14O32Cl2 C
FLUORKYUYGENITE Ca12Al14O32[(H2O)4F2] C
CHLORKYUYGENITE Ca12Al14O32[(H2O)4Cl2] C
BITIKLEITE {Ca3}[Sb+++++Sn++++](Al3)O12 C
DZHULUITE {Ca3}[Sb+++++Sn++++](Fe+++3)O12 C
USTURITE {Ca3}[Sb+++++Zr](Fe+++3)O12 C
ELBRUSITE {Ca3}[U+++++0,5Zr1,5](Fe+++3)O12 C
ROMARCHITE SnO Q
HYDROROMARCHITE Sn3O2(OH)2 Q
4/B. Oxides M:O = 3:4 [M3O4], spinel type and related compounds
4/B.01 to 04 Spinel group
SPINEL MgAl2O4 C
HERCYNITE Fe++Al2O4 C
GALAXITE (Mn++,Fe++,Mg)(Al,Fe+++)2O4 C
GAHNITE ZnAl2O4 C
4/B.01- Aluminate spinel subgroup
4/B.02- Ferrite spinel subgroup
MAGNESIOFERRITE MgFe+++2O4 C
MAGNETITE Fe++Fe+++2O4 C
XIEITE FeCr2O4 O
JACOBSITE (Mn++,Fe++,Mg)(Fe+++,Mn+++)2O4 C
TREVORITE NiFe+++2O4 C
CUPROSPINEL (Cu++,Mg)Fe+++2O4 C
FRANKLINITE (Zn,Mn++,Fe++)(Fe+++,Mn+++)2O4 C
4/B.03- Chromite spinel subgroup
MAGNESIOCHROMITE MgCr2O4 C
CHROMITE Fe++Cr2O4 C
MANGANOCHROMITE (Mn++,Fe++)(Cr+++,V+++)2O4 C
COCHROMITE (Co,Ni,Fe++)(Cr,Al)2O4 C
NICHROMITE (Ni,Co,Fe++)(Cr+++,Fe+++,Al)2O4 C
ZINCOCHROMITE ZnCr2O4 C
4/B.04- V/Ti/Ge spinel subgroup
MAGNESIOCOULSONITE MgV2O4 C
VUORELAINENITE (Mn++,Fe++)(V+++,Cr+++)2O4 C
COULSONITE Fe++V+++2O4 C
QANDILITE (Mg,Fe++)2(Ti,Fe+++,Al)O4 C
ULVOSPINEL Fe++2Ti++++O4 C
BRUNOGEIERITE Fe++2Ge++++O4 C
HAUSMANNITE Mn++Mn+++2O4 Q
IWAKIITE Mn++(Fe+++,Mn+++)2O4 Q
DONATHITE (?) (Fe++,Mg)(Cr,Fe+++)2O4 Q
HETAEROLITE ZnMn+++2O4 Q
HYDROHETAEROLITE Zn2Mn+++4O8.H2O Q
HARMUNITE CaFe+++2O4 O
MAROKITE CaMn+++2O4 O
WERNERKRAUSEITE Ca(Fe+++,Mn+++)2Mn++++O6 O
TEGENGRENITE (Mg,Mn++)2Sb+++++0,5(Mn+++,Si,Ti)0,5O4 R ps C
FILIPSTADITE (Mn,Mg)2Sb+++++Fe+++O8 O
KUSACHIITE CuBi2O4 Q
SCHAFARZIKITE Fe++Sb+++2O4 Q
VERSILIAITE Fe2Fe4Sb6O16S O
APUANITE Fe++Fe+++4Sb+++4O12S Q
MINIUM Pb++2Pb++++O4 Q
CHRYSOBERYL BeAl2O4 O
MARIINSKITE BeCr2O4 O
MAGNESIOTAAFFEITE-2N'2S Mg3Al8BeO16 H
MAGNESIOTAAFFEITE-6N'3S Mg2Al6BeO12 R
FERROTAAFFEITE-6N'3S (Fe++,Zn,Mg)2Al6BeO12 R
SWEDENBORGITE NaBe4SbO7 H
KUDRYAVTSEVAITE Na3MgFe+++Ti4O12 O
DMITRYIVANOVITE CaAl2O4 M
KROTITE CaAl2O4 M
GROSSITE CaAl4O7 M
TASHELGITE CaMgFe+++Al9O16(OH) M ps O
4/C. Oxides M:O = 2:3 [M2O3] and related compounds
CLAUDETITE As2O3 M
STIBIOCLAUDETITE AsSbO3 M
VALENTINITE Sb2O3 O
AUROANTIMONATE AuSbO3  
ARSENOLITE As2O3 C
SENARMONTITE Sb2O3 C
BISMITE Bi2O3 M
SPHAEROBISMOITE Bi2O3 Q
SILLENITE Bi+++12(SiO4)O16 C
CHROMBISMITE Bi+++16(CrO4)O23 Q
DUKEITE Bi+++24Cr++++++8O57(OH)6.3H2O R
KANGITE (Sc,Ti,Al,Zr,Mg,Ca,[])2O3 C
BIXBYITE (Mn+++,Fe+++)2O3 C
AVICENNITE Tl2O3 C
YTTRIAITE-(Y) Y2O3 C
PANGUITE (Ti++++,Sc,Al,Mg,Zr,Ca)1,8O3 O
4/C.04- Hematite group
CORUNDUM Al2O3 R
HEMATITE alpha-Fe2O3 R
LUOGUFENGITE epsilon-Fe2O3 O
ESKOLAITE Cr2O3 R
KARELIANITE V2O3 R
TISTARITE Ti2O3 R
4/C.05- Ilmenite group
AKIMOTOITE (Mg,Fe++)(SiO3) R
GEIKIELITE MgTiO3 R
ILMENITE Fe++TiO3 R
PYROPHANITE MnTiO3 R
ECANDREWSITE (Zn,Fe++,Mn++)TiO3 R
MELANOSTIBITE Mn(Sb+++++,Fe+++)O3 R
BRIZZIITE NaSb+++++O3 R
MAGHEMITE gamma-Fe+++2O3  
MAGNESIOHOGBOMITE-2N2S Ti(Mg,Fe)2Al8O15(OH) H
MAGNESIOHOGBOMITE-6N6S Ti(Mg,Fe)2Al8O15(OH) R
MAGNESIOHOGBOMITE-2N3S Ti(Mg,Fe)3Al10O19(OH) R
ZINCOHOGBOMITE-2N2S (Zn,Fe,Ti,Al)22(O,OH)32 H
ZINCOHOGBOMITE-2N6S Ti(Zn,Mg,Fe)6Al16O31(OH) H
FERROHOGBOMITE-2N2S (Fe++,Zn,Mg)3(Al,Fe+++,Ti++++)8O15(OH) H
FREUDENBERGITE Na2(Ti,Fe)8O16 M ps H
KAMIOKITE Fe2Mo3O8 H
NOLANITE (V+++,Fe++,Fe+++,Ti)10O14(OH)2 H
RINMANITE (Zn,Mn++)2Sb+++++2Mg2Fe+++4O14(OH)2 H
MAGNESIONIGERITE-2N1S (Mg,Fe++)4(Al10Sn2)[]12O22(OH)2 R
MAGNESIONIGERITE-6N6S (Mg,Fe++)18(Al42Sn6)[]48O90(OH)6 R
FERRONIGERITE-2N1S (Fe,Mg)4(Al10Sn2)O22(OH)2 R
FERRONIGERITE-6N6S (Fe,Mg)18(Al42Sn6)O90(OH)6 R
MENGXIANMINITE (?) (Ca,Na)3(Fe++,Mn++)2Mg2(Sn++++,Zn)5Al8O29 (?) O
DIAOYUDAOITE NaAl11O17 H
YIMENGITE K(Cr+++,Ti,Fe+++,Mg)12O19 H
HAWTHORNEITE Ba[Ti3Cr4Fe++2Fe+++2Mg]O19 H
HAGGERTYITE (Ba,K)(Mg,Cr+++)Fe++4Fe+++2Ti++++5O19 H
BATIFERRITE Ba[Ti2Fe+++8Fe++2]O19 H
HIBONITE (Ca,Ce)(Al,Ti,Mg)12O19 H
HIBONITE-(Fe) (Fe++,Mg)Al12O19 H
NEZILOVITE PbZn2(Mn++++,Ti++++)2Fe+++8O19 H
MAGNETOPLUMBITE Pb(Fe+++,Mn+++)12O19 H
ZENZENITE Pb3(Fe+++,Mn+++)4Mn++++3O15 H
LINDQVISTITE Pb2(Mn++,Mg)Fe+++16O27 H
PLUMBOFERRITE Pb2(Mn++,Mg)0,33Fe+++0,67O18,33 H
BARIOFERRITE BaFe+++12O19 H
BARTELKEITE PbFeGe3O7(OH)2.H2O M
OTJISUMEITE PbGe4O9 A ps H
4/C.09- Crichtonite group
LANDAUITE NaMn++Zn2(Ti,Fe+++)6Ti12O38 M ps R
MATHIASITE (K,Ca,Sr)(Ti,Cr,Fe,Mg)21O38 R
LOVERINGITE (Ca,Ce)(Ti,Fe+++,Cr,Mg)21O38 R
CRICHTONITE (Sr,La,Ce,Y)(Ti,Fe+++,Mn)21O38 R
DESSAUITE (Sr,Pb)(Y,U)(Ti,Fe+++)20O38 R ps H
MAPIQUIROITE (Sr,Pb)(U,Y)Fe2(Ti,Fe+++,Cr+++)18O38 R
LINDSLEYITE (Ba,Sr)(Ti,Cr,Fe,Mg,Zr)21O38 R
ALMEIDAITE PbZn2(Mn,Y)(Ti,Fe+++)18O37(OH,O) R
PASEROITE PbMn++(Fe+++,[])2(V+++++,Ti,[])18O38 R
SENAITE Pb(Ti,Fe,Mn)21O38 R
GRAMACCIOLIITE-(Y) (Pb,Sr)(Y,Mn)(Ti,Fe+++)18Fe+++2O38 R ps H
CLEUSONITE (Pb,Sr)(U++++,U++++++)(Fe+++,Zn)2(Ti,Fe++,Fe+++)18(O,OH)38 R
DAVIDITE-(Y) (?) (Y,Ce,La)2Fe+++2(Ti,Fe+++)18O38 (?) R
DAVIDITE-(La) (La,Ce)(Y,U,Fe++)(Ti,Fe+++)20(O,OH)38 R
DAVIDITE-(Ce) (Ce,La)(Y,U,Fe++)(Ti,Fe+++)20(O,OH)38 R
4/C.10- Perovskite group
PEROVSKITE CaTiO3 O ps C
MEGAWITE Ca(Sn,Zr)O3 O ps C
LAKARGIITE Ca(Zr,Ti,Sn)O3 O ps C
LATRAPPITE Ca2NbFe+++O6 O
BARIOPEROVSKITE BaTiO3 O
TAUSONITE SrTiO3 C
LOPARITE-(Ce) (Na,Ce,Ca)(Ti,Nb)O3 Q/O ps Q
ISOLUESHITE (Na,La,Ca)(Nb,Ti)O3 C
PAULOABIBITE NaNbO3 R
LUESHITE NaNbO3 M ps C
NATRONIOBITE NaNbO3 M
MACEDONITE PbTiO3 Q
4/C.11 to 20 Pyrochlore group
HYDROXYCALCIOBETAFITE (Ca,Na,U)2(Ti,Nb,Ta)2O6(OH) C
OXYCALCIOBETAFITE Ca2(Ti,Nb)2O6O C
OXYURANOBETAFITE (U,Ca,[])2(Ti,Nb)2O6O C
OXYPLUMBOBETAFITE Pb2(Ti,Nb)2O6O C
4/C.11- Betafite subgroup
4/C.12- Pyrochlore subgroup
HYDROXYMANGANOPYROCHLORE (Mn,Th,Na,Ca,REE)2(Nb,Ti)2O6(OH) C
FLUORNATROPYROCHLORE (Na,Pb,Ca,REE,U)2Nb2O6F C
OXYNATROPYROCHLORE (Na,Ca,U)2Nb2O6(O,OH) C
URANPYROCHLORE = OXYNATROPYROCHLORE OR NATROPYROCHLORE (U,Ca,Ce)2(Nb,Ta)2O6(OH,F) (?) C
BISMUTOPYROCHLORE = OXYNATROPYROCHLORE or zero-valent-dominant PYROCHLORE (Bi,U,Ca,Pb)1+x(Nb,Ta)2O6(OH).nH2O (?) C
HYDROXYCALCIOPYROCHLORE (Ca,Na,U,[])2(Nb,Ti)2O6(OH) C
FLUORCALCIOPYROCHLORE (Ca,Na)2(Nb,Ti)2O6F C
OXYCALCIOPYROCHLORE Ca2Nb2O6O C
STIBIOBETAFITE = OXYCALCIOPYROCHLORE (Sb+++,Ca)2(Ti,Nb,Ta)2(O,OH)7 (?) C
FLUORSTRONTIOPYROCHLORE (Sr,[])2Nb2(O,OH)6F C
OXYPLUMBOPYROCHLORE Pb2Nb2O6O C
KENOPLUMBOPYROCHLORE (Pb,[])2Nb2O6([],O) C
OXYYTTROPYROCHLORE-(Y) (Y,[])2Nb2O6O C
HYDROPYROCHLORE (H2O,[])2Nb2(O,OH)6(H2O) C
KALIPYROCHLORE = HYDROPYROCHLORE (K,Sr)2-xNb2O6(O,OH).nH2O C
HYDROXYKENOPYROCHLORE   C
FLUORKENOPYROCHLORE ([],Na,Ce,Ca)2(Nb,Ti)2O6F C
CERIOPYROCHLORE-(Ce) = FLUORKENOPYROCHLORE or Ca-/zero-valent-dominant PYROCHLORE (Ce,Ca,Y)2(Nb,Ta)2O6(OH,F) (?) C
4/C.13 to 15 Microlite subgroup
OXYNATROMICROLITE (Na,Ca,U)2(Ta,Nb)2O6(O,F) C
FLUORNATROMICROLITE (Na,Ca,Bi)2Ta2O6F C
FLUORCALCIOMICROLITE (Ca,Na,[])2Ta2O6F C
MICROLITE = FLUORCALCIOMICROLITE or OXYCALCIOMICROLITE (Ca,Na)2Ta2O6(O,OH,F) (?) C
HYDROXYCALCIOMICROLITE Ca1,5Ta2O6(OH) C
OXYCALCIOMICROLITE Ca2Ta2O6O C
OXYSTANNOMICROLITE Sn2Ta2O6O C
STANNOMICROLITE = OXYSTANNOMICROLITE or Ca- or zero-valrnt-dominant MICROLITE (Sn++,Fe++,Mn++)(Ta,Nb,Sn++++)2(O,OH)7 (?) C
KENOPLUMBOMICROLITE (Pb,[])2Ta2O6([],O,OH) C
STIBIOMICROLITE = OXYCALCIOMICROLITE or OXYSTIBIOMICROLITE or CALCIOMICROLITE (Sb,Ca,Na)2(Ta,Nb)2(O,OH)7 (?) C
OXYSTIBIOMICROLITE (Sb+++,Ca)2Ta2O6O C
HYDROMICROLITE (H2O,[])2Ta2(O,OH)6(H2O) C
BISMUTOMICROLITE = HYDROXYKENOMICROLITE or mixture (Bi,Ca)(Ta,Nb)2O6(OH) (?) C
HYDROXYKENOMICROLITE ([],Na,Sb+++)2Ta2O6(OH) C
CESSTIBTANTITE = HYDROXYKENOMICROLITE or zero-valent-dominant MICROLITE (Cs,Na)Sb+++Ta4O12 C
OXYKENOMICROLITE   C
HYDROKENOMICROLITE ([],H2O)2Ta2(O,OH6)(H2O) C
MURATAITE-(Y) (Y,Na)6(Zn,Fe+++)5Ti12O29(O,F)10F4 C
SCHETELIGITE (Ca,Y,Sb,Mn)2(Ti,Ta,Nb,W)2O6(O,OH) O (?)
TAZZOLIITE Ba2CaSr0.5Na0.5Ti2Nb3SiO17[PO2(OH)2]0.5 O
4/C.16 to 17 Romeite group
ARGENTOROMEITE Ag2Sb2(O,OH)7 (?) C
STETEFELDTITE = ARGENTOROMEITE Ag2Sb2(O,OH)7 (?) C
PLUMBOROMEITE    
CUPROROMEITE Cu++2Sb2(O,OH)7 (?) C (?)
FLUORNATROROMEITE (Na,Ca)2Sb2(O,OH)6F C
HYDROXYCALCIOROMEITE (Ca,Sb+++)2(Sb+++++,Ti)2O6(OH) C
ROMEITE = FLUORNATROROMEITE or FLUORCALCIOROMEITE or OXYCALCIOROMEITE (Ca,Fe++,Mn++,Na)2(Sb+++++,Ti++++)2O6(O,OH,F) C
FLUORCALCIOROMEITE (Ca,Na)2Sb+++++2(O,OH)6F C
OXYCALCIOROMEITE (Ca,Fe++,Sb+++,Na)2Sb+++++2O7 C
OXYPLUMBOROMEITE (Pb,Ca)2Sb+++++2O7 C
BINDHEIMITE = OXYPLUMBOROMEITE or PLUMBOROMEITE Pb2Sb2O6O C
MONIMOLITE = OXYPLUMBOROMEITE (Pb,Ca)3Sb2O8 (?) C
STIBIOROMEITE Sb+++Sb+++++2O6(OH) C
BISMUTOROMEITE    
BISMUTOSTIBICONITE = BISMUTOROMEITE Bi(Sb+++++,Fe+++)2O7 (?) C
INGERSONITE Ca3Mn++Sb+++++4O14 H
4/C.18 to 19 Elsmoreite subgroup
PLUMBOELSMOREITE    
JIXIANITE = PLUMBOELSMOREITE Pb(W,Fe+++)2(O,OH)7 (?) C
HYDROKENOELSMOREITE []2W2O6(H2O) C
ELSMOREITE = HYDROKENOELSMOREITE []2W2O6(H2O) C
PITTONGITE Na2(W,Fe+++)9(O,OH)27.4H2O H
PHYLLOTUNGSTITE CaFe+++3H(WO4)6.10H2O O
ZIRKELITE (Ca,Th,Ce)Zr(Ti,Nb)2O7 C
ZIRCONOLITE-2M CaZrTi2O7 M
ZIRCONOLITE-3T CaZrTi2O7 A
ZIRCONOLITE-3O CaZrTi2O7 O
LAACHITE (Ca,Mn)2Zr2Nb2TiFeO14 M
MENEZESITE Ba3MgZr4Nb12O42.12H2O C
ASPEDAMITE []12(Fe+++,Fe++)3Nb4[Th(Nb,Fe+++)12O42]{(H2O),(OH)}12 C
KRIESELITE (Al,Ga)2(Ge,Al)O4(F,OH)2 O
CARBOIRITE Fe++Al2GeO5(OH)2 A
4/C.23- Derbylite group
HEMLOITE (As,Sb)2(Ti,V,Fe,Al)12O23OH A
GRAESERITE Fe+++4Ti3As+++O13(OH) M
TOMICHITE (V,Fe)4Ti3AsO13(OH) M
DERBYLITE Fe4Ti3SbO13(OH) M
ZOLTAIITE BaV+++12(Ti,V++++)2(Si2O8)O19 R
GREENWOODITE Ba2-x(V+++OH)xV9(Fe+++,Fe++)2Si2O22 R
BATISIVITE Ba(V+++,Cr+++)8Ti++++6(Si2O7)O22 A
ARMALCOLITE (Mg,Fe++)Ti2O5 O
PSEUDOBROOKITE (Fe+++,Fe++)2(Fe++,Ti)O5 O
PSEUDORUTILE Fe+++2Ti3O9 H
MONGSHANITE (?) (Mg,Cr,Fe++)2(Ti,Zr,Cr,Fe+++)5O12 H
OXYVANITE (V+++,Cr+++)2(V++++,Ti++++)O5 M
BERDESINSKIITE V+++2TiO5 M
OLKHONSKITE (Cr+++,V+++)2Ti3O9 M (?)
SCHREYERITE V+++2Ti3O9 M
STIBIVANITE (-2M,-2O) Sb+++2V++++O5 O/M
4/D. Oxides M:O = 1:2 [MO2] and related compounds
4/D.01- Quartz series
QUARTZ SiO2 R
TRIDYMITE SiO2 M ps H
CRISTOBALITE SiO2 Q
MOGANITE SiO2 M
MELANOPHLOGITE SiO2 C/Q
COESITE SiO2 M
SEIFERTITE SiO2 O
STISHOVITE SiO2 Q
LECHATELIERITE (natural fused silica) SiO2  
OPAL SiO2.nH2O am.
4/D.02- Rutile group
RUTILE TiO2 Q
PYROLUSITE Mn++++O2 Q
CASSITERITE SnO2 Q
ARGUTITE GeO2 Q
PARATELLURITE TeO2 Q
PLATTNERITE PbO2 Q
TRIPUHYITE Fe+++(Sb+++++,Sn,W++++++,Ti++++)O4 Q
4/D.04- Tapiolite group
TAPIOLITE-(Fe) (Fe++,Mn++)(Ta,Nb)2O6 Q
TAPIOLITE-(Mn) (Mn++,Fe++)(Ta,Nb)2O6 Q
BYSTROMITE MgSb+++++2O6 Q
ORDONEZITE ZnSb+++++2O6 Q
BELYANKINITE Ca1-2(Ti,Zr,Nb)5O12.9H2O (?) am.
MANGANBELYANKINITE (Mn,Ca)(Ti,Nb)5O12.9H2O am.
GERASIMOVSKITE (Mn,Ca)(Nb,Ti)5O12.9H2O (?) am.
PETERANDRESENITE Mn4Nb6O19.14H2O M
TERNOVITE (Mg,Ca)Nb4O11.nH2O M
FRANCONITE Na2Nb4O11.9H2O M
HOCHELAGAITE (Ca,Na,Sr)Nb4O11.8H2O M
JEPPEITE (K,Ba)2(Ti,Fe+++)6O13 M
4/D.08- Cryptomelane group
MANJIROITE (Na,K)(Mn++++,Mn++)8O16.nH2O Q
CRYPTOMELANE K(Mn++++,Mn++)8O16 M ps Q
STRONTIOMELANE (Sr,K,Ba)Mn++++6Mn++2O16 M
PRIDERITE (K,Ba)(Ti,Fe+++)8O16 Q
HENRYMEYERITE BaFe++Ti7O16 Q
MANNARDITE BaTi6V+++2O16.H2O Q
REDLEDGEITE BaTi6Cr+++2O16.H2O Q
FERRIHOLLANDITE BaMn++++6(Fe+++,Mn+++)2O16 M
HOLLANDITE BaMn++++6Mn++2O16 M
CORONADITE Pb(Mn++++,Mn++)8O16 M ps Q
CESAROLITE PbH2Mn++++3O8 (?)
TODOROKITE (Mn++,Ca,Mg)Mn++++3O7.H2O M
WOODRUFFITE Zn++(Mn++++,Mn+++)5O10.3,5H2O M ps Q
ROMANECHITE (Ba,H2O)2(Mn++++,Mn+++)5O10 M
RAMSDELLITE MnO2 O
AKHTENSKITE epsilon-Mn++++O2 H
NSUTITE (gamma-MnO2)Mn++xMn++++1-xO2-2x(OH)2x (x is small) H
VERNADITE (MnO2)(Mn++++,Fe+++,Ca,Na)(O,OH)2.nH2O H
RANCIEITE (Ca,Mn++)Mn++++4O9.3H2O H (?)
TAKANELITE (Mn++,Ca)Mn++++4O8.H2O H
JANGGUNITE Mn++++5-x(Mn++,Fe+++)1+xO8(OH)6 (x=0,2) O
ANATASE TiO2 Q
DOWNEYITE SeO2 Q
BROOKITE TiO2 O
SRILANKITE (Ti,Zr)O2 O
TELLURITE TeO2 O
SCRUTINYITE alpha-PbO2 O
KURANAKHITE PbMn++++Te++++++O6 O
HUANZALAITE (Mg,Fe++)WO4 M
HUBNERITE MnWO4 M
FERBERITE Fe++WO4 M
SANMARTINITE (Zn,Fe++)WO4 M
HEFTETJERNITE (Sc,Sn++++,Mn++)(Ta,Nb)O4 M
KORAGOITE (Mn++,Mn+++,Fe++)3(Nb,Ta,Ti)3(Nb,Mn)2(W,Ta)2O20 M
QITIANLINGITE (Fe++,Mn)2(Nb,Ta)2W++++++O10 O
IXIOLITE (Ta,Nb,Sn,Fe,Mn)4O8 M
TITANOWODGINITE (Mn++,Fe++)(Ti,Sn,Ta,Sc)(Ta,Nb)2O8 M
WODGINITE (Ta,Nb,Sn,Mn,Fe)16O32 M
FERROTITANOWODGINITE (Fe++,Mn++)(Ti,Sn++++,Ta,Fe+++)(Ta,Nb)2O8 M
FERROWODGINITE (Fe++,Mn++)(Sn,Ti,Fe+++,Ta)(Ta,Nb)2O8 M
LITHIOWODGINITE (Li,Mn,Fe)(Ta,Nb,Sn)3O8 M
COLUMBITE-(Mg) (Mg,Fe++,Mn)(Nb,Ta)2O6 O
COLUMBITE-(Mn) (Mn,Fe++)(Nb,Ta)2O6 O
COLUMBITE-(Fe) Fe++Nb2O6 O
TANTALITE-(Mg) (Mg,Fe++)(Ta,Nb)2O6 O
TANTALITE-(Mn) Mn++Ta2O6 O
TANTALITE-(Fe) Fe++Ta2O6 O
POLYCRASE-(Y) (Y,Ca,Ce,U,Th)(Ti,Nb,Ta)2O6 O
URANOPOLYCRASE (U,Y)(Ti,Nb,Ta)2O6 O
YTTROCRASITE-(Y) (Y,Th,Ca,U)(Ti,Fe+++)2(O,OH)6 O
FERSMITE (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 O
EUXENITE-(Y) (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 O
TANTEUXENITE-(Y) (Y,Ce,Ca)(Ta,Nb,Ti)2(O,OH)6 O
CALCIOSAMARSKITE (Ca,Fe+++,U,Y)NbO4 M
SAMARSKITE-(Yb) (Yb,Y,U,Th,Ca,Fe)(Nb,Ta)O4 M ps O
SAMARSKITE-(Y) (Y,Ce,U,Fe+++)3(Nb,Ta,Ti)5O16 M
ISHIKAWAITE (U,Y,Fe+++,Fe++)(Nb,Ti)O4 O
YTTROCOLUMBITE-(Y) (Y,U,Fe++)(Nb,Ta)O4 O
YTTROTANTALITE-(Y) (Y,U,Fe++)(Ta,Nb)O4 O
LORANSKITE-(Y) (Y,Ce,Ca)ZrTaO6 (?) O (?)
KASSITE CaTi2O4(OH)2 O
CAFETITE CaTi2O5.H2O O
KOBEITE-(Y) (Y,U)(Ti,Nb)2(O,OH)6 (?) am.
LUCASITE-(Ce) (Ce,La)Ti2(O,OH)6 M
AESCHYNITE-(Y) (Y,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 O
AESCHYNITE-(Ce) (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 O
AESCHYNITE-(Nd) (Nd,Ce,Ca)(Ti,Nb)2(O,OH)6 O
VIGEZZITE (Ca,Ce)(Nb,Ta,Ti)2O6 O
NIOBOAESCHYNITE-(Y) (Y,Ce,Nd)0,5(Ca,Th)0,5(Nb,Ti)2(O,OH)6 O
NIOBOAESCHYNITE-(Ce) (Ce,Ca,Th)(Nb,Ti)2(O,OH)6 O
NIOBOAESCHYNITE-(Nd) (?) (Nd,Ce)(Nb,Ti)2(O,OH)6 O
RYNERSONITE Ca(Ta,Nb)2O6 O
TANTALAESCHYNITE-(Y) (Y,Ce,Ca)(Ta,Ti,Nb)2O6 O
THORUTITE (Th,U,Ca)Ti2(O,OH)6 M
BRANNERITE (U,Ca,Y,Ce)(Ti,Fe)2O6 M
ORTHOBRANNERITE U++++U++++++Ti4O12(OH)2 O
PETSCHECKITE U++++Fe++(Nb,Ta)2O8 H
LIANDRATITE U++++++(Nb,Ta)2O8 H
TAKANAWAITE-(Y) Y(Ta,Nb)O4 M
IWASHIROITE-(Y) Y(Ta,Nb)O4 M
FERGUSONITE-BETA-(Y) YNbO4 M
FERGUSONITE-BETA-(Ce) (Ce,La,Nd)NbO4 M
FERGUSONITE-BETA-(Nd) (Nd,Ce)NbO4 M
FERGUSONITE-(Y) YNbO4 Q
FERGUSONITE-(Ce) (Ce,Nd,La)NbO4.0,3H2O M
FERGUSONITE-(Nd) (?) (Nd,Ce)(Nb,Ti)O4 M
FORMANITE-(Y) YTaO4 Q
CLINOCERVANTITE beta-Sb+++Sb+++++O4 M
CERVANTITE Sb+++Sb+++++O4 O
KYAWTHUITE Bi+++Sb+++++O4 M
STIBIOCOLUMBITE SbNbO4 O
STIBIOTANTALITE SbTaO4 O
BISMUTOCOLUMBITE Bi(Nb,Ta)O4 Q
BISMUTOTANTALITE Bi(Ta,Nb)O4 O
CHILUITE Bi6Te++++++2Mo++++++2O21 H
GELOSAITE Bi(Mo++++++,Mo+++++)2-2,5O7(OH).H2O M
MAMBERTIITE BiMo+++++2,80O8(OH) A
SARDIGNAITE Bi+++Mo2O7(OH).2H2O M
LITHIOTANTITE Li(Ta,Nb)3O8 M
NATROTANTITE Na2Ta4O11 M
IRTYSHITE Na2(Ta,Nb)4O11 H
CALCIOTANTITE CaTa4O11 H
CESPLUMTANTITE (Cs,Na)2(Pb,Sb+++)3Ta8O24 Q
SZKLARYITE []Al6BAs+++3O15 O
BAHIANITE Al5Sb+++++3O14(OH)2 M
SIMPSONITE Al4(Ta,Nb)3(O,OH,F)14 R
ALUMOTANTITE AlTaO4 O
RANKAMAITE (Na,K,Pb,Li)3(Ta,Nb,Al)11(O,OH)30 O
SOSEDKOITE (K,Na)5Al2(Ta,Nb)22O60 O
BILLWISEITE Sb+++5(Nb,Ta)3WO18 M
TUGARINOVITE MoO2 M
FOORDITE Sn++(Nb,Ta)2O6 M
THOREAULITE Sn++Ta2O6 M
ROSIAITE PbSb+++++2O6 R
CHANGBAIITE PbNb2O6 R
AKAOGIITE TiO2 M
BADDELEYITE ZrO2 M
ALLENDEITE Sc4Zr3O12 R
TAZHERANITE (Zr,Ti,Ca)O2 C
CALZIRTITE CaZr3TiO9 Q
HIARNEITE (Ca,Mn++,Na)2(Zr,Mn+++)5(Sb+++++,Ti,Fe+++)2O16 Q
CERIANITE-(Ce) (Ce++++,Th)O2 C
THORIANITE ThO2 C
URANINITE UO2 C
VORLANITE (CaU++++++)O4 C ps H
4/E.01- Oxides M:O smaller than 1:2 [M2O5], [MO3], etc.
TANTITE Ta2O5 A (?)
TUNGSTIBITE Sb2O3.WO3 O
TUNGSTITE WO3.H2O O
MEYMACITE WO3.2H2O am.
HYDROTUNGSTITE H2WO4.H2O M
ANTHOINITE WAl(O,OH)3 (?) A
MPOROROITE W++++++AlO3(OH)3.2H2O A (?)
YTTROTUNGSTITE-(Y) YW2O6(OH)3 M
CEROTUNGSTITE-(Ce) CeW2O6(OH)3 M
MOLYBDITE MoO3 O
SIDWILLITE MoO3.2H2O M
ILSEMANNITE Mo3O8.nH2O (?) am.
BAMFORDITE Fe+++Mo2O6(OH)3.H2O A
4/F.01- Hydroxides and hydrated oxides
SASSOLITE H3BO3 A
BEHOITE Be(OH)2 O
CLINOBEHOITE Be(OH)2 M
GIBBSITE Al(OH)3 M
BAYERITE Al(OH)3 M
NORDSTRANDITE Al(OH)3 A
DOYLEITE Al(OH)3 A
4/F.03- Brucite series
BRUCITE Mg(OH)2 R
AMAKINITE (Fe++,Mg)(OH)2 R
PYROCHROITE Mn++(OH)2 R
THEOPHRASTITE Ni(OH)2 R
PARAOTWAYITE Ni(OH)2-x(SO4,CO3)0,5x M
JAMBORITE Ni++(OH)2.H2O H
SWEETITE Zn(OH)2 Q
ASHOVERITE Zn(OH)2 Q
WULFINGITE Zn(OH)2 O
SPERTINIITE Cu++(OH)2 O
PORTLANDITE Ca(OH)2 H
BRANDHOLZITE MgSb+++++2(OH)12.6H2O R
BOTTINOITE NiSb+++++2(OH)12.6H2O H
DRONINOITE Ni6Fe+++2(OH)16Cl2.4H2O R
MEIXNERITE Mg6Al2(OH)18.4H2O R
WOODALLITE Mg6(Cr,Fe+++)2(OH)16Cl2.4H2O R
IOWAITE Mg6Fe+++2(OH)16Cl2.4H2O H
MUSKOXITE Mg7Fe+++4(OH)13.10H2O H
DIASPORE AlO(OH) O
BOHMITE AlO(OH) O
GOETHITE alpha-Fe+++O(OH) O
LEPIDOCROCITE gamma-Fe+++O(OH) O
AKAGANEITE beta-Fe+++(O,OH,Cl) M ps Q
SCHWERTMANNITE Fe+++16O16(OH)12(SO4)2 Q
FEROXYHYTE delta-Fe+++O(OH) H
MANGANITE Mn+++O(OH) M
GROUTITE Mn+++O(OH) O
FEITKNECHTITE beta-Mn+++O(OH) H
TSUMGALLITE GaO(OH) O
LITHIOPHORITE Li6Al14Mn++3Mn++++18O42(OH)42 H or M
ASBOLANE (Co,Ni)1-y(Mn++++O2)2-x(OH)2-2y+2x.nH2O H
HETEROGENITE-2H Co+++O(OH) H
HETEROGENITE-3R Co+++O(OH) R
BRACEWELLITE Cr+++O(OH) O
GUYANAITE CrO(OH) O
GRIMALDIITE Cr+++O(OH) R
KYZYLKUMITE V+++2Ti2O5(OH) M
TIVANITE V+++TiO3(OH) M
MONTROSEITE (V+++,Fe+++)O(OH) O
PARAMONTROSEITE VO2 O
AKDALAITE 4Al2O3.H2O H
FERRIHYDRITE 5Fe+++2O3.9H2O H
HYDROCALUMITE Ca2Al(OH)6[Cl1-x(OH)x].3H2O M
KUZELITE Ca4Al2(OH)12(SO4).6H2O R
JIANSHUIITE (Mg,Mn++)Mn++++3O7.3H2O A
AURORITE (Mn,Ag,Ca)Mn++++3O7.3H2O A (?)
ERNIENICKELITE NiMn++++3O7.3H2O R
CHALCOPHANITE (Zn,Fe++,Mn++)Mn++++3O7.3H2O R
CIANCIULLIITE Mn++++(Mg,Mn++)2Zn+2(OH)10.2-4H2O M
BIRNESSITE Na4Mn14O27.9H2O O
CUALSTIBITE Cu2AlSb+++++(OH)12 R
ZINCALSTIBITE Zn2AlSb+++++(OH)12 R
OMSITE (Ni, Cu)2Fe+++(OH)6[Sb(OH)6] R
SHAKHOVITE Hg+4Sb+++++O3(OH)3 M
QUENSELITE PbMn+++O2(OH) M
SOHNGEITE Ga(OH)3 C
DZHALINDITE In(OH)3 C
BERNALITE Fe(OH)3 O ps C
4/F.16- Schoenfliesite group
SCHOENFLIESITE MgSn++++(OH)6 C
BURTITE CaSn(OH)6 C
WICKMANITE Mn++Sn++++(OH)6 C
NATANITE Fe++Sn++++(OH)6 C
MUSHISTONITE (Cu++,Zn,Fe++)Sn++++(OH)6 C
VISMIRNOVITE ZnSn++++(OH)6 C
4/F.17- Stottite group
MOPUNGITE NaSb+++++(OH)6 Q
TETRAWICKMANITE Mn++Sn++++(OH)6 Q
JEANBANDYITE (Fe+++,[])(Sn++++,[])(OH)6 Q ps C
STOTTITE Fe++Ge(OH)6 Q
EYSELITE Fe+++Ge++++3O7(OH) O
VARLAMOFFITE Sn2Fe+++O5(OH) C
KIMROBINSONITE (Ta,Nb)(OH)5-2x(O,CO3)x C
4/G. Vanadium oxides (V++++/V+++++)
4/G.01- Sorovanadates
POSTITE Mg(H2O)6Al2(OH)2(H2O)8(V10O28).13H2O O
GUNTERITE Na4(H2O)16(H2V10O28).6H2O M ps H
LASALITE Na2Mg2(V10O28).20H2O M
HUEMULITE Na4MgV+++++10O28.24H2O A
HUGHESITE Na3Al(V10O28).22H2O A
HUMMERITE KMgV+++++5O14.8H2O A
RONNEBURGITE K2Mn++V4O12 M
KOKINOSITE Na2Ca2(V+++++10O28).24H2O A
MAGNESIOPASCOITE MgCa2(V10O28).16H2O M ps H
PASCOITE Ca3V10O28.17H2O M
RAKOVANITE Na3H3V+++++10O28.15H2O M
SCHINDLERITE (NH4)4Na2[V+++++10O28].10H2O A
WERNERBAURITE (NH4)4Ca[V+++++10O28].16H2O A
NASHITE Na3Ca2[(V++++V+++++9)O28].24H2O M
SHERWOODITE Ca9Al2V++++4V+++++24O80.56H2O Q
4/G.02 to 06 Unclassified vanadium oxides
VANOXITE V++++4V+++++2O13.8H2O (?) R (?)
VERGASOVAITE Cu3O[(Mo,S)O4](SO4) O
KAZAKHSTANITE Fe+++5V++++3V+++++12O39(OH)9.9H2O M
SCHUBNELITE Fe+++2-x(V+++++,V++++)2O4(OH)4 A
VANALITE NaAl8V10O38.30H2O M
UVANITE U++++++2V+++++6O21.15H2O (?) O (?)
RAUVITE Ca(UO2)2V+++++10O28.16H2O  
4/G.07- Inovanadates [V2O6]--
NAVAJOITE (V+++++,Fe+++)10O24.12H2O M
ANKINOVICHITE (Ni,Zn)Al4(VO3)2(OH)12.2H2O M
ALVANITE ZnAl4(VO3)2(OH)12(H2O)2 M
MUNIRITE NaVO3.(2-x)H2O M
METAMUNIRITE Na2[V+++++2O6] or NaVO3 O
DICKTHOMSSENITE Mg(V2O6).7H2O M
ANSERMETITE Mn++(V+++++2O6).4H2O M
ROSSITE CaV2O6.4H2O A
METAROSSITE CaV2O6.2H2O A
CALCIODELRIOITE Ca(VO3)2(H2O)4 M
DELRIOITE (Sr,Ca)(VO3)2(H2O)4 M
METADELRIOITE Ca(VO3)2(H2O)4 A
4/G.08- Phyllovanadates
HAGGITE V2O2(OH)3 M
DOLORESITE H8V++++6O16 M
DUTTONITE V++++O(OH)2 M
LENOBLITE V++++2O4.2H2O O (?)
4/G.09 12 Phyllovanadates "Vanadiumbronze"
SHCHERBINAITE V2O5 O
CAVOITE CaV++++3O7 O
BASSOITE SrV++++3O7 M
MELANOVANADITE Ca(V+++++2V++++2)O10.5H2O A
BARIANDITE Al3(V+++++,V++++)40O100.45H2O M
BOKITE (Al,Fe+++)1,3(V+++++,V++++,Fe+++)8O20.7,4H2O M
STRACZEKITE (Ca,K,Ba)(V+++++,V++++)8O20.3H2O M
FERNANDINITE Ca(V+++++,V++++,Fe++)80O20.4H2O M
CORVUSITE (Na,Ca,K)(V+++++,V++++,Fe++)8O20.4H2O M
BARNESITE (Na,Ca)2V+++++6O16.3H2O M
GRANTSITE (NaCa)x(V+++++,V++++)6O16.4H2O (x = about 2,3) M
HENDERSONITE (Ca,Sr)x(V+++++,V++++)12O32.12H2O (x = about 2,6) O
HEWETTITE CaV+++++6O16.9H2O M
METAHEWETTITE CaV+++++6O16.3H2O M
4/G.13- Tectovanadates
BANNERMANITE (Na,K)xV++++xV+++++6-xO15 (x=0,7) M
PHOSPHOVANADYLITE-Ca Ca[V++++4P2O10(OH)6].12H2O C
PHOSPHOVANADYLITE (Ba,Ca,K,Na)0,66[P2(V++++,Al)4(O,OH)16].12H2O C
4/H.01 to 08 Uranyl hydroxides and hydrates, with [UO2]++
IANTHINITE (UO2).5(UO3).10H2O O
STUDTITE UO4.4H2O M
METASTUDTITE UO4.2H2O O
SCHOEPITE [(UO2)8O2(OH)12](H2O)12 O
METASCHOEPITE UO3.nH2O (n smaller than 2 ) O
PAULSCHERRERITE (UO2)(OH)2 M ps O
PARASCHOEPITE (?) UO3.2H2O (?) O
AGRINIERITE K2(Ca,Sr)(UO2)6O6(OH)4.5H2O O
RAMEAUITE K2Ca(UO2)6O6(OH)4,6H2O M
COMPREIGNACITE K2(UO2)6O4(OH)6.7H2O O
BECQUERELITE Ca(UO2)6O4(OH)6.8H2O O
BILLIETITE Ba(UO2)6O4(OH)6.8H2O O
PROTASITE Ba(UO2)3O3(OH)2.3H2O M ps H
MASUYITE Pb(UO2)3O3(OH)2.2H2O O
VANDENBRANDEITE Cu(UO2)(OH)4 A
CLARKEITE Na[(UO2)O(OH)](H2O)0-1 H
CALCIOURANOITE (Ca,Ba,Pb)U2O7.5H2O am.
METACALCIOURANOITE (Ca,Na,Ba)U2O7.2H2O (?)
BAURANOITE BaU2O7.4-5H2O (?)
GAUTHIERITE KPb[(UO2)7O5(OH)7].8H2O M
WOLSENDORFITE (Pb,Ca)U2O7.2H2O O
FOURMARIERITE Pb(UO2)4O3(OH)4.4H2O O
VANDENDRIESSCHEITE Pb1,5(UO2)10O6(OH)11.11H2O O
METAVANDENDRIESSCHEITE PbU7O22.nH2O (n smaller than 12) O
SAYRITE Pb2(UO2)5O6(OH)2.4H2O M
SPRIGGITE Pb2(UO2)6O8(OH)2.3H2O M
CURITE Pb3(UO2)8O8(OH)6.2H2O O
RICHETITE PbU++++++4O13.4H2O A
URANOSPHAERITE Bi2U2O9.3H2O M
HOLFERTITE U++++++1,75Ti++++Ca0,25O7,5(H2O)3 or U++++++1,75Ti++++Ca0,25O7,17(OH)0,67(H2O)3 H
CARLOSBARBOSAITE (UO2)2Nb2O6(OH)2.2H2O O
4/J. Arsenites
4/J.01 to 05 Arsenites with [AsO3]--- (isolated groups)
REINERITE Zn3(As+++O3)2 O
NANLINGITE NaLiCa5Mg12Fe++(AsO3)8F14 R
FINNEMANITE Pb5(As+++O3)3Cl H
GEORGIADESITE Pb4(AsO3)4Cl4(OH) M
FREEDITE Pb8Cu+(As+++O3)2O3Cl5 M
TRIGONITE Pb3Mn(As+++O3)2(As+++O2OH) M
ROUSEITE Pb2Mn++(As+++O3)2.2H2O A
NEALITE Pb4Fe++(As+++++O3)2Cl4.2H2O A
ZIMBABWEITE (Na,K)2PbAs+++4(Ta,Nb,Ti)4O18 O
EKATITE (Fe+++,Fe++,Zn)12(OH)6(AsO3)6[AsO3,HOSiO3]2 H
TOOELEITE Fe+++6(As+++O3)4SO4(OH)4.4H2O O
CHADWICKITE H(UO2)(As+++O3) Q (?)
SEELITE Mg(UO2)(AsO4)0,6(AsO3)1,4.7H2O M
CAFARSITE Ca8(Ti,Fe++,Fe+++,Mn)6-7(As+++O3)12.4H2O C
MAGNUSSONITE Mn++5As+++3O9(OH,Cl) C/Q
DYMKOVITE (Ni,Mg)(UO2)2(As+++O3).7H2O M
ARMANGITE Mn++26As+++18O50(OH)4(CO3) R
4/J.06- Arsenites with [As2O5]---- groups
FETIASITE (Fe++,Fe+++,Ti++++)3O2(As+++2O5) M
SCHNEIDERHOHNITE Fe++Fe+++3As+++5O13 A
VAJDAKITE [(Mo++++++O2)2(H2O)2As+++2O5)].H2O M
PAULMOOREITE Pb2As+++2O5 M
GEBHARDITE Pb8(As+++2O5)2OCl6 M
4/J.07- Arsenites with [AsxOy]---- groups
LUDLOCKITE Pb++Fe+++4As+++10O22 A
4/J.08- Arsenites (unclassified)
KARIBIBITE Fe+++2As+++4(O,OH)9 O
LAZARENKOITE (Ca,Fe++)Fe+++As+++3O7.3H2O O
4/J.09- Arsenites with [As4O8]---- (ring arsenites)
TORRECILLASITE Na(As,Sb)+++4O6Cl O
LUCABINDIITE (K,NH4)As4O6(Cl,Br) H
GAJARDOITE KCa0,5As+++4O6Cl2.5H2O H / A
STENHUGGARITE CaFe+++(As+++O2)(As+++Sb+++O5) Q
4/J.10- Arsenites with [As2O4]-- (chain arsenites)
MANGANARSITE Mn++3As+++204(OH)4 R
LEITEITE ZnAs+++2O4 M
TRIPPKEITE CuAs+++2O4 Q
4/K. Sulfites, selenites, tellurites
4/K.01 to 10 Sulfites, selenites, tellurites with [XO3]-- and related structures
SCOTLANDITE PbSO3 M
MOLYBDOMENITE PbSeO3 M
PLUMBOSELITE Pb3O2(SeO3) O
ORLANDIITE Pb3SeO3Cl4.H2O A
SARRABUSITE Pb5Cu(SeO3)4Cl4 M
BALYAKINITE CuTeO3 O
MAGNOLITE Hg+2Te++++O3 O
FAIRBANKITE PbTe++++O3 A
PLUMBOTELLURITE PbTe++++O3 O
SCHMITTERITE (UO2)TeO3 O
MOCTEZUMITE Pb(UO2)(TeO3)2 M
SMIRNITE Bi2Te++++O5 O
PINGGUITE Bi+++6Te++++2O13 O
CHEKHOVICHITE (Bi,Pb,Fe)2Te4O11 M
GRAVEGLIAITE Mn++(SO3).3H2O O
HANNEBACHITE Ca2(SO3)2.H2O O
ORSCHALLITE Ca3(SO3)2(SO4).12H2O R
GRAEMITE CuTeO3.H2O O
CHOLOALITE PbCu++(Te++++O3)2.H2O C
SOFIITE Zn2(Se++++O3)Cl2 O ps H
GEORGBOKIITE Cu5(SeO3)2O2Cl2 M
PARAGEORGBOKIITE beta-Cu5(SeO3)2O2Cl2 M
NICKSOBOLEVITE Cu7(SeO3)2O2Cl6 M
CHLOROMENITE Cu9O2(SeO3)4Cl6 M
ILINSKITE (Na,K)Cu5(SeO3)2O2Cl3 O
BURNSITE KCdCu++7O2(SeO3)2Cl9 H
PREWITTITE KPb1,5Cu6Zn(SeO3)2O2Cl10 O
ALLOCHALCOSELITE Cu+Cu++5PbO2(SeO3)2Cl5 M
CHALCOMENITE CuSeO3.2H2O O
TEINEITE CuTeO3.2H2O O
CESBRONITE Cu5(TeO3)2(OH)6.2H2O O
JUABITE CaCu10(Te++++O3)4(As+++++O4)4(OH)2.4H2O A
CLINOCHALCOMENITE CuSeO3.2H2O M
COBALTOMENITE CoSeO3.2H2O M
AHLFELDITE (Ni,Co)SeO3.2H2O M
NESTOLAITE CaSeO3.H2O M
ALFREDOPETROVITE Al2(Se++++O3)3.6H2O H
MANDARINOITE Fe+++2Se++++3O9.6H2O M
BLAKEITE (?) Fe+++2(TeO3)3 (?)
SONORAITE Fe+++Te++++O3(OH).H2O M
EMMONSITE Fe+++2Te++++3O9.2H2O A
RODALQUILARITE H3Fe+++2(Te++++O3)4Cl A
POUGHITE Fe+++2(TeO3)2(SO4).3H2O O
KEYSTONEITE Mg0,5[Ni++Fe+++(TeO3)3].4,5H2O H
KINICHILITE Mg0,5[Mn++Fe+++(TeO3)3].4,5H2O H
ILIRNEYITE Mg0,5[ZnMn+++(TeO3)3].4,5H2O H
ZEMANNITE Mg0,5[Zn++Fe+++(Te++++O3)3].4,5H2O H
QUETZALCOATLITE Zn6Cu3(Cl,Pb,Ag)2(TeO3)2O6(OH)6 H
FRANCISITE Cu3Bi(SeO3)2O2Cl O
FAVREAUITE PbBiCu6O4(SeO3)4(OH).H2O Q
4/K.11- Uranylselenites with [UO2]++ and [SeO3]--
DERRIKSITE Cu4(UO2)(SeO3)2(OH)6 O
MARTHOZITE Cu++(UO2)3(SeO3)2O2.8H2O O
HAYNESITE (UO2)3(SeO3)2(OH)2.5H2O O
LARISAITE (H3O)(Na,K)(UO2)3O2(SeO3)2.4H2O M
PIRETITE Ca(UO2)3(SeO3)2(OH)4.4H2O O
GUILLEMINITE Ba(UO2)3(SeO3)2O2.3H2O O
DEMESMAEKERITE Pb2Cu5(UO2)2(SeO3)6(OH)6.2H2O A
4/K.12- Tellurates with [Te2O5]--
RAJITE CuTe++++2O5 M
DENNINGITE (Ca,Mn)(Mn,Zn)(Te2O5)2 Q
MACKAYITE Fe+++Te2O5(OH) Q
4/K.13 to 14 Tellurates with [Te3O8]----
ZINCOSPIROFFITE Zn2(Te3O8) M
SPIROFFITE Mn++2Te3O8 M
MROSEITE CaTe++++(CO3)O2 O
CARLFRIESITE CaTe++++2Te++++++O8 M
WALFORDITE (Fe+++,Te++++++)(Te++++3O8) C
WINSTANLEYITE TiTe++++3O8 C
CLIFFORDITE UTe3O9 C
4/K.15 to 19 Tellurates with [TeO6]------
RAISAITE Cu++Mg[Te++++++O4(OH)2].6H2O M
ECKHARDITE (Ca,Pb)Cu++Te++++++O5(H2O) M
FRANKHAWTHORNEITE Cu2Te++++++O4(OH)2 M
OTTOITE Pb2Te++++++O5 M
XOCOMECATLITE Cu3Te++++++O4(OH)4 O
BRUMADOITE Cu3Te++++++O4(OH)4.5H2O M
MCALPINEITE Cu++3Te++++++O6.H2O C
JENSENITE Cu++3Te++++++O6.2H2O M
MOJAVEITE Cu6[Te++++++O4(OH)2](OH)7Cl R
LEISINGITE (Cu,Mg,Zn)2(Mg,Fe)Te++++++O6.6H2O R
UTAHITE Cu5Zn3(Te++++++O4)4(OH)8.7H2O A
CUZTICITE Fe+++2Te++++++O6.3H2O H
YAFSOANITE {Ca3}[Te++++++2](Zn3)O12 C
XOCOLATLITE Ca2Mn++++2Te++++++2O12.H2O M
FUETTERERITE Pb3Cu++6Te++++++O6(OH)7Cl5 R ps H
KHINITE-4O Pb++Cu++3Te++++++O6(OH)6 O
KHINITE-3T Pb++Cu++3Te++++++O6(OH)2 R
TIMROSEITE Pb2Cu++5(Te++++++O6)2(OH)2 O
PARATIMROSEITE Pb2Cu++4(Te++++++O6)2(H2O)2 O
BAIRDITE Pb2Cu++4Te++++++2O10(OH)2(SO4)(H2O) M
AGAITE Pb3Cu++Te++++++O5(OH)2(CO3) O
BACKITE Pb2AlTe++++++O6Cl R
MARKCOOPERITE Pb(UO2)Te++++++O6 M ps Q
MONTANITE Bi2Te++++++O6.2H2O M (?)
4/K.16 to 19 Tellurates[TeO6] + groups[(S/P/As/V)O4] or + tellurite[TeO3]--
JOELBRUGGERITE Pb3Zn3(Sb+++++,Te++++++)As2O13(OH,O) H
DUGGANITE Pb3Zn3Te(As,V,Si)2(O,OH)14 H
KUKSITE (Pb,Ca)3Zn3Te++++++O6(PO4,VO4)2 O
CHEREMNYKHITE Zn3Pb3Te++++O6(VO4,AsO4)2 O
TLALOCITE (Cu,Zn)16(Te++++O3)(Te++++++O4)2Cl(OH)25.27H2O M (?)
EUREKADUMPITE (Cu,Zn)16(Te++++O3)2(AsO4)3Cl(OH)18.7H2O O ps H
TLAPALLITE H6(Ca,Pb)2(Cu,Zn)3(SO4)(Te++++O3)4(Te++++++O6) M
SCHIEFFELINITE Pb10Te6O20(OH)14(SO4).5H2O O
CHROMSCHIEFFELINITE Pb10Te++++++6O20(OH)14(CrO4).5H2O O
YECORAITE Bi5Fe+++3(Te++++O3)(Te++++++O4)2O9.9H2O (?) Q or H
GIRDITE (?) Pb3H2(Te++++O3)(Te++++++O6) (?) M
OBOYERITE Pb6H6(Te++++O3)3(Te++++++O6)2.2H2O A
EZTLITE Pb2Fe+++6(Te++++O3)3(Te++++++O6)(OH)10.8H2O M
HOUSLEYITE Pb6CuTe4O18(OH)2 M
THORNEITE Pb6(Te++++++2O10)(CO3)Cl2(H2O) M
4/L. Iodates
4/L.01 to 03 Iodates with [IO3]-
LAUTARITE Ca(IO3)2 M
BRUGGENITE Ca(IO3)2.H2O M
DIETZEITE Ca2H2O(IO3)2(CrO4) M
SALESITE Cu(IO3)(OH) O
BLUEBELLITE Cu6[I+++++O3(OH)3](OH)7Cl R
BELLINGERITE Cu++3(IO3)6.2H2O A

Class V - Nitrates, carbonates, borates

Mineral Formula System
5/A. Nitrates with [NO3]-
NITRATINE NaNO3 R
NITER KNO3 O
GWIHABAITE (NH4,K)(NO3) O
NITROBARITE Ba(NO3)2 C
NITROCALCITE Ca(NO3)2.4H2O M
NITROMAGNESITE Mg(NO3)2.6H2O M
GERHARDTITE Cu2(NO3)(OH)3 O
ROUAITE Cu2(NO3)(OH)3 M
LIKASITE Cu3(NO3)(OH)5.2H2O O
SVEITE KAl7(NO3)4Cl2(OH)16.8H2O M
5/B. Anhydrous carbonates [CO3]--, without additional anion
ZABUYELITE Li2CO3 M
NAHCOLITE NaHCO3 M
KALICINITE KHCO3 M
TESCHEMACHERITE (NH4)HCO3 O
NATRITE Na2CO3 M
WEGSCHEIDERITE Na5(CO3)(HCO3)3 A
5/B.02- Calcite group
VATERITE CaCO3 H
CALCITE CaCO3 R
MAGNESITE MgCO3 R
SIDERITE Fe++CO3 R
RHODOCHROSITE Mn++CO3 R
SMITHSONITE ZnCO3 R
SPHAEROCOBALTITE CoCO3 R
GASPEITE (Ni,Mg,Fe++)CO3 R
OTAVITE CdCO3 R
5/B.03- Dolomite group
DOLOMITE CaMg(CO3)2 R
ANKERITE Ca(Fe++,Mg,Mn)(CO3)2 R
KUTNOHORITE Ca(Mn++,Mg,Fe++)(CO3)2 R
MINRECORDITE CaZn(CO3)2 R
NORSETHITE BaMg(CO3)2 R
HUNTITE CaMg3(CO3)4 R
BENSTONITE (Ba,Sr)6(Ca,Mn)6Mg(CO3)13 R
5/B.04- Aragonite group
ARAGONITE CaCO3 O
STRONTIANITE SrCO3 O
WITHERITE BaCO3 O
CERUSSITE PbCO3 O
ALSTONITE BaCa(CO3)2 A ps O
BARYTOCALCITE BaCa(CO3)2 M
OLEKMINSKITE Sr(Sr,Ca,Ba)(CO3)2 R
PARALSTONITE BaCa(CO3)2 R
JUANGODOYITE Na2Cu++(CO3)2 M
EITELITE Na2Mg(CO3)2 R
NYEREREITE Na2Ca(CO3)2 O ps H
NATROFAIRCHILDITE Na2Ca(CO3)2 O
FAIRCHILDITE K2Ca(CO3)2 H
ZEMKORITE (Na,K)2Ca(CO3)2 H
BUTSCHLIITE K2Ca(CO3)2 R
SHORTITE Na2Ca2(CO3)3 O
SAHAMALITE-(Ce) (Mg,Fe++)Ce2(CO3)4 M
REMONDITE-(Ce) Na3(Ce,La,Ca,Na,Sr)3(CO3)5 M ps H
REMONDITE-(La) Na3(La,Ce,Ca)3(CO3)5 M ps H
PETERSENITE-(Ce) (Na,Ca)4(Ce,La,Nd,Sr,Pr,Sm,Ba)2(CO3)5 M
CALCIOBURBANKITE Na3(Ca,Ce,La,Sr)3(CO3)5 H
BURBANKITE (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 H
KHANNESHITE (NaCa)3(Ba,Sr,Ce,Ca)3(CO3)5 H
CARBOCERNAITE (Ca,Na)(Sr,Ce,Ba)(CO3)2 O
PARATOOITE-(La) (REE,Ca,Na,Sr)6Cu(CO3)8 or REE3(Ca,Sr)2NaCu(CO3)8 O
SANROMANITE Na2CaPb3(CO3)5 H
5/C. Anhydrous carbonates [CO3]--, with additional anions
5/C.01- Azurite - rosasite series
AZURITE Cu3(CO3)2(OH)2 M
MALACHITE Cu2(CO3)(OH)2 M
GEORGEITE Cu++5(CO3)3(OH)4.6H2O am.
CHUKANOVITE Fe++2(CO3)3(OH)2 M
POKROVSKITE Mg2(CO3)(OH)2.0,5H2O M
MCGUINNESSITE (Mg,Cu++)2(CO3)(OH)2 M
KOLWEZITE (Cu++,Co)2(CO3)(OH)2 A
GLAUKOSPHAERITE (Cu,Ni)2(CO3)(OH)2 M
NULLAGINITE Ni2(CO3)(OH)2 M
ROSASITE (Cu++,Zn)2(CO3)(OH)2 M
ZINCROSASITE (Zn,Cu++)2(CO3)(OH)2 M
PARADSASVARITE Zn2(CO3)(OH)2 M
HYDROZINCITE Zn5(CO3)2(OH)6 M
BRIANYOUNGITE Zn3(CO3,SO4)(OH)4 M ps O
AURICHALCITE (Zn,Cu)5(CO3)2(OH)6 M
LOSEYITE (Mn,Zn)7(CO3)2(OH)10 M
SCLARITE (Zn,Mg,Mn++)4Zn3(CO3)2(OH)10 M
BARENTSITE Na7AlH2(CO3)4F4 A
DAWSONITE NaAl(CO3)(OH)2 O
TUNISITE NaCa2Al4(CO3)4(OH)8Cl Q
NORTHUPITE Na3Mg(CO3)2Cl C
TYCHITE Na6Mg2(CO3)4(SO4) C
MANGANOTYCHITE Na6(Mn++,Fe++,Mg)2(SO4)(CO3)4 C
FERROTYCHITE Na6Fe++2(SO4)(CO3)4 C
BRADLEYITE Na3Mg(PO4)(CO3) M
SIDORENKITE Na3Mn(PO4)(CO3) M ps O
BONSHTEDTITE Na3Fe++(PO4)(CO3) M ps O
CRAWFORDITE Na3Sr(PO4)(CO3) M ps O
SABINAITE Na4Zr2TiO4(CO3)4 M
BRENKITE Ca2(CO3)F2 O
PODLESNOITE BaCa2(CO3)2F2 O
HOLDAWAYITE Mn++6(CO3)2(OH)7(Cl,OH) M
ROUVILLEITE Na3(Ca,Mn++)2(CO3)3(F,OH) M
DEFERNITE Ca6(CO3)2-x(SiO4)x(OH)7(Cl,OH)1-2x (x=0,5) O
BASTNASITE-(Y) (Y,Ce)(CO3)F H
BASTNASITE-(La) (La,Ce)(CO3)F H
BASTNASITE-(Ce) (Ce,La)(CO3)F H
BASTNASITE-(Nd) (Nd, La,Ce)(CO3)F H
HYDROXYLBASTNASITE-(La) (La,Ce)(CO3)(OH,F) H
HYDROXYLBASTNASITE-(Ce) (Ce,La)(CO3)(OH,F) H
HYDROXYLBASTNASITE-(Nd) (Nd,La)(CO3)(OH,F) H
KOZOITE-(Nd) (Nd,La)(CO3)(OH) O
KOZOITE-(La) (La,Ce,Nd)(CO3)(OH) O
HORVATHITE-(Y) NaY(CO3)F2 O
PARISITE-(Ce) Ce2CaF2(CO3)3 M
PARISITE-(Nd) Ca(Nd,Ce,La)2(CO3)3F2 R
RONTGENITE-(Ce) Ca2(Ce,La)3(CO3)5F3 R
SYNCHYSITE-(Y) (Y,Ce)Ca(CO3)2F M ps H
SYNCHYSITE-(Ce) Ca(Ce,La)(CO3)2F M
SYNCHYSITE-(Nd) Ca(Nd,La)(CO3)2F M ps H
HUANGHOITE-(Ce) BaCe(CO3)2F R
QAQARSSUKITE (Ba,Ca,Sr)(Ce,La,Nd)(CO3)2F R
CEBAITE-(Ce) Ba3Ce2(CO3)5F2 M
CEBAITE-(Nd) (?) Ba3(Nd,Ce)2(CO3)5F2 M
KUKHARENKOITE-(La) Ba2(La,Ce,Th)(CO3)3F M
KUKHARENKOITE-(Ce) Ba2Ce(CO3)3F M
ZHONGHUACERITE-(Ce) Ba2Ce(CO3)3F R
CORDYLITE-(La) (Na,Ca)Ba(La,Ce,Sr)2(CO3)4F H
CORDYLITE-(Ce) NaBaCe2(CO3)4F H
LUKECHANGITE-(Ce) Na3(Ce,La,Nd)2(CO3)4F H
ARISITE-(Ce) NaCe2(CO3)2[(CO3)1-xF2x]F H
ARISITE-(La) NaLa2(CO3)2[F2x(CO3)1-x]F H
MINEEVITE-(Y) Na25Ba(Y,Gd,Dy)2(HCO3)4(CO3)11(SO4)2ClF2 H
REEDERITE-(Y) (Na,Al,Mn,Ca)15(Y,Ce,Nd,La)2(CO3)9(SO3F)(Cl,F) H
MICHEELSENITE (Ca,Y)3Al(PO3OH,CO3)(CO3)(OH)6.12H2O H
SHANNONITE Pb2OCO3 O
HYDROCERUSSITE Pb3(CO3)2(OH)2 R
PLUMBONACRITE Pb5O(OH)2(CO3)3 H
PHOSGENITE Pb2(CO3)Cl2 Q
BISMUTITE Bi2(CO3)O2 Q
KETTNERITE CaBi(CO3)OF Q
BEYERITE (Ca,Pb)Bi2(CO3)2O2 Q
5/D. Hydrous carbonates [CO3]--, without additional anion
BARRINGTONITE MgCO3.2H2O (?) A
NESQUEHONITE Mg(HCO3)(OH).2H2O M
LANSFORDITE MgCO3.5H2O M
HELLYERITE NiCO3.6H2O A
MONOHYDROCALCITE CaCO3.H2O H
IKAITE CaCO3.6H2O M
THERMONATRITE Na2CO3.H2O O
NATRON Na2CO3.10H2O M
TRONA Na3(CO3)(HCO3).2H2O M
BAYLISSITE K2Mg(CO3)2.4H2O M
PIRSSONITE Na2Ca(CO3)2.2H2O O
GAYLUSSITE Na2Ca(CO3)2.5H2O M
CHALCONATRONITE Na2Cu(CO3)2.3H2O M
ADAMSITE-(Y) NaY(CO3)2.6H2O A
SHOMIOKITE-(Y) Na3Y(CO3)3.3H2O O
CALKINSITE-(Ce) (Ce,La)2(CO3)3.4H2O O
LANTHANITE-(La) (La,Ce)2(CO3)3.8H2O O
LANTHANITE-(Ce) (Ce,La)2(CO3)3.8H2O O
LANTHANITE-(Nd) (Nd,La)2(CO3)3.8H2O O
TENGERITE-(Y) Y2(CO3)3.nH2O O
KIMURAITE-(Y) CaY2(CO3)4.6H2O O
GALGENBERGITE-(Ce) Ca(Ce,La,Nd)2(CO3)4.H2O A
LOKKAITE-(Y) CaY4(CO3)7.9H2O O
LECOQITE Na3Y(CO3)3.6H2O H
EWALDITE (Ba,Sr)(Ca,Na,Y,Ce)(CO3)2.10-12H2O H
DONNAYITE-(Y) Sr3NaCaY(CO3)6.3H2O A ps R
MCKELVEYITE-(Y) Ba3Na(Ca,U)Y(CO3)6.3H2O A ps R
MCKELVEYITE-(Nd) (?) Na(Ba,Sr)3Ca(Nd,Ce,La)(CO3)6.3H2O (?) A
WELOGANITE Sr3Na2Zr(CO3)6.3H2O A ps R
TULIOKITE BaNa6Th(CO3)6.6H2O H
5/E. Hydrous carbonates [CO3]--, with additional anions
HYDROMAGNESITE Mg5(CO3)4(OH)2.4H2O M
WIDGIEMOOLTHALITE (Ni,Mg)5(CO3)4(OH)2.4-5H2O M
DYPINGITE Mg5(CO3)4(OH)2.5H2O M (?)
GIORGIOSITE Mg5(CO3)4(OH)2.5H2O (?) (?)
CHLORARTINITE Mg2(CO3)Cl(OH).3H2O R
ARTINITE Mg2(CO3)(OH)2.3H2O M
INDIGIRITE Mg2Al2(CO3)4(OH)2.15H2O M (?)
COALINGITE Mg10Fe+++2(CO3)(OH)24.2H2O R
BRUGNATELLITE Mg6Fe+++(CO3)(OH)13.4H2O H
5/E.02- Manasseite group
QUINTINITE (-2H,-3T) (Mg,Fe++)4Al2(OH)12(CO3).3H2O H/R
CARESITE (-3T) (Fe++,Mg)4Al2(OH)12(CO3).3H2O R
CHARMARITE (-2H,-3T) Mn++4Al2(OH)12(CO3).3H2O H/R
ZACCAGNAITE Zn4Al2(OH)12(CO3).3H2O H
MANASSEITE = HYDROTALCITE Mg6Al2(CO3)(OH)16.4H2O H
CHLORMAGALUMINITE (Mg,Fe++)4Al2(OH)12(Cl2,CO3).2H2O H
SJOGRENITE = PYROAURITE Mg6Fe++2(CO3)(OH)14.5H2O H
5/E.03- Hydrotalcite group
HYDROTALCITE Mg6Al2(CO3)(OH)16.4H2O R
STICHTITE Mg6Cr+++2(CO3)(OH)16.4H2O R
PYROAURITE Mg6Fe+++2(CO3)(OH)16.4H2O R
DESAUTELSITE Mg6Mn+++2(CO3)(OH)16.4H2O R
TAKOVITE Ni6Al2(OH)16(CO3,OH).4H2O R
REEVESITE Ni6Fe+++2(CO3)(OH)16.4H2O R
COMBLAINITE Ni++6Co+++2(CO3)(OH)16.4H2O R
FOUGERITE Fe++4Fe+++2(OH)12[CO3].3H2O R
TREBEURDENITE Fe++2Fe+++4O2(OH)10[CO3].3H2O R
MOSSBAUERITE Fe+++6O4(OH)8[CO3].3H2O R
SERGEEVITE Ca2Mg11(CO3)13-x(HCO3)x(OH)x.10-xH2O (x=4) R
KARCHEVSKYITE [Mg18Al9(OH)54][Sr2(CO3,PO4)9(H2O,H3O)11] R
PUTNISITE SrCa4Cr+++8(CO3)8SO4(OH)16.25H2O O
SCARBROITE Al5(OH)13(CO3).5H2O H
HYDROSCARBROITE Al14(CO3)3(OH)36.nH2O A
ALUMOHYDROCALCITE CaAl2(CO3)2(OH)4.3H2O A
PARAALUMOHYDROCALCITE (PARA-ALUMOHYDROCALCITE) CaAl2(CO3)2(OH)4.6H2O (?)
OTWAYITE Ni2(CO3)(OH)2.H2O O
ZARATITE Ni3(CO3)(OH)4.4H2O C
KAMBALDAITE NaNi4(CO3)3(OH)3.3H2O H
SZYMANSKIITE Hg+16(Ni,Mg)6(CO3)12(OH)12(H3O8).3H2O H
PETERBAYLISSITE Hg+3(CO3)(OH).2H2O O
CLEARCREEKITE Hg+3(CO3)(OH).2H2O M
CALLAGHANITE Cu2Mg2(CO3)(OH)6.2H2O M
MARKLITE Cu5(CO3)2(OH)6. 6H2O M
DECRESPIGNYITE-(Y) (Y,Gd,Dy)4Cu(CO3)4Cl(OH)5.2H2O M ps H
NIVEOLANITE NaBeCO3(OH).1-2H2O Q
LUSERNAITE-(Y) Y4Al(CO3)2(OH,F)11.6H2O O
THOMASCLARKITE-(Y) Na(Y,REE)(HCO3)(OH)3.4H2O M ps Q
KAMPHAUGITE-(Y) Ca(Y,REE)(CO3)2(OH).H2O Q
CALCIOANCYLITE-(Ce) (Ca,Sr)(Ce,REE)(CO3)2(OH).H2O O
CALCIOANCYLITE-(Nd) Ca(Nd,Ce,Gd,Y)3(CO3)4(OH)3.H2O O
ANCYLITE-(La) Sr(La,Ce)(CO3)2(OH).H2O O
ANCYLITE-(Ce) SrCe(CO3)2(OH).H2O O
GYSINITE-(Nd) Pb(Nd,La)(CO3)2(OH).H2O O
KOCHSANDORITE CaAl2(CO3)2(OH)4.1,5H2O O
STRONTIODRESSERITE (Sr,Ca)Al2(CO3)2(OH)4.H2O O
DRESSERITE BaAl2(CO3)2(OH)4.H2O O
HYDRODRESSERITE BaAl2(CO3)2(OH)4.3H2O A
MONTROYALITE Sr4Al8(CO3)3(OH,F)26.10-11H2O A (?)
DUNDASITE PbAl2(CO3)2(OH)4.H2O O
BARSTOWITE 3PbCl2.PbCO3.H2O or Pb4Cl6CO3.H2O M
SCHUILINGITE-(Nd) PbCu(Nd,Gd,Sm,Y)(CO3)3(OH).1,5H2O O
SHELDRICKITE NaCa3(CO3)2F3.H2O R
THORBASTNASITE Th(Ca,Ce)(CO3)2F2.3H2O H
5/F. Uranylcarbonates with [UO2]++ and [CO3]--
RUTHERFORDINE UO2(CO3) O
BLATONITE (UO2)(CO3).H2O H/R (?)
JOLIOTITE (UO2)(CO3).2H2O O
OSWALDPEETERSITE (UO2)2CO3(OH)2.4H2O M
CEJKAITE Na4(UO2)(CO3)3 A
AGRICOLAITE K4(UO2)(CO3)3 M
GRIMSELITE K3Na(UO2)(CO3)3.H2O H
BAYLEYITE Mg2(UO2)(CO3)3.18H2O M
SWARTZITE CaMg(UO2)(CO3)3.12H2O M
ANDERSONITE Na2Ca(UO2)(CO3)3.6H2O R
METAZELLERITE Ca(UO2)(CO3)2.3H2O O
ZELLERITE Ca(UO2)(CO3)2.5H2O O
FONTANITE Ca(UO2)3(CO3)4.3H2O O
LIEBIGITE Ca2(UO2)(CO3)3.11H2O O
ROUBAULTITE Cu2(UO2)3(CO3)2O2(OH)2.4H2O A
ZNUCALITE CaZn11(UO2)(CO3)3(OH)20.4H2O A
VOGLITE Ca2Cu++(UO2)(CO3)4.6H2O (?) M
URANCALCARITE Ca(UO2)3(CO3)(OH)6.3H2O O
SHARPITE Ca(UO2)6(CO3)5(OH)4.6H2O O
RABBITTITE Ca3Mg3(UO2)2(CO3)6(OH)4.18H2O M
ALBRECHTSCHRAUFITE Ca4Mg(UO2)2(CO3)6F2.17H2O A
WYARTITE CaU+++++(UO2)2(CO3)O4(OH).7H2O O
ASTROCYANITE-(Ce) Cu+2(Ce,Nd,La,Pr,Sm,Ca,Y)2(UO2)(CO3)5(OH)2.3H2O H
SHABAITE-(Nd) Ca(Nd,Y)2(UO2)(CO3)4(OH)2.6H2O M
KAMOTOITE-(Y) (Y,Nd,Gd)2U++++++4(CO3)3O12.14,5H2O M
BIJVOETITE-(Y) [(Y,REE)8(H2O)25(UO2)16O8(OH)8(CO3)16](H2O)14 M ps O
WIDENMANNITE Pb2(UO2)(CO3)3 O
5/G. Nesoborates
5/G.01 to 06 Nesoborates with [BO3]---
KOTOITE Mg3B2O6 O
JIMBOITE Mn3B2O6 O
JACQUESDIETRICHITE Cu2(OH)3BO(OH2) O
TAKEDAITE Ca3B2O6 R
NORDENSKIOLDINE CaSnB2O6 R
TUSIONITE Mn++Sn++++(BO3)2 R
PERTSEVITE-(F) Mg2(BO3,SiO4)(F,OH)0,5-1 O
PERTSEVITE-(OH) Mg2(BO3,SiO4)(OH,F)0,5-1 O
WARWICKITE Mg(Ti,Fe+++,Al)2(BO3)O O
YUANFULIITE Mg(Fe+++,Fe++,Al,Ti,Mg)(BO3)O O
PINAKIOLITE (Mg,Mn++)2(Mn+++,Sb+++)BO5 M
ALUMINOMAGNESIOHULSITE (Mg,Fe++)2(Al,Mg,Sn)2(BO3)O2 M
MAGNESIOHULSITE (Mg,Fe++)2(Fe+++,Sn++++,Mg)BO5 M
HULSITE (Fe++,Mg)2(Fe+++,Sn)BO5 M
5/G.04- Ludwigite group
LUDWIGITE Mg2Fe+++BO5 O
VONSENITE Fe++2Fe+++BO5 O
AZOPROITE (Mg,Fe++)2(Fe+++,Ti,Mg)BO5 O
FREDRIKSSONITE Mg2(Mn+++,Fe+++)BO5 O
BONACCORDITE Ni2Fe+++BO5 O
ORTHOPINAKIOLITE Mn+++7[(Mn++,Mg)xFe+++y[]z](BO3)8O16 (sum x,y,z=17) O
CHESTERMANITE Sb+++++(Mn+++,Fe+++)5[(Mn++,Mg)xFe+++y](BO3)8O16 (sum x,y=18) O
TAKEUCHIITE Mn+++11[(Mn++,Mg)xFe+++y[]z](BO3)12O24 (sum x,y,z=25) O
BLATTERITE Sb+++++3(Mn+++,Fe+++)9(Mn++,Mg)35(BO3)16O32 O
GAUDEFROYITE Ca4Mn+++3-x(BO3)3(CO3)(O,OH)3 H
FLUOBORITE Mg3(BO3)(F,OH)3 H
HYDROXYLBORITE Mg3(BO3)(OH,F)3 H
KARLITE (Mg,Al)6(BO3)3(OH,Cl)4 O
JEREMEJEVITE Al6B5O15(F,OH)3 H
PAINITE CaZrBAl9O18 H
BERBORITE (-1T,-2T,-3H) Be2(BO3)(OH,F).H2O R
BERBORITE (-1T,-2T,-2H,-3H) Be2(BO3)(OH,F).H2O H
BERBORITE (-1T,-2T,-3H) Be2(BO3)(OH,F).H2O R
WIGHTMANITE Mg5(BO3)O(OH)5.2H2O M
SHABYNITE Mg5(BO3)(Cl,OH)2(OH)5.4H2O M
CANAVESITE Mg2(CO3)(HBO3).5H2O M
SAKHAITE Ca12Mg4(BO3)7(CO3)4Cl(OH)2.H2O C
QILIANSHANITE NaH4(CO3)(BO3).2H2O M
5/G.07 to 12 Nesoborates with [BO4]-----
SINHALITE MgAlBO4 O
PSEUDOSINHALITE (Mg,Fe++)2Al3B2O9(OH) M
BEHIERITE (Ta,Nb)BO4 Q
SCHIAVINATOITE (Nb,Ta)BO4 Q
BANDYLITE CuB(OH)4Cl Q
TEEPLEITE Na2B(OH)4Cl Q
CAHNITE Ca2B(AsO4)(OH)4 Q
FROLOVITE CaB2(OH)8 A
HENMILITE Ca2Cu[B(OH)4]2(OH)4 A
HEXAHYDROBORITE Ca[B(OH)4]2.2H2O M
CARBOBORITE Ca2Mg(CO3)2B2(OH)8.4H2O M
IMAYOSHIITE Ca3Al(CO3)[B(OH)4](OH)6.12H2O H
SULFOBORITE Mg3B2(SO4)(OH)8(OH,F)2 O
SEAMANITE Mn3(PO4)B(OH)6 O
MOYDITE-(Y) YB(OH)4(CO3) O
5/H. Soroborates
5/H.01 to 04 Soroborates with [B2O5]---- to [B2O7]--
SUANITE Mg2B2O5 M
CLINOKURCHATOVITE Ca(Mg,Fe++,Mn)B2O5 M
KURCHATOVITE Ca(Mg,Mn,Fe++)B2O5 O
SZAIBELYITE MgBO2(OH) M
SUSSEXITE MnBO2(OH) M
SIBIRSKITE Ca2B2O4(OH)2 M
SHIMAZAKIITE-4M Ca2B2-xO5-3x(OH)3x (x=0-0,06) M
SHIMAZAKIITE-4O Ca2B2-xO5-3x(OH)3x (x=0-0,06) O
PARASIBIRSKITE Ca2B2O5.H2O M
WISERITE (Mn++,Mg)14B8(Si,Mg)O22(OH)10Cl Q
LUNEBURGITE Mg3B2(PO4)2(OH)6.5H2O M
PINNOITE MgB2O4.3H2O Q
SATIMOLITE KNa2Al4B6O15Cl3.13H2O O
PENTAHYDROBORITE CaB2O(OH)6.2H2O A
5/H.05 to 18 Soroborates with [B3O5]- to [B6O10]--
AMEGHINITE NaB3O3(OH)4 M
KURNAKOVITE MgB3O3(OH)5.5H2O A
INDERITE MgB3O3(OH)5.5H2O M
INDERBORITE CaMg[B3O3(OH)5]2.6H2O M
MEYERHOFFERITE Ca2B6O6(OH)10.2H2O A
INYOITE Ca2B6O6(OH)10.8H2O M
SOLONGOITE Ca2B3O4(OH)4Cl M
HYDROCHLORBORITE Ca2B4O4(OH)7Cl.7H2O M
URALBORITE CaB2O2(OH)4 M
NIFONTOVITE Ca3B6O6(OH)12(H2O)2 M
OLSHANSKYITE Ca2[B3O3(OH)6](OH)(H2O)3 M (?)
ALFREDSTELZNERITE Ca4(H2O)4[B4O4(OH)6]4(H2O)15 O
TINCALCONITE Na6[B4O5(OH)4]3.8H2O R
BORAX Na2B4O5(OH)4.8H2O M
FEDOROVSKITE Ca2(Mg,Mn)2B4O7(OH)6 O
ROWEITE Ca2Mn++2B4O7(OH)6 O
HALURGITE Mg2[B4O5(OH)4]2.H2O M
HUNGCHAOITE MgB4O5(OH)4.7H2O A ps H
WARDSMITHITE Ca5MgB24O42.30H2O H
EKATERINITE Ca2B4O7(Cl,OH)2.2H2O H
BORCARITE Ca4MgB4O6(OH)6(CO3)2 M
NUMANOITE Ca4CuB4O6(CO3)2(OH)6 M
ULEXITE NaCaB5O6(OH)6.5H2O A
AMMONIOBORITE (NH4)2B10O16.5H2O M
SANTITE KB5O6(OH)4.2H2O O
RAMANITE-(Rb) RbB5O6(OH)4.4H2O O
RAMANITE-(Cs) CsB5O6(OH)4.4H2O M
SBORGITE NaB5O6(OH)4.3H2O M
TERTSCHITE Ca4B10O19.20H2O M (?)
ADMONTITE MgB6O10.7H2O M
MCALLISTERITE Mg2B12O14(OH)12.9H2O R
AKSAITE MgB6O7(OH)6.2H2O O
RIVADAVITE Na6Mg[B6O7(OH)6]4.10H2O M
TERUGGITE Ca4MgAs2B12O22(OH)12.12H2O M
5/J. Inoborates [B2O4]-- to [B6O10]--
VIMSITE CaB2O2(OH)4 M
SANTAROSAITE Cu(B2O4) Q
CALCIBORITE CaB2O4 O
KORZHINSKITE CaB2O4.H2O M
CHELKARITE CaMgB2O4Cl2.7H2O (?) O
ALDZHANITE (?) CaMgB2O4Cl.7H2O (?) O
JARANDOLITE CaB3O4(OH)3 M
COLEMANITE Ca2B6O11.5H2O M
HYDROBORACITE CaMgB6O8(OH)6.3H2O M
KERNITE Na2B4O6(OH)2.3H2O M
LARDERELLITE (NH4)B5O6(OH)4 M
EZCURRITE Na4B10O17.7H2O A
PROBERTITE NaCaB5O7(OH)4.3H2O M
PRICEITE Ca2B5O7(OH)5.H2O A
KALIBORITE KHMg2B12O16(OH)10.4H2O M
ARISTARAINITE Na2MgB12O20.10H2O M
5/K. Phylloborates with complex [Bx(O,OH)y] groups
FABIANITE CaB3O5(OH) M
NASINITE Na2B5O8(OH).2H2O O
BIRINGUCCITE Na2B5O8(OH).H2O M
TUZLAITE NaCaB5O8(OH)2.3H2O M
HILGARDITE-1A Ca2B5O9Cl.H2O A
HILGARDITE-3A Ca2B5O9Cl.H2O A
HILGARDITE-4M Ca2B5O9Cl.H2O M
TYRETSKITE (-1A) Ca2B5O9(OH).H2O A
LEUCOSTAURITE Pb2[B5O9]Cl.0,5H2O O
HEIDORNITE Na2Ca3B5O8(SO4)2Cl(OH)2 M
VOLKOVSKITE KCa4[B5O8(OH)4][B(OH)3]Cl.4H2O A
GOWERITE CaB6O10.5H2O M
VEATCHITE Sr2B11O16(OH)5.H2O M
VEATCHITE-P (P-VEATCHITE) Sr2B11O16(OH)5.H2O M
VEATCHITE-A Sr2B11O16(OH)5.H2O A
NOBLEITE CaB6O9(OH)2.3H2O M
TUNELLITE SrB6O9(OH)2.3H2O M
BALAVINSKITE Sr2B6O11.4H2O (?)
GINORITE Ca2B14O23.8H2O M
STRONTIOGINORITE SrCaB14O20(OH)6.5H2O M
STRONTIOBORITE SrB8O11(OH)4 M
STUDENITSITE NaCa2B9O14(OH)4.2H2O M
PREOBRAZHENSKITE Mg3B11O15(OH)9 O
VITIMITE Ca6SO4B14O19(OH)14.5H2O M
BRIANROULSTONITE Ca3B5O6(OH)Cl2.8H2O M
PRINGLEITE Ca9B26O34(OH)24Cl4.13H2O A
RUITENBERGITE Ca9B26O34(OH)24Cl4.13H2O M
WALKERITE Ca16(Mg,Li)2Cl6B52O68(OH)56.28H2O O
PENOBSQUISITE Ca2(Fe++,Mg)[B9O13(OH)6]Cl.4H2O M
BRAITSCHITE-(Ce) (Ca,Na)7(Ce,La,Nd)2[B6O7(OH)3(O,OH)3]4.(H2O) H
PEPROSSIITE-(Ce) (Ce,La)Al2(B4O10)O0,5 H
5/L. Tectoborates with [BO2]- to [B6O10]--
METABORITE HBO2 C
CLINOMETABORITE HBO2 M
HAMBERGITE Be2BO3(OH) O
RHODIZITE (K,Cs)Al4Be4(B,Be)12O28 C
LONDONITE (Cs,K,Rb)Al4Be4(B,Be)12O28 C
JOHACHIDOLITE CaAlB3O7 O
BORACITE Mg3B7O13Cl O ps C
ERICAITE (Fe++,Mg,Mn)3B7O13Cl O
CHAMBERSITE Mn3B7O13Cl O
TREMBATHITE (Mg,Fe++,Mn)3B7O13Cl R
CONGOLITE (Fe++,Mg,Mn)3B7O13Cl R

Class VI - Sulfates, Chromates, Molybdates, Tungstates, (SO4)--, etc

Mineral Formula System
6/A. Anhydrous sulfates [SO4]--, without additional anion
6/A.01 to 02 Medium cations
CHALCOCYANITE CuSO4 O
ZINKOSITE (?) ZnSO4 O
MILLOSEVICHITE (Al,Fe+++)2(SO4)3 R
MIKASAITE (Fe+++,Al)2(SO4)3 R
6/A.03 to 05 Medium and very large cations
LANGBEINITE K2Mg2(SO4)3 C
MANGANOLANGBEINITE K2Mn2(SO4)3 C
CALCIOLANGBEINITE K2Ca2(SO4)3 C
EFREMOVITE (NH4)2Mg2(SO4)3 C
VANTHOFFITE Na6Mg(SO4)4 M
ELDFELLITE NaFe+++(SO4)2 M
YAVAPAIITE KFe+++(SO4)2 M
STEKLITE KAl(SO4)2 R
GODOVIKOVITE (NH4)(Al,Fe+++)(SO4)2 H
SABIEITE (NH4)Fe+++(SO4)2 R
ALUMINOPYRACMONITE (NH4)3Al(SO4)3 R
PYRACMONITE (NH4)3Fe+++(SO4)3 R ps H
6/A.06 to 09 Very large cations
MERCALLITE KHSO4 O
MISENITE K2SO4.6KHSO4 (?) M
LETOVICITE (NH4)3H(SO4)2 A
THENARDITE Na2SO4 O
ARCANITE K2SO4 0
ARCANITE 'TAYLORITE' K2SO4 O
MASCAGNITE (NH4)2SO4 O
APHTHITALITE (K,Na)3Na(SO4)2 R
MOHNITE (NH4)K2Na(SO4)2 R
KALISTRONTITE K2Sr(SO4)2 R
PALMIERITE (K,Na)2Pb(SO4)2 R
GLAUBERITE Na2Ca(SO4)2 M
ANHYDRITE CaSO4 O
6/A.09 Baryte group
CELESTINE SrSO4 O
BARYTE BaSO4 O
HASHEMITE Ba(Cr,S)O4 O
ANGLESITE PbSO4 O
6/B. Anhydrous sulfates [SO4]--, with additional anions
6/B.01 to 10 Medium cations
DOLEROPHANITE Cu2(SO4)O M
ANTLERITE Cu3(SO4)(OH)4 O
BROCHANTITE Cu4(SO4)(OH)6 M
KLEBELSBERGITE Sb+++4O4(OH)2(SO4) O
COQUANDITE Sb6+xO8+x(SO4)(OH)x.(H2O)1-x (x = 0.3) A
TAVAGNASCOITE Bi4O4(SO4)(OH)2 O
SCHUETTEITE Hg3(SO4)O2 H
DANSITE (D'ANSITE) Na21Mg(SO4)10Cl3 C
DANSITE-Fe (D'ANSITE-Fe) Na21Fe++(SO4)10Cl3 C
DANSITE-Mn (D'ANSITE-Mn) Na21Mn++(SO4)10Cl3 C
YEELIMITE (YE'ELIMITE) Ca4Al6O12(SO4) C
ADRANOSITE-(Al) (NH4)4NaAl2(SO4)4(OH)2Cl Q
ADRANOSITE-(Fe) (NH4)4NaFe2(SO4)4Cl(OH)2 Q
THERASIAITE (NH4)3KNa2Fe++Fe+++(SO4)3Cl5 M
FEDOTOVITE K2Cu++3O(SO4)3 M
CHLOROTHIONITE K2Cu(SO4)Cl2 O
KAMCHATKITE KCu++3OCl(SO4)2 O
GREGORYITE (Na2,K2,Ca)CO3 H (?)
PIYPITE K2Cu2(SO4)2O Q
ALUMOKLYUCHEVSKITE K3Cu3(Al,Fe+++)O2(SO4)4 M
KLYUCHEVSKITE K3Cu3(Fe+++,Al)O2(SO4)4 M
EUCHLORINE KNaCu++3(SO4)3O M
WULFFITE K3NaCu4O2(SO4)4 O
PARAWULFFITE K5Na3Cu8O4(SO4)8 M
NABOKOITE Cu++7Te++++O4(SO4)5.KCl Q
ATLASOVITE Cu6Fe+++Bi+++O4(SO4)5.KCl Q
SIDPIETERSITE Pb4(S2O3)O2(OH)2 A
FASSINAITE Pb++2(S2O3)(CO3) O
STEVERUSTITE Pb++5Cu+(S++++++O3S--)3(OH)5.2H2O M
ITOITE Pb3Ge(SO4)2O2(OH)2 O
CALEDONITE Pb5Cu2(CO3)(SO4)3(OH)6 O
LINARITE PbCu(SO4)(OH)2 M
SCHMIEDERITE Pb2Cu++2(Se++++O3)(Se++++++O4)(OH)4 M
MUNAKATAITE Pb2Cu(Se++++O3)(SO4)(OH)4 M
CHENITE Pb4Cu(SO4)2(OH)6 A
ELYITE Pb4Cu(SO4)O2(OH)4.H2O M
MAMMOTHITE Pb6Cu4AlSb+++++O2(SO4)2Cl4(OH)16 M
GRANDVIEWITE Cu3Al9(SO4)2(OH)29 M
6/B.11 to 14 Large cations
6/B.11- Alunite group
NATROALUNITE Na2Al6(SO4)4(OH)12 R
ALUNITE K2Al6(SO4)4(OH)12 R
AMMONIOALUNITE (NH4)2Al6(SO4)4(OH)12 R
NATROALUNITE-2R (Na,Ca,K)2Al6(SO4)4(OH)12 R
HUANGITE CaAl6(SO4)4(OH)12 R
WALTHIERITE BaAl6(SO4)4(OH)12 R
NATROJAROSITE Na2Fe+++6(SO4)4(OH)12 R
JAROSITE K2Fe+++6(SO4)4(OH)12 R
DORALLCHARITE (Tl,K)2Fe+++6(SO4)4(OH)12 O
AMMONIOJAROSITE (NH4)2Fe+++6(SO4)4(OH)12 R
HYDRONIUMJAROSITE (H3O+)2Fe+++6(SO4)4(OH)12 R
ARGENTOJAROSITE Ag+2Fe+++6(SO4)4(OH)12 R
PLUMBOJAROSITE PbFe+++6(SO4)4(OH)12 R
OSARIZAWAITE Pb2Cu++Al4(SO4)4(OH)12 R
BEAVERITE-Zn Pb(Fe2Zn)(SO4)2(OH) R
BEAVERITE-Cu Pb(Cu++,Fe+++,Al)6(SO4)4(OH)12 R
KRIVOVICHEVITE Pb3Al(SO4)(OH)7 R
SULPHOHALITE Na6(SO4)2FCl C
GALEITE Na15(SO4)5F4Cl R
SCHAIRERITE Na21(SO4)7F6Cl R
KOGARKOITE Na3(SO4)F M
KRASHENINNIKOVITE KNa2CaMg(SO4)3F H
CESANITE Na3Ca2(SO4)3(OH) H
CARACOLITE Na2(Pb2Na)(SO4)3Cl M ps H
AIOLOSITE Na4Bi+++(SO4)3Cl H
LANARKITE Pb2(SO4)O M
OLSACHERITE Pb2(SeO4)(SO4) O
GRANDREEFITE Pb2SO4F2 M
PSEUDOGRANDREEFITE Pb6SO4F1O O ps Q
LEADHILLITE Pb4(SO4)(CO3)2(OH)2 M ps A
MACPHERSONITE Pb4(SO4)(CO3)2(OH)2 O
SUSANNITE Pb4(SO4)(CO3)2(OH)2 R
HECTORFLORESITE Na9(IO3)(SO4)4 M
BURKEITE Na6(CO3)(SO4)2 O
HANKSITE KNa22(SO4)9(CO3)2Cl H
CANNONITE Bi2O(OH)2SO4 M
RIOMARINAITE Bi(OH)SO4.H2O M
LEGUERNITE Bi38O42(SO4)15 M
6/C. Hydrous sulfates [SO4]--, without additional anion
6/C.01 to 11 Medium cations
6/C.01- Kieserite group
KIESERITE MgSO4.H2O M
SZOMOLNOKITE Fe++SO4.H2O M
SZMIKITE Mn++SO4.H2O M
COBALTKIESERITE Co(SO4).H2O M
DWORNIKITE (Ni,Fe++)SO4.H2O M
POITEVINITE (Cu++,Fe++,Zn)SO4.H2O A
GUNNINGITE (Zn,Mn++)SO4.H2O M
SANDERITE MgSO4.2H2O (?)
BONATTITE CuSO4.3H2O M
6/C.03- Rozenite group
STARKEYITE MgSO4.4H2O M
CRANSWICKITE MgSO4.4H2O M
ROZENITE Fe++SO4.4H2O M
ILESITE (Mn++,Zn,Fe++)SO4.4H2O M
APLOWITE (Co,Mn++,Ni)SO4.4H2O M
BOYLEITE (Zn,Mg)SO4.4H2O M
6/C.04- Chalcanthite group
PENTAHYDRITE MgSO4.5H2O A
SIDEROTIL (Fe++,Cu)SO4.5H2O A
JOKOKUITE Mn++SO4.5H2O A
CHALCANTHITE Cu++SO4.5H2O A
6/C.05- Hexahydrite group
HEXAHYDRITE MgSO4.6H2O M
FERROHEXAHYDRITE Fe++SO4.6H2O M
CHVALETICEITE (Mn++,Mg)SO4.6H2O M
MOORHOUSEITE (Co,Ni,Mn++)SO4.6H2O M
NICKELHEXAHYDRITE (Ni,Mg,Fe++)(SO4).6H2O M
BIANCHITE (Zn,Fe++)(SO4).6H2O M
RETGERSITE NiSO4.6H2O Q
6/C.06- Melanterite group
ALPERSITE (Mg,Cu)SO4.7H2O M
MELANTERITE Fe++SO4.7H2O M
MALLARDITE Mn++SO4.7H2O M
BIEBERITE CoSO4.7H2O M
BOOTHITE CuSO4.7H2O M
ZINCMELANTERITE (Zn,Cu++,Fe++)SO4.7H2O M
EPSOMITE MgSO4.7H2O O
MORENOSITE NiSO4.7H2O O
GOSLARITE ZnSO4.7H2O O
MERIDIANIITE MgSO4.11H2O A
RHOMBOCLASE (H5O2)+Fe+++(SO4)2.2H2O O
LAUSENITE Fe+++2(SO4)3.6H2O M
KORNELITE Fe+++2(SO4)3.7H2O M
ALUMINOCOQUIMBITE AlFe+++(SO4)3.9H2O R
COQUIMBITE Fe+++2(SO4)3.9H2O R
PARACOQUIMBITE Fe+++2(SO4)3.9H2O R
QUENSTEDTITE Fe+++2(SO4)3.10H2O A
ALUNOGEN Al2(SO4)3.17H2O A
METAALUNOGEN (META-ALUNOGEN) Al4(SO4)6.27H2O M
ZIRCOSULFATE Zr(SO4)2.4H2O O
ROMERITE Fe++Fe+++2(SO4)4.14H2O A
LISHIZHENITE ZnFe+++2(SO4)4.14H2O A
RANSOMITE CuFe+++2(SO4)4.6H2O M
6/C.12 to 20 Medium and very large cations
6/C.12- Halotrichite group
PICKERINGITE MgAl2(SO4)4.22H2O M
WUPATKIITE (Co,Mg,Ni)Al2(SO4)4.22H2O M
HALOTRICHITE Fe++Al2(SO4)4.22H2O M
APJOHNITE Mn++Al2(SO4)4.22H2O M
DIETRICHITE (Zn,Fe++,Mn++)Al2(SO4)4.22H2O M
REDINGTONITE (Fe++,Mg,Ni)(Cr,Al)2(SO4)4.22H2O M
BILINITE Fe++Fe+++2(SO4)4.22H2O M
MENDOZITE NaAl(SO4)2.11H2O M
KALINITE KAl(SO4)2.11H2O M (?)
ALUM-(Na) NaAl(SO4)2.12H2O C
ALUM-(K) KAl(SO4)2.12H2O C
TSCHERMIGITE (NH4)Al(SO4)2.12H2O C
LONECREEKITE (NH4)(Fe+++,Al)(SO4)2.12H2O C
LANMUCHANGITE TlAl(SO4)2.12H2O C
PERTLIKITE K2(Fe++,Mg,Mn++)2(Mg,Fe+++)4Fe+++2Al(SO4)12.18H2O Q ps C
VOLTAITE K2Fe++5Fe+++4(SO4)12.18H2O C
ZINCOVOLTAITE K2Zn5Fe+++3Al(SO4)12.18H2O C
AMMONIOMAGNESIOVOLTAITE (NH4)2Mg5Fe+++3Al(SO4)12.18H2O C
MAGNESIOVOLTAITE K2Mg5Fe+++3Al(SO4)12.18H2O C
KRAUSITE KFe+++(SO4)2.H2O M
TAMARUGITE NaAl(SO4)2.6H2O M
AMARILLITE NaFe++(SO4)2.6H2O M
KROHNKITE Na2Cu(SO4)2.2H2O M
FERRINATRITE Na3Fe+++(SO4)3.3H2O R
GOLDICHITE KFe+++(SO4)2.4H2O M
LOWEITE Na12Mg7(SO4)13.15H2O R
BLODITE Na2Mg(SO4)2.4H2O M
NICKELBLODITE Na2(Ni,Mg)(SO4)2.4H2O M
COBALTOBLODITE Na2(Co,Mg)(SO4)2.4H2O M
MANGANOBLODITE Na2(Mn++,Mg)(SO4)2.4H2O M
CHANGOITE Na2Zn(SO4)2.4H2O M
LEONITE K2Mg(SO4)2.4H2O M
MEREITERITE K2Fe++(SO4)2.4H2O M
KONYAITE Na2Mg(SO4)2.5H2O M
6/C.19- Picromerite group
PICROMERITE K2Mg(SO4)2.6H2O M
CYANOCHROITE K2Cu++(SO4).6H2O M
BOUSSINGAULTITE (NH4)2Mg(SO4)2.6H2O M
NICKELBOUSSINGAULTITE (NH4)2(Ni,Mg)(SO4)2.6H2O M
MOHRITE (NH4)2Fe++(SO4)2.6H2O M
POLYHALITE K2Ca2Mg(SO4)4.2H2O A
LEIGHTONITE K2Ca2Cu(SO4)4.2H2O A ps O
GORGEYITE K2Ca5(SO4)6.H2O M
6/C.21 to 22 Very large cations
MATTEUCCITE NaHSO4.H2O M
LECONTITE (NH4,K)Na(SO4).2H2O O
EUGSTERITE Na4Ca(SO4)3.2H2O M (?)
OMONGWAITE (Na,K)2Ca5(SO4)6.3H2O M ps H
HYDROGLAUBERITE Na4Ca(SO4)3.2H2O M
WATTEVILLITE Na2Ca(SO4)2.4H2O (?) O (?)
SYNGENITE K2Ca(SO4)2.H2O M
KOKTAITE (NH4)2Ca(SO4)2.H2O M
MIRABILITE Na2SO4.10H2O M
BASSANITE 2CaSO4.H2O M ps H
GYPSUM CaSO4.2H2O M
RAPIDCREEKITE Ca2(SO4)(CO3).4H2O O
ARDEALITE Ca2(SO4)(HPO4).4H2O M
BEHOUNEKITE U++++(SO4)2.4H2O O
6/D. Hydrous sulfates [SO4]--, with additional anions
6/D.01 to 10 Medium cations
BUTLERITE Fe+++(SO4)(OH).2H2O M
PARABUTLERITE Fe+++(SO4)(OH).2H2O O
VOLASCHIOITE Fe+++4(SO4)O2(OH)6.2H2O M
METAHOHMANNITE Fe+++2(SO4)2O.4H2O (?)
AMARANTITE Fe+++2(SO4)2O.7H2O A
HOHMANNITE Fe+++2(SO4)2O.8H2O A
FIBROFERRITE Fe+++(SO4)(OH).5H2O M
XITIESHANITE Fe+++(SO4)(OH).7H2O M
CAMINITE Mg7(SO4)5(OH)4.H2O Q
MONTETRISAITE Cu6(SO4)(OH)10.H2O O
REDGILLITE Cu6(SO4)(OH)10.H2O M
POSNJAKITE Cu4(SO4)(OH)6.H2O M
LANGITE Cu4(SO4)(OH)6.2H2O M
WROEWOLFEITE Cu4(SO4)(OH)6.2H2O M
NAMUWITE (Zn,Cu)4(SO4)(OH)6.4H2O H
LAHNSTEINITE Zn4(SO4)(OH)6.3H2O A ps H
OSAKAITE Zn4(SO4)(OH)6.5H2O A
GUARINOITE (Zn,Co,Ni)6(SO4)(OH,Cl)10.5H2O H
SCHULENBERGITE (Cu,Zn)7(SO4,CO3)2(OH)10.3H2O R
MINOHLITE (Cu,Zn)7(SO4)2(OH)10.8H2O R ps H
CHRISTELITE Zn3Cu2(SO4)2(OH)6.4H2O A
KTENASITE (Cu,Zn)5(SO4)2(OH)6.6H2O M
RAMSBECKITE (Cu,Zn)15(SO4)4(OH)22.6H2O M
NAKAURIITE Cu8(SO4)4(CO3)(OH)6.48H2O O
MOOREITE (Mg,Zn,Mn)15(SO4)2(OH)26.8H2O M
TORREYITE (Mg,Mn)9Zn4(SO4)2(OH)22.8H2O M
LAWSONBAUERITE (Mn,Mg)9Zn4(SO4)2(OH)22.8H2O M
HAUCKITE (Mg,Mn++)24Zn18Fe+++3(SO4)4(CO3)2(OH)81 (?) H
PAUFLERITE V++++O(SO4) O
BOBJONESITE V++++O(SO4).3H2O M
ORTHOMINASRAGRITE V++++O(SO4).5H2O O
ANORTHOMINASRAGRITE V++++O(SO4).5H2O A
MINASRAGRITE V++++O(SO4).5H2O M
BOBJONESITE V++++O(SO4).3H2O M
ANORTHOMINASRAGRITE V++++O(SO4).5H2O M
STANLEYITE V++++O(SO4).6H2O O
KARPOVITE Tl2VO(SO4)2(H2O) M
EVDOKIMOVITE Tl4(VO)3(SO4)5(H2O)5 M
JURBANITE Al(SO4)(OH).5H2O M
KHADEMITE Al(SO4)F.5H2O O
MANGAZEITE Al2(SO4)(OH)4.3H2O A
METAALUMINITE (META-ALUMINITE) Al2(SO4)(OH)4.5H2O M
ALUMINITE Al2(SO4)(OH)4.7H2O M ps O
VENDIDAITE Al2(SO4)Cl(OH)3.6H2O M
FELSOBANYAITE Al4(SO4)(OH)10.4H2O H
HYDROBASALUMINITE Al4(SO4)(OH)10.12-36H2O M
ZAHERITE Al12(SO4)5(OH)26.20H2O A
WILCOXITE MgAl(SO4)2F.18H2O A
SVYAZHINITE (Mg,Mn)(Al,Fe+++)(SO4)2F.14H2O A
MAGNESIOAUBERTITE (Mg,Cu)Al(SO4)2Cl.14H2O A
AUBERTITE CuAl(SO4)2Cl.14H2O A
COSSAITE (Mg0,5,[])Al6(SO4)6(HSO4)F6.36H2O R ps H
BECHERERITE Zn7Cu(OH)13[SiO(OH)3](SO4) R
SPANGOLITE Cu6Al(SO4)(OH)12Cl.3H2O R
CYANOTRICHITE Cu4Al2(SO4)(OH)12.2H2O O
CARBONATECYANOTRICHITE Cu++4Al2(CO3,SO4)(OH)12.2H2O O
CAMEROLAITE Cu6Al3(OH)18(H2O)2[Sb(OH)6](SO4) M
WOODWARDITE Cu4Al2(SO4)(OH)12.2-4H2O (?) H
HYDROWOODWARDITE [Cu1-xAlx(OH)2][(SO4)0,5x(H2O)n] (x lower than 0,67; n = about 1,5x) R
ZINCOWOODWARDITE (Zn,Cu)5,5-4Al2,5-4(SO4)1,5-2(OH)16.5-8H2O R ps H
CHALCOALUMITE CuAl4(SO4)(OH)12(H2O)3 M
KYRGYZSTANITE (Zn,Ni)Al4(SO4)(OH)12.3H2O M
NICKELALUMITE NiAl4(SO4)(OH)12(H2O)3 M
MBOBOMKULITE (Ni,Cu)Al4[(NO3)2,(SO4)](OH)12.3H2O M
HYDROMBOBOMKULITE (Ni,Cu)Al4[(NO3)2,(SO4)](OH)12.13-14H2O M (?)
CARRBOYDITE (Ni,Cu)14Al9(SO4,CO3)6(OH)43.7H2O (?) H
ZINCALUMINITE Zn6Al6(SO4)2(OH)26.5H2O H (?)
GLAUCOCERINITE (Zn,Cu)10Al6(SO4)3(OH)32.18H2O H
HONESSITE Ni6Fe+++2(SO4)(OH)16.4H2O R
HYDROHONESSITE Ni6Fe+++2(SO4)(OH)16.7H2O H
MOUNTKEITHITE (Mg,Ni)11(Fe+++,Cr,Al)3(OH)24(SO4,CO3)3,5.11H2O H
6/D.10- Copiapite group
BOTRYOGEN MgFe+++(SO4)2(OH).7H2O M
ZINCOBOTRYOGEN (Zn,Mg,Mn)Fe+++(SO4)2(OH).7H2O M
CALCIOCOPIAPITE CaFe+++4(SO4)6(OH)2.19H2O A
MAGNESIOCOPIAPITE MgFe+++4(SO4)6(OH)2.20H2O A
COPIAPITE Fe++Fe+++4(SO4)6(OH)2.20H2O A
CUPROCOPIAPITE Cu++Fe+++4(SO4)6(OH)2.20H2O A
ZINCOCOPIAPITE ZnFe+++4(SO4)6(OH)2.18H2O A
ALUMINOCOPIAPITE (Al,Mg)Fe+++4(SO4)6(OH)2.20H2O A
FERRICOPIAPITE (Fe+++,Al,Mg)Fe+++5(SO4)6(OH)2.20H2O A
GUILDITE CuFe+++(SO4)2(OH).4H2O M
CHAIDAMUNITE CuFe(SO4)2(OH).4H2O A ps M
6/D.11 to 19 Medium and very large cations
DESPUJOLSITE Ca3Mn++++(SO4)2(OH)6.3H2O H
SCHAURTEITE Ca3Ge++++(SO4)2(OH)6.3H2O H
FLEISCHERITE Pb3Ge(SO4)2(OH)6.3H2O H
MALLESTIGITE Pb3Sb+++++(SO4)(AsO4)(OH)6.3H2O H
PERETAITE CaSb+++4O4(OH)2(SO4)2.2H2O M
VLODAVETSITE AlCa2(SO4)2F2Cl.4H2O Q
6/D.13- Ettringite group
ETTRINGITE Ca6Al2(SO4)3(OH)12.26H2O H
BENTORITE Ca6(Cr,Al)2(SO4)3(OH)12.26H2O H
KOTTENHEIMITE Ca3Si(OH)6(SO4)2.12H2O H
HIELSCHERITE Ca3Si(OH)6(SO4)(SO3).11H2O H
THAUMASITE Ca6Si2(CO3)2(SO4)2(OH)12.24H2O H
JOURAVSKITE Ca6Mn++++2(SO4,CO3)4(OH)12.26H2O H
CARRARAITE Ca3Ge++++(OH)6(SO4)(CO3).12H2O H
CHARLESITE Ca6(Al,Si)2(SO4)2B(OH)4(OH,O)12.26H2O H
STURMANITE Ca6(Fe+++,Al,Mn++)2(SO4)2[B(OH)4](OH)12.25H2O H
BURYATITE Ca3(Si,Fe+++,Al)(SO4)[B(OH)4](O,OH)5O.12H2O R ps H
METAVOLTINE K2Na6Fe++Fe+++6(SO4)12O2.18H2O H
MOTUKOREAITE NaMg6Al3(SO4)2(OH)18.12H2O H
NATROGLAUCOCERINITE (Na,Zn,Cu)10Al6(SO4)3(OH)32.18(H2O) (?)  
NIKISCHERITE NaFe++6Al3(SO4)2(OH)18.12H2O R
SHIGAITE NaMn++6Al3(SO4)2(OH)18.12H2O R
WERMLANDITE (Ca,Mg)Mg7(Al,Fe+++)2(SO4)2(OH)18.12H2O (?) R
LANNONITE HCa4Mg2Al4(SO4)8F9.32H2O Q
SLAVIKITE (H3O+)3Mg6Fe15(SO4)21(OH)18.98H2O R
SIDERONATRITE Na2Fe+++(SO4)2(OH).3H2O O
METASIDERONATRITE Na2Fe+++(SO4)2(OH).H2O O
ALCAPARROSSAITE K3Ti++++Fe+++(SO4)4O(H2O)2 M
CLAIRITE (NH4)2(Fe+++,Mn+++)3(SO4)4(OH)3.3H2O A
HUIZINGITE-(Al) (NH4)9Al3(SO4)8(OH)2.4H2O A
CARLSONITE (NH4)5Fe+++3O(SO4)6.7H2O A
DARAPSKITE Na3(SO4)(NO3).H2O M
WITZKEITE K4Na4Ca(SO4)4(NO3)2.2 H2O M
UNGEMACHITE K3Na8Fe+++(SO4)6(NO3)2.6H2O R
CLINOUNGEMACHITE K2Na3Fe(SO4)6(OH)3.9H2O M ps R
HUMBERSTONITE K3Na7Mg2(SO4)6(NO3)2.6H2O R
FUENZALIDAITE K6(Na,K)4Na6Mg10(SO4)12(IO3)12.12H2O R
CARLOSRUIZITE K6(Na,K)4Na6Mg10(Se++++++O4)12(IO3)12.12H2O R
GEORGEERICKSENITE (GEORGE-ERICKSENITE) Na6CaMg(IO3)6(CrO4,SO4)2.12H2O R
NASLEDOVITE PbMn3Al4(CO3)4(SO4)O5.5H2O (?)
KAINITE MgSO4.KCl.3H2O M
KONONOVITE NaMg(SO4)F M
UKLONSKOVITE NaMg(SO4)F2H2O M
NATROCHALCITE NaCu2(SO4)2(OH,H2O)2 M
KALIOCHALCITE KCu2(SO4)2[(OH)(H2O)] M
CAMPIGLIAITE Cu++4Mn++(SO4)2(OH)6.4H2O M
EDWARDSITE Cd2(Cu,Zn)3(SO4)2(OH)3.4H2O M
NIEDERMAYRITE Cu4Cd(SO4)2(OH)6.4H2O M
KOBYASHEVITE Cu5(SO4)2(OH)6.4H2O A
DEVILLINE CaCu4(SO4)2(OH)6.3H2O M
ALDRIDGEITE (Cd,Ca)(Cu,Zn)4(SO4)2(OH)6.3H2O M
SERPIERITE Ca(Cu,Zn)4(SO4)2(OH)6.3H2O M
ORTHOSERPIERITE Ca(Cu,Zn)4(SO4)2(OH)6.3H2O O
LAUTENTHALITE PbCu++4(OH)6(SO4)2.3H2O M
ARZRUNITE Cu4Pb2SO4O2Cl6.4H2O (?) O
TATARSKITE Ca6Mg2(SO4)2(CO3)2Cl4(OH)4.7H2O O
VONBEZINGITE Ca6Cu++3(SO4)3(OH)12.2H2O M
6/D.20 to 21 Uranylsulfates with [UO2]++ and [SO4]--
JACHYMOVITE (UO2)8(SO4)(OH)14.13H2O M (?)
URANOPILITE (UO2)6(SO4)(OH)6O2.14H2O A
METAURANOPILITE (UO2)6(SO4)(OH)10.5H2O M
PLASILITE Na(UO2)(SO4)(OH).2H2O M
JEZEKITE Na8[UO2(CO3)3(SO4)2].2H2O H
ADOLFPATERAITE K(UO2)(SO4)(OH).H2O M
MATHESIUSITE K5(UO2)4(SO4)4(VO5)(H2O)4 Q
MEISSERITE Na5(UO2)(SO4)3(SO3OH)(H2O) A
BELAKOVSKIITE Na7(UO2)(SO4)4(SO3OH)(H2O)3 A
BLUELIZARDITE Na7(UO2)(SO4)4Cl(H2O)2 M
NATROZIPPEITE Na5(UO2)8(SO4)4O5(OH)3.12H2O M
ZIPPEITE K1,85H+0,15[(UO2)4O2(SO4)2(OH)2](H2O)4 M
COBALTZIPPEITE Co(UO2)2(SO4)O2.3,5H2O M
NICKELZIPPEITE Ni(UO2)2(SO4)O2.3,5H2O M
MAGNESIUMZIPPEITE Mg(UO2)2(SO4)O2.3,5H2O M
ZINCZIPPEITE Zn(UO2)2(SO4)O2.3,5H2O M
MARECOTTITE Mg3(H2O)18[(UO2)4O3(OH)(SO4)2]2.10H2O A
SEJKORAITE-(Y) (Y1,98Dy0,24)H+0,34[(UO2)8O88O7OH(SO4)4](OH)(H2O)26 A
DELIENSITE Fe++(UO2)2(SO4)2(OH)2.3H2O O
RABEJACITE Ca2[(UO2)4O4(SO4)2](H2O)8 A
LEYDETITE Fe(UO2)(SO4)2(H2O)11 M
JOHANNITE Cu(UO2)2(SO4)2(OH)2.8H2O A
PSEUDOJOHANNITE Cu3(OH)2[(UO2)4O4(SO4)2](H2O)12 A
SCHROCKINGERITE NaCa3(UO2)(CO3)3(SO4)F.10H2O A
BESHTAUITE (NH4)2(UO2)(SO4)2.2H2O M
6/F.01 to 05 Chromates [CrO4]--
TARAPACAITE K2CrO4 O
CHROMATITE CaCrO4 Q
CROCOITE PbCrO4 M
WATTERSITE Hg+4Hg++Cr++++++O6 M
EDOYLERITE Hg++3Cr++++++O4S2 M
DEANESMITHITE Hg+2Hg++3Cr++++++O5S2 A
VAUQUELINITE Pb2Cu++(CrO4)(PO4)(OH) M
FORNACITE (Pb,Cu++)3[(Cr,As)O4]2(OH) M
MOLYBDOFORNACITE Pb2Cu[(As,P)O4][(Mo,Cr)O4](OH) M
PHOENICOCHROITE Pb2(CrO4)O M
GEORGEROBINSONITE Pb4(CrO4)2(OH)2FCl O
REYNOLDSITE Pb2Mn++++2O5(CrO4) A
SANTANAITE Pb11CrO16 H
IQUIQUEITE K3Na4Mg(Cr++++++O4)B24O39(OH).12H2O H
EMBREYITE Pb5(CrO4)2(PO4)2.H2O M
CASSEDANNEITE Pb5(VO4)2(CrO4)2.H2O M
LOPEZITE K2Cr2O7 A
6/G.01 to 02 Molybdates [MoO4]--, Wolframates (tungstates) [WO4]--
POWELLITE CaMoO4 Q
SCHEELITE CaWO4 Q
PARANIITE-(Y) Ca2Y(AsO4)(WO4)2 Q
WULFENITE PbMoO4 Q
SUSEINARGIUITE Na0,5Bi0,5(MoO4) Q
STOLZITE PbWO4 Q
RASPITE PbWO4 M
KOECHLINITE Bi2MoO6 O
RUSSELLITE Bi2WO6 Q
BIEHLITE (Sb+++,As+++)2(MoO6) M
LINDGRENITE Cu3(MoO4)2(OH)2 M
SZENICSITE Cu3MoO4(OH)4 O
CUPROTUNGSTITE Cu++3(WO4)2(OH)2 Q
MARKASCHERITE Cu3(MoO4)(OH)4 M
CUPROMOLYBDITE Cu3(MoO4)O O
FERRIMOLYBDITE Fe+++2(MoO4)3.8H2O (?) O (?)
TANCAITE-(Ce) Fe+++(Ce,La,Nd)(MoO4)3.3H2O R ps C
OPHIRITE Ca2Mg4[Zn2Mn+++2(H2O)2(Fe+++W9O34)2].46H2O A
6/G.04 to 07 Uranylmolybdates with [UO2]++ and [MoO4]--
SEDOVITE U(MoO4)2 O
NURAGHEITE Th(MoO4)2.H2O M
ICHNUSAITE Th(MoO4)2.3H2O M
MOURITE U++++Mo++++++5O12(OH)10 M
UMOHOITE (UO2)MoO4.2H2O A
MOLURANITE H4U++++(UO2)3(MoO4)7.18H2O am.
DELORYITE Cu++4(UO2)(MoO4)2(OH)6 M
CALCURMOLITE (Ca,Na)2(UO2)3(MoO4)2(O,OH)3.10-15H2O M
TENGCHONGITE CaU++++++6Mo++++++2O25.12H2O O
COUSINITE MgU2Mo2O13.6H2O (?) (?)
IRIGINITE UO2Mo2O7.3H2O O
URANOTUNGSTITE (Fe++,Ba,Pb)(UO2)2WO4(OH)4.12H2O O

Class VII - Phosphates, Arsenates, Vanadates (PO4)---, etc.

Mineral Formula System
7/A. Anhydrous phosphates [PO4]--- without additional anion
7/A.01- Very small cations: Li, Be, Al
BERLINITE AlPO4 R
ALARSITE AlAsO4 R
RODOLICOITE Fe+++3(PO4) R
LITHIOPHOSPHATE Li3PO4 O
NALIPOITE NaLi2PO4 O
OLYMPITE LiNa5(PO4)2 O
BERYLLONITE NaBePO4 M
HURLBUTITE CaBe2(PO4)2 M
STRONTIOHURLBUTITE SrBe2(PO4)2 M
7/A.02 to 05 Medium cations: mainly Fe, Mn
SIMFERITE Li0,5(Mg,Mn+++)5(PO4)3 O
TRIPHYLITE LiFe++PO4 O
LITHIOPHILITE LiMnPO4 O
FERRISICKLERITE Li(Fe+++,Mn++)PO4 O
SICKLERITE Li(Mn++,Fe+++)PO4 O
HETEROSITE Fe+++PO4 O
PURPURITE Mn+++PO4 O
MARICITE NaFe++PO4 O
KARENWEBBERITE Na(Fe++,Mn++)PO4 O
NATROPHILITE NaMnPO4 O
CHOPINITE (Mg,Fe++)3(PO4)2 M
SARCOPSIDE (Fe++,Mn,Mg)3(PO4)2 M
GRAFTONITE (Fe++,Mn,Ca)3(PO4)2 M
BEUSITE (Mn++,Fe++,Ca,Mg)3(PO4)2 M
ZAVALIAITE (Mn++,Fe++,Mg)3(PO4)2 M
FARRINGTONITE Mg3(PO4)2 M
STANFIELDITE Ca4(Mg,Fe++,Mn)5(PO4)6 M
PANETHITE (Na,Ca,K)2(Mg,Fe++,Mn)2(PO4)2 M
BRIANITE Na2CaMg(PO4)2 M
TUITE gamma-(Ca,Mg,Na)3(PO4)2 R
WOPMAYITE Ca6Na3[]Mn(PO4)3(PO3OH)4 R
MERRILLITE Ca9Na(Mg,Fe)(PO4)7 R
FERROMERRILLITE Ca9NaFe++(PO4)7 R
BOBDOWNSITE Ca9Mg(PO4)6(PO3F)  
WHITLOCKITE Ca9(Mg,Fe++)(PO4)6(PO3OH) R
STRONTIOWHITLOCKITE Sr7(Mg,Ca)3(PO4)6[PO3(OH)] R
HEDEGAARDITE (Ca,Na)9(Ca,Na)Mg(PO4)6(PO3OH) R
7/A.06 to 11 Medium and large cations: Mg, Mn, Fe, Cu, Zn and Ca, Na
QINGHEIITE-(Fe++) Na2Fe++Mg(Al,Fe+++)(PO4)3 M
QINGHEIITE Na2NaMn++2Mg2(Al,Fe+++)2(PO4)6 M
BOBFERGUSONITE Na2Mn++5Fe+++Al(PO4)6 M
ZHANGHUIFENITE Na3Mn++4Mg2Al(PO4)6 M
MANITOBAITE (Na,Ca)3(Mn++,Fe++)5(Al,Fe+++)1,5(PO4)6 M
FERROWYLLIEITE (Na,Ca,Mn)(Fe++,Mn)(Fe++,Fe+++,Mg)Al(PO4)3 M
WYLLIEITE (Na,Ca,Mn++)(Mn++,Fe++)(Fe++,Fe+++,Mg)Al(PO4)3 M
FERROROSEMARYITE []NaFe++Fe+++Al(PO4)3 M
ROSEMARYITE (Na,Ca,Mn++)(Mn++,Fe++)(Fe+++,Fe++,Mg)Al(PO4)3 M
FERROALLUAUDITE NaCaFe++(Fe++,Mn++,Fe+++)2(PO4)3 M
ALLUAUDITE NaCaFe++(Mn++,Fe++,Fe+++,Mg)2(PO4)3 M
MAGHAGENDORFITE NaMn++Mg(Fe++,Fe+++)2(PO4)3 M
FERROHAGENDORFITE (Na,Ca)2Fe++(Fe++,Fe+++)2(PO4)3 (?) M
HAGENDORFITE NaCaMn++(Fe++,Fe+++,Mg)2(PO4)3 M
VARULITE (Na,Ca)Mn++(Mn++,Fe++,Fe+++)2(PO4)3 M
CANUTITE NaMn++3[AsO4]2[AsO2(OH)2] M
GROATITE NaCaMn++2(PO4)[PO3(OH)]2 M
ARSENIOPLEITE NaCaMn++(Mn++,Mg)2(AsO4)3 M
CARYINITE Na(Ca,Pb)(Ca,Mn)(Mn,Mg)2(AsO4)3 M
HATERTITE Na2(Ca, Na)(Fe+++, Cu)2(AsO4)3 M
7/A.06- Hagendorfite-Wyllieite groups
JOHILLERITE Na(Mg,Zn)3Cu(AsO4)3 M
BRADACZEKITE NaCu4(AsO4)3 M
ODANIELITE (O'DANIELITE) Na(Zn,Mg)3H2(AsO4)3 M
YAZGANITE Na(Mg,Mn)Fe+++2(AsO4)3.H2O M
NICKENICHITE Na0,8Ca0,4(Mg,Fe+++,Al)3Cu0,4(AsO4)3 M
YURMARINITE Na7(Fe+++,Mg,Cu)4(AsO4)6 R
CALCIOJOHILLERITE NaCaMg3(AsO4)3 M
GALILEIITE (Na,K)12(Fe++,Mn++,Cr)48(PO4)36 R
CHLADNIITE Na12Ca5(Mg,Fe++)43(PO4)36 R
JOHNSOMERVILLEITE Na8Ca7(Fe++,Mg,Mn++)43(PO4)36 R
FILLOWITE Na12Ca4(Mn++,Fe++)44(PO4)36 M
STORNESITE-(Y) (Y,Ca)[]2Na6(Ca,Na)8(Mg,Fe)43(PO4)36 R
BERZELIITE {Ca2Na}[Mg2](As+++++3)O12 C
MANGANBERZELIITE {Ca2Na}[Mn++2](As+++++3)O12 C
SCHAFERITE {Ca2Na}[Mg2](V+++++3)O12 C
PALENZONAITE {Ca2Na}[Mn++2](V+++++3)O12 C
LAMMERITE Cu3[(As,P)O4]2 M
LAMMERITE-beta Cu3(AsO4)2 M
STRANSKIITE Zn2Cu++(AsO4)2 A
XANTHIOSITE Ni3(AsO4)2 M
MCBIRNEYITE Cu3(VO4)2 A
PSEUDOLYONSITE (Cu,Zn)3(VO4)2 M
LYONSITE Cu++3Fe+++4(VO4)6 O
GRIGORIEVITE Cu3Fe+++2Al2(VO4)6 A
HOWARDEVANSITE NaCu++Fe+++2(VO4)3 A
KOKSHAROVITE CaMg2Fe+++4(VO4)6 A
ZIMINAITE Fe+++6(VO4)6 A
TILLMANNSITE (Ag3Hg)+++(VO4,AsO4) Q
CHURSINITE Hg+Hg++(AsO4) M
7/A.12 to 15 Very large cations: Ca, Na, etc.
MONETITE CaHPO4 A
WEILITE CaHAsO4 A
SVENEKITE Ca(H2AsO4)2 A
PHOSPHAMMITE (NH4)2HPO4 M (?)
BIPHOSPHAMMITE (NH4,K)H2PO4 Q
ARCHERITE (K,NH4,)H2PO4 Q
NAHPOITE Na2HPO4 M
BUCHWALDITE NaCaPO4 O
OLGITE Na(Na,Sr)2(Ba,Sr)(PO4)2 H
IWATEITE Na2BaMn++(PO4)2 R
SCHULTENITE PbHAsO4 M
7/A.14- Xenotime series
PRETULITE Sc(PO4) Q
XENOTIME-(Yb) (Yb,Y,Er)PO4 Q
XENOTIME-(Y) YPO4 Q
CHERNOVITE-(Y) YAsO4 Q
CHERNOVITE-(Ce) (?) (Ce,Y)(AsO4) Q
WAKEFIELDITE-(Y) YVO4 Q
WAKEFIELDITE-(La) (La,Nd,Pr)VO4 Q
WAKEFIELDITE-(Ce) (Ce,La,Nd,Y,Pr,Sm)(V,As)O4 Q
WAKEFIELDITE-(Nd) (Nd,La,Ce)VO4 Q
7/A.15- Monazite group
MONAZITE-(La) (La,Ce,Nd)PO4 M
MONAZITE-(Ce) (Ce,La,Nd,Th)PO4 M
MONAZITE-(Nd) (Nd,Ce,Sm)(PO4) M
MONAZITE-(Sm) (Sm,Gd,Ce,Th,Ca)(PO4) M
GASPARITE-(Ce) (Ce,La,Nd)AsO4 M
CHERALITE CaTh(PO4)2 M
VITUSITE-(Ce) Na3(Ce,La,Nd)(PO4)2 O
KOSNARITE KZr++++2(PO4)3 R ps C
7/A.18- Rooseveltite series
ROOSEVELTITE BiAsO4 M
TETRAROOSEVELTITE BiAsO4 Q
XIMENGITE BiPO4 H
7/A.19- Clinobisvamite series
DREYERITE BiVO4 Q
PUCHERITE BiVO4 O
CLINOBISVANITE BiVO4 M
7/A.20- Anhydrous divanadates [V+++++2O7]----
PETEWILLIAMSITE (Ni,Co)2(As2O7) M
ZIESITE Cu2V+++++2O7 M
BLOSSITE Cu2V+++++2O7 O
CHERVETITE Pb2V2O7 M
7/B. Anhydrous phosphates with additional anions: F, Cl, O, OH
7/B.01- Very small cations: Li, Be
HERDERITE CaBe(PO4)F M
HYDROXYLHERDERITE CaBe(PO4)(OH) M
BERGSLAGITE CaBe(AsO4)(OH) M
VAYRYNENITE MnBe(PO4)(OH,F) M
BABEFPHITE BaBe(PO4)(F,O) Q
7/B.02 to 19 Medium cations: Mg, Mn, Fe, Cu, Zn
GRIPHITE Na4Ca6(Mn,Fe++,Mg)19Li2Al8(PO4)24(F,OH)8 C
TANCOITE HNa2LiAl(PO4)2(OH) O
AMBLYGONITE (Li,Na)Al(PO4)(F,OH) A
MONTEBRASITE LiAl(PO4)(OH,F) A
MONTEBRASITE LiAl(PO4)(OH,F) A
TAVORITE LiFe+++(PO4)(OH) A
7/B.02- Amblygonite group
WAGNERITE (Mg,Fe++)2(PO4)F M
HYDROXYLWAGNERITE Mg2(PO4)(OH) M
ZWIESELITE Fe++,Mn)2(PO4)F M
TRIPLITE (Mn,Fe++,Mg,Ca)2(PO4)(F,OH) M
WOLFEITE (Fe++,Mn++)2(PO4)(OH) M
TRIPLOIDITE (Mn,Fe++)2(PO4)(OH) M
STANEKITE Fe+++(Mn++,Fe++,Mg)(PO4)O M
JOOSTEITE Mn++(Mn+++,Fe+++)(PO4)O M
SARKINITE Mn++2(AsO4)(OH) M
ALTHAUSITE Mg2(PO4)(OH,F,O) O
HOLTEDAHLITE Mg12(PO3OH,CO3)(PO4)5(OH,O)6 H
PHOSPHOELLENBERGERITE Mg14(PO4,AsO4)6(PO3OH,CO3)2(OH)6 H
SATTERLYITE (Fe++,Mg,Fe+++)2(PO4)(OH) H
PARWELITE (Mn,Mg)5Sb(As,Si)2O12 M
LIBETHENITE Cu2(PO4)(OH) M
ZINCOLIBETHENITE CuZn(PO4)(OH) O
OLIVENITE Cu2AsO4(OH) M
AURIACUSITE Fe+++Cu++(AsO4,Sb+++++O4)(O,OH) O
ZINCOLIVENITE Cu(Zn,Cu)AsO4(OH) O
ADAMITE Zn2(AsO4)(OH) O/M
EVEITE Mn2(AsO4)(OH) O
TARBUTTITE Zn2(PO4)(OH) A
PARADAMITE Zn2(AsO4)(OH) A
ERICLAXMANITE Cu4O(AsO4)2 A
KOZYREVSKITE Cu4O(AsO4)2 O
COPARSITE Cu4O2[(As,V)O4]Cl O
POPOVITE Cu5O2(AsO4)2 R
STOIBERITE Cu5V+++++2O10 M
AVERIEVITE Cu++5O2(VO4)2.n(CuCl) or Cu++5O2(VO4)2.n(CuCl2) or Cu++5O2(VO4)2.n(K,Rb,Cs)Cl M
YAROSHEVSKITE Cu9O2(VO4)4Cl2 A
FINGERITE Cu11(VO4)6O2 A
STAROVAITE KCu5O(VO4)3 A
URUSOVITE CuAl(AsO4)O M
7/B.08- Lazulite group
TROLLEITE Al4(PO4)3(OH)3 M
LAZULITE (Mg,Fe)Al2(PO4)2(OH)2 M
SCORZALITE (Fe++,Mg)Al2(PO4)2(OH)2 M
BARBOSALITE Fe++Fe+++2(PO4)2(OH)2 M
HENTSCHELITE Cu++Fe+++2(PO4)2(OH)2 M
WILHELMKLEINITE ZnFe+++2(AsO4)2(OH)2 M
ZINCLIPSCOMBITE ZnFe+++2(PO4)2(OH)2 Q
LIPSCOMBITE (Fe++,Mn++)Fe+++2(PO4)2(OH)2 Q
RICHELLITE Ca3Fe+++10(PO4)8(OH,F)12.nH2O (?) am.
AERUGITE Ni17As6O32 R
GRATTAROLAITE Fe+++O3(PO4) R
ANGELELLITE Fe+++4(AsO4)2O3 A
PLIMERITE ZnFe+++4(PO4)3(OH)5 O
ROCKBRIDGEITE (Fe++,Mn)Fe+++4(PO4)3(OH)5 O
FRONDELITE Mn++Fe+++4(PO4)3(OH)5 O
LUDJIBAITE Cu5(PO4)2(OH)4 A
PSEUDOMALACHITE Cu5(PO4)2(OH)4 M
REICHENBACHITE Cu++5(PO4)2(OH)4 M
CORNWALLITE Cu5(AsO4)2(OH)4 M
CORNUBITE Cu5(AsO4)2(OH)4 A
TURANITE Cu5(VO4)2(OH)4 O
GATEHOUSEITE Mn++5(PO4)2(OH)4 O
ARSENOCLASITE Mn5(AsO4)2(OH)4 O
REPPIAITE Mn5(VO4)2(OH)4 M
BRAZILIANITE NaAl3(PO4)2(OH)4 M
AUGELITE Al2(PO4)(OH)3 M
VIITANIEMIITE Na(Ca,Mn++)Al(PO4)(F,OH)3 M
CORNETITE Cu3(PO4)(OH)3 O
CLINOCLASE Cu3(AsO4)(OH)3 M
GILMARITE Cu3(AsO4)(OH)3 A
ARHBARITE Cu2Mg(AsO4)(OH)3 A
FLINKITE Mn++2Mn+++(AsO4)(OH)4 O
RETZIAN-(La) (Mn,Mg)2(La,Ce,Nd)(AsO4)(OH)4 O
RETZIAN-(Ce) Mn2Ce(AsO4)(OH)4 O
RETZIAN-(Nd) Mn2(Nd,Ce,La)(AsO4)(OH)4 O
RAADEITE Mg7(PO4)2(OH)8 M
WATERHOUSEITE Mn++7(PO4)2(OH)4 M ps O
ALLACTITE Mn7(AsO4)2(OH)8 M
ARGANDITE Mn++7(VO4,AsO4)2(OH)8 M
GERDTREMMELITE (Zn,Fe++)(Al,Fe+++)2(AsO4)(OH)5 A
MAGNESIUMCHLOROPHOENICITE (Mg,Mn)3Zn2(AsO4)(OH,O)6 M
CHLOROPHOENICITE (Mn,Mg)3Zn2(AsO4)(OH,O)6 M
JAROSEWICHITE Mn++3Mn+++(AsO4)(OH)6 O
SABELLIITE (Cu,Zn)2Zn[(As,Sb)O4](OH)3 R
THEISITE Cu5Zn5(As+++++,Sb+++++)2O8(OH)14 O
FORETITE Cu2Al2(AsO4)(OH,O,H2O)6 A
HEMATOLITE (Mn,Mg,Al)15(AsO3)(AsO4)2(OH)23 R
ARAKIITE (Zn,Mn++)(Mn++,Mg)12(Fe+++,Al)2(As+++O3)(As+++++O4)2(OH)23 M
7/B.20 to 40 Medium and large cations: Mg, Cu, Zn and Ca, Na, K, Ba, Pb
ARROJADITE-(KNa) KNa5CaFe++13Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(KFeNa) (?) {KNa}{Fe++[]}{Ca}{Na3}{Fe++13}{Al}(PO4)11(HPO4)(OH)2 M
ARROJADITE-(KFe) KNa3CaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(NaFe) (?) {Na2}{Fe++[]}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)(OH)2 M
ARROJADITE-(BaNa) BaNa3(NaCa)Fe++13Al(PO4)11(PO3OH)(OH) M
FERRIARROJADITE-(BaNa) (?) {Ba[]}{Na2}{Ca}{Na2[]}{Fe++13}{Fe+++}(PO4)11(HPO4)(OH)2 M
ARROJADITE-(BaFe) Na2BaCaFe++14Al(PO4)11(PO3OH)(OH)2 M
FLUORARROJADITE-(KNa) (?) {KNa}{Na2}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)F2 M
FLUORARROJADITE-(BaNa) BaNa4CaFe13Al(PO4)11(PO3OH)F2 M
FLUORARROJADITE-(NaFe) (?) {Na2}{Fe++[]}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)F2 M
FLUORARROJADITE-(BaFe) Na2BaCaFe++14Al(PO4)11(PO3OH)F2 M
ARROJADITE-(SrFe) Na2SrCaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(PbFe) Na2PbCaFe++14Al(PO4)11(PO3OH)(OH)2 M
DICKINSONITE-(KMnNa) KNa4CaMn++14Al(PO4)12(OH)2 M
FLUORCARMONITE-(BaNa) Ba[]Na2Na2[]CaMg13Al(PO4)11(PO3OH)F2 M
SAMUELSONITE (Ca,Ba)Ca8(Fe++,Mn++)4Al2(PO4)10(OH)2 M
NABIASITE BaMn9[(V,As)O4]6(OH)2 C
NEFEDOVITE Na5Ca4(PO4)4F A
ARCTITE Na2Ca4(PO4)3F R
HENEUITE CaMg5(PO4)3(CO3)(OH) A
MELONJOSEPHITE CaFe++Fe+++(PO4)2(OH) O
PROSPERITE CaZn2(AsO4)2.H2O M
7/B.24- Bearthite-Brackebuschite-Tsumebite group
BEARTHITE Ca2Al(PO4)2(OH) M
GOEDKENITE (Sr,Ca)2Al(PO4)2(OH) M
GRANDAITE Sr2Al(AsO4)2(OH) M
GAMAGARITE Ba2(Fe+++,Mn+++)(VO4)2(OH) M
TOKYOITE Ba2Mn+++(VO4)2(OH) M
BUSHMAKINITE Pb2(Al,Cu++)PO4(V+++++,Cr++++++)O4(OH) M
CALDERONITE Pb2Fe+++(VO4)2(OH) M
BRACKEBUSCHITE Pb2(Mn+++,Fe+++)(VO4)2(OH) M
ARSENBRACKEBUSCHITE Pb2(Fe++,Zn)(AsO4)2(OH,H2O) M
FEINGLOSITE Pb2(Zn,Fe++)[(As,S)O4]2.H2O M
TSUMEBITE Pb2Cu(PO4)(SO4)(OH) M
ARSENTSUMEBITE Pb2Cu(AsO4)(SO4)(OH) M
LULZACITE Sr2Fe++(Fe++,Mg)2Al4(PO4)4(OH)10 A
JAMESITE Pb2ZnFe+++2(Fe+++2,8Zn1,2)(AsO4)4(OH)8[(OH)1,2O0,8] A
ISOKITE CaMg(PO4)F M
PANASQUEIRAITE CaMg(PO4)(OH,F) M
TILASITE CaMg(AsO4)F M
LACROIXITE NaAl(PO4)F M
DURANGITE NaAl(AsO4)F M
MAXWELLITE (Na,Ca)(Fe+++,Al,Mg)(AsO4)(F,O) M
NACAPHITE Na2Ca(PO4)F O
THADEUITE (Ca,Mn++)(Mg,Fe++,Mn+++)3(PO4)2(OH,F)2 O
7/B.26- Adelite group
ADELITE CaMg(AsO4)(OH) O
GOTTLOBITE CaMg(VO4,AsO4)(OH).0,5H2O O
NICKELAUSTINITE Ca(Ni,Zn)(AsO4)(OH) O
COBALTAUSTINITE Ca(Co,Cu++)(AsO4)(OH) O
AUSTINITE CaZn(AsO4)(OH) O
HERMANNROSEITE CaCu(PO4,AsO4)(OH) O
CONICHALCITE CaCu++(AsO4)(OH) O
TANGEITE CaCu(VO4)(OH) O
GABRIELSONITE PbFe++(AsO4)(OH) O
DUFTITE PbCu(AsO4)(OH) O
7/B.27- Descloizite group
ARSENDESCLOIZITE PbZn(AsO4)(OH) O
DESCLOIZITE PbZn(VO4)(OH) O
MOTTRAMITE PbCu++(VO4)(OH) O
CECHITE Pb(Fe++,Mn)(VO4)(OH) O
PYROBELONITE PbMn++(VO4)(OH) O
BERTOSSAITE (Li,Na)2CaAl4(PO4)4(OH,F)4 O
PALERMOITE (Sr,Ca)(Li,Na)2Al4(PO4)4(OH)4 O
NATROPALERMOITE Na2SrAl4(PO4)4(OH)4 O
PEATITE-(Y) Li4Na12(Y,Na,Ca,HREE)12(PO4)12(CO3)4(F,OH)8 O ps C
RAMIKITE-(Y) Li4Na12(Y,Ca,HREE)6Zr6(PO4)12(CO3)4O4(OH,F)4 A ps C
ATTAKOLITE (Ca,Sr)Mn++(Al,Fe+++)4[(Si,P)O4]H(PO4)3(OH)4 M
SEWARDITE Ca2Fe+++2(AsO4)2(OH)2 O
CRIMSONITE PbFe+++2(PO4)2(OH)2 O
CARMINITE PbFe+++2(AsO4)2(OH)2 O
LENINGRADITE PbCu++3(VO4)Cl2 O
NAMIBITE Cu++(BiO)2V+++++O4OH M
PAGANOITE (Ni,Co)Bi+++As+++++O5 A
KHORIXASITE (Bi0,67[]0,33)Cu(VO4)(OH) M
7/B.29- Bjarebyite group
PENIKISITE Ba(Mg,Fe++)2Al2(PO4)3(OH)3 A
KULANITE Ba(Fe++,Mn,Mg)2Al2(PO4)3(OH)3 A
BJAREBYITE (Ba,Sr)(Mn++,Fe++,Mg)2Al2(PO4)3(OH)3 M
JOHNTOMAITE Ba(Fe++,Ca,Mn++)2Fe3+++2(PO4)3(OH)3 M
PERLOFFITE Ba(Mn,Fe++)2Fe+++2(PO4)3(OH)3 M
JAGOWERITE BaAl2(PO4)2(OH)2 A
VESIGNIEITE Cu3Ba(VO4)2(OH)2 M
DRUGMANITE Pb2(Fe+++,Al)H(PO4)2(OH)2 M
SMRKOVECITE Bi2O(OH)(PO4) M
ATELESTITE Bi2O(OH)(AsO4) M
HECHTSBERGITE Bi2O(OH)(VO4) M
PETITJEANITE Bi+++3(PO4)2O(OH) A
PREISINGERITE Bi3(AsO4)2O(OH) A
SCHUMACHERITE Bi3[(V,As,P)O4]2O(OH) A
KUZNETSOVITE Hg3Cl(AsO4) C
ARTSMITHITE Hg+4Al(PO4)2-x(OH)1+3x (x = 0,26) M
CURETONITE Ba(Al,Ti++++)(PO4)4(O,OH)F M
BAYLDONITE (Cu,Zn)3Pb(AsO4)2(OH)2 M
HEYITE Pb5Fe++2(VO4)2O4 M
7/B.35- Beudantite group
SCHLOSSMACHERITE (H3O,Ca)Al3(AsO4,SO4)2(OH)6 R
WOODHOUSEITE CaAl3(PO4)(SO4)(OH)6 R
SVANBERGITE SrAl3(PO4)(SO4)(OH)6 R
KEMMLITZITE (Sr,Ce)Al3(AsO4)(SO4)(OH)6 R
HINSDALITE (Pb,Sr)Al3(PO4,SO4)(OH,H2O)6 R
HIDALGOITE PbAl3(AsO4)(SO4)(OH)6 R
GALLOBEUDANTITE PbGa3[(AsO4),(SO4)]2(OH)6 R
CORKITE PbFe+++3(PO4)(SO4)(OH)6 R
BEUDANTITE PbFe+++3(AsO4)(SO4)(OH)6 R
7/B.36- Crandallite group
CRANDALLITE CaAl3(PO3OH)(PO4)(OH)6 R
IANGREYITE Ca2Al7(PO4)2(PO3OH)2(OH,F)15.8H2O R
VISEITE Ca10Al24(SiO4)6(PO4)7O22F3.72H2O (?) C
ARSENOCRANDALLITE (Ca,Sr)Al3[(As,P)O4]2(OH)5.H2O R
GOYAZITE SrAl3(PO3OH)(PO4)(OH)6 R
ARSENOGOYAZITE (Sr,Ca,Ba)Al3(AsO4,PO4)2(OH,F)5.H2O R
GORCEIXITE BaAl3[(PO3(O,OH)]2(OH)6 R
ARSENOGORCEIXITE HBaAl3(AsO4)2(OH)6 R
WEILERITE BaAl3(AsO4)(SO4)(OH)6 R
PLUMBOGUMMITE PbAl3(PO4)2(OH)5.H2O R
GALLOPLUMBOGUMMITE Pb(Ga,Al)3-xGexH1-x(PO4)2(OH)6 (x between 0 and 1) R
PHILIPSBORNITE PbAl3(AsO4)2(OH)5.H2O R
WAYLANDITE (Bi,Ca)Al3(PO4,SiO4)2(OH)6 R
EYLETTERSITE (Th,Pb)1-xAl3(PO4,SiO4)2(OH)6 (?) R
FLORENCITE-(La) (La,Ce)Al3(PO4)2(OH)6 R
FLORENCITE-(Ce) CeAl3(PO4)2(OH)6 R
FLORENCITE-(Sm) (Sm,Nd)Al3(PO4)2(OH)6 R
ARSENOFLORENCITE-(La) (La,Ce,Nd)Al3(AsO4)2(OH)6 R
ARSENOFLORENCITE-(Ce) (Ce,La)Al3(AsO4,PO4)2(OH)6 R
ARSENOFLORENCITE-(Nd) (?) (Nd,La,Ce,Ba)(Al,Fe+++)3(AsO4,PO4)2(OH)6 (?) R
FLORENCITE-(Nd) (Nd,Ce)Al3(PO4)2(OH)6 A
GRAULICHITE-(Ce) (Ce,Ba)(Fe+++,Al)3(AsO4)2(OH,H2O)6 A
BENAUITE (Sr,Ba)(Fe+++,Al)3(PO4)2(SO4)2(OH,H2O)6 R
SPRINGCREEKITE Ba(V+++,Fe+++)2(PO4)2(OH,H2O)6 R
DUSSERTITE BaFe+++3(AsO4)2(OH)5 R
KINTOREITE PbFe+++3(PO4)2(OH,H2O)6 R
PATTERSONITE PbFe+++3(PO4)2(OH,H2O)6 A
SEGNITITE PbFe+++3H(AsO4)2(OH)6 R
KOLITSCHITE Pb[Zn0,5[]0,5]Fe3(AsO4)2(OH)6 M ps R
ZAIRITE Bi(Fe+++,Al)3(PO4)2(OH)6 R
BRENDELITE (Bi+++,Pb++)2(Fe+++,Fe++)O2(OH)(PO4) M
PAULKELLERITE Bi2Fe+++(PO4)O2(OH)2 M
NEUSTADTELITE Bi2Fe+++(Fe+++,Co++)O2(OH)2(AsO4)2 A
COBALTNEUSTADTELITE Bi2Fe+++(Co++,Fe+++)O(OH)3(AsO4)2 A
MEDENBACHITE Bi2Fe+++(Cu,Fe++)O2(OH)2(AsO4)2 A
DAQINGSHANITE-(Ce) (Sr,Ca,Ba)3(Ce,La)(PO4)(CO3)3-x(OH,F)x H
7/B.39- Apatite group
FLUORAPATITE Ca5(PO4)3F H
CHLORAPATITE Ca5(PO4)3Cl H
CHLORAPATITE-M Ca5(PO4)3Cl M
HYDROXYLAPATITE Ca5(PO4)3(OH) H
HYDROXYLAPATITE-M Ca5(PO4)3(OH) M
CARLGIESECKEITE-(Nd) NaNdCa3(PO4)3F R ps H
SVABITE Ca5(AsO4)3F H
TURNEAUREITE Ca5(AsO4)3Cl H
JOHNBAUMITE Ca5(AsO4)3(OH) H
STRONADELPHITE Sr5(PO4)3(F,OH) H
FLUORSTROPHITE Sr4Ca(PO4)3F H
FLUORCAPHITE Ca(Sr,NaCa)(Ca,Sr,Ce)3(PO4)3F H
MIYAHISAITE (Sr,Ca)2Ba3(PO4)3F H
DELONEITE (Na,Ca,Ce)2Sr3(Ca,Ce)5(PO4)6(OH)F R
BELOVITE-(Ce) Sr3Na(Ce,La)(PO4)3(F,OH) R
BELOVITE-(La) Sr3Na(La,Ce)(PO4)3(F,OH) R
KUANNERSUITE-(Ce) NaBa3(Ce,Nd,La)(PO4)3(F,Cl) R ps H
ALFORSITE Ba5(PO4)3Cl H
MORELANDITE (Ba,Pb)3(Ca,Pb)2(AsO4,PO4)3Cl H
PHOSPHOHEDYPHANE Ca2Pb3(PO4)3Cl H
FLUORPHOSPHOHEDYPHANE Ca2Pb3(PO4)3F H
HEDYPHANE Pb3Ca2(AsO4)3Cl H
VANACKERITE Pb4Cd(AsO4)3(Cl,OH) R ps H
PYROMORPHITE Pb5(PO4)3Cl H
MIMETITE Pb5(AsO4)3Cl H
MIMETITE-M Pb5(AsO4)3Cl M ps H
VANADINITE Pb5(VO4)3Cl H
THEOPARACELSITE Cu++3(OH)2As2O7 O
7/C. Hydrous phosphates without additional anion
7/C.01 to 15 Small and medium cations: Be and Mn, Fe, Cu, Zn, Mg
PAHASAPAITE (Ca5,5Li3,6K1,2Na0,2[]13,5)Li8[Be24P24O96].38H2O C
FAHEYITE (Mn,Mg)Fe+++2Be2(PO4)4.6H2O H
GAINESITE Na(Na,K)(Be,Li)(Zr,Zn)2(PO4)4.1-2H2O Q
SELWYNITE NaK(Be,Al)Zr2(PO4)4.2H2O Q
MCCRILLISITE NaCs(Be,Li)Zr2(PO4)4.1-2H2O Q
FRANSOLETITE H2Ca3Be2(PO4)4.4H2O M
PARAFRANSOLETITE Ca3Be2(PO4)2(PO3OH)2.4H2O A
EHRLEITE Ca2ZnBe(PO4)2(PO3OH).4H2O A
HUREAULITE Mn5(PO4)2[PO3(OH)]2.4H2O M
SAINFELDITE Ca5(H2O)4(AsO3OH)2(AsO4)2 M
GIFTGRUBEITE CaMn2Ca2(AsO4)2(AsO3OH)2.4H2O M
MIGUELROMEROITE Mn5(H2O)4(AsO3OH)2(AsO4)2 M
CHONGITE Ca3Mg2(AsO4)2(AsO3OH)2.4H2O M
VILLYAELLENITE (Mn,Ca)Mn2Ca2(H2O)4(AsO3OH)2(AsO4)2 M
NYHOLMITE Cd3Zn2(AsO3OH)2(AsO4)2.4H2O M
KAATIALAITE Fe+++As+++++3O9.6-8H2O M
KRAUTITE MnAs+++++O3(OH).H2O M
STERLINGHILLITE Mn++3(AsO4)2.3H2O (?)
MAGNESIOKORITNIGITE Mg(AsO3OH).H2O A
COBALTKORITNIGITE (Co,Zn)(As+++++O3)(OH).H2O A
KORITNIGITE Zn(As+++++O3)(OH).H2O A
GEMINITE Cu++(As+++++O3OH).H2O A
PUSHCHAROVSKITE Cu++(As+++++O3OH).1,5H2O A
YVONITE Cu(AsO3.OH).2H2O A
ROLLANDITE Cu3(AsO4)2.4H2O O
CHUDOBAITE (Mg,Zn)5H2(AsO4)4.10H2O A
LINDACKERITE (Cu,Co)5(AsO4)2(AsO3OH)2.10H2O A
HLOUSEKITE (Ni,Co)Cu4(AsO4)2(AsO3OH)2.9H2O A
PRADETITE CoCu4(AsO4)2(AsO3OH)2.9H2O A
VESELOVSKYITE (Zn,Cu,Co)Cu4[AsO3(OH)AsO4]2.9H2O A
KLAJITE MnCu4(AsO4)2(AsO3OH)2.9-10H2O A
GEIGERITE Mn5(H2O)8(AsO3OH)2(AsO4)2.2H2O A
ONDRUSITE CaCu4(AsO4)2(AsO3OH)2.10H2O A
SLAVKOVITE Cu13(AsO4)6(AsO3OH)4.23H2O A
FERVANITE Fe+++4(VO4)4.5H2O M
KOLOVRATITE Hydrous vanadate of Ni and Zn (?)
WARIKAHNITE Zn3(AsO4)2.2H2O A
SERRABRANCAITE Mn+++(PO4).H2O M
CORREIANEVESITE Fe++Mn++2(PO4)2.3H2O O
PHOSPHOFERRITE (Fe++,Mn)3(PO4)2.3H2O O
REDDINGITE Mn++3(PO4)2.3H2O O
GARYANSELLITE (Mg,Fe+++)3(PO4)2(OH,O).1,5H2O O
KRYZHANOVSKITE MnFe+++2(PO4)2(OH)2.H2O O
7/C.09- Variscite group
METAVARISCITE AlPO4.2H2O M
PHOSPHOSIDERITE Fe+++PO4.2H2O M
KOLBECKITE ScPO4.2H2O M
MALHMOODITE Fe+++Zr(PO4)2.4H2O M
VARISCITE AlPO4.2H2O O
STRENGITE Fe+++PO4.2H2O O
MANSFIELDITE AlAsO4.2H2O O
SCORODITE Fe+++AsO4.2H2O O
YANOMAMITE InAsO4.2H2O O
PARASCORODITE Fe+++AsO4.2H2O R
KONINCKITE Fe+++PO4.3H2O (?) Q
ZIGRASITE MgZr(PO4)2.4H2O A
LUDLAMITE (Fe++,Mg,Mn)3(PO4)2.4H2O M
SWITZERITE (Mn++,Fe++)3(PO4)2.7H2O M
METASWITZERITE Mn3(PO4)2.4H2O M
CASTELLAROITE Mn++3(AsO4)2.4,5H2O M
PHOSPHOPHYLLITE Zn2(Fe++,Mn)(PO4)2.4H2O M
HOPEITE Zn3(PO4)2.4H2O O
ARSENOHOPEITE Zn3(AsO4)2.4H2O O
PARAHOPEITE Zn3(PO4)2.4H2O A
DAVIDLLOYDITE Zn3(AsO4)2.4H2O A
NIZAMOFFITE Mn++Zn2(PO4)2.4H2O O
RADOVANITE Cu2Fe+++(As+++O2)(As+++++O4)(OH)2.H2O O
SMOLIANINOVITE (Co,Ni,Mg,Ca)3(Fe+++,Al)2(AsO4)4.11H2O O
FAHLEITE Zn5CaFe+++2(AsO4)6.14H2O O
BARAHONAITE-(Al) (Ca,Cu,Na,Al)6Al(AsO4)4.6-6,5(H2O,OH) M
BARAHONAITE-(Fe) (Ca,Cu,Na,Fe+++,Al)6Fe+++(AsO4)4.6(H2O,OH,Cl) M
CURRIERITE Na4Ca3MgAl4(AsO3OH)12.9H2O H
NEWBERYITE MgHPO4.3H2O O
STEIGERITE AlVO4.3H2O M
SCHODERITE Al2(PO4)(VO4).8H2O M
METASCHODERITE Al2(PO4)(VO4).6H2O M
KANKITE Fe+++AsO4.3,5H2O M
7/C.13- Vivianite group
BOBIERRITE Mg3(PO4)2.8H2O M
CATTIITE Mg3(PO4)2.22H2O A
MANGANESEHORNESITE (Mn++,Mg)3(AsO4)2.8H2O M
BARICITE (Mg,Fe++,Fe+++)3(PO4)2.8(H2O,OH) M
VIVIANITE Fe++3(PO4)2.8H2O M
PAKHOMOVSKYITE (Co,Mg)3(PO4)2.8H2O M
ARUPITE (Ni,Fe++)3(PO4)2.8H2O M
HORNESITE Mg3(AsO4)2.8H2O M
PARASYMPLESITE Fe++3(AsO4)2.8H2O M
ERYTHRITE Co3(AsO4)2.8H2O M
ANNABERGITE Ni3(AsO4)2.8H2O M
KOTTIGITE Zn3(AsO4)2.8H2O M
KOBOKOBOITE Al6(PO4)4(OH)6.11H2O A
SYMPLESITE Fe++3(AsO4)2.8H2O A
METAKOTTIGITE (Zn,Fe+++,Fe++)3(AsO4)2.8(H2O,OH) A
BURGESSITE Co2(H2O)4[AsO3(OH)]2(H2O) M
BRASSITE MgHAsO4.4H2O O
PHOSPHORROSSLERITE MgHPO4.7H2O M
ROSSLERITE MgHAsO4.7H2O M
7/C.16 to 34 Medium and large cations: Fe, Mn, Zn, Mg and Ca, (NH4)+
PARASCHOLZITE CaZn2(PO4)2.2H2O M
SCHOLZITE CaZn2(PO4)2.2H2O O
FLUCKITE CaMn++H2(AsO4)2.2H2O A
7/C.17- Fairfieldite - roselite series
COLLINSITE Ca2(Mg,Fe++)(PO4)2.2H2O A
HILLITE Ca2(Zn,Mg)(PO4)2.2H2O A
MESSELITE Ca2(Fe++,Mn)(PO4)2.2H2O A
FAIRFIELDITE Ca2(Mn,Fe++)(PO4)2.2H2O A
CASSIDYITE Ca2(Ni,Mg)(PO4)2.2H2O A
TALMESSITE Ca2Mg(AsO4)2.2H2O A
NICKELTALMESSITE Ca2(Ni,Mg)(AsO4)2.2H2O A
GAITITE Ca2Zn(AsO4)2.2H2O A
PARABRANDTITE Ca2Mn++(AsO4).2H2O A
ROSELITEBETA (ROSELITE BETA) Ca2Co(AsO4)2.2H2O A
WENDWILSONITE Ca2(Mg,Co)(AsO4)2.2H2O M
ROSELITE Ca2(Co++,Mg)(AsO4)2.2H2O M
RRUFFITE Ca2Cu(AsO4)2.2H2O M
ZINCROSELITE Ca2Zn(AsO4)2.2H2O M
BRANDTITE Ca2(Mn++,Mg)(AsO4)2.2H2O M
WICKSITE NaCa2(Fe++,Mn++)4MgFe+++(PO4)6.2H2O O
TASSIEITE (Na,[])Ca2(Mg,Fe++,Fe+++)2(Fe+++,Mg)2(Fe++,Mg)2(PO4)6.2H2O O
BEDERITE []Ca2Mn++2Fe+++2Mn++2(PO4)6.2H2O O
GRISCHUNITE NaCa2Mn++5Fe+++(AsO4)6.2H2O O
WALENTAITE H(Ca,Mn,Fe++)Fe+++3[(AsO4,PO4)]4.7H2O O
ANAPAITE Ca2Fe++(PO4)2.4H2O A
LIVERSIDGEITE Zn6(PO4)4.7H2O A
BAKHCHISARAITSEVITE Na2Mg5(PO4)4.7H2O M
RIMKOROLGITE (Mg,Mn)5(Ba,Sr,Ca)(PO4)4.8H2O M ps H
CAMARONESITE Fe+++2(PO3OH)2(SO4)(H2O)4.1-2H2O R
JUANSILVAITE Na5Al3[AsO3(OH)]4[AsO2(OH)2]2(SO4)2.4H2O M
GENGENBACHITE KFe+++3[(H2PO4)2|(HPO4)4].6H2O H
FRANCOANELLITE H6(K,Na)3(Al,Fe+++)5(PO4)8.13H2O R
TARANAKITE K3Al5[PO3(OH)]6(PO4)2.18H2O R
HAIGERACHITE KFe+++3(H2PO4)6(HPO4)2.4H2O M
DORFMANITE Na2HPO4.2H2O O
CATALANOITE Na2PO3(OH).8H2O O
HAZENITE KNaMg2(PO4)2.14H2O O
HAZENITE KNaMg2(PO4)2.14H2O O
STRUVITE-(K) KMgPO4.6H2O O
STRUVITE (NH4)MgPO4.6H2O O
DITTMARITE (NH4)Mg(PO4).H2O O
NIAHITE (NH4)(Mn++,Mg,Ca)PO4.H2O O
HANNAYITE (NH4)2Mg3H4(PO4)4.8H2O A
SCHERTELITE (NH4)2MgH2(PO4)2.4H2O O
STERCORITE H(NH4)Na(PO4).4H2O A
SWAKNOITE (NH4)2Ca(HPO4)2.H2O O
MUNDRABILLAITE (NH4)2Ca(HPO4)2.H2O M
HAIDINGERITE CaHAsO4.H2O O
MCNEARITE NaCa5H4(AsO4)5.4H2O A
IRHTEMITE Ca4MgH2(AsO4)4.4H2O M
IRHTEMITE Ca4MgH2(AsO4)4.4H2O M
VLADIMIRITE Ca4(AsO4)2(AsO3OH).4H2O M
FERRARISITE Ca5H2(AsO4)4.9H2O A
GUERINITE Ca5H2(AsO4)4.9H2O M
RAUENTHALITE Ca3(AsO4)2.10H2O M/A
PHAUNOUXITE Ca3(AsO4).11H2O A
PICROPHARMACOLITE H2Ca4Mg(AsO4)4.11H2O A
BRUSHITE CaHPO4.2H2O M
PHARMACOLITE CaHAsO4.2H2O M
CHURCHITE-(Y) YPO4.2H2O M
CHURCHITE-(Dy) (?) (Dy,Sm,Gd,Nd)(PO4).2H2O M
PINTADOITE Ca2V2O7.9H2O (?)
MACHATSCHKIITE (Ca,Na)6(As+++++O4)(As+++++O3OH)3(PO4,SO4).15H2O R
NASTROPHITE Na(Sr,Ba)(PO4).9H2O C
NABAPHITE NaBaPO4.9H2O C
7/C.29- Rhabdophane group
RHABDOPHANE-(Y) (Y,La,Nd)PO4.H2O H
RHABDOPHANE-(La) (La,Ce)PO4.H2O H
RHABDOPHANE-(Ce) (Ce,La)PO4.H2O H
RHABDOPHANE-(Nd) (Nd,Ce,La)PO4.H2O H
BROCKITE (Ca,Th,Ce)(PO4).H2O H
TRISTRAMITE (Ca,U++++,Fe+++)(PO4,SO4).2H2O H
GRAYITE (Th,Pb,Ca)PO4.H2O ps H
NINGYOITE (U,Ca,Ce)2(PO4)2.1-2H2O O ps H
STEPITE U++++(AsO3OH)2.4H2O Q
VYSOKYITE U++++[As+++++O2(OH)2]4.4H2O A
KEYITE Cu++3(Zn,Cu++)4Cd2(AsO4)6(H2O)2 M
ERIKAPOHLITE Cu3(Zn,Cu,Mg)4Ca2(AsO4)6.2H2O M
SCHLEGELITE Bi7(MoO4)2(AsO4)3O4 O
SCHNEEBERGITE (Bi+++,Ca)(Co,Ni,Fe+++)2(AsO4)2[(H2O)(OH)] M
NICKELSCHNEEBERGITE (Bi+++,Ca)(Ni,Co,Fe+++)2(AsO4)2[(H2O)(OH)] M
CABALZARITE Ca(Mg,Al,Fe+++)2(AsO4)2(H2O,OH)2 M
NICKELLOTHARMEYERITE (Ca,Bi+++)(Ni,Fe+++,Co)2(AsO4)2(H2O,OH)2 M
COBALTLOTHARMEYERITE Ca(Co,Fe+++,Ni)2(AsO4)2(OH,H2O)2 M
LOTHARMEYERITE Ca(Mn+++,Zn)2(AsO4)2(OH,H2O)2 M
FERRILOTHARMEYERITE Ca(Fe+++,Zn)2(AsO4)2(OH,H2O)2 M
MANGANLOTHARMEYERITE Ca(Mn+++,[],Mg)2{AsO4,[AsO2(OH)2]}2(OH,H2O)2 M
NICKELTSUMCORITE Pb(Ni,Fe+++)2(AsO4)2(H2O,OH)2 M
COBALTTSUMCORITE Pb(Co,Fe+++,Ni)2(AsO4)2(H2O,OH)2 M
THOMETZEKITE Pb(Cu,Zn)2(AsO4)2(OH,H2O)2 M/A (?)
TSUMCORITE Pb(Zn,Fe+++)2(AsO4)2(OH,H2O)2 M
MAWBYITE Pb(Fe+++,Zn)2(AsO4)2(OH,H2O)2 M
MOUNANAITE PbFe+++2(VO4)2(OH,H2O)2 M
KRETTNICHITE PbMn+++2(VO4)2(OH)2 M
LUKRAHNITE Ca(Cu,Zn)(Fe+++,Zn)(AsO4)2.2(H2O,OH) A
PHOSPHOGARTRELLITE PbCuFe+++(PO4)2(OH,H2O)2 A
YANCOWINNAITE PbCuAl(AsO4)2OH.H2O A
GARTRELLITE PbCu(Fe,Cu)(AsO4)2(OH,H2O)2 A
ZINCGARTRELLITE Pb(Zn,Fe+++,Cu)2(AsO4)2(H2O,OH)2 A
RAPPOLDITE Pb(Co,Ni,Zn)2(AsO4)2.2H2O A ps M
HELMUTWINKLERITE Pb(Zn,Cu)2(AsO4)2(OH,H2O)2 A
POTTSITE (Pb3Bi)Bi(VO4)4.H2O. Q
7/C.33 to 34 Molybdophosphates with [MoO4]-- [PO4]--- and similar compounds
MELKOVITE CaFe+++H6(MoO4)4(PO4).6H2O M
BETPAKDALITE-NaNa [Na2(H2O)16Na(H2O)6][Mo8As2Fe+++3O33(OH)4] M
BETPAKDALITE-NaCa (Na,Ca)3Fe+++2(As2O4)(MoO4)6.15H2O M
BETPAKDALITE-CaMg [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe+++3O36(OH)] M
BETPAKDALITE-CaCa MgCa2Fe+++3(Mo++++++8O28)(AsO4)2(OH).23H2O M
MENDOZAVILITE-NaFe (Na,K)(Ca,Mg)2Fe+++3(PO4)2(Mo++++++8O28)(OH).9H2O M
MENDOZAVILITE-KCa [K2(H2O)15Ca(H2O)6][Mo8P2Fe+++3O34(OH)3] M
PARAMENDOZAVILITE NaAl4Fe+++7(PO4)5(P+++++Mo++++++12O40)(OH)16.56H2O M/A
OBRADOVICITE-NaCu Na2(H2O)17Cu(H2O)6][Mo8As2Fe+++3O34(OH)3] O
OBRADOVICITE-KCu H4(K,Na)Cu++Fe+++2(AsO4)(MoO4)5.12H2O O
RANKACHITE CaFe++V+++++4W++++++8O36.12H2O O
7/C.35- Hydrous diphosphates [P2O7]---
CANAPHITE CaNa2P2O7.4H2O M
WOOLDRIDGEITE Na2CaCu++2(P2O7)2.10H2O O
FIANELITE Mn++2V+++++(V+++++,As+++++)O7.2H2O M
HYLBROWNITE Na3MgP3O10.12H2O M ps O
KANONEROVITE Mn++Na3P3O10.12H2O M
7/D. Hydrous phosphates with additional anions
7/D.01 to 02 Small cations: Be, Li
MORAESITE Be2(PO4)(OH).4H2O M
BEARSITE Be2(AsO4)(OH).4H2O M
GLUCINE CaBe4(PO4)2(OH)4.0,5H2O (?)
WEINEBENEITE Ca[Be3(PO4)2(OH)2].4H2O M
URALOLITE Ca2Be4(PO4)3(OH)3.5H2O M
ATENCIOITE Ca2Mg2Fe++2-3Be4(PO4)6(OH)4.6H2O A
ZANAZZIITE Ca2Be4(Mg,Fe++)5(PO4)6(OH)4.6(H2O) M
GUIMARAESITE Ca2(Zn,Mg,Fe++)5Be4(PO4)6(OH)4.6H2O M
ROSCHERITE Ca2Be4(Mn,Fe++)5(PO4)6(OH)4.6H2O M/A
OKRUSCHITE Ca2Mn++5Be4(AsO4)6(OH)4.6H2O M
GREIFENSTEINITE Ca2Be4(Fe++,Mn)5(PO4)6(OH)4.6(H2O) M
TIPTOPITE [(Li,Na,Ca,[])6](OH)2(H2O)(K2)(Be6P6O24) H
7/D.03 to 24 Medium cations: Cu, Zn, Mn, Al, Fe
GLADIUSITE (Fe++,Mg)4Fe+++2(PO4)(OH)11.H2O M ps O
GINIITE Fe++Fe+++4(PO4)4(OH)2.2H2O M
KALUGINITE (Mn++,Ca)MgFe+++(PO4)2(OH).4H2O O
LANDESITE Fe+++Mn++2(PO4)2(OH).2H2O O
WILHELMGUMBELITE [ZnFe++Fe+++3(PO4)3(OH)4(H2O)5].2H2O O
SCHMIDITE [Zn2(Fe+++,Mn++)2Fe+++(PO4)3(OH)3(H2O)6].2H2O  
FLURLITE Zn3Mn++Fe+++(PO4)3(OH)2.9H2O M
SCHOONERITE [ZnMnFe++2Fe+++(PO4)3(OH)2(H2O)7].2H2O O
MCAUSLANITE HFe++3Al2(PO4)4F.18H2O A
SINKANKASITE H2MnAl(PO4)2(OH).6H2O A
PITTICITE Hydrous ferric arsenate sulfate am.
DIADOCHITE Fe+++2(PO4)(SO4)(OH).5H2O A
SARMIENTITE Fe+++2(AsO4)(SO4)(OH).5H2O M
HILARIONITE Fe+++2(SO4)(AsO4)(OH).6H2O M
HILARIONITE   M
BUKOVSKYITE Fe+++2(AsO4)(SO4)(OH).7H2O M
ZYKAITE Fe+++4(AsO4)3(SO4)(OH).15H2O O
SATPAEVITE Al12V++++2V+++++6O37.30H2O O (?)
NISSONITE Cu2Mg2(PO4)2(OH)2.5H2O M
STRASHIMIRITE Cu8(AsO4)4(OH)4.5H2O M
DOMEROCKITE Cu4(AsO4)2(AsO3OH)(OH)3.H2O A
EUCHROITE Cu2(AsO4)(OH).3H2O O
LAPEYREITE Cu3O[AsO3(OH)]2.0,75H2O O
LEGRANDITE Zn2(AsO4)(OH).H2O M
IANBRUCEITE [Zn2(OH)(H2O)(AsO4)](H2O)2 M
SPENCERITE Zn4(PO4)2(OH)2.3H2O M
CLONCURRYITE Cu0,5Al2(VO)0,5(PO4)2(F,OH)2.5H2O M
NEVADAITE (Cu++,Al,V+++)2-3Al4(PO4)4(OH)F4.11H2O M
WHITECAPSITE H16Fe2++5Fe+++14Sb+++6(AsO4)18O16.120H2O H
7/D.08- Arthurite group
KLEEMANITE ZnAl2(PO4)2(OH)2.3H2O M
WHITMOREITE Fe++Fe+++2(PO4)2(OH)2.4H2O M
EARLSHANNONITE (Mn++,Fe++)Fe+++2(PO4)2(OH)2.4H2O M
CORALLOITE Mn++Mn+++2(AsO4)2(OH)2.4H2O M
KUNATITE CuFe+++2(PO4)2(OH)2.4H2O M
ARTHURITE Cu++Fe+++2(AsO4,PO4,SO4)2(O,OH)2.4H2O M
COBALTARTHURITE (Co++,Mg)Fe+++2(AsO4)2(OH)2.4H2O M
BENDADAITE Fe++Fe+++2(AsO4)2(OH)2.4H2O M
OJUELAITE ZnFe+++2(AsO4)2(OH)2.4H2O M
MAPIMITE Zn2Fe+++3(AsO4)3(OH)4.10H2O M
VAUXITE Fe++Al2(PO4)2(OH)2.6H2O A
FERRIVAUXITE Fe+++Al2(PO4)2(OH)3.5H2O A
METAVAUXITE Fe++Al2(PO4)2(OH)2.8H2O M
CESARFERREIRAITE Fe++Fe+++2(AsO4)2(OH)2.8H2O A
KASTNINGITE (Mn++,Fe++,Mg)Al2(PO4)2(OH)2.8H2O A
STEWARTITE Mn++Fe+++2(PO4)2(OH)2.8H2O A
PSEUDOLAUEITE Mn++Fe+++2(PO4)2(OH)2.7-8H2O M
7/D.10- Paravauxite group
GORDONITE MgAl2(PO4)2(OH)2.8H2O A
MAGHREBITE MgAl2(AsO4)2(OH)2.8H2O A
USHKOVITE MgFe+++2(PO4)2(OH)2.8H2O A
PARAVAUXITE Fe++Al2(PO4)2(OH)2.8H2O A
MANGANGORDONITE (Mn++,Fe++)Al2(PO4)2(OH)2.8H2O A
NORDGAUITE Mn++Al2(PO4)2(F,OH)2.5H2O A
SIGLOITE Fe+++Al2(PO4)2(OH)3.7H2O A
FERROLAUEITE Fe++Fe+++2(PO4)2(OH)2.8H2O A
LAUEITE Mn++Fe+++2(PO4)2(OH)2.8H2O A
KUMMERITE Mn++Fe+++Al(PO4)2(OH)2.8H2O A
ZINCOSTRUNZITE ZnFe+++2(PO4)2(OH)2.6,5H2O A
FERROSTRUNZITE Fe++Fe+++2(PO4)2(OH)2.6H2O A
STRUNZITE Mn++Fe+++2(PO4)2(OH)2.6H2O A ps M
FERRISTRUNZITE Fe+++Fe+++2(PO4)2(OH)3.5H2O A
KAYROBERTSONITE [MnAl2(PO4)2(OH)2(H2O)4].2H2O A
BERMANITE Mn++Mn+++2(PO4)2(OH)2.4H2O M
CACOXENITE (Fe+++,Al)25(PO4)17O6(OH)12.75H2O H
KAMARIZAITE Fe+++3(AsO4)2(OH)3.3H2O O
TINTICITE Fe+++11(PO4,VO4)8(OH)8.13H2O A
ZINCOBERAUNITE ZnFe+++5(PO4)4(OH)5.6H2O O
BERAUNITE Fe++Fe+++5(PO4)4(OH)5.4H2O M
ELEONORITE Fe+++6(PO4)4O(OH)4.6H2O M
TVRDYITE Fe++Fe+++2Al3(PO4)4(OH)5(H2O)4.2H2O M
SOUZALITE (Mg,Fe++)3(Al,Fe+++)4(PO4)4(OH)6.2H2O M
GORMANITE Fe++3Al4(PO4)4(OH)6.2H2O A
DUFRENITE Fe++Fe+++4(PO4)3(OH)5.2H2O M
MATIOLIITE Na(Mg,Fe++)Al5(PO4)4(OH)6.2H2O M
BURANGAITE (Na,Ca)2(Fe++,Mg)2Al10(PO4)8(OH,O)12.4H2O M
NATRODUFRENITE Na(Fe+++,Fe++)(Fe+++,Al)5(PO4)4(OH)6.2H2O M
GAYITE NaMn++Fe+++5(PO4)4(OH)6.2H2O M
ERCITITE Na(Mn+++,Fe+++)(PO4)(OH).2H2O M
KIDWELLITE NaFe+++9(PO4)6(OH)10.5H2O M
MEURIGITE-Na Na(Fe+++,Al)8(PO4)6(OH)7.6,5H2O M
MEURIGITE-K KFe+++8(PO4)6(OH)7.6,5H2O M
PHOSPHOFIBRITE [K0,5(H2O)3][(Fe+++,Cu)8(PO4)6(OH)7(H2O)4] M
METAVIVIANITE Fe++Fe+++2(PO4)2(OH)2.6H2O A
MITRYAEVAITE Al11(PO4,SO3OH)10F3.30H2O A
SASAITE (Al,Fe+++)6[(PO4),(SO4)]5(OH)3.35-36H2O O
VASHEGYITE Al11(PO4)9(OH)6.38H2O or Al6(PO4)5(OH)3.23H2O O
VANTASSELITE Al4(PO4)3(OH)3.9H2O O
ARANGASITE Al2(PO4)(SO4)F.7,5?2O M
SANJUANITE Al2(PO4)(SO4)(OH).9H2O M (?)
ROSSIANTONITE Al3(PO4)(SO4)2(OH)2(H2O)10.4H2O A
KRIBERGITE Al5(PO4)3(SO4)(OH)4.2H2O (?) A
FLUORWAVELLITE Al3(PO4)2(F,OH)3.5H2O O
WAVELLITE Al3(PO4)2(OH,F)3.5H2O O
ALLANPRINGITE Fe+++3(PO4)2(OH).5H2O M
KINGITE Al3(PO4)2(OH,F)3.9H2O A
CHILDRENITE Fe++Al(PO4)(OH)2.H2O M
EOSPHORITE MnAl(PO4)(OH)2.H2O M
ERNSTITE (Mn++1-xFe+++x)Al(PO4)(OH)2-xOx M
7/D.15- Turquoise group
PLANERITE Al6(PO4)2(PO3OH)2(OH)8.4H2O A
AHEYLITE (Fe++,Zn)Al6(PO4)4(OH)8.4H2O A
AFMITE Al3(OH)4(H2O)3(PO4)(PO3OH)H2O A
TURQUOISE Cu++(Al,Fe+++)6(PO4)4(OH)8.4H2O A
FAUSTITE (Zn,Cu++)Al6(PO4)4(OH)8.4H2O A
CHALCOSIDERITE Cu++(Fe+++,Al)6(PO4)4(OH)8.4H2O A
CLARAITE (Cu,Zn)15(CO3)4(AsO4)2(SO4)(OH)14.7H2O A
LUETHEITE Cu2Al2(AsO4)2(OH)4 M
CHENEVIXITE Cu2Fe+++2(AsO4)2(OH)4 M
GUANACOITE Cu2(Mg,Cu)Mg2(AsO4)2(OH)4.4H2O M
AKROCHORDITE Mn++4Mg(AsO4)2(OH)4.4H2O M
ALDERMANITE Mg5Al12(PO4)8(OH)22.32H2O O
SENEGALITE Al2(PO4)(OH)3.H2O O
BULACHITE Al2(AsO4)(OH)3.3H2O O
FLUELLITE Al2(PO4)F2(OH).7H2O O
KIPUSHITE (Cu,Zn)5Zn(PO4)2(OH)6.H2O M
PHILIPSBURGITE (Cu,Zn)6(AsO4,PO4)2(OH)6.H2O M
VESZELYITE (Cu,Zn)3(PO4)(OH)3.2H2O M
ZAPATALITE Cu3Al4(PO4)3(OH)9.4H2O Q
CERULEITE Cu2Al7(AsO4)4(OH)13.12H2O A
PARNAUITE Cu9(AsO4)2(SO4)(OH)10.7H2O O
LEOGANGITE Cu10(AsO4)4(SO4)(OH)6.8H2O M
LIROCONITE Cu2Al(AsO4)(OH)4.4H2O M
CHALCOPHYLLITE Cu++18Al2(AsO4)3(SO4)3(OH)27.33H2O R
BARROTITE Cu9Al(HSiO4)2[(SO4)(HAsO4)0,5](OH)12.8H2O R
HOTSONITE Al5(PO4)(SO4)(OH)10.8H2O A
RUSAKOVITE (Fe+++,Al)5(VO4,PO4)2(OH)9.3H2O (?)
SIELECKIITE Cu3Al4(PO4)2(OH)12.2H2O A
ROSIERESITE [Pb,Cu,Al,(PO4),H2O] (?) am.
STEINMETZITE Zn2Fe+++(PO4)2(OH).3H2O A
EVANSITE Al3(PO4)(OH)6.6H2O (?) am.
BETTERTONITE Al6(AsO4)3(OH)9.16H2O M
PENBERTHYCROFTITE [Al6(AsO4)3(OH)9(H2O)5].8H2O M
LISKEARDITE [(Al,Fe)32(AsO4)18(OH)42(H2O)22].52H2O O (?)
7/D.25 to 57 Medium and very large cations: Al, Mg and Ca, Na, K
SAMPLEITE NaCaCu5(PO4)4Cl.5H2O O
LAVENDULAN NaCaCu5(AsO4)4Cl.5H2O O
LEMANSKIITE NaCaCu5(AsO4)4Cl.5H2O Q
ZDENEKITE Na(Pb,Ca)Cu++5(AsO4)4Cl.5H2O Q
MAHNERTITE (Na,Ca,K)Cu++3(AsO4)2Cl.5H2O Q
BRAITHWAITEITE NaCu++5(Sb+++++Ti4++++)O2(AsO4)4(AsO3OH)2(H2O)8 A
SHUBNIKOVITE Ca2Cu++8(AsO4)6Cl(OH).7H2O (?) O (?)
ATTIKAITE Ca3Cu2Al(AsO4)2(OH)2.2H2O O
BIRCHITE CdCu2(SO4)(PO4)2.5H2O O
GOLDQUARRYITE CuCd2Al3(PO4)4F2.12H2O A
ANDYROBERTSITE KCdCu5(AsO4)4[As(OH)2O2].2(H2O) M
CALCIOANDYROBERTSITE KCaCu5(AsO4)4[As(OH)2O2].2(H2O) M
ESPERANZAITE NaCa2Al2(As+++++O4)2F4(OH).H2O M
ENGLISHITE K3Na2Ca10Al15(PO4)21(OH)7.26H2O O
NATROPHOSPHATE Na7(PO4)2F.19H2O C
TINSLEYITE KAl2(PO4)2(OH).2H2O M
KAPUNDAITE (Na,Ca)2Fe+++4(PO4)4(OH)3.5H2O A
SPHENISCIDITE (NH4,K)(Fe+++,Al)2(PO4)2(OH).2H2O M
LEUCOPHOSPHITE KFe+++2(PO4)2(OH).2H2O M
MINYULITE KAl2(PO4)2(OH,F).4H2O O
7/D.28- Overite group
OVERITE CaMgAl(PO4)2(OH).4H2O O
SEGELERITE CaMgFe+++(PO4)2(OH).4H2O O
JUONNIITE CaMgSc(PO4)2(OH).4H2O O
WILHELMVIERLINGITE CaMn++Fe+++(PO4)2(OH).2H2O O
LUNOKITE (LUN'OKITE) (Mn++,Ca)(Mg,Fe++,Mn++)Al(PO4)2(OH).4H2O O
MANGANOSEGELERITE (Mn++,Ca)(Mn++,Fe++,Mg)Fe+++(PO4)2(OH).4H2O O
7/D.29- Whiteite group
WHITEITE-(CaFeMg) Ca(Fe++,Mn++)Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(CaMnMg) CaMn++Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(CaMnMn) CaMnMn2Al2[PO4]4(OH)2.8H2O M
WHITEITE-(MnFeMg) (Mn++,Ca)(Fe++,Mn++)Mg2Al2(PO4)4(OH)2.8H2O M
RITTMANNITE (Mn++,Ca)Mn++(Fe++,Mn++)2(Al,Fe+++)2(PO4)4(OH)2.8H2O M
JAHNSITE-(NaFeMg) NaMg2Fe+++3(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnMg) CaMn++(Mg,Fe++)2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnFe) CaMn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaFeFe) (?) CaFe++2(Fe++)2(Fe+++)2(PO4)4(OH)2.8H2O (?) M
JAHNSITE-(CaFeMg) CaFe++Mg2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnMn) CaMn++Mn++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnMn) (Mn++,Ca)Mn++(Mn++,Fe++)2Fe+++2(PO4)4(OH)2.8H2O M
KECKITE CaMn(Fe+++,Mn)2Fe+++2(PO4)4(OH)3.7H2O M
FERRAIOLOITE MgMn++4(Fe++0,5Al+++0,5)4Zn4(PO4)8(OH)4(H2O)20 M
FALSTERITE Ca2MgMn++2(Fe++0,5Fe+++0,5)4Zn4(PO4)8(OH)4(H2O)14 M
XANTHOXENITE Ca4Fe+++2(PO4)4(OH)2.3H2O A
KOLFANITE Ca2Fe+++3O2(AsO4)3.2H2O M
MITRIDATITE Ca2Fe+++3(PO4)3O2.3H2O M
ARSENIOSIDERITE Ca2Fe+++3(AsO4)3O2.3H2O M
SAILAUFITE NaCaMn+++3O2(AsO4)2(CO3).3H2O M
ROBERTSITE Ca6Mn+++9(PO4)9O6(H2O)6.3H2O M
PARAROBERTSITE Ca2Mn+++3(PO4)3O2.3H2O M
7/D.31- Montgomeryite group
MONTGOMERYITE Ca4MgAl4(PO4)6(OH)4.12H2O M
KINGSMOUNTITE (Ca,Mn++)4(Fe++,Mn++)Al4(PO4)6(OH)4.12H2O M
CALCIOFERRITE Ca4Fe++(Fe+++,Al)4(PO4)6(OH)4.13H2O M
ZODACITE Ca4Mn++Fe+++4(PO4)6(OH)4.12H2O M
GIRVASITE NaCa2Mg3(PO4)2[PO2(OH)2](CO3)(OH)2.4H2O M
MANTIENNEITE (H2O,K)2(Mg,Fe++)2(Al,Fe+++)2Ti(PO4)4(O,F)2.14H2O O
PAULKERRITE (H2O,K)2(Mg,Mn++)2(Fe+++,Al)2Ti(PO4)4(O,F)2.14H2O O
BENYACARITE (H2O,K)2(Mn++,Fe++)2(Fe+++,Ti)2Ti(PO4)4(O,F)2.14H2O O
KOVDORSKITE Mg2(PO4)(OH).3H2O M
CAMGASITE CaMg(AsO4)(OH).5H2O M
ISOCLASITE Ca2(PO4)(OH).2H2O (?) M
GATUMBAITE CaAl2(PO4)2(OH)2.H2O M
JOTEITE Ca2CuAl[AsO4][AsO3(OH)]2(OH)2.5H2O A
TAPIAITE Ca5Al2(AsO4)4(OH)4.12H2O M
JUNGITE Ca2Zn4Fe+++8(PO4)9(OH)9.16H2O O
PARWANITE (Na,K)(Mg,Ca)4Al8(CO3)(PO4)8(OH)7.30H2O M ps H
MEJILLONESITE NaMg2(PO3OH)(PO4)(OH).H5O2 O
ANGARFITE NaFe+++5(PO4)4(OH)4.4H2O O
OLMSTEADITE KFe++2(Nb,Ta)(PO4)2O2.2H2O O
JOHNWALKITE K(Mn++,Fe+++,Fe++)2(Nb,Ta)(PO4)2O2(H2O,OH)2 O
WYCHEPROOFITE NaAlZr(PO4)2(OH)2.H2O A
VOGGITE Na2Zr(PO4)(CO3)(OH).2H2O M
SKORPIONITE Ca3Zn2(CO3)(PO4)2(OH)2.H2O M
VYACHESLAVITE U++++(PO4)(OH).2.5H2O O
LERMONTOVITE U++++(PO4)(OH).H2O (?) O
SANTAFEITE (Na,Ca,Sr)3(Mn++,Fe+++)2Mn++++2(VO4)4(OH,O)5.2H2O O
PEISLEYITE Na3Al16(SO4)2(PO4)10(OH)17.20H2O M
NATROPHARMACOALUMITE (Na,K,H3O)Al4(AsO4)3(OH)4.4H2O C
PHARMACOALUMITE KAl4(AsO4)3(OH)4.6,5H2O C
PHARMACOSIDERITE KFe+++4(AsO4)3(OH)4.6-7H2O C/Q
NATROPHARMACOSIDERITE (Na,K)2Fe+++4(AsO4)3(OH)5.7H2O Q ps C
BARIOPHARMACOALUMITE Ba0,5Al4(AsO4)3(OH)4.4H2O C
BARIOPHARMACOSIDERITE BaFe+++4(AsO4)3(OH)5.5H2O Q ps C
HYDRONIUMPHARMACOALUMITE (H3O)Al4(AsO4)3(OH)4.4,5H2O C
HYDRONIUMPHARMACOSIDERITE (H3O,K)(Fe+++,Al)4(AsO4)3(OH)4.4H2O C
STRONTIOPHARMACOSIDERITE Sr0,5Fe4[(AsO4)3(OH)4].4H2O C
CAESIUMPHARMACOSIDERITE CsFe4[(AsO4)3(OH)4].4H2O C
GUTSEVICHITE (?) (Al,Fe+++)3(PO4,VO4)2(OH)3.8H2O (?) (?)
SANTABARBARAITE Fe+++3(PO4)2(OH)3.5H2O am.
FERRISYMPLESITE Fe+++3(AsO4)2(OH)3.5H2O am.
YUKONITE Ca2Fe+++3(AsO4)4(OH).12H2O (?) am.
OGDENSBURGITE Ca2(Zn,Mn)Fe+++4(AsO4)4(OH)6.6H2O O ps H
ANGASTONITE CaMgAl2(PO4)2(OH)2.7H2O A
MATULAITE Fe+++Al7(PO4)4(PO3OH)2(OH)8(H2O)8.8H2O M
FOGGITE CaAl(PO4)(OH)2.H2O O
KRASNOVITE Ba(Al,Mg)(PO4,CO3)(OH)2.H2O O
MORINITE NaCa2Al2(PO4)2(F,OH)5.2H2O M
GALLISKIITE Ca4Al2(PO4)2F8.5H2O A
FLUOROWARDITE NaAl3(PO4)2F2(OH)2.2H2O Q
WARDITE NaAl3(PO4)2(OH)4.2H2O Q
CYRILOVITE NaFe+++3(PO4)2(OH)4.2H2O Q
MILLISITE (Na,K)CaAl6(PO4)4(OH)9.3H2O Q
WALLKILLDELLITE-Fe (Ca,Cu)4Fe6[(As,Si)O4]4(OH)8.18H2O H
WALLKILLDELLITE Ca4Mn++6As+++++4O16(OH)8.18H2O H
LANGBANSHYTTANITE Pb2Mn2Mg(AsO4)2(OH)4.6H2O A
7/D.53- Mixite group
PETERSITE-(Y) (Y,Ce,Nd,Ca)Cu++6(PO4)3(OH)6.3H2O H
PETERSITE-(Ce) (?)    
PETERSITE-(Nd) (?)    
CALCIOPETERSITE CaCu6[(PO4)2(PO3OH)](OH)6.3H2O H
GOUDEYITE (Al,Y)Cu6(AsO4)3(OH)6.3H2O H
ZALESIITE CaCu++6(AsO4)2(AsO3OH)(OH)6.3H2O H
AGARDITE-(Y) (Y,Ca)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(La) (La,Ca)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(Ce) (Ce,Ca,La)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(Nd) (Nd,La,Y)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(Dy) (?) (Dy,La,Ca)Cu6(AsO4)3(OH)6.3H2O (?) H
PLUMBOAGARDITE (Pb,REE,Ca)Cu6(AsO4)3(OH)6.3H2O H
MIXITE BiCu++6(AsO4)3(OH)6.3H2O H
JUANITAITE (Cu,Ca,Fe++)10Bi(AsO4)4(OH)11.H2O Q
MRAZEKITE Bi+++2Cu++3(PO4)2O2(OH)2.2H2O M
BLEASDALEITE (Ca,Fe+++)2Cu5(Bi+++,Cu++)(PO4)4(H2O,OH,Cl)13 M ps Q
RICHELSDORFITE Ca2Cu5Sb(AsO4)4Cl(OH)6.6H2O M
TYROLITE CaCu5(AsO4)2(CO3)(OH)4.6H2O O
TANGDANITE Ca2Cu9(AsO4)4(SO4)0.5(OH)9.9H2O M
DELVAUXITE CaFe+++4(PO4,SO4)2(OH)8.4-6H2O (?) am.
SYNADELPHITE (Mn,Mg,Ca,Pb)9(As+++O3)(As+++++O4)2(OH)9.2H2O (?) A ps O
BOUAZZERITE Mg5,5Bi3Fe+++7(AsO4)9O6(OH)2.43H2O M
VOLBORTHITE Cu++3V+++++2O7(OH)2.2H2O M
ENGELHAUPTITE KCu3(V2O7)(OH)2Cl H
KARPENKOITE Co3(V2O7)(OH)2.2H2O R ps H
MARTYITE (Zn,Co)3(V2O7)(OH)2.2H2O R ps H
7/E. Uranylphosphates/vanadates [UO2]and[PO4]/[AsO4], [UO2]and[V2O8]
7/E.01 Autunite group
TROGERITE (UO2)3(AsO4)2.12H2O (?) Q (?)
SABUGALITE H0,5Al0,5(UO2)2(PO4)2.8H2O M ps Q
SALEEITE Mg(UO2)2(PO4)2.10H2O M ps Q
NOVACEKITE I Mg(UO2)2(AsO4)2.10-12H2O Q
NOVACEKITE Mg(UO2)2(AsO4)2.10-12H2O Q
NOVACEKITE II Mg(UO2)2(AsO4)2.10H2O Q
KAHLERITE Fe++(UO2)2(AsO4)2.10-12H2O Q
FRITZSCHEITE Mn++(UO2)2[(P,V)O4]2.10H2O (?) Q
RAUCHITE (Ni,Mg)(UO2)2(AsO4)2.10H2O A
TORBERNITE Cu++(UO2)2(PO4)2.8-12H2O Q
ZEUNERITE Cu++(UO2)2(AsO4)2.10-16H2O Q
AUTUNITE Ca(UO2)2(PO4)2.10-12H2O Q
URANOSPINITE Ca[(UO2)(AsO4)]2(H2O)11 O
URANOCIRCITE Ba[(UO2)(PO4)]2(H2O)10 O
HEINRICHITE Ba[(UO2)(AsO4)]2(H2O)10 M
SODIUMAUTUNITE (?) Na2(UO2)2(PO4)2.8H2O Q
7/E.02 Metaautunite group
METANOVACEKITE Mg(UO2)2(AsO4)2.4-8H2O Q
METASALEEITE Mg(UO2)2(PO4)2.8H2O Q
BASSETITE Fe++(UO2)2(PO4)2.8H2O M
METAKAHLERITE Fe++(UO2)2(AsO4)2.8H2O Q
LEHNERITE Mn++U++++++(PO4)2O.8H2O M
METARAUCHITE (Ni,Co)(UO2)2(AsO4)2.8H2O A
METAKIRCHHEIMERITE Co(UO2)2(AsO4)2.8H2O Q (?)
METATORBERNITE Cu++(UO2)2(PO4)2.8H2O Q
METAZEUNERITE Cu++(UO2)2(AsO4)2.8H2O Q
METALODEVITE Zn(UO2)2(AsO4)2.10H2O Q
METAAUTUNITE (META-AUTUNITE) Ca(UO2)2(PO4)2.2-6H2O Q
METAURANOSPINITE Ca(UO2)2(AsO4)2.8H2O Q
METAURANOCIRCITE I Ba(UO2)2(PO4)2.6-8H2O Q
METAURANOCIRCITE II Ba[(UO2)(PO4)]2(H2O)7 M
METAHEINRICHITE Ba[(UO2)(AsO4)]2(H2O)7 M
METANATROAUTUNITE Na2(UO2)2(PO4)2.6-8H2O Q
NATROURANOSPINITE (Na2,Ca)(UO2)2(AsO4)2.5H2O Q
METAANKOLEITE (META-ANKOLEITE) K2(UO2)2(PO4)2.6H2O Q
ABERNATHYITE K2(UO2)2(AsO4)2.8H2O Q
URAMPHITE (NH4)(UO2)(PO4).3H2O O (?)
URAMARSITE (NH4,H3O)2(UO2)(AsO4,PO4)2.6H2O Q
CHERNIKOVITE (H3O)2(UO2)2(PO4)2.6H2O Q
PSEUDOAUTUNITE (?) (H3O)4Ca2(UO2)2(PO4)4.5H2O (?) Q
ULRICHITE CaCu++(UO2)(PO4)2.4H2O M
SINCOSITE CaV++++2(PO4)2(OH)4.3H2O Q
SIMPLOTITE CaV++++4O9.5H2O M
BARIOSINCOSITE (Ba,Sr)(V++++OPO4)2.4H2O Q
URANOSPATHITE Al0,5-1(UO2)2(PO4)2F.20-21H2O O ps Q
ARSENURANOSPATHITE HAl(UO2)4(AsO4)4.40H2O Q
RANUNCULITE HAl(UO2)PO4(OH)3.4H2O M ps O
TRIANGULITE Al3(UO2)4(PO4)4(OH)5.5H2O A
UPALITE Al(UO2)3(PO4)2O(OH).7H2O M
THREADGOLDITE Al(UO2)2(PO4)2(OH).8H2O M
CHISTYAKOVAITE Al(UO2)2(AsO4)2(F,OH).6,5H2O M
FURONGITE Al4[(UO2)4(PO4)6](OH)2(H2O)19,5H2O A
MOREAUITE Al3(UO2)(PO4)3(OH)2.13H2O M
VOCHTENITE (Fe++,Mg)Fe+++[(UO2)(PO4)]4(OH).12-13H2O M
COCONINOITE Fe+++2Al2(UO2)2(PO4)4(SO4)(OH)2.20H2O M (?)
XIANGJIANGITE (Fe+++,Al)(UO2)4(PO4)2(SO4)2(OH).22H2O Q
LAKEBOGAITE NaCa(Fe+++,Al)2H(UO2)2(PO4)4(OH)2.8H2O M
PHURALUMITE Al2(UO2)3(PO4)2(OH)6.10H2O M
MUNDITE Al(UO2)3(PO4)2(OH)3,5.5H2O O
YINGJIANGITE (K2,Ca)(UO2)7(PO4)4(OH)6.6H2O O
PHOSPHURANYLITE KCa(H3O)3(UO2)7(PO4)4O4.8H2O O
PHURCALITE Ca2(UO2)3O2(PO4)2.7H2O O
ARSENURANYLITE Ca(UO2)4(AsO4)2(OH)4.6H2O O
BERGENITE Ba4Ca2(UO2)6(PO4)6O6.16H2O M
FRANCOISITE-(Ce) (Ce,Nd,Ca)(UO2)3(PO4)2O(OH).6H2O M
FRANCOISITE-(Nd) (Nd,Y,Sm,Ce)(UO2)3(PO4)2O(OH).6H2O M
DEWINDTITE Pb3[H(UO2)3O2(PO4)2]2.12H2O O
DUMONTITE Pb2(UO2)3O2(PO4)2.5H2O M
HUGELITE Pb2(UO2)3(AsO4)2O2.5H2O M
KAMITUGAITE PbAl(UO2)5[(P,As)O4]2(OH)9.9.5H2O A
KIVUITE (Th,Ca,Pb)H2(UO2)4(PO4)2(OH)8.7H2O (?) O (?)
ALTHUPITE ThAl(UO2)7(PO4)4(OH)5.15H2O A
NIELSBOHRITE K(UO2)3(AsO4)(OH)4.H2O O
VANMEERSSCHEITE U++++++(UO2)3(PO4)2(OH)6.4H2O O
METAVANMEERSSCHEITE U++++++(UO2)3(PO4)2(OH)6.2H2O O
ARSENOVANMEERSSCHEITE U++++++(UO2)3(AsO4,PO4)2(OH)2.4H2O O
SODIUMKOMAROVITE Na6Ca(Nb,Ti)6(Si4O12)(O,OH)14(F,OH)2.3-4H2O O
KOMAROVITE (Ca,Sr,Na)2(Nb,Ti)6(Si4O12)(O,OH)14(F,OH)2.6-7H2O O
PARSONSITE Pb2(UO2)(PO4)2.2H2O A
HALLIMONDITE Pb2(UO2)(AsO4)2 A
PRZHEVALSKITE Pb(UO2)2(PO4)2.4H2O O
SREINITE (BiO)3Pb(UO2)4(OH)7(PO4,AsO4)2.4H2O C
ASSELBORNITE (BiO)3(Pb,Ba)(UO2)4(OH)7(AsO4)2.4H2O C
PHOSPHOWALPURGITE Bi4(UO2)(PO4,AsO4)2O4.2H2O A
ORTHOWALPURGITE (UO2)Bi4O4(AsO4)2.2H2O O
WALPURGITE Bi4(UO2)(AsO4)2O4.2H2O A
7/E.11- Uranyl nesovanadates with [UO2]++++ [V2O8]------
VANURALITE Al(UO2)2(V+++++O4)2(OH).11H2O M
METAVANURALITE Al(UO2)2V2O8(OH).8H2O A
SENGIERITE Cu2(UO2)2V2O8.6H2O M
STRELKINITE Na2(UO2)2V2O8.6H2O O
CARNOTITE K2(UO2)2V2O8.3H2O M
MARGARITASITE (Cs,K,H3O)2(UO2)2V2O8.H2O M
VANURANYLITE (H3O,Ba,Ca,K)1,6(UO2)2V2O8.4H2O (?) O (?)
TYUYAMUNITE Ca(UO2)2V2O8.5-8H2O O
METATYUYAMUNITE Ca(UO2)2V2O8.3H2O O
FRANCEVILLITE (Ba,Pb)(UO2)2V2O8.5H2O O
CURIENITE Pb(UO2)2V2O8.5H2O O

Class VIII - Silicates

Mineral Formula System
8/A. Nesosilicates: isolated tetrahedrons [SiO4]----, Si:O = 1:4
8/A.01 to 03 Cations in tetrahedral coordination [4]
PHENAKITE Be2SiO4 R
WILLEMITE Zn2SiO4 R
EUCRYPTITE LiAlSiO4 R
LIBERITE Li2BeSiO4 M
TRIMERITE Ca,Mn2Be3(SiO4)3 M
ESPERITE PbCa2Zn3(SiO4)3 M
LARSENITE PbZnSiO4 O
8/A.04 to 07 Cations in octahedral coordination [6]
8/A.04- Olivine group
FORSTERITE Mg2SiO4 O
FAYALITE Fe++2SiO4 O
TEPHROITE Mn++2SiO4 O
LIEBENBERGITE (Ni,Mg)2SiO4 O
LAIHUNITE Fe++Fe+++2(SiO4)2 M
MONTICELLITE CaMgSiO4 O
KIRSCHSTEINITE CaFe++SiO4 O
GLAUCOCHROITE CaMnSiO4 O
WADSLEYITE (Mg,Fe++)2SiO4 O
RINGWOODITE (Mg,Fe++)2SiO4 C
AHRENSITE Fe2SiO4 C
MERWINITE Ca3Mg(SiO4)2 M
BREDIGITE Ca7Mg(SiO4)4 O ps H
LARNITE Ca2SiO4 M
CALCIOOLIVINE (CALCIO-OLIVINE) Ca2SiO4 O
8/A.08 to 12 Cations in cubic and octahedral coordination [8+6]
8/A.08- Garnet group
PYROPE {Mg3}[Al2](Si3)O12 C
JEFFBENITE Mg3Al2Si3O12 Q
ALMANDINE {Fe++3}[Al2](Si3)O12 C
SPESSARTINE {Mn++3}[Al2](Si3)O12 C
CALDERITE {Mn++3}[Fe+++2](Si3)O12 C
KNORRINGITE {Mg3}[Cr+++2](Si3)O12 C
MAJORITE {Mg3}[SiMg](Si3)O12 C
MENZERITE-(Y) {Y2Ca}[Mg2](Si3)O12 C
GROSSULAR {Ca3}[Al2](Si3)O12 C
KATOITE {Ca3}[Al2]([]3)(OH)12 C
ANDRADITE {Ca3}[Fe+++2](Si3)O12 C
SCHORLOMITE {Ca3}[Ti2](SiFe+++2)O12 C
MORIMOTOITE {Ca3}[TiFe++](Si3)O12 C
UVAROVITE {Ca3}[Cr+++2](Si3)O12 C
MOMOIITE {Mn++3}[V+++2](Si3)O12 C
GOLDMANITE {Ca3}[V+++2](Si3)O12 C
ERINGAITE {Ca3}[Sc2](Si3)O12 C
KIMZEYITE {Ca3}[Zr2](SiAl2)O12 C
IRINARASSITE {Ca3}[Sn++++2](SiAl2)O12 C
TOTURITE {Ca3}[Sn++++2](SiFe+++2)O12 C
KERIMASITE {Ca3}[Zr2](SiFe+++2)O12 C
WADALITE Ca12Al010Si4O32Cl6 C
ELTYUBYUITE Ca12Fe+++10Si4O32Cl6 C
HOLTSTAMITE {Ca3}[Al2](Si2)([])O8(OH)4 Q
HENRITERMIERITE {Ca3}[Mn+++2](Si2)( [])O8(OH)4 Q
REIDITE ZrSiO4 Q
ZIRCON (Zr,Hf)SiO4 Q
HAFNON HfSiO4 Q
ATELISITE-(Y) Y4Si3O8(OH)8 Q
STETINDITE Ce++++SiO4 Q
THORITE (Th,U)SiO4 Q
COFFINITE U(SiO4)1-x(OH)4x Q
UMBOZERITE Na3Sr4ThSi8(O,OH)24 am.
HUTTONITE ThSiO4 M
EULYTINE Bi4(SiO4)3 C
8/B. Nesosilicates with tetrahedron's additional anion
8/B.01 to 08 Cations in tetrahedral or octahedral coordination [4/6]
EUCLASE BeAlSiO4(OH) M
HODGKINSONITE MnZn2SiO4(OH)2 M
SPHAEROBERTRANDITE Be3SiO4(OH)2 M ps O
BERYLLITE Be3SiO4(OH)2.H2O O (?)
SILLIMANITE Al2SiO5 O
ANDALUSITE Al2SiO5 O
KANONAITE (Mn+++,Al)AlSiO5 O
KYANITE Al2SiO5 A
MULLITE Al8(Si,Al)4O16(O,OH,F)4 O
BOROMULLITE Al8BO4AlO4(SiO4)2O3 O
YODERITE (Mg,Al,Fe+++)8Si4(O,OH)20 M
TOPAZ Al2SiO4(F,OH)2 O
MAGNESIOSTAUROLITE []4Mg4Al16(Al2[]2)Si8O40[(OH)2O6] M
ZINCOSTAUROLITE (Zn,Li,Fe,Mg)2Al9(Si,Al)4O22(OH)2 M
STAUROLITE (Fe++,Mg,Zn)2Al9(Si,Al)4O22(OH)2 M ps O
GERSTMANNITE (Mg,Mn)2ZnSiO4(OH)2 O
8/B.04- Humite group
NORBERGITE Mg3(SiO4)(F,OH)2 O
CHONDRODITE (Mg,Fe++)5(SiO4)2(F,OH)2 M
HYDROXYLCHONDRODITE Mg5(SiO4)2(OH)2 M
HUMITE (Mg,Fe++)7(SiO4)3(F,OH)2 O
CLINOHUMITE (Mg,Fe++)9(SiO4)4(F,OH)2 M
HYDROXYLCLINOHUMITE Mg9(SiO4)4(OH,F)2 M
RIBBEITE (Mn++,Mg)5(SiO4)2(OH)2 O
ALLEGHANYITE Mn++5(SiO4)2(OH)2 M
KUMTYUBEITE Ca5(SiO4)2F2 M
REINHARDBRAUNSITE Ca5(SiO4)2(OH,F)2 M
MANGANHUMITE (Mn++,Mg)7(SiO4)3(OH)2 O
LEUCOPHOENICITE Mn++7(SiO4)3(OH)2 M
CHEGEMITE Ca7(SiO4)3(OH)2 O
FLUORCHEGEMITE Ca7(SiO4)3F2 O
JERRYGIBBSITE Mn++9(SiO4)4(OH)2 O
SONOLITE Mn++9(SiO4)4(OH,F)2 M
EDGREWITE Ca9(SiO4)4F2 M
HYDROXYLEDGREWITE Ca9(SiO4)4(OH)2 M
RONDORFITE Ca8Mg(SiO4)4Cl2 C
JASMUNDITE Ca11(SiO4)4O2S Q
CHAPMANITE Sb+++Fe+++2(SiO4)2(OH) M
BISMUTOFERRITE BiFe+++2(SiO4)2(OH) M
TRANQUILLITYITE Fe++8(Zr,Y)2Ti3Si3O24 H
IIMORIITE-(Y) Y2(SiO4)(CO3) A
BRAUNITE Mn++Mn+++6SiO12 Q
BRAUNITE II (?) Ca(Mn+++,Fe+++)14SiO24 Q
ABSWURMBACHITE Cu++Mn+++6SiO12 Q
NELTNERITE CaMn+++6SiO12 Q
FRANCISCANITE Mn++3V+++++(SiO4)(O,OH)7 H
OREBROITE Mn++3(Sb+++++,Fe+++)Si(O,OH)7 H
WELINITE Mn++3(W++++++,Mg)0,7SiO4(O,OH)3 H
GATEDALITE ZrMn++2Mn+++4SiO12 Q
LANGBANITE (Mn++,Ca)4(Mn+++,Fe+++)9Sb+++++Si2O24 R
YEATMANITE Mn++9Zn6Sb+++++2Si4O28 A
KATOPTRITE (Mn,Mg)13(Al,Fe+++)4Sb+++++2Si2O28 M
HOLDENITE (Mn,Mg)6Zn3(AsO4)2(SiO4)(OH)8 O
KOLICITE Mn7Zn4(AsO4)2(SiO4)2(OH)8 O
MANGANOSTIBITE (Mn++,Fe++)7(SbO4)(AsO4,SiO4)O4 O
DIXENITE Cu+Mn++14Fe+++(As+++O3)5(SiO4)2(As+++++O4)(OH)6 R
TURTMANNITE (Mn,Mg)22,5Mg33x[(V,As)O4]3[SiO4]3[AsO3]xO55x(OH)20+x R ps H
MCGOVERNITE (Mn,Mg,Zn)22(AsO3)(AsO4)3(SiO4)3(OH)20 R
CARLFRANCISITE Mn++3(Mn++,Mg,Fe+++,Al)42[As+++O3]2(As+++++O4)4[(Si,As+++++)O4]6[(As+++++,Si)O4]2(OH)42 R
WIKLUNDITE Pb2(Mn++,Zn)3(Fe+++,Mn++)2(Mn++,Mg)19(As+++O3)2(Si,As+++++O4)6(OH)18Cl6 R
KRAISSLITE (Mn++,Mg)24Zn3Fe+++(As+++O3)2(As+++++O4)3(SiO4)6(OH)18 H
ASBECASITE Ca3(Ti,Fe,Sn)(Be,B,Al)2(As+++,Sb+++)3O6(SiO4)2 R
8/B.12 to 38 Cations with coordination number between [8] and [12]
TITANITE CaTiSiO5 M
VANADOMALAYAITE CaVOSiO4 M
MALAYAITE CaSnSiO5 M
NATROTITANITE (Na,Ca,Y,REE)TiSiO4(O,F) M
TRIMOUNSITE-(Y) (Y,Dy,Er,Yb,Gd,Ho,Tb,Sm)2Ti2SiO9 M
PARANATISITE Na2(TiO)SiO4 O
NATISITE Na2(TiO)SiO4 Q
IVANYUKITE-Cu Cu[Ti4(OH)2O2(SiO4)3].7H2O C
IVANYUKITE-K K2[Ti4(OH)2O2(SiO4)3].9H2O C
IVANYUKITE-Na-C Na2[Ti4O2(OH)2(SiO4)3].6H2O C
IVANYUKITE-Na-T Na3[Ti4(OH)O3(SiO4)3].7H2O R
YFTISITE-(Y) (Y,Dy,Er)4(Ti,Sn++++)O(SiO4)2(F,OH)6 O
MONGOLITE Ca4Nb6Si5O24(OH)10.5-6H2O Q
CHESNOKOVITE Na2SiO2(OH)2.8H2O O
ILMAJOKITE (Na,Ce,Ba)2TiSi3O5(OH)10.nH2O M
SITINAKITE Na2K(Ti,Nb)4O4(SiO4)2(O,OH).4H2O Q
KIHLMANITE-(Ce) Ce2TiO2[SiO4](HCO3)2(H2O) A
TUNDRITE-(Ce) Na2(Ce,La,Nd)2(Ti,Nb)(O,OH)2(SiO4)(CO3)2 A
TUNDRITE-(Nd) Na3(Nd,La)4(Ti,Nb)2(SiO4)2(CO3)3O4(OH).2H2O A
KULIOKITE-(Y) (Y,Yb,Er,Dy,Lu,Gd,Tm,Ho)4Al(SiO4)2(OH)2F5 A
TORNEBOHMITE-(La) (La,Ce)2Al(SiO4)2(OH) M
TORNEBOHMITE-(Ce) (Ce,La)2Al(SiO4)2(OH) M
ALUMINOCERITE-(Ce) (Ce,Ca,La,Nd)9(Al,Fe+++)(SiO4)3[SiO3(OH)]4(OH)3 R
CERITE-(Ce) Ce+++9Fe+++(SiO4)6[(SiO3)(OH)](OH)3 R
CERITE-(La) (La,Ce,Ca)9(Fe,Ca,Mg)(SiO4)3[(SiO3)(OH)]4(OH)3 R ps H
SARYARKITE-(Y) Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7.6H2O H
KITTATINNYITE Ca4Mn++2Mn+++4Si4O16(OH)8.18H2O H
HATRURITE Ca3SiO5 R
OLMIITE CaMn++SiO3(OH)2 O
POLDERVAARTITE CaCaSiO3(OH)2 O
AFWILLITE Ca3Si2O4(OH)6 M
BULTFONTEINITE Ca2SiO2(OH,F)4 A
SPURRITE Ca5(SiO4)2(CO3) M
SILICOCARNOTITE Ca5[(SiO4)(PO4)](PO4) O
TERNESITE Ca5(SiO4)2SO4 O
GALUSKINITE Ca7(SiO4)3(CO3) M
NAGELSCHMIDTITE Ca3(PO4)2.2(alpha-Ca2SiO4) H
HARRISONITE Ca(Fe++,Mg)6(PO4)2(SiO4)2 R
CHELYABINSKITE (Ca,Mg)3Si(OH)6(SO4,CO3)2.9H2O O
VUAGNATITE CaAlSiO4(OH) O
MOZARTITE CaMn+++SiO4(OH) O
CHANTALITE CaAl2SiO4(OH)4 Q
CEBOLLITE Ca2(Mg,Fe++,Al)Si2(O,OH)7 O
MAGNESIOCHLORITOID MgAl2SiO5(OH)2 A
CHLORITOID (Fe++,Mg,Mn)2Al4Si2O10(OH)4 M/A
OTTRELITE (Mn,Fe++,Mg)2Al4Si2O10(OH)4 M/A
STRINGHAMITE CaCuSiO4.2H2O M
CLINOHEDRITE CaZnSiO4.H2O M
CHESSEXITE Na4Ca2(Mg,Zn)3Al8(SiO4)2(SO4)10(OH)10.40H2O O
8/B.27 to 28 Nesosilicates with [SO4]--, [CrO4]--, [PO4]---
FLUORELLESTADITE Ca5(SiO4)1,5(SO4)1,5F H
HYDROXYLELLESTADITE Ca5(SiO4)1,5(SO4)1,5OH M ps H
MATTHEDDLEITE Pb5(SiO4)1,5(PO4)1,5Cl H
HYDROXYLMATTHEDDLEITE Pb5(SiO4)1,5(PO4)1,5OH  
BRITHOLITE-(Y) (Y,Ca)5(SiO4,PO4)3(OH,F) H
BRITHOLITE-(Ce) (Ce,Ca)5(SiO4,PO4)3(OH,F) H
FLUORBRITHOLITE-(Y) (Y,Ca,Ce,Nd)5(SiO4)3(F,O) H
FLUORBRITHOLITE-(Ce) (Ce,Ca)5(SiO4)3F H
FLUORCALCIOBRITHOLITE (Ca,Ce,La,Nd)5(SiO4,PO4)3(F,O) H
IRANITE Pb10Cu(CrO4)6(SiO4)2(F,OH)2 A
RAYGRANTITE Pb10Zn(SO4)6(SiO4)2(OH)2 A
HEMIHEDRITE Pb10Zn(CrO4)6(SiO4)2F2 A
WHERRYITE Pb7Cu2(SO4)4(SiO4)2(OH)2 M
MACQUARTITE Pb3Cu++(CrO4)SiO3(OH)4.2H2O M
8/B.29 to 33 Be and B nesosilicates
8/B.29- Datolite - gadolinite group
DATOLITE Ca2B2Si2O8(OH)2 M
BAKERITE Ca4B4(BO3)(SiO4)3(OH)5 M
HOMILITE Ca2(Fe++,Mg)B2Si2O10 M
MINASGERAISITE-(Y) CaY2Be2Si2O10 M
GADOLINITE-(Y) Y2Fe++Be2Si2O10 M
GADOLINITE-(Ce) (Ce,La,Nd,Y)2Fe++Be2Si2O10 M
HINGGANITE-(Y) BeYSiO4(OH) M
HINGGANITE-(Ce) BeCeSiO4(OH) M
HINGGANITE-(Yb) (Yb,Y)BeSiO4(OH) M
CALCYBEBOROSILITE-(Y) (?) (Y,Ca)2(B,Be)2Si2O8(OH)2 (?) M
ELLENBERGERITE Mg6TiAl6Si8O28(OH)10 H
KORNERUPINE Mg4(Al,Fe+++)6(Si,B)4O21(OH) O
PRISMATINE (Mg,Al,Fe++)5-6Al4((Si,Al)O4)4(BO3)(O,OH,F)3 O
MAGNESIODUMORTIERITE (Mg,Ti,-)(Al,Mg)2Al4Si3O18-y(OH)yB (y=2-3) O
DUMORTIERITE Al7(BO3)(SiO4)3O3 O
TITANOHOLTITE (Ti0,75[]0,25)Al6BSi3O18 O
HOLTITE Al6(Al,Ta)(Si,Sb)3BO15(O,OH)2 O
NIOBOHOLTITE (Nb0,6[]0,4)Al6BSi3O18 O
GRANDIDIERITE (Mg,Fe++)Al3(BO4)(SiO4)O O
OMINELITE (Fe++,Mg)Al3BSiO9 O
BORALSILITE Al16(BO4)6(SiO4)2O5 M
WERDINGITE (Mg,Fe)2Al12(Al,Fe)2Si4B2(B,Al)2O37 A
HARKERITE Ca24Mg8Al2(SiO4)8(BO3)6(CO3)10.2H2O C
GARRELSITE Ba3NaSi2B7O16(OH)4 M
OKANOGANITE-(Y) Na(Y,Ce,Nd,Ca,Na)15Fe+++(Si3B3O18)(SiO4)4F10(OH)4 R
VICANITE-(Ce) (Ca,REE,Th)15Fe+++(SiO4)3(Si3B3O18)(BO3)(As+++++O4)(As+++O3)x(NaF3)1-xF7.0,2H2O (x=0.4) R
PROSHCHENKOITE-(Y) (Y,REE,Ca,Na,Mn)15(Fe++,Mn)Ca(P,Si)Si6B3O34F14 R
LAPTEVITE-(Ce) Ca6(Fe++,Mn++)Y3REE7(SiO4)3(PO4)(B3Si3O18)(BO3)F11 H
HUNDHOLMENITE-(Y) (Y,REE,Ca,Na)15(Al,Fe+++)(CaxAs+++1-x)(Si,As+++++)Si6B3(O,F)48 (x = 0,78) R
TRITOMITE-(Y) Y5(SiO4,BO4)3(O,OH,Cl) R (?)
TRITOMITE-(Ce) Ce5(SiO4,BO4)3(OH,O) R
8/B.34 to 38 Uranyl nesosilicates with [UO2]++ and [SiO4]----
SKLODOWSKITE (H3O)2Mg(UO2)2(SiO4)2.2H2O M
CUPROSKLODOWSKITE (H3O)2Cu(UO2)2(SiO4)2.2H2O A
OURSINITE (Co,Mg)(UO2)2Si6(OH)2.6H2O O
URANOPHANE Ca(UO2)2SiO3(OH)2.5H2O M
URANOPHANEBETA Ca(UO2)2SiO3(OH)2.5H2O M
BOLTWOODITE (K,Na)(UO2)SiO3(OH).1,5H2O M
NATROBOLTWOODITE (Na,K)(UO2)SiO3(OH).1,5H2O O
KASOLITE Pb(UO2)SiO4.H2O M
URANOSILITE U++++++Si7O17 O
SODDYITE (UO2)2SiO4.2H2O O
SWAMBOITE U++++++H6(UO2)6(SiO4)6.30H2O M
URSILITE (Mg,Ca)4[(UO2)4(OH)5/(Si2O5)5,5].13H2O O
LEPERSONNITE-(Gd) CaO.(Gd,Dy)2O3.24UO3.8CO2.4SiO2.60H2O O
8/C. Sorosilicates: paired tetrahedrons, Si:O = 2:7
8/C.01 to 06 Sorosilicates [Si2O7]------ without tetrahedron's additional anion
THORTVEITITE (Sc,Y)2Si2O7 M
GITTINSITE CaZrSi2O7 M
KRISTIANSENITE Ca2ScSn(Si2O7)(Si2O6OH) A
KEIVIITE-(Y) (Y,Yb)2Si2O7 M
KEIVIITE-(Yb) (Yb,Y)2Si2O7 M
YTTRIALITE-(Y) (Y,Th)2Si2O7 H (?)
PERCLEVEITE-(Ce) (Ce,La,Nd)2(Si2O7) Q
ROWLANDITE-(Y) Y4Fe++Si4O14F2 (?) am.
CERVANDONITE-(Ce) (Ce,Nd,La)(Fe+++,Fe++,Ti++++,Al)3O2(Si2O7)1-x+y(AsO3)1+x-y(OH)3x-3y (x=0,47 y=0,31) M
8/C.02- Melilite group
ALUMOAKERMANITE NaCa(Al,Fe+++)Si2O7 Q
AKERMANITE Ca2MgSi2O7 Q
OKAYAMALITE Ca2B2SiO7 Q
GEHLENITE Ca2Al(AlSi)O7 Q
MELILITE (Ca,Na)2(Al,Mg)(Si,Al)2O7 Q
GUGIAITE Ca2BeSi2O7 Q
HARDYSTONITE Ca2ZnSi2O7 Q
JEFFREYITE (Ca,Na)2(Be,Al)Si2(O,OH)7 O ps Q
MELIPHANITE (Ca,Na)2Be(Si,Al)2(O,OH,F)7 Q
BARYLITE BaBe2Si2O7 O ps H
SCOTTYITE BaCu2Si2O7 O
ANDREMEYERITE BaFe++2Si2O7 M (?)
RANKINITE Ca3Si2O7 M
KELDYSHITE Na2-xHxZrSi2O7.nH2O A
PARAKELDYSHITE Na2ZrSi2O7 A
KHIBINSKITE K2ZrSi2O7 M ps R
BARYSILITE Pb8Mn(Si2O7)3 R
EDGARBAILEYITE Hg+6Si2O7 M
8/C.07 to 20 Sorosilicates [Si2O7]6- with tetrahedron's additional anion: O,OH,F
BERTRANDITE Be4Si2O7(OH)2 O
HEMIMORPHITE Zn4Si2O7(OH)2.H2O O
JUNITOITE CaZn2Si2O7.H2O O
CUSPIDINE Ca4(Si2O7)(F,OH)2 M
RUSINOVITE Ca10(Si2O7)3Cl2 O
FUKALITE Ca4Si2O6(CO3)(OH)2 O
TILLEYITE Ca5Si2O7(CO3)2 M
JAFFEITE Ca4(Si3O7)(OH)6 H
SUOLUNITE Ca2Si2O5(OH)2.H2O O
AKLIMAITE Ca4[Si2O5(OH)2](OH,F)4.5H2O M
KILLALAITE Ca6,4[H0,6Si2O7]2(OH)2 M
BIRAITE-(Ce) (Fe++,Mg)(Ce,La,Nd)2(CO3)(Si2O7) M
LAWSONITE CaAl2Si2O7(OH)2.H2O O
ITOIGAWAITE SrAl2Si2O7(OH)2.H2O O
HENNOMARTINITE SrMn+++2Si2O7(OH)2.H2O O
NOELBENSONITE BaMn+++2(Si2O7)(OH)2.H2O O
ILVAITE CaFe++2Fe+++Si2O7O(OH) O/M
MANGANILVAITE CaFe++Fe+++(Mn,Fe++)(Si2O7)O(OH) M
WOHLERITE Na4Ca8(Zr,Nb)4(Si2O7)4(O,OH,F)8 M
MARIANOITE Na2Ca4Nb(Nb,Zr)(Si2O7)2(O,F)4 M
JANHAUGITE Na6Mn++6Ti4(Si2O7)4[O2(OH,F,O)6] M
NORMANDITE NaCa(Mn++,Fe++)(Zr,Ti)(Si2O7)OF M
LAVENITE (Na,Ca)8(Mn++,Fe++)4(Zr,Ti)4(Si2O7)4(O,OH,F)8 M
BURPALITE Na8Ca4Zr4(Si2O7)4F8 M
BAGHDADITE Ca12(Zr,Ti)4(Si2O7)4(O,F)8 M
DOVRYENITE Ca6Zr(Si2O7)2(OH)4 O
ROUMAITE (Ca,Na,Ce,La)6-7(Nb,Ti++++)(Si2O7)(OH)F3 M
NIOCALITE Ca14Nb2(Si2O7)4(O6F2) M
HIORTDAHLITE-I (Na3Ca)Ca8Zr2(Y,Zr,REE,Na)+++2(Si2O7)4(O3F5) (?) A
HIORTDAHLITE-II (Na,Ca)4Ca8Zr2(Y,Zr,REE,Na)2(Si2O7)4(O3F5) A
8/C.12- Mosandrite-Rosenbuschite series
MOSANDRITE-(Ce) (Ca3REE)[(H2O)2Ca0,5[]0,5]Ti(Si2O7)2(OH)2(H2O)2 M
RINKITE-(Ce) (Ca3Ce)Na(NaCa)Ti(Si2O7)2(OF)F2 M
NACARENIOBSITE-(Ce) Na3Ca3(Ce,La,Pr,Nd)(Nb,Ti)(Si2O7)2OF3 M
ROSENBUSCHITE (Ca,Na)12(Zr,Ti)4(Si2O7)4(O4F4) A
GOTZENITE Na(Na,Ca)4Ca2Ti(Si2O7)2(O,F)2 A
KOCHITE Na2(Na,Ca)4Ca4(Mn,Ca)2Zr2(Si2O7)4(O,F)4F4 A
HAINITE-(Y) Na2Ca4(Y,REE)Ti(Si2O7)2OF3 A
FOGOITE-(Y) Na3Ca2Y2Ti(Si2O7)2OF3 A
BATIEVAITE-(Y) Y2Ca2Ti(Si2O7)2(OH)2(H2O)4 A
8/C.13- Lamprophyllite series
GRENMARITE (Na,Ca)4(Mn,Na)(Zr,Mn)2(Zr,Ti)(Si2O7)2(O,F)2 M
SEIDOZERITE Na4MnZr2Ti(Si2O7)2O2F2 M
NABALAMPROPHYLLITE Na3(Ba,Na)2Ti3Si8O16(OH,F)2 M
LAMPROPHYLLITE Na2(Sr,Ba)2Ti3(SiO4)4(OH,F)2 M
FLUORLAMPROPHYLLITE Na3(SrNa)Ti3(Si2O7)2O2F2 M
LILEYITE Ba2(Na,Fe,Ca)3MgTi2(Si2O7)2O2F2 M
EMMERICHITE Ba2Na(Na,Fe++)2(Fe+++,Mg)Ti2(Si2O7)2O2F2 M
BARYTOLAMPROPHYLLITE (Na,K)2(Ba,Ca,Sr)2(Ti,Fe)3(SiO4)4(O,OH)2 M
FERROERICSSONITE BaFe++2Fe+++(Si2O7)O(OH) M
ERICSSONITE (-2M) BaMn2Fe+++OSi2O7(OH) M
ERICSSONITE (-2O) BaMn2(Fe+++O)Si2O7(OH) O
8/C.14- Murmanite-Lomonosovite series
VIGRISHINITE Zn2Ti4-xSi4O14(OH,H2O,[])8 A
SHKATULKALITE Na10(Mn++,Ca,Sr)Ti3Nb3(Si2O7)6(OH)2F.12H2O M
JINSHAJIANGITE (Na,Ca)(Ba,K)(Fe++,Mn++)4(Ti,Fe+++)2(Si2O7)2O2(F,O,OH)2-3 M
PERRAULTITE (Na,Ca)(Ba,K)(Mn++,Fe++)4(Ti,Zr)2(Si2O7)2O2(OH,F,O)3 M
BOBSHANNONITE Na2KBa(Mn++,Na)8(Nb,Ti)4(Si2O7)4O4(OH)4(O,F)2 A
SURKHOBITE (Ba,K)2CaNa(Mn,Fe++,Fe+++)8Ti4(Si2O7)4O4(F,OH,O)6 M
MURMANITE Na4Ti++++Nb2(Si2O7)2O4.4H2O A
CALCIOMURMANITE (Na,[])2Ca(Ti,Mg,Nb)4[Si2O7]2O2(OH,O)2(H2O)4 A
ZVYAGINITE NaZnNb2Ti[Si2O7]2O(OH,F)3(H2O)4+x (x less than 1) A
EPISTOLITE Na4Ti++++4(Si2O7)2O2(OH,F)2.4H2O A
BORNEMANITE (Na,Ba)4(Na,Ti,Mn++)4(Ti,Nb)2(PO4)(Si2O7)2O2(OH,F,O)2 M
LOMONOSOVITE Na8Mn++Ti++++3Si4O12(PO4)2O4 A
BETALOMONOSOVITE Na6[]4Ti4(Si2O7)2[PO3(OH)][PO2(OH)2]O2(OF) A
VUONNEMITE Na11Ti++++Nb2(Si2O7)2(PO4)2O3(F,OH) A
INNELITE (Ba,K)4(Na,Ca)3Ti3(Si2O7)(SO4)O4 A
PHOSPHOINNELITE Na3Ba4Ti3(Si2O7)2(PO4,SO4)2(O,F)3 A
YOSHIMURAITE (Ba,Sr)2(Mn++,Fe++)2(Ti++++,Fe+++)(PO4,SO4,SiO4)(Si2O7)(O,OH) A
BUSSENITE Na2(Ba,Sr)2(Fe++,Mn++)TiSi2O7(CO3)(OH)3F A
QUADRUPHITE Na14Ca(Mg,Mn)(Ti,Mn,Zr,Nb)4Si4O12(PO4)4O6F2 A
SOBOLEVITE Na12Ca(NaCaMn)Ti2(TiMn)[Si2O7]2(PO4)4O3F3 M
POLYPHITE Na5(Na4Ca2)Ti2[Si2O7](PO4)3O2F2 A
8/C.15- Bafertisite series
FRESNOITE Ba2TiSi2O8 Q
BAFERTISITE Ba(Fe++,Mn)2TiSi2O7(O,OH)2 M
HEJTMANITE Ba(Mn,Fe++)2TiO(Si2O7)(OH,F)2 M
DELINDEITE (Na,K)3Ba2(Ti,Fe+++)3(Si2O7)2(O,OH,H2O)6 A
CAMARAITE Ba3NaTi4(Fe++,Mn)8(Si2O7)4O4(OH,F)7 A
SCHULLERITE (Na,Ca,Mn)2Ba2(Mg,Fe++)2(Ti,Fe+++)2(Si2O7)2O2F2 A
BYKOVAITE (Ba,Na,K)2{(Na,Ti,Mn)4[(Ti,Nb)2O2Si4O14](H2O,F,OH)2}.3,5H2O M
NECHELYUSTOVITE (Ba,Sr,K)2{(Na,Ti,Mn)4[(Ti,Nb)2O2Si4O14](O,H2O,F)2}.4,5H2O M
KOLSKYITE CaNa2Ti4(Si2O7)O4(H2O)7 A
KAZANSKYITE Ba[]TiNbNa3Ti(Si2O7)2O2(OH)2(H2O)4 A
LAURENTIANITE [NbO(H2O)]3(Si2O7)2[Na(H2O)2]3 R
FERSMANITE (Ca,Na)8(Ti,Nb)4(Si4O12)O10(F,OH)4 M
BELKOVITE Ba3(Nb,Ti)6(Si2O7)2O12 H
MATSUBARAITE Sr4Ti5Si4O22 M
PERRIERITE-(Ce) (Ce,La,Ca,Sr)4(Fe++,Mg,Mn++)(Ti,Fe+++)4Si4O22 M
PERRIERITE-(La) (La,Ce,Ca)4(Fe++,Mn++,Mg)(Ti,Fe)4Si4O22 M
HEZUOLINITE (Sr,REE)4Zr(Ti,Fe+++,Fe++)2Ti2O8(Si2O7)2 M
RENGEITE (Sr,Ce)4Zr(Ti++++,Al)4Si4O22 M
CHEVKINITE-(Ce) (Ca,Ce,La)4(Fe++,Mg)2(Ti,Fe+++)3O8(Si2O7)2 M
DINGDAOHENGITE-(Ce) Ce4Fe++(Ti,Fe++,Mg,Fe+++)2Ti2Si4O22 M
POLYAKOVITE-(Ce) (Ce,La,Nd,Ca)4(Mg,Fe++)(Cr+++,Fe+++)2(Ti,Nb)2Si4O22 M
CHRISTOFSCHAFERITE-(Ce) (Ce,La,Ca)4Mn(Ti,Fe)3(Fe,Ti)(Si2O7)2O8 M
STRONTIOCHEVKINITE (Sr,La,Ce,Ca)4Zr(Ti++++,Fe++,Fe+++)2Ti2O4(Si2O7)2 M
MAONIUPINGITE-(Ce) (Ca,Ce)4(Fe+++,Ti,Fe++,[])(Ti,Fe+++,Fe++,Nb)4Si4O22 M
STAVELOTITE-(La) La3Mn++3Cu++(Mn+++,Fe+++,Mn++++)26[Si2O7]6O30 R
KARNASURTITE-(Ce) (Ce,La,Th)(Ti,Nb)(Al,Fe+++)(Si,P)2O7(OH)4.3H2O (?) H (?)
SCHLUTERITE-(Y) (Y,REE)2Al(Si2O7)(OH)2F M
NASONITE Pb6Ca4Si6O21Cl2 H
MELANOTEKITE Pb2Fe+++2Si2O9 O
KENTROLITE Pb2Mn+++2Si2O9 O
8/C.21 to 27 Structures with neso-[SiO4]-- and soro-[Si2O7]------
HARSTIGITE Ca6MnBe4(SiO4)2(Si2O7)2(OH)2 O
DELLAITE Ca6Si3O11(OH)2 M (?)
RUSTUMITE Ca10(Si2O7)2(SiO4)Cl2(OH)2 M
8/C.23- Epidote group
CLINOZOISITE Ca2Al3[Si2O7][SiO4]O(OH) M
NIIGATAITE CaSrAl3[Si2O7][SiO4]O(OH) M
EPIDOTE Ca2Al2Fe+++[Si2O7][SiO4]O(OH) M
EPIDOTE-(Sr) CaSr(Al,Fe+++,Mn+++)3(Si2O7)(SiO4](OH) M
HANCOCKITE CaPbAl2Fe+++[Si2O7][SiO4]O(OH) M
MUKHINITE Ca2Al2V+++(SiO4)3(OH) M
PIEMONTITE Ca2(Al,Mn+++,Fe+++)3Si3O11O(OH) M
PIEMONTITE-(Sr) CaSr(Al,Mn+++,Fe+++)3Si3O11O(OH) M
TWEDDILLITE CaSr(Mn+++,Fe+++)2Al(SiO4)(Si2O7)O(OH) M
PIEMONTITE-(Pb) CaPbAl2Mn+++[Si2O7][SiO4]O(OH) M
ALLANITE-(Y) Ca(Y,Ce,La)(Al,Fe++,Fe+++)3(SiO4)3(OH) M
ALLANITE-(La) Ca(La,REE,Ca)Al2(Fe2+,Fe3+)(SiO4)(Si2O7)O(OH) M
ALLANITE-(Ce) (Ce,Ca,Y)2(Al,Fe++,Fe+++)3(SiO4)3(OH) M
ALLANITE-(Nd) CaNdAl2Fe++(SiO4)(Si2O7)O(OH) M
FERRIALLANITE-(La) Ca(La,Ce,Th)(Fe+++,Al)(Al,Fe+++)(Fe++,Mn,Ti,Mg)(SiO4)(Si2O7)O(OH) M
FERRIALLANITE-(Ce) CaCeFe+++AlFe++[Si2O7][SiO4]O(OH) M
VANADOALLANITE-(La) CaLaV+++AlFe++(SiO4)(Si2O7)O(OH) M
DISSAKISITE-(La) Ca(La,Ce,Th)(Mg,Fe++)(Al,Fe+++,Cr)2(SiO4)(Si2O7)O(OH) M
DISSAKISITE-(Ce) Ca(Ce,La)(Mg,Fe++)(Al,Fe+++)2(SiO4)3(OH) M
UEDAITE-(Ce) (Mn++,Ca,Fe++)(Ce,Nd)Fe++(Al,Fe+++)2(Si2O7)(SiO4)OOH M
ASKAGENITE-(Nd) Mn++NdAl2Fe+++(Si2O7)(SiO4)O2 M
MANGANIANDROSITE-(La) (Mn++,Ca)(La,Ce,Ca,Nd)AlMn+++Mn++(SiO4)(Si2O7)O(OH) M
FERRIANDROSITE-(La) MnLaFe+++AlMn++(Si2O7)(SiO4)O(OH) M
MANGANIANDROSITE-(Ce) (Mn++,Ca)(Ce,La)Mn++(Mn+++,Fe+++)Al(SiO4)(Si2O7)O(OH) M
VANADOANDROSITE-(Ce) (Mn++,Ca)(Ce,La)Mn++(V+++,Mg,Al)Al(SiO4)(Si2O7)(O,F)(OH) M
DOLLASEITE-(Ce) CaCeMg2AlSi3O11(OH,F)2 M
KHRISTOVITE-(Ce) (Ca,REE)REE(Mg,Fe++)AlMn++Si3O11(OH)(F,O) M
VASTMANLANDITE-(Ce) (Ce,La)3CaAl2Mg2[Si2O7][SiO4]3F(OH)2 M
GATELITE-(Ce) Ca(Ce,Nd,La,Pr)3(Mg,Fe++,Al)(Al,Mg)3(SiO4)3(Si2O7)(O,F)(OH,O)2 M
PERBOEITE-(Ce) Ca(Ce,Nd,La)3Al3Fe++Si2O7[SiO4]3O(OH)2 M
ALNAPERBOEITE-(Ce) Na0,5Ca(Ce,Nd,La)2,5Al4Si2O7[SiO4]3O(OH)2 M
ZOISITE Ca2Al3[Si2O7][SiO4]O(OH) O
8/C.24- Pumpellyite group
MACFALLITE Ca2Mn+++3(SiO4)(Si2O7)(OH)3 M
SURSASSITE Mn++2Al3(SiO4)(Si2O7)(OH)3 M
PUMPELLYITE-(Mg) Ca2MgAl2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Fe++) Ca2Fe++Al2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Mn++) Ca2(Mn++,Mg)(Al,Mn+++,Fe)2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Al) Ca2(Al,Fe++,Mg)Al2(SiO4)(Si2O7)(O,OH)2.H2O M
PUMPELLYITE-(Fe+++) Ca2(Fe+++,Mg,Fe++)(Al,Fe+++)2(SiO4)(Si2O7)(OH)2.H2O M
POPPIITE Ca2(V+++,Fe+++,Mg)(V+++,Al)2(SiO4)(Si2O7)(O,OH)3 M
JULGOLDITE-(Mg) Ca2(Mg,Fe++)(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
JULGOLDITE-(Fe++) Ca2Fe++(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
JULGOLDITE-(Fe+++) Ca2Fe+++(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
SHUISKITE Ca2(Mg,Al)(Cr,Al)2(SiO4)(Si2O7)(OH)2.H2O M
OKHOTSKITE-(Mn++) Ca2(Mn++,Mg)(Mn+++,Al,Fe+++)2Si3O10(OH)4 M
SAMFOWLERITE Ca28Mn++6Zn4(Be,Zn)4Be12(SiO4)12(Si2O7)8(OH)12 M
FLUORVESUVIANITE Ca19(Al,Mg,Fe++)13(SiO4)10(Si2O7)4(F,OH,O)10 Q
VESUVIANITE Ca10Mg2Al4(SiO4)5(Si2O7)2(OH)4 Q
WILUITE Ca19(Al,Mg,Fe,Ti)13(B,Al,[])5Si18O68(O,OH)10 Q
MANGANVESUVIANITE Ca19Mn+++(Al,Mn+++,Fe+++)10(Mg,Mn++)2Si18O69(OH)9 Q
CYPRINE Ca19Cu++(Al10Mg2)Si18O68(OH)10 Q
GANOMALITE Pb9Ca5Mn++Si9O33 H
QUEITITE Pb4Zn2(SiO4)(Si2O7)(SO4) M
8/C.28 to 33 Sorosilicates with [Si3O10]--------
ROSENHAHNITE Ca3Si3O8(OH)2 or HCa3[Si3O9(OH)] A
KILCHOANITE Ca6(SiO4)(Si3O10) O
PAVLOVSKYITE Ca3(SiO4)2(Si3O10) O
AMINOFFITE Ca2(Be,Al)Si2O7(OH).H2O Q
KINOITE Ca2Cu2Si3O8(OH)4 M
FLUORTHALENITE-(Y) Y3Si3O10F M
THALENITE-(Y) Y3Si3O10(OH) M
8/C.34 to 36 Other sorosilicates
KANNANITE Ca4Al4(MgAl)(VO4)(SiO4)2(Si3O10)(OH)6 Ca4Al4(MgAl)(VO4)(SiO4)2(Si3O10)(OH)6 O
ALPEITE Ca4Mn+++2Al2(Mn+++Mg)(SiO4)2(Si3O10)(VO4)(OH)6 O
ARDENNITE-(As) Mn4[Al4(AlMg)][Si5As]O22(OH)6 O
ARDENNITE-(V) Mn4[Al4(AlMg)][Si5V]O22(OH)6 O
LAVOISIERITE Mn++8[Al10(Mn+++Mg)][Si11P]O44(OH)12 O
CAIRNCROSSITE Sr2Ca7(Si4O10)(OH)2.15H2O A
RUIZITE CaMn+++Si2O6(OH).2H2O M
HUBEITE Ca2Mn++Fe+++Si4O12(OH).2H2O A
CASSAGNAITE (Ca,Mn++)4(Fe+++,Mn+++,Al)4(V+++,Mg,Al)2(SiO4)2(Si3O10)(OH,O)8 O
AKATOREITE (Mn++,Fe++)9Al2Si8O24(OH)8 A
TIRAGALLOITE Mn++4As+++++Si3O12(OH) M
MEDAITE (Mn,Ca)6(V+++++,As)Si5O18(OH) M
SCHEUCHZERITE Na(Mn,Mg,Zn)9V+++++Si9O28(OH)4 A
BRACCOITE NaMn++5[Si5O14(OH)](AsO3)(OH) A
SANEROITE Na2(Mn++,Mn+++)10Si11VO34(OH)4 A
ORIENTITE Ca2Mn++Mn+++2Si3O10(OH)4 O
ZUNYITE Al13Si5O20(OH,F)18Cl C
FENCOOPERITE Ba6Fe+++3Si8O23(CO3)2Cl3.H2O R
8/D. Unclassified silicates
8/D.02 to 11 Small cations: Mg, Fe, Mn, Cu
BOSTWICKITE CaMn+++6Si3O16.7H2O O
GILALITE Cu++5Si6O17.7H2O M
APACHITE Cu9Si10O29.11H2O M
AJOITE (K,Na)Cu++7AlSi9O24(OH)6.3H2O A
AERINITE (Ca5,1Na0,5)(Fe+++AlFe++1,7Mg0,3)(Al5,1Mg0,7)[Si12O36(OH)12H].[(CO3)1,2(H2O)12] H
ALMBOSITE Fe++5Fe+++4V+++++4Si3O27 (?)
KURUMSAKITE (Zn,Ni,Cu)8Al8V2Si5O35.27H2O (?) O (?)
8/D.12 to 22 Large cations: Na, K, Ca, Sr, Pb
ERTIXIITE Na2Si4O9 C
KENYAITE Na2Si22O41(OH)8.6H2O M
TIETTAITE (Na,K)17Fe+++TiSi16O29(OH)30.2H2O O
JUANITE Ca10Mg4Al2Si11O39.4H2O (?) O (?)
JENNITE Ca9[Si6O18(OH)6].8H2O A
OYELITE Ca10B2Si8O29.12H2O O
WAWAYANDAITE Ca12Mn++4B2Be18Si12O46(OH,Cl)30 M
LUDDENITE Pb2Cu2Si5O14.14H2O M
CREASEYITE Pb2Cu2Fe+++2Si5O17.6H2O O
PLUMBOTSUMITE Pb5Si4O8(OH)10 O
8/E. Cyclosilicates: SiO3 rings, Si:O = 1:3
8/E.01 to 05 Three tetrahedrons rings [Si3O9]6-
BENITOITE BaTiSi3O9 H
PABSTITE Ba(Sn,Ti)Si3O9 H
BAZIRITE BaZrSi3O9 H
WADEITE (K,Na)2ZrSi3O9 H
BOBTRAILLITE (Na,Ca)13Sr11(Zr,Y,Nb)14Si42B6O132(OH)12.12H2O R
ROGERMITCHELLITE Na12(Sr,Na)24Ba4Zr26Si78(B,Si)12O246(OH)24.18H2O R ps H
WALSTROMITE BaCa2Si3O9 A
MARGAROSANITE Pb(Ca,Mn++)2Si3O9 A
ROEBLINGITE Pb2Ca6Mn++(Si6O18)2(SO4)2(OH)2.4H2O M
MATHEWROGERSITE Pb7(Fe,Cu)Al3GeSi12O36.(OH,H2O)6 R
JONESITE Ba4(K,Na)2Ti4Al2Si10O36.6H2O O
CATAPLEIITE Na2ZrSi3O9.2H2O H
CALCIOCATAPLEIITE CaZrSi3O9.2H2O H
MOSKVINITE-(Y) Na2K(Y,Dy)Si6O15 O
CAPPELENITE-(Y) Ba(Y,Ce)6Si3B6O24F2 R
STILLWELLITE-(Ce) (Ce,La,Ca)BSiO5 R
DIVERSILITE-(Ce) Na2(Ba,K)6CeFe++2Ti3[Si3O9]3[SiO3OH]3.9(OH,H2O) R
8/E.06 to 08 Four tetrahedrons rings [Si4O12]8-
8/E.06- Axinite group
AXINITE-(Mg) Ca2MgAl2BO3Si4O12(OH) A
AXINITE-(Fe) Ca2Fe++Al2BO3Si4O12(OH) A
AXINITE-(Mn) Ca2Mn++Al2BO3Si4O12(OH) A
TINZENITE (Ca,Mn,Fe)3Al2BO3Si4O12(OH) A
PAPAGOITE CaCu++AlSi2O6(OH)3 M
COLINOWENSITE BaCuSi2O6 Q
ASHBURTONITE Pb4Cu++4Si4HO12(HCO3)4(OH)4Cl Q
BOBMEYERITE Pb4(Al3Cu)(Si4O12)(S0,5Si0,5O4)(OH)7Cl(H2O)3 O
8/E.07- Labuntsovite Group
KOROBITSYNITE Na8-xTi4(Si4O12)2(O,OH)4.8H2O O
NENADKEVICHITE Na8-xNb4(Si4O12)2(O,OH)4.8H2O O
TSEPINITE-Na Na(Na,H3O,K,Sr,Ba)12-xTi8(Si4O12)4(OH,O)8.nH2O (x=0-6, n=12-16) M
TSEPINITE-K (K,Ba,Na)4(Ti,Nb)4(Si4O12)2(OH,O)4.6H2O M
TSEPINITE-Ca (Ca,K,Na)4(Ti,Nb)4(Si4O12)2(OH,O)4.8H2O M
TSEPINITE-Sr (Sr,Ba,K)2-x(Ti,Nb)4(Si4O12)(OH,O)2.5-6H2O M
PARATSEPINITE-Ba (Ba,Na,K)2-x(Ti,Nb)2(Si4O12)(OH,O)2.4H2O M
PARATSEPINITE-Na Na(NaSrKCa)7(TiNb)8(Si4O12)4(O,OH)8.H2O M
VUORIYARVITE-K (K,Na)12-xNb8(Si4O12)4(O)8.nH2O (x=0-6, n=12-16) M
KUZMENKOITE-Zn K2Zn(Ti,Nb)4(Si4O12)2(OH,O)4.6-8H2O M
KUZMENKOITE-Mn K4Mn2Ti8(Si4O12)4(OH)8.nH2O (n=10-12) M
GJERDINGENITE-Fe K2(Fe++,Mn++)(Nb,Ti)4(Si4O12)2(O,OH)4.7-8H2O M ps O
GJERDINGENITE-Mn (K,Na)2(Mn++,Fe++)(Nb,Ti)4(Si4O12)2(O,OH)4.6H2O M ps O
GJERDINGENITE-Na (K,Na,Sr)2Na(Nb,Ti)4(Si4O12)2(O,OH)2.5H2O M
GJERDINGENITE-Ca (K,Na,Sr)2Ca(Nb,Ti)4(Si4O12)2(O,OH)2.6H2O M
BUROVAITE-Ca (K,Na)4Ca2(Ti,Nb)8[Si4O12]4(OH,O)8.12H2O M
KARUPMOLLERITE-Ca (Na,Ca,K)2Ca2(Nb,Ti)4(Si4O12)2(O,OH)4.7H2O M
LEMMLEINITE-K Na4K4K4Ti8(Si4O12)4(O,OH)8.8H2O M ps O
LEMMLEINITE-Ba Na4K4Ba2+xTi8(Si4O12)4(O,OH)8.8H2O M
PARALABUNTSOVITE-Mg Na8K8Mg4Ti16(Si4O12)8(O,OH)8.nH2O (n=20-24) M
LABUNTSOVITE-Mg Na4K4Mg2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
LABUNTSOVITE-Fe Na4K4Fe2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
LABUNTSOVITE-Mn Na4K4Mn2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
PARAKUZMENKOITE-Fe (K,Ba)8Fe4Ti16(Si4O12)8(OH,O)16.nH2O (n=20-28) M
ORGANOVAITE-Zn K8Zn4Nb16(Si4O12)8O16.nH2O (n=20-28) M
ORGANOVAITE-Mn K8Mn4Nb16(Si4O12)8O16.nH2O (n=20-28) M
GUTKOVAITE-Mn CaK2Mn(Ti,Nb)4(Si4O12)2(O,OH)4.5H2O M
NESKEVAARAITE-Fe K3Na2Fe++(Ti,Nb)4(Si4O12)2(O,OH)4.5-6H2O M
ALSAKHAROVITE-Zn (Na,Ca)Sr(K,Ba)Zn(Ti,Nb)4(Si4O12)2(O,OH)4.7H2O M
LEPKHENELMITE-Zn (Ba,K)2Zn(Ti,Nb)4Si8O24(O,OH)4.7H2O M
8/E.08- Joaquinite group
BAOTITE Ba4(Ti,Nb)8Si4O28Cl Q
CERCHIARAITE-(Al) Ba4(Al,Fe+++)4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl Q
CERCHIARAITE-(Fe) Ba4(Fe+++,Al)4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl Q
CERCHIARAITE-(Mn) Ba4(Mn+++,Fe+++,Al)4(Si6O18)(OH)7Cl Q
TITANTARAMELLITE Ba4(Ti,Fe+++,Fe++,Mg)4(B2Si8O27)O2Clx O
TARAMELLITE Ba4(Fe+++,Ti,Fe++,Mg)4(B2Si8O27)O2Clx O
NAGASHIMALITE Ba4(V+++,Ti)4Si8B2O27Cl(O,OH)2 O
STRONTIOJOAQUINITE Sr2Ba2(Na,Fe++)2Ti2Si8O24(O,OH)2.H2O M
STRONTIOORTHOJOAQUINITE Sr2Ba2(Na,Fe++)2Ti2Si8O24(O,OH)2.H2O O
BARIOORTHOJOAQUINITE (BARIO-ORTHOJOAQUINITE) (Ba,Sr)4Fe++2Ti2Si8O26.H2O O
JOAQUINITE-(Ce) Ba2NaCe2Fe++(Ti,Nb)2Si8O26(OH,F).H2O M
BYELORUSSITE-(Ce) NaMn++Ba2(Ce,La)2Ti2Si8O26(F,OH).H2O O
ORTHOJOAQUINITE-(La) Ba2Na(La,Ce)2Fe++(Ti,Nb)2Si8O26(O,OH,F).H2O O
ORTHOJOAQUINITE-(Ce) Ba2NaCe2Fe++Ti2Si8O26(O,OH).H2O O
8/E.09 to 10 Double rings of four tetrahedrons [Si8O20]8-
KAINOSITE-(Y) Ca2(Y,Ce)2Si4O12(CO3).H2O O
PHOSINAITE-(Ce) Na13Ca2(Ce,La,Th,Nd,Pr)(Si4O12)(PO4)4 O
CLINOPHOSINAITE Na12(Ca,Sr)4(PO4)4(Si4O12) M
EKANITE ThCa2Si8O20 Q
IRAQITE-(La) K(La,Ce,Th)2(Ca,Na)4(Si,Al)16O40 Q
STEACYITE Th(Ca,Na)2K1-xSi8O20 Q
TURKESTANITE Th(Ca,Na)2(K1-x[]x)Si8O20.nH2O Q
ARAPOVITE (U,Th)(Ca,Na)2(K1-x[]x)Si8O20.H2O (x=0,5) Q
8/E.11- Combination of four-membered rings and pairs
HYALOTEKITE (Ba,Pb,Ca,K)6(B,Si,Al)2(Si,Be)10O28(F,Cl) A ps M
KAPITSAITE-(Y) (Ba,K,Pb++)4(Y,Ca,Na)2Si8(B,Si)4O28F A ps Q
ITSIITE Ba2Ca(BSi2O7)2 Q
KASATKINITE Ba2Ca8B5Si8O32(OH)3.6H2O M
8/E.12 to 21 Six-membered rings [Si6O18]12-
BERYL Be3Al2Si6O18 H
BAZZITE Be3(Sc,Al)2Si6O18 H
STOPPANIITE (Fe,Al,Mg)4(Be6Si12O36)(H2O)2(Na,[]) H
PEZZOTTAITE CsLiBe2Al2Si6O18 R
INDIALITE Mg2Al4Si5O18 H
FERROINDIALITE Mg2Al4Si5O18 H
CORDIERITE Mg2Al4Si5O18 O
SEKANINAITE (Fe++,Mg)2Al4Si5O18 O
VYUNTSPAKHKITE-(Y) Y4Al2AlSi5O18(OH)5 M
GERENITE-(Y) (Ca,Na)2(Y,REE)3(Si6O18).2H2O A
BARATOVITE KCa7(Ti,Zr)2Li3Si12O36F2 M ps H
ALEKSANDROVITE KCa7Sn2Li3Si12O36F2 M
COMBEITE Na2Ca2Si3O9 R
KOSTYLEVITE K2ZrSi3O9.H2O M
8/E.16- Lovozerite group
IMANDRITE Na6Ca1,5Fe+++Si6O18 O
KAZAKOVITE Na6(Mn++,H2)TiSi6O18 R
KAPUSTINITE Na5(Na,Mn++)Zr(Si6O16)(OH)2 M
LITVINSKITE Na2([],Na,Mn++)ZrSi6O12(O,OH)6 M
LOVOZERITE Na2CaZrSi6O18(OH,O)6.H2O R (?)
TOWNENDITE Na8ZrSi6O18 R ps H
ZIRSINALITE Na6(Ca,Mn,Fe++)ZrSi6O18 R
KOASHVITE Na6(Ca,Mn)(Ti,Fe)Si6O18.H2O O
TISINALITE Na3H3(Mn++,Ca,Fe)TiSi6(O,OH)18.2H2O R
PETARASITE Na5Zr2Si6O18(Cl,OH).2H2O M
ABENAKIITE-(Ce) Na26(Ce,Nd,La,Pr,Th,Sm)6(SiO3)6(PO4)6(CO3)6(S++++O2)O R
STEENSTRUPINE-(Ce) Na14Mn++2(Fe+++,Mn+++)2Ce6(Zr,Th)(Si6O18)2(PO4)6(HPO4)(OH)2.2H2O R
THOROSTEENSTRUPINE CaMnThSi4O11(OH)F.6H2O am. (?)
8/E.19- Tourmaline group
OXYROSSMANITE [](LiAl2)Al6(Si6O18)(BO3)3(OH)3O R
ROSSMANITE [](LiAl2)Al6(Si6O18)(BO3)3(OH)3OH R
DARRELLHENRYITE Na(LiAl2)Al6(Si6O18)(BO3)3(OH)3OH R
FLUORELBAITE Na(Li1,5Al1,5)Al6(Si6O18)(BO3)3(OH)3F R
ELBAITE Na(Li1,5Al1,5)Al6(Si6O18)(BO3)3(OH)3OH R
FLUORTSILAISITE NaMn3Al6(Si6O18)(BO3)3(OH)3F R
MAGNESIOFOITITE [](Mg2Al)Al6(Si6O18)(BO3)3(OH)3OH R ps H
OXYDRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3FNa(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O R
FLUORDRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3F R
DRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3OH R
OXYCHROMIUMDRAVITE NaMg2Cr7(Si6O18)(BO3)3(OH)3O R
CHROMIUMDRAVITE NaMg3Cr6(Si6O18)(BO3)3(OH)3OH R
VANADIOOXYDRAVITE NaMg2V3Al4(Si6O18)(BO3)3(OH)3O R
VANADIOOXYCHROMIUMDRAVITE NaMg2V3Cr4(Si6O18)(BO3)3(OH)3O R
OXYVANADIUMDRAVITE NaMg2V7(Si6O18)(BO3)3(OH)3O R
FOITITE [](Fe++2Al)Al6(Si6O18)(BO3)3(OH)3OH R
OXYFOITITE [](Fe++Al2)Al6(Si6O18)(BO3)3(OH)3O R
OXYSCHORL Na(Fe++Al)3Al6(Si6O18)(BO3)3(OH)3O R
FLUORSCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3F R
SCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3OH R
OLENITE NaAl3Al6(Si6O18)(BO3)3(O3)OH R
LUINAITE-(OH) (Na,[](Fe++,Mg)3Al6(BO3)3Si6O18(OH)4 R
FLUORBUERGERITE NaFe+++3Al6(Si6O18)(BO3)3O3F R
POVONDRAITE NaFe+++3(Fe+++4Mg2)(Si6O18)(BO3)3(OH)3O R
CHROMOALUMINOPOVONDRAITE NaCr3(Al4Mg2)(Si6O18)(BO3)3(OH)3O R
FLUORLIDDICOATITE Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F R
FLUORUVITE CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F R
UVITE CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3OH R
FERUVITE CaFe++3(Al5Mg)(Si6O18)(BO3)3(OH)3OH R
LUCCHESIITE CaFe++3Al6(Si6O18)(BO3)3(OH)3O R
ADACHIITE CaFe++3Al6(Si5AlO18)(BO3)3(OH)3(OH) R
ODINTSOVITE K2(Na,Li)4Ca3Ti2Be4Si12O38 O
TIENSHANITE KNa3(Na,K,[])6(Ca,Y,REE)2Ba6(Mn++,Fe++,Zn,Ti)6(Ti,Nb)6Si36B12O114[O5,5(OH,F)3,5]F2 H
VERPLANCKITE Ba2(Mn,Fe++,Ti)Si2O6(O,OH,Cl,F)2.3H2O H
DIOPTASE CuSiO2(OH)2 R
CHRYSOCOLLA (Cu,Al)2H2Si2O5(OH)4.nH2O M
8/E.22- Double six-membered rings [Si12O30]12- Milarite-osumilite group
POUDRETTEITE KNa2B3Si12O30 H
MILARITE KCa2AlBe2Si12O30.0,5H2O H
OFTEDALITE (Sc,Ca,Mn++)2K(Be,Al)3Si12O30 H
AGAKHANOVITE-(Y) (YCa)[]2KBe3Si12O30 H
FRIEDRICHBECKEITE K([]0,5Na0,5)2(Mg0,8Mn0,1Fe0,1)2(Be0,6Mg0,4)3[Si12O30] H
ALMARUDITE (K,Na)(Mn++,Fe++,Mg)2(Be,Al)3(Si12O30) H
TRATTNERITE (Mg,Fe++)3Fe+++2(Si12O30) H
EIFELITE KNa3Mg4Si12O30 H
ROEDDERITE (Na,K)2(Mg,Fe++)5Si12O30 H
CHAYESITE K(Mg,Fe++)4Fe+++Si12O30 H
MERRIHUEITE (K,Na)2(Fe++,Mg)5Si12O30 H
KLOCHITE ([]1Na1)KFe2Zn3(Si12O30) H
YAGIITE (Na,K)1,5Mg2(Al,Mg)3(Si,Al)12O30 H
OSUMILITE-(Mg) KMg2Al3(Al2Si10)O30 H
OSUMILITE (K,Na)(Fe++,Mg)2(Al,Fe+++)3(Si,Al)12O30 H
LIPUITE KNa8Mn+++5Mg0,5[Si12O30(OH)4](PO4)O2(OH)2.4H2O O
EMELEUSITE Na4Li2Fe+++2Si12O30 O ps H
SUGILITE KNa2(Fe++,Mn++,Al)2Li3Si12O30 H
SOGDIANITE (Zr,Ti++++,Fe+++,Al)2([],Na)2K[Li3Si12O30] H
BEREZANSKITE Ti2[]KLi3(Si12O30) H
DARAPIOSITE NaxK(Li,Zn,Fe++)2(Mn,Zr,Y)2(Si12O30) (x = less than 2) H
DUSMATOVITE K(K,Na,[])(Mn++,Y,Zr)2(Zn,Li)3Si12O30 H
SHIBKOVITE K(Ca,Mn,Na)2(K2-x[]x)2Zn3Si12O30 H
BRANNOCKITE (K,Na)Li3Sn2Si12O30 H
ARMENITE BaCa2Al6Si9O30.2H2O O
YAKOVENCHUKITE-(Y) K3Na(Ca,Na)Y2(Si12O30).3H2O O
FAIZIEVITE K2Li6Na(Ca6Na)Ti4[Si6O18]2[Si12O30]F2 A
8/E.23- Eight-membered rings
MUIRITE Ba10Ca2MnTiSi10O30(OH,Cl,F)10 Q
8/E.24- Nine-membered rings
ZAKHAROVITE Na4Mn++5Si10O24(OH)6.6H2O R
8/E.25- Nine-membered rings. Eudialyte group.
AQUALITE (H3O)8(Na,K,Sr)5Ca6Zr3Si26O66(OH)9Cl R
ILYUKHINITE (H3O,Na)14Ca6Mn2Zr3Si26O72(OH)2.3H2O R
FENGCHENGITE Na12[]3(Ca,Sr)6Fe+++3Zr3Si(Si25O73)(H2O,OH)3(OH,Cl)2 R
EUDIALYTE Na15Ca6(Fe++,Mn)3Zr3(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
MANGANOEUDIALYTE Na14Ca6Mn3Zr3[Si26O72(OH)2]Cl2.4H2O R
IKRANITE (Na,H3O)15(Ca,Mn,REE)6Fe+++2Zr3([],Zr)([],Si)Si24O66(O,OH)6Cl.nH2O R
RASLAKITE Na15Ca3Fe3(Na,Zr)3Zr3Nb0,5(Si3O9)2(Si9O27)2(SiO)(Cl,OH).3(OH,H2O) R
FERROKENTBROOKSITE Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3(Cl,F,OH)2 R
KENTBROOKSITE (Na,REE)15(Ca,REE)6(Mn++,Fe++)3Zr3Nb(Si25O73)(O,OH,H2O)3(F,Cl)2 R
CARBOKENTBROOKSITE (Na,[])12(Na,Ce)3Ca6Mn3Zr3Nb(Si25O73)(OH)3(CO3).H2O R
ANDRIANOVITE Na12(K,Sr,Ce)3Ca6Mn3Zr3Nb(Si25O73)(O,H2O,OH)5 R
VORONKOVITE Na15(Na,Ca,Ce)3(Mn,Ca)3Fe3Zr3Si26O72(OH,O)4Cl.H2O R
ONEILLITE Na15Ca3Mn3Fe3Zr3Nb(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
DAVINCIITE Na12K3Ca6Fe++3Zr3(Si26O73OH)Cl2 R
MOGOVIDITE Na9(Ca,Na)5Ca6Zr3Fe2(Si,Nb)[(OH,H2O)3|Cl0,3|CO3|(Si3O9)2(Si9O27)2] R
GOLYSHEVITE [Na10Ca3]Ca6Zr3Fe2SiNb[(OH)3|CO3|(Si3O9)2|(Si9O27)2].H2O R
FEKLICHEVITE Na11Ca9(Fe+++,Fe++)2Zr3Nb[Si25O73](OH,H2O,Cl,O)5 R
GEORGBARSANOVITE Na12(Mn,Sr,REE)3Ca6Fe++3Zr3NbSi25O76Cl2.H2O R
ZIRSILITE-(Ce) Na11-12Ca6(Ce,Na)3Mn3Zr3Nb(CO3)2(Si3O9)4(Si9O27)2(SiO)(OH)6.H2O R
JOHNSENITE-(Ce) Na12(Ce,La,Sr,Ca,M)3Ca6Mn3Zr3W(Si25O73)(CO3)(OH,Cl)2 R
TASEQITE Na12Sr3Ca6Fe3Zr3NbSi25O73(O,OH,H2O)3Cl2 R
KHOMYAKOVITE Na12Sr3Ca6Fe++3Zr3W(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
MANGANOKHOMYAKOVITE Na12Sr3Ca6Mn++3Zr3W(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
ALLUAIVITE Na19(Ca,Mn++)6(Ti,Nb)3(Si3O9)2(Si10O28)2Cl.2H2O R
RASTSVETAEVITE Na27K8Ca12Fe3Zr6Si4[Si3O9]4[Si9O27]4(O,OH,H2O)6Cl2 R
DUALITE Na30(Ca,Na,Ce,Sr)12(Na,Mn,Fe,Ti)6Zr3Ti3MnSi51O144(OH,H2O,Cl)9 R
LABYRINTHITE (Na,K,Sr)35Ca12Fe3Zr6TiSi51O144(O,OH,H2O)9Cl3 R
8/E.26- Twelve-membered and larger rings
TRASKITE Ba9Fe++2Ti2(SiO3)12(OH,Cl,F)6.6H2O H
MEGACYCLITE K2Na16Si18O36(OH)18.32H2O M
8/F. Inosilicates: chains and ribbons, Si:O=1:3 or 4:11
8/F.01 to 06 Infinite single chains [Si2O6]----
8/F.01 to- 02 Pyroxenes group
CLINOENSTATITE Mg2Si2O6 M
CLINOFERROSILITE (Fe++,Mg)2Si2O6 M
KANOITE (Mn++,Mg)2Si2O6 M
PIGEONITE (Mg,Fe++,Ca)(Mg,Fe++)Si2O6 M
DIOPSIDE CaMgSi2O6 M
HEDENBERGITE CaFe++Si2O6 M
JOHANNSENITE CaMnSi2O6 M
PETEDUNNITE Ca(Zn,Mn++,Fe++,Mg)Si2O6 M
AUGITE (Ca,Na)(Mg,Fe,Al,Ti)(Si,Al)2O6 M
OMPHACITE (Ca,Na)(Mg,Fe++,Fe+++,Al)Si2O6 M
KUSHIROITE CaAl(AlSiO6) M
ESSENEITE CaFe+++AlSiO6 M
GROSSMANITE CaTi+++(AlSiO6) M
DAVISITE Ca(Sc,Ti,Mg)(AlSiO6) M
SPODUMENE LiAlSi2O6 M
JADEITE Na(Al,Fe+++)Si2O6 M
TISSINTITE (Ca,Na,[])AlSi2O6 M
AEGIRINE NaFe+++Si2O6 M
AEGIRINEAUGITE (AEGIRINE-AUGITE) (?) (Ca,Na)(Mg,Fe++,Fe+++)Si2O6 M
NAMANSILITE NaMn+++(Si2O6) M
JERVISITE (Na,Ca,Fe++)(Sc,Mg,Fe++)Si2O6 M
NATALYITE Na(V+++,Cr+++)Si2O6 M
KOSMOCHLOR NaCr+++Si2O6 M
8/F.01- Clinopyroxenes
8/F.02- Orthopyroxenes
ENSTATITE Mg2Si2O6 O
FERROSILITE (Fe++,Mg)2Si2O6 O
DONPEACORITE (Mn++,Mg)MgSi2O6 O
NCHWANINGITE Mn++SiO3OH2.H2O O
MAGNESIOCARPHOLITE MgAl2Si2O6(OH)4 O
FERROCARPHOLITE (Fe++,Mg)Al2Si2O6(OH)4 O
CARPHOLITE MnAl2Si2O6(OH)4 O
VANADIOCARPHOLITE Mn++V+++Al(Si2O6)(OH)4 O
POTASSICCARPHOLITE K0,5-1(Li,Mn++)2Al4(Si2O6)2(OH;F)8 O
BALIPHOLITE BaMg2LiAl3Si4O12(OH,F)8 O
PUNKARUAIVITE LiTi2[Si4O11(OH)](OH)2.H2O M
YEGOROVITE Na4[Si2O4(OH)2]2.7H2O M
LORENZENITE Na2Ti2Si2O9 O
KUKISVUMITE Na6ZnTi4Si8O28.4H2O O
MANGANOKUKISVUMITE Na6Mn++Ti4Si8O28.4H2O O
LINTISITE Na3LiTi2Si4O14.2H2O M
ELISEEVITE Na1,5Li[Ti2Si4O12,5(OH)1,5].2H2O M
VINOGRADOVITE Na8Ti8O8(Si2O6)4[(Si3Al)O10]2[(H2O),(Na,K)2] M
PARAVINOGRADOVITE Na2Ti3Fe+++(Si2O6)2(Si3AlO10)(OH)4.H2O A
CAPRANICAITE (K,[])(Ca,Na)Al4B4Si2O18 M
SHATTUCKITE Cu5(SiO3)4(OH)2 O
PLANCHEITE Cu8Si8O22(OH)4.H2O O
LAVINSKYITE K(LiCu)Cu6(Si4O11)2(OH)4 O
8/F.07 to 13 Infinite double bands [Si4O11]6-
8/F.07 to- 12 Amphibole group
CUMMINGTONITE []Mg7Si8O22(OH)2 M
GRUNERITE []Fe++7Si8O22(OH)2 M
MANGANOCUMMINGTONITE []Mn2Mg5Si8O22(OH)2 M
MANGANOGRUNERITE []Mn2Fe++5Si8O22(OH)2 M
PERMANGANOGRUNERITE (?) []Mn4Fe++3Si8O22(OH)2 (?) M
FLUOROCLINOHOLMQUISTITE (?) (?)  
FERRICLINOHOLMQUISTITE [](Li2Mg3Fe+++2)Si8O22(OH)2 (?) M
CLINOFERROHOLMQUISTITE [](Li2Fe++3Al2)Si8O22(OH)2 M
SODICFERRICLINOFERROHOLMQUISTITE (Na,[])Li2(Fe++,Mg)3Fe+++2Si8O22(OH)2 M
FERRICLINOFERROHOLMQUISTITE Li2(Fe++,Mg)3(Fe+++,Al)2Si8O22(OH;F)2 M
8/F.07- Amphibole with Mg, Fe, Mn
8/F.08- Alcali amphiboles
GLAUCOPHANE []Na2(Mg3Al2)Si8O22(OH)2 M
FERROGLAUCOPHANE []Na2(Fe++3Al2)Si8O22(OH)2 M
MAGNESIORIEBECKITE []Na2(Mg3Fe+++2)Si8O22(OH)2 M
RIEBECKITE []Na2(Fe++3Fe+++2)Si8O22(OH)2 M
NYBOITE NaNa2(Mg3Al2)Si7AlO22(OH)2 M
FLUORONYBOITE Na(Na,Ca)2(Mg,Fe++)3(Al,Mg,Fe+++)2Si7AlO22(F,OH)2 M
FERRICNYBOITE (?) NaNa2(Mg3Fe+++2)Si7AlO22(OH)2 (?) M
FERRONYBOITE (?) NaNa2(Fe++3Al2)Si7AlO22(OH)2 (?) M
FERRICFERRONYBOITE (?) NaNa2(Fe++3Fe+++2)Si7AlO22(OH)2 (?) M
FERROFERRINYBOITE NaNa2(Fe++3 Fe+++2)(Si7Al)O22(OH)2 M
ECKERMANNITE NaNa2(Mg4Al)Si8O22(OH)2 M
FERROECKERMANNITE NaNa2(Fe++Al)Si8O22(OH)2 M
FERRIPEDRIZITE NaLi3(Mg,Fe++)2Fe+++2Si8O22(OH,F)2 M
FERROPEDRIZITE NaLi2(Fe++2Al2Li)Si8O22(OH)2 M
PEDRIZITE Li2(Li,MgFe++Al)5(Si,Al)8O22(OH,F)2 M
FLUOROSODICPEDRIZITE NaLi2(Mg2Al2Li)Si8O22(F,OH)2 M
SODICPEDRIZITE (?) NaLi2(LiMg2Fe+++Al)(Si8O22)(OH,F)2 M
SODICFERRIPEDRIZITE NaLi3(Mg,Fe++)2Fe+++2(Si8O22)(OH,F)2 M
SODICFERRIFERROPEDRIZITE NaLi3(Fe++,Mg)2(Fe+++,Al)2(Si8O22)(OH,F)2 M
FLUOROSODICFERROPEDRIZITE NaLi2(Fe++2Al2Li)Si8O22F2 M
OTTOLINIITE []Na,Li(Mg3Fe+++Al)(Si8O22)(OH)2 M
FERRIOTTOLINIITE Na0,5(Na,Li)2Li0,5(Mg,Fe++,Zn)3Fe+++2(Si8O22)(OH,F)2 M
FERROOTTOLINIITE (?) []NaLi(Fe++3Fe+++Al)Si8O22(OH)2 M
WHITTAKERITE Na(NaLi)(Mg2AlFe+++Li)(Si8O22)(OH)2 M
FERRIWHITTAKERITE Na(NaLi)(LiMg2Fe+++2)(Si8O22)(OH)2 M
FERROWHITTAKERITE (?) Na(NaLi)2(Fe++2AlFe+++Li)(Si8O22)(OH)2 M
LEAKEITE NaNa2(Mg2Fe+++2Li)Si8O22(OH)2 M
FLUOROLEAKEITE NaNa2(Mg2Fe+++Li)Si8O22F2 M
POTASSICLEAKEITE KNa2Mg2Fe+++2LiSi8O22(OH)2 M
FERROLEAKEITE (?) NaNa2(Fe++2Fe+++2Li)Si8O22(OH)2 (?) M
FLUOROFERROLEAKEITE NaNa2(Fe++2Fe+++2Li)Si8O22F2 M
FLUOROALUMINOLEAKEITE NaNa2(Mg2Al2Li)Si8O22F2 M
KORNITE (Na,K)Na2(Mg2Mn+++2Li)Si8O22(OH)2 M
DELLAVENTURAITE NaNa2(MgMn+++2Ti++++Li)Si8O22O2 M
UNGARETTIITE NaNa2(Mn++2Mn+++3)Si8O22O2 M
OBERTIITE NaNa2(Mg3Fe+++Ti++++)Si8O22O2 M
FERRIOBERTIITE Na(Na2)(Mg3Fe+++Ti)(Si8O22)O2 M
FERROFERRIOBERTIITE NaNa2(Fe++3Fe+++Ti++++)Si8O22O2 M
MANGANIOBERTIITE Na(Na2)(Mg3Mn+++Ti)(Si8O22)O2 M
MAGNESIOARFVEDSONITE NaNa2(Mg4Fe+++)Si8O22(OH)2 M
FLUOROMAGNESIOARFVEDSONITE (Na,K)Na2(Mg,Fe++)4Fe+++Si8O22(F,OH)2 M
ARFVEDSONITE NaNa2(Fe++,Mg)4Fe+++Si8O22(OH)2 M
POTASSICARFVEDSONITE KNa2Fe++4Fe+++Si8O22(OH)2 M
FLUOROPOTASSICMAGNESIOARFVEDSONITE KNa2(Mg,Fe++)5Si8O22(F,OH)2 M
KOZULITE NaNa2Mn++4(Fe+++,Al)Si8O22(OH)2 M
8/F.09- Na, Ca Amphiboles
RICHTERITE Na(CaNa)Mg5Si8O22(OH)2 M
FLUORORICHTERITE Na(CaNa)Mg5Si8O22F2 M
POTASSICRICHTERITE (?) (K,Na)(Ca,Na)2(Mg,Fe)5Si8O22(OH,F)2 (?) M
FLUOROPOTASSICRICHTERITE KNaCaMg5Si8O22F2 M
POTASSICFLUORORICHTERITE (?) (K,Na)(CaNa)Mg5Si8O22F2 M
FERRORICHTERITE Na(CaNa)Fe++5Si8O22(OH)2 M
MAGNESIOKATOPHORITE Na(CaNa)Mg4(Al,Fe+++)Si7AlO22(OH)2 M
POTASSIANFLUORMAGNESIOKATOPHORITE (?) K(CaNa)Mg4(Al,Fe+++))Si7AlO22F2 M
MAGNESIOFERRIKATOPHORITE (?) Na2Ca(Mg,Fe++)4Fe+++Si7AlO22(OH)2 (?) M
KATOPHORITE Na(CaNa)Fe++4(Al,Fe+++)Si7AlO22(OH)2 M
FERRIKATOPHORITE (?) Na2Ca(Fe++,Mg)4Fe+++(Si7Al)O22(OH)2 (?) M
ALUMINOMAGNESIOTARAMITE Na2Ca(Mg,Fe++)3Al2(AlSi3O11)2(OH)2 M
FLUOROALUMINOMAGNESIOTARAMITE Na2Ca(Mg,Fe++)3Al2(AlSi3O11)2(F,OH)2 M
ALUMINOTARAMITE Na2Ca(Fe++,Mg)3Al2(AlSi3O11)2(OH)2 M
POTASSICALUMINOTARAMITE (K,Na)2(Ca,Na)(Fe++,Mg)3(Al,Fe+++)2(AlSi3O11)2(OH)2 M
MAGNESIOTARAMITE Na(CaNa)Mg3AlFe+++Si6Al2O22(OH)2 M
FERRIMAGNESIOTARAMITE (?) Na(CaNa)Mg3Fe+++2Si6Al2O22(OH)2 (?) M
TARAMITE Na(CaNa)Fe++3AlFe+++Si6Al2O22(OH)2 M
FERRITARAMITE (?) Na(CaNa)Fe++3Fe+++2Si6Al2O22(OH)2 (?) M
PARVOWINCHITE Na(Na,Mn++)2Mg4Fe+++Si8O22(OH,F)2 M
WINCHITE [](CaNa)Mg4(Al,Fe+++)Si8O22(OH)2 M
FERROWINCHITE (?) [](CaNa)Fe++4(Al,Fe+++)Si8O22(OH)2 M
FERRIWINCHITE []NaCa(Mg,Fe++)4Fe+++Si8O22(OH)2 M
ALUMINOBARROISITE (?) [](CaNa)Mg3Al2Si7AlO22(OH)2 (?) M
ALUMINOFERROBARROISITE (?) [](CaNa)Fe++3Al2Si7AlO22(OH)2 (?) M
BARROISITE [](CaNa)Mg3AlFe+++Si7AlO22(OH)2 M
FERROBARROISITE [](CaNa)Fe++3AlFe+++Si7AlO22(OH)2 M
FERRIBARROISITE [](CaNa)Mg3Fe+++2Si7AlO22(OH)2 M
FERRIFERROBARROISITE (?) [](CaNa)Fe++3Fe+++2Si7AlO22(OH)2 (?) M
8/F.10- Ca2 amphiboles
PARVOMANGANOTREMOLITE Nax(CaMn++)2Mg5Si8O22(OH)2 (x = less than 0,5) M
TREMOLITE []Ca2Mg5Si8O22(OH)2 M
FLUOROTREMOLITE Ca2Mg5Si8O22F2 M
ACTINOLITE []Ca2(Mg,Fe++)5Si8O22(OH)2 M
FERROACTINOLITE []Ca2Fe++5Si8O22(OH)2 M
MAGNESIOHORNBLENDE []Ca2[Mg4(Al,Fe+++)]Si7AlO22(OH)2 M
MAGNESIOFERRIFLUOROHORNBLENDE []{Ca2}{Mg4Fe3+}(AlSi7O22)F2 M
FERROHORNBLENDE []Ca2[Fe++4(Al,Fe+++)]Si7AlO22(OH)2 M
FERROFERRIHORNBLENDE []Ca2(Fe++4Fe+++)(Si7Al)O22(OH)2 M
ALUMINOTSCHERMAKITE (?) []Ca2(Mg3Al2)Si6Al2O22(OH)2 (?) M
TSCHERMAKITE []Ca2(Mg3AlFe+++)Si6Al2O22(OH)2 M
ALUMINOFERROTSCHERMAKITE (?) []Ca2(Fe++3Al2)Si6Al2O22(OH)2 (?) M
FERROTSCHERMAKITE []Ca2(Fe++3AlFe+++)Si6Al2O22(OH)2 M
FERROALUMINOTSCHERMAKITE (?) []Ca2Fe++3Al2(Si7Al)O22(OH)2 (?) M
FERRITSCHERMAKITE (?) []Ca2(Mg3Fe+++2)Si6Al2O22(OH)2 (?) M
FERRIFERROTSCHERMAKITE (?) []Ca2(Fe++3Fe+++2)Si6Al2O22(OH)2 (?) M
PARVOMANGANOEDENITE Na(CaMn++)Mg5(Si7Al)O22(OH)2 M
EDENITE NaCa2(Mg,Fe++)5(Si7Al)O22(OH)2 M
FLUOROEDENITE (FLUORO-EDENITE) NaCa2(Mg,Fe++)5(Si7Al)O22F2 M
FERROEDENITE NaCa2Fe++5Si7AlO22(OH)2 M
CANNILLOITE (?) CaCa2(Mg4Al)Si5Al3O22(OH)2 (?) M
FLUOROCANNILLOITE CaCa2(Mg4Al)Si5Al3O22F2 M
PARGASITE NaCa2(Mg4Al)Si6Al2O22(OH)2 M
FLUOROPARGASITE NaCa2(Mg,Fe++)4AlSi6Al2O22(F,OH)2 M
FERROPARGASITE NaCa2(Fe++4Al)Si6Al2O22(OH)2 M
CHROMIOPARGASITE NaCa2(Mg4Cr)(Si6Al2)O22(OH)2 M
POTASSICFERROPARGASITE KCa2(Fe++4Al)Si6Al2O22(OH)2 M
POTASSICPARGASITE (K,Na)Ca2(Mg,Fe++,Al,Fe+++)5(Si,Al)8O22(OH,F)2 M
POTASSICFLUOROPARGASITE KCa2(Mg4Al)(Si6Al2)O22F2 M
POTASSICCHLOROPARGASITE (K,Na)Ca2(Fe++,Mg)4(Al,Fe+++)(Si6Al2O22(Cl,OH)2 M
OXOMAGNESIOHASTINGSITE NaCa2(Mg2Fe+++3)(Al2Si6)O22O2 M
FLUOROMAGNESIOHASTINGSITE NaCa2(Mg4Fe+++)Si6Al2O22F2 M
MAGNESIOHASTINGSITE NaCa2(Mg4Fe+++)Si6Al2O22(OH)2 M
POTASSICMAGNESIOHASTINGSITE KCa2(Mg4Fe+++)Si6Al2O22(OH)2 M
HASTINGSITE NaCa2(Fe++4Fe+++)Si6Al2O22(OH)2 M
POTASSICHASTINGSITE (K,Na,[])Ca2(Fe++)4Fe+++Si6Al2O22(OH) M
FLUOROPOTASSICHASTINGSITE KCa2(Fe++4Fe+++)Si6Al2O22F2 M
CHLOROPOTASSICHASTINGSITE KCa2(Fe++4Fe+++)Si6Al2O22(Cl,OH)2 M
KAERSUTITE NaCa2(Mg4Ti)Si6Al2O23(OH) M
FERROKAERSUTITE NaCa2(Fe++4Ti)Si6Al2O22(OH)2 M
POTASSICSADANAGAITE (K,Na)Ca2[Fe++3(Al,Fe+++)2]Si5Al3O22(OH)2 M
POTASSICALUMINOSADANAGAITE KCa2Al2(Fe++)3(Si5Al3)O22(OH)2 M
POTASSICMAGNESIOSADANAGAITE (K,Na)Ca2[Mg3(Al,Fe+++)2]Si5Al3O22(OH)2 M
MAGNESIOSADANAGAITE NaCa2Mg3(Al,Fe++,Ti)2(Al,Si)4(Si2O11)2(OH)2 M
ALUMINOMAGNESIOSADANAGAITE NaCa2[Mg3(Al,Fe+++)2]Si5Al3O22(OH)2 M
SADANAGAITE NaCa2[Fe++3(Al,Fe+++)2]Si5Al3O22(OH)2 (?) M
POTASSICFERRISADANAGAITE (K,Na)Ca2[Fe++3)(Fe+++,Al)2]Si5Al3O22(OH,F)2 M
8/F.11- Pb, Ca amphiboles
JOESMITHITE PbCa2(Mg,Fe++,Fe+++)5Si6Be2O22(OH)2 M
8/F.12- Orthorhombic amphiboles
HOLMQUISTITE [](Li2Mg3Al2)Si8O22(OH)2 O
FERROHOLMQUISTITE [](Li2Fe++3Al2)Si8O22(OH)2 O
SODICANTHOPHYLLITE NaMg7Si8O22(OH)2 O
SODICFERROANTHOPHYLLITE NaFe++7Si8O22(OH)2 O
ANTHOPHYLLITE []Mg7Si8O22(OH)2 O
FERROANTHOPHYLLITE []Fe++7Si8O22(OH)2 O
SODICGEDRITE NaMg6AlSi6Al2O22(OH)2 O
SODICFERROGEDRITE NaFe++6AlSi6Al2O22(OH)2 O
GEDRITE [](Mg,Fe++)5Al2Si6Al2O22(OH)2 O
FERROGEDRITE [](Fe++,Mg)5Al2Si6Al2O22(OH)2 O
PROTOANTHOPHYLLITE (Mg,Fe++)2Mg5Si8O22(OH)2.H2O O
PROTOFERROANTHOPHYLLITE (Fe++,Mn++)2(Fe++,Mg)5(Si4O11)2(OH)2 O
PROTOFERROSUENOITE (Mn++,Fe++)2(Fe++,Mg)5(Si4O11)2(OH)2 O
8/F.14 to 17 Modified double bands
8/F.14- Aenigmatite group
KRINOVITE Na2Mg4Cr2Si6O20 A
AENIGMATITE Na2Fe++5Ti++++Si6O20 A
WILKINSONITE Na2Fe++4Fe+++2Si6O20 A
MAKAROCHKINITE Ca2Fe++4Fe+++TiSi4BeAlO20 A
HOGTUVAITE (Ca,Na)2(Fe++,Fe+++,Ti,Mg,Sn,Mn)6(Si,Be,Al)6O20 A
DORRITE Ca2Mg2Fe+++4Si2Al4O20 A
RHONITE Ca2(Mg,Fe++)4Fe+++Ti++++Si3Al3O20 A
KURATITE Ca2(Fe++5Ti)O2[Si4Al2O18] A
SERENDIBITE Ca2Mg3Al3Si3Al1,5B1,5O20 A
WELSHITE Ca4Mg9Sb+++++3Be3Si6(Fe+++,Al)3O20 A
BECKETTITE Ca2V6Al6O20 A
WARKITE Ca2Sc6Al6O20 A
SAPPHIRINE (-1A,-2A,-2M,-4M,-5A) (Mg,Al)8(Al,Si)6O20 M/A
KHMARALITE Mg5,5Al14Fe2Si5Be1,5O40 M
SURINAMITE (Mg,Fe+++)3(Al,Fe+++)3BeSi3O16 M
MESAITE CaMn++5(V2O7)3.12H2O M
DEERITE (Fe++,Mn)6(Fe+++,Al)3Si6O20(OH)5 M ps O
HOWIEITE Na(Fe++,Mn)10(Fe+++,Al)2Si12O31(OH)13 A
TANEYAMALITE Na(Mn++,Mg,Fe++)12Si12(O,OH)44 A
JOHNINNESITE Na2Mn++9(Mg,Mn++)7(OH)8(AsO4)2(Si6O17)2 A
8/F.18 to 20 Three chains [Si3O9]6-
WOLLASTONITE (1A, 1T, 2M, 3A, 4A, 5A, 7A, 7T polytypes) CaSiO3 M/A
WOLLASTONITE-1T (?) CaSiO3 A
WOLLASTONITE-2M (?) CaSiO3 M
WOLLASTONITE-7T CaSiO3 A
FERROBUSTAMITE Ca(Fe++,Ca,Mn)Si2O6 A
BUSTAMITE (Mn,Ca)3Si3O9 R
VISTEPITE (Mn++,Ca)4Sn++++B2(SiO7)(Si3O9)(OH)2 A
CASCANDITE Ca(Sc,Fe++)Si3O8(OH) A
PECTOLITE NaCa2Si3O8(OH) A
PECTOLITE-M2abc NaCa2Si3O8(OH) M
DENISOVITE (K,Na)Ca2Si3O8(F,OH) M
MARSHALLSUSSMANITE NaCaMn++Si3O8(OH) A
SERANDITE Na(Mn++,Ca)2Si3O8(OH) A
STEEDEITE NaMn2[Si3BO9](OH)2 A
FOSHAGITE Ca4Si3O9(OH)2 A
TRABZONITE Ca4[Si3O9(OH)]OH M
HILLEBRANDITE CaSiO3(OH)2 M ps O
YANGITE PbMn++Si3O8.H2O A
CHESTERITE (Mg,Fe++)17Si20O54(OH)6 O
CLINOJIMTHOMPSONITE (Mg,Fe++)5Si6O16(OH)2 M
JIMTHOMPSONITE (Mg,Fe++)5Si6O16(OH)2 O
RIVERSIDEITE (?) [Ca4Si6O17.2H2O].(Ca.3H2O) O
TOBERMORITE [Ca4Si6O17.2H2O].(Ca.3H2O) O
CLINOTOBERMORITE [Ca4Si6O17.2H2O].(Ca.3H2O) M
KENOTOBERMORITE [Ca4Si6O15(OH)2.2H2O].3H2O  
PLOMBIERITE Ca5Si6O10(OH)2.7H2O O
WHELANITE Cu2Ca6[Si6O17(OH)](CO3)(OH)3(H2O)2 O
SORENSENITE Na4Sn++Be2(Si3O9).2H2O M
UMBITE K2ZrSi3O9.H2O O
PARAUMBITE K3Zr2HSi6O18.nH2O O
8/F.21 to 23 Three bands [Si6O15]6-, [Si6O17]10- and modified
NEKOITE Ca3Si6O15.7H2O A
SCAWTITE Ca7Si6O18(CO3).2H2O M
XONOTLITE Ca6Si6O17(OH)2 M/A
TACHARANITE Ca12Al2Si18O51.18H2O M
ZORITE Na2Ti(Si,Al)3O9.nH2O O
HAINEAULTITE (Na,Ca)5Ca(Ti,Nb)5(Si12O34)(OH,F)4.5H2O O
CHIVRUAIITE Ca4(Ti,Nb)5[(Si6O17)2[(OH,O)5].13-14H2O O
TOKKOITE K2Ca4[Si7O18(OH)](F,OH) A
TINAKSITE K2Na(Ca,Fe++,Mn++,Mg)2(Ti,Fe)Si7O19(OH) A
SENKEVICHITE CsKNaCa2TiSi7O19(OH) A
ELPIDITE Na2ZrSi6O15.3H2O O
TERSKITE Na4Zr(H4Si6O18) O
HYDROTERSKITE Na2ZrSi6O12(OH)6 O
8/F.24 to 26 Four chains [Si4O12]8-
BALANGEROITE (Mg,Fe+++,Fe++,Mn++)42Si16O54(OH)40 M
GAGEITE (-1A,-2M) (Mn,Mg,Zn)42Si16O54(OH)40 M/A
LEUCOPHANITE Na2Ca2Be2(Si4O12)F2 A ps O
MAGBASITE KBaFe+++Mg7Si8O22(OH)2F6 O
BATISITE (Ba,K,Na)3Ti2Si4O14 O
SHCHERBAKOVITE (K,Na,Ba)3(Ti,Nb)2Si4O14 O
NOONKANBAHITE BaKNaTi2(Si4O12)O2 O
TAIKANITE (Ba,Sr)2Mn+++2Si4O12 M
KRAUSKOPFITE BaSi2O4(OH)2.2H2O M
OHMILITE Sr3(Ti,Fe+++)(Si2O6)2(O,OH).2-3H2O M
HARADAITE Sr2V++++2O2(Si4O12) O
SUZUKIITE Ba2(VO2)Si4O12 O
8/F.27- Five chains [Si5O15]10-
RHODONITE (Mn++,Fe++,Mg,Ca)SiO3 A
BABINGTONITE Ca2(Fe++,Mn)Fe+++Si5O14(OH) A
MANGANBABINGTONITE Ca2(Mn,Fe++)Fe+++Si5O14(OH) A
SCANDIOBABINGTONITE Ca2(Fe++,Mn)ScSi5O14(OH) A
SANTACLARAITE CaMn++4Si5O14(OH)2.H2O A
NAMBULITE (Li,Na)(Mn,Ca)4Si5O14(OH) A
NATRONAMBULITE (Na,Li)Mn4Si5O14(OH) A
LITHIOMARSTURITE LiCa2Mn2HSi5O15 A
MARSTURITE NaCaMn3Si5O14(OH) A
INESITE Ca2Mn7Si10O28(OH)2.5H2O A
8/F.28 to 30 Six chains [Si6O18]12- and six bands [Si12O30]12-
HOWLITE Ca2B5SiO9(OH)5 M
HILAIRITE Na2ZrSi3O9.3H2O R
CALCIOHILAIRITE CaZrSi3O9.3H2O R
KOMKOVITE BaZrSi3O9.3H2O R
PYATENKOITE-(Y) Na5(Y,Dy,Gd)(Ti,Nb)Si6O18.6H2O R
SAZYKINAITE-(Y) (Na,K)5Y(Zr,Ti)Si6018.6H2O R
GAIDONNAYITE Na2ZrSi3O9.2H2O O
GEORGECHAOITE KNaZrSi3O9.2H2O O
STOKESITE CaSnSi3O9.2H2O O
ZEKTZERITE NaLi(ZrTi,Hf)Si6O15 O
TUHUALITE (Na,K)Fe++Fe+++Si6O15 O
PELLYITE Ba2Ca(Fe++,Mg)2Si6O17 O
8/F.31- Seven chains [Si7O21]14-
PYROXFERROITE (Fe++,Mn,Ca)SiO3 A
PYROXMANGITE MnSiO3 A
PLUMALSITE (?) Pb4Al2(SiO3)7 (?) O
8/F.32- Twelve chains [Si12O36]24-
ALAMOSITE PbSiO3 M
8/F.33- Chains and pairs combinations
DAVREUXITE MnAl6Si4O17(OH)2 M
STRAKHOVITE NaBa3(Mn++,Mn+++)4Si6O19(OH)3 M
8/F.34 to 38 Complex chain structures (cylinders, etc)
NARSARSUKITE Na2(Ti,Fe+++)Si4(O,F)11 Q
VLASOVITE Na2ZrSi4O11 M/A
PENKVILKSITE Na4(Ti++++,Zr)Si8O22.4H2O M
TUMCHAITE Na2(Zr,Sn)Si4O11.2H2O M
FLUORCANASITE K3Na3Ca5Si12O30F4.H2O M
CANASITE K3Na3Ca5Si12O30(OH,F)4 M
FRANKAMENITE K3Na3Ca5(Si12O30)(F,OH)4.H2O A
MISERITE K(Ca,Ce)6Si8O22(OH,F)2 A
YUKSPORITE K4(Sr,Ba)2(Ca,Na)14(Mn,Fe)0.5(Ti,Nb)4(Si2O7)3(Si6O17)2(O,OH)4.3(OH,H2O) M
CHAROITE (K,Sr,Ba,Mn)15-16(Ca,Na)32[(Si70(O,OH)180)](OH,F)4.nH2O M
EVESLOGITE (Ca,K,Na,Sr,Ba)48[(Ti,Nb,Fe,Mn)12(OH)12Si48O144](F,OH,Cl)14 M
GRUMANTITE NaHSi2O5.H2O O
CAYSICHITE-(Y) Y4(Ca3REE)(OH)(H2O)5(Si8O20)(CO3)6.2H2O O
HELLANDITE-(Yb) (Ca,Y)4(Yb,Y)2(Al,Fe+++,Ti++++)(Be,Li)2B4Si4O22(O,F,OH)2 (?) M
HELLANDITE-(Y) (Ca3REE)4Y2Al[]2[Si4B4O22](OH)2 M
HELLANDITE-(Gd) (Ca,Y)4(Gd,Y)2(Al,Fe+++,Ti++++)(Be,Li)2B4Si4O22(O,F,OH)2 (?) M
HELLANDITE-(Ce) (Ca3REE)4Ce2Al[]2[Si4B4O22](OH)2 M
TADZHIKITE-(Ce) Ca4Ce2Ti[]2[Si4B4O22](OH)2 M
ASHCROFTINE-(Y) K5Na5(Y,Ca)12Si28O70(OH)2(CO3)8.8H2O Q
MOTTANAITE-(Ce) Ca4(CeCa)2AlBe2[Si4B4O22]O2 M
CIPRIANIITE Ca4[(Th,U,REE)]2Al[]2[Si4B4O22](OH,F)2 M
PIERGORITE-(Ce) Ca8Ce2(Al0,5Fe3+++0,5)([],Li,Be)2Si6B8O36(OH,F)2 M
MAGNESIONEPTUNITE KNa2Li(Mg,Fe++)2Ti2Si8O24 M
NEPTUNITE KNa2Li(Fe++,Mn)2Ti2Si8O24 M
MANGANONEPTUNITE KNa2Li(Mn,Fe++)2Ti2Si8O24 M
WATATSUMIITE KNa2LiMn++2V++++2Si8O24 M
SVERIGEITE NaMnMgSn++++Be2Si3O12(OH) O
LIEBAUITE Ca3Cu5Si9O26 M
8/G. Transition inosilicates - phyllosilicates
OKENITE Ca5Si9O23.9H2O A
EAKERITE Ca2SnAl2Si6O18(OH)2.2H2O M
BUSSYITE-(Ce) (Ce,REE)3(Na,H2O)6MnSi9Be5(O,OH)30F4 M
BUSSYITE-(Y) (Y,REE,Ca)3(Na,Ca)6MnSi9Be5(O,OH,F)34 M
SEMENOVITE-(Ce) (Ca,Ce,La,Na)10-12(Fe++,Mn)(Si,Be)20(O,OH,F)48 O
NORDITE-(La) Na3SrLaZnSi6O17 O
NORDITE-(Ce) Na3SrCeZnSi6O17 O
FERRONORDITE-(Ce) Na3SrCeFe++Si6O17 O
FERRONORDITE-(La) Na3Sr(La,Ce)Fe++Si6O17 O
MANGANONORDITE-(Ce) Na3SrCeMn++Si6O17 O
VLADYKINITE Na3Sr4(Fe++Fe+++)Si8O24 M
EUDIDYMITE Na2Be2(Si6O15).H2O M
EPIDIDYMITE Na2Be2(Si6O15).H2O O
SILINAITE NaLiSi2O5.2H2O M
SEARLESITE NaBSi2O5(OH)2 M
MAKATITE Na2Si4O8(OH)2.4H2O M
BAVENITE Ca4Be2Al2Si9O26(OH)2 O
BOHSEITE Ca4Be3+xAl1-xSi9O25-x(OH)3+x (x=0-1) O
FERROCHIAVENNITE Ca1-2FeSi5Be2O13(OH)2.2H2O M ps H
CHIAVENNITE CaMnBeSi5O13(OH)2.2H2O O
TVEDALITE (Ca,Mn++)4Be3Si6O17(OH)4.3H2O O
ALFLARSENITE Ca7(SiO4)3(OH)2 M
PREHNITE Ca2Al2Si3O10(OH)2 O
AMSTALLITE CaAl(Si,Al)4O8(OH)4.(H2O,Cl) M
RUDENKOITE Sr3Al3(Si,Al)4O10(OH,O)8Cl2.H2O M
KVANEFJELDITE Na4(Ca,Mn)Si6O14(OH)2 O
CHIAPPINOITE-(Y) (Y,Ce)2(Mn++,Ca)(Si3O7)4 O
PERETTIITE-(Y) Y+++2Mn++4Fe++[Si2B8O24] O?
ALTISITE Na3K6Ti2Al2Si8O26Cl3 M
NATROLEMOYNITE (Na,K,H3O)4Zr2(Si10O26).9H2O M
LEMOYNITE (Na,K)2CaZr2Si10O26.5-6H2O M
HOGARTHITE (Na,K)2CaTi2Si10O26.8H2O M
LOUDOUNITE NaCa5Zr4Si16O40(OH)11.8H2O (?)
LEUCOSPHENITE BaNa4Ti2B2Si10O30 M
LAPLANDITE-(Ce) Na4CeTiPSi7O22.5H2O O
8/G.12- Astrophyllite group
NALIVKINITE Li2Na(Fe++,Mn++)7Ti2Si8O26(OH)4F A
BULGAKITE Li2(Ca,Na)Fe++7Ti2(Si4O12)2O2(OH)4(F,O)(H2O)2 A
LOBANOVITE K2Na2(Fe++,Fe+++,Mn)4Mg2Ti2Si8O26(OH)4 M
HYDROASTROPHYLLITE (H3O,K)2Ca(Fe++,Mn)5-6Ti2Si8O26(OH)4F A
ASTROPHYLLITE K2Na(Fe++,Mn)7Ti2Si8O26(OH)4F A
TARBAGATAITE (K,[])2(Ca,Na)(Fe++,Mn)7Ti2(Si4O12)2O2(OH)4(OH,F) A
KUPLETSKITE K2Na(Mn,Fe++)7(Ti,Nb)2Si8O26(OH)4F A
KUPLETSKITE-(Cs) (Cs,K)2Na(Mn,Fe,Li)7(Ti,Nb)2Si8O26(OH)4F A
NIOBOKUPLETSKITE K2Na(Mn++,Zn,Fe++)7(Nb,Zr,Ti)2Si8O26(OH)4(O,F) A
ZIRCOPHYLLITE K2(Na,Ca)(Mn,Fe++)7(Zr,Nb)2Si8O26(OH)4F A
NIOBOPHYLLITE K2Na(Mn,Fe++)7(Nb,Ti)2Si8O26(OH)4(F,O) A
SVEINBERGITE Ca(Fe++6Fe+++)Ti2(Si4O12)2O2(OH)5(H2O)4 A
DEVITOITE [Ba6(PO4)2(CO3)][Fe++7(OH)4Fe+++2O2(SiO3)8] A
NAFERTISITE Na3Fe++10Ti2(Si6O17)2O2(OH)6F(H2O)2 M
CARYOCHROITE (Na,Sr,Ca,Mn,K)3(Fe+++,Mg,Mn,Fe++)10Ti2Si12O37(H2O,O,OH)17 M
ZERAVSHANITE Cs4Na2Zr3[Si18O45](H2O)2 M
VEBLENITE KNa(Fe++5Fe+++4Mn7)Nb4(Si2O7)2(Si8O22)2O6(OH)10(H2O)3 A
8/H. Phyllosilicates: layers Si2O5, Si:O = 2:5
8/H.01 to 08 Tetragonal or pseudotetragonal layer structures [Si4O10]4-, etc.
APOPHYLLITE-(NaF) NaCa4Si8O20F.8H2O O
APOPHYLLITE-(KF) (K,Na)Ca4Si8O20(F,OH).8H2O O
APOPHYLLITE-(KOH) KCa4Si8O20(OH,F).8H2O Q
CUPRORIVAITE CaCuSi4O10 Q
DIEGOGATTAITE Na2CaCu2Si8O20.H2O M
WESSELSITE (Sr,Ba)Cu++(Si4O10) Q
EFFENBERGERITE BaCuSi4O10 Q
GILLESPITE BaFe++Si4O10 Q
SANBORNITE BaSi2O5 O
BIGCREEKITE BaSi2O5.4H2O O
DAVANITE K2TiSi6O15 A
DALYITE K2ZrSi6O15 A
LITIDIONITE KNaCuSi4O10 A
FENAKSITE (K,Na,Ca)4(Fe++,Fe+++,Mn)2Si8O20(OH,F) A
MANAKSITE KNaMn++Si4O10 A
CALCINAKSITE KNaCa(Si4O10).H2O A
ERSHOVITE Na4K3(Fe++,Mn++,Ti)2Si8O20(OH)4.4H2O A
PARAERSHOVITE Na3K3Fe+++2(Si4O10OH)2(H2O)4 A
NATROSILITE Na2Si2O5 M
KANEMITE NaSi2O5.3H2O O
REVDITE Na2Si2O5.5H2O A
LATIUMITE (Ca,K)8(Al,Mg,Fe)(Si,Al)10O25(SO4) M
TUSCANITE K(Ca,Na)6(Si,Al)10O22(SO4,CO3,(OH)2).H2O M
CARLETONITE KNa4Ca4Si8O18(CO3)4(OH,F).H2O Q
8/H.09 to 27 Mica-like phyllosilicates with [Si4O10] and related structures
PYROPHYLLITE Al2Si4O10(OH)2 M
FERRIPYROPHYLLITE Fe+++2Si4O10(OH)2 M
MACAULAYITE (Fe+++,Al)24Si4O43(OH)2 M
TALC Mg3Si4O10(OH)2 M/A
MINNESOTAITE (Fe++,Mg)3Si4O10(OH)2 M
WILLEMSEITE (Ni,Mg)3Si4O10(OH)2 M
KEGELITE Pb8Al4Si8(SO4)2(CO3)4(OH)8O20 M ps H
8/H.10 to 14 Mica group
ALUMINOCELADONITE KAl(Mg,Fe++)[]Si4O10(OH)2 M
FERROALUMINOCELADONITE (FERRO-ALUMINOCELADONITE) KAl(Fe++,Mg)[]Si4O10(OH)2 M
CELADONITE KFe+++(Mg,Fe++)[]Si4O10(OH)2 M
CHROMCELADONITE KCrMgSi4O10(OH)2 M
MANGANICELADONITE KMgMn+++Si4O10(OH)2 M
FERROCELADONITE KFe+++(Fe++,Mg)[]Si4O10(OH)2 M
PARAGONITE NaAl2[]AlSi3O10(OH)2 M
BOROMUSCOVITE KAl2[]BSi3O10(OH)2 M
MUSCOVITE KAl2[]AlSi3O10(OH)2 M ps H
CHROMPHYLLITE KCr2[]AlSi3O10(OH,F)2 M ps H
ROSCOELITE KV2[]AlSi3O10(OH)2 M
GANTERITE (Ba,Na,K)(Al,Mg)2(Al,Si)AlSi3O10(OH)2 M
TOBELITE (NH4)Al2[]AlSi3O10(OH)2 M
NANPINGITE CsAl2[]AlSi3O10(OH)2 M
8/H.10- Celadonite-Muscovite series
8/H.11- Lithionite-Biotite series
POLYLITHIONITE KLi2AlSi4O10F2 M
BALESTRAITE KLi2V+++++Si4O12 M
SOKOLOVAITE CsLi2AlSi4O10(F,OH)2 M
YANGZHUMINGITE (K,Li)Mg2,5Si4O10F2 M
TAINIOLITE KLiMg2Si4O10F2 M
NORRISHITE KLiMn+++2Si4O12 M
SHIROKSHINITE KNaMg2Si4O10F2 M
MONTDORITE KFe++1,5Mn++0,5Mg0,5[]0,5Si4O10F2 M
TRILITHIONITE KLi1,5Al1,5AlSi3O10F2 M
MASUTOMILITE KLiAlMn++AlSi3O10F2 M
ASPIDOLITE NaMg3AlSi3O10(OH)2 M
FLUOROPHLOGOPITE KMg3AlSi3O10(F,OH)2 M ps H
PHLOGOPITE KMg3AlSi3O10(OH)2 M
FLUOROTETRAFERRIPHLOGOPITE KMg3(Fe+++,Al)Si3O10F2 M
TETRAFERRIPHLOGOPITE KMg3Fe+++Si3O10(OH)2 M
HENDRICKSITE KZn3AlSi3O10(OH)2 M
SHIROZULITE K(Mn++,Mg)3AlSi3O10(OH)2 M
FLUORANNITE KFe++3AlSi3O10(F,OH)2 M
ANNITE KFe++3AlSi3O10(OH)2 M
TETRAFERRIANNITE KFe++3Fe+++Si3O10(OH)2 M
SUHAILITE (NH4)Fe++3AlSi3O10(OH)2 M
EPHESITE NaLiAl2Al2Si2O10(OH)2 M/A
PREISWERKITE NaMg2AlAl2Si2O10(OH)2 M
EASTONITE KMg2AlAl2Si2O10(OH)2 M
SIDEROPHYLLITE KFe++2AlAl2Si2O10(OH)2 M
SOKOLOVAITE Cs2Li2AlSi4O10F2 M
8/H.12- Brittle micas. Margarite series
ANANDITE (-2O) BaFe++3Fe+++Si3O10S(OH) M
BITYITE LiCaAl2(AlBeSi2O10)(OH)2 M
OXYKINOSHITALITE Ba(Mg2Ti++++)(Si2Al2)O10O2 M
FLUOROKINOSHITALITE BaMg3Al2Si2O10F2 M
KINOSHITALITE BaMg3(Al2Si2)O10(OH,F)2 M
FERROKINOSHITALITE Ba(Fe++,Mg)3(Si2Al2)O10(OH,F)2 M
MARGARITE CaAl2[]Al2Si2O10(OH)2 M
CHERNYKHITE BaV2[]Al2Si2O10(OH)2 M
HANJIANGITE (1M, 2M, 3T) Ba2Ca(V+++Al)[Si3AlO10(OH)2]F(CO3)2 M
CLINTONITE CaMg2AlAl3SiO10(OH)2 M
8/H.13- Interlayer-deficient micas
WONESITE Na0,5[]0,5Mg2,5Al0,5AlSi3O10(OH)2 M
BRAMMALLITE Na0,65Al2[]Al0,65Si3,35O10(OH)2 M
ILLITE K0,65Al2[]Al0,65Si3,35O10(OH)2 M
GLAUCONITE (K,Na)(Mg,Fe++,Fe+++)(Fe+++,Al)(Si,Al)4O10(OH)2 M
AGRELLITE NaCa2Si4O10F A
GLAGOLEVITE NaMg6AlSi3O10(OH,O)8.H2O A
SHLYKOVITE KCa[Si4O9(OH)] M
CRYPTOPHYLLITE K2Ca[Si4O10].5H2O M
ERLIANITE (Fe++,Fe+++,Mg)24(Fe+++V)6Si36O90(OH,O)48 O
BANNISTERITE KCa(Mn,Fe++,Zn)21(Si,Al)32O76(OH)16.12H2O M
BARIUMBANNISTERITE (?) (K,H3O)(Ba,Ca)(Mn++,Fe++,Mg)21(Si,Al)32O80(O,OH)16.4-12H2O M
LENNILENAPEITE K6-7(Mg,Mn,Fe++,Fe+++,Zn)48(Si,Al)72(O,OH)216.16H2O A
STILPNOMELANE K(Fe++,Mg,Fe+++,Al)8(Si,Al)12(O,OH)27.2H2O M/A
MIDDENDORFITE K3Na2Mn5Si12(O,OH)36.2H2O M
FRANKLINPHILITE (K,Na)4(Mn++,Mg,Zn,Fe+++)48(Si,Al)72(O,OH)216.6H2O A ps H
PARSETTENSITE (K,Na,Ca)(Mn,Al)7Si8O20(OH)8.2H2O (?) M ps H
ARMBRUSTERITE K5Na7Mn15(Si9O22)4(OH)10.4H2O M
EGGLETONITE (Na,K,Ca)2(Mn,Fe)8(Si,Al)12O29(OH)7.11H2O M
TAMAITE (Ca,K,Ba,Na)3-4Mn++24(Si,Al)40(O,OH)112.21H2O M
GANOPHYLLITE (K,Na)2(Mn,Al,Mg)8(Si,Al)12O29(OH)7.8-9H2O M
EKMANITE (?) (Fe++,Mg,Mn,Fe+++)3(Si,Al)4O10(OH)2.2H2O (?) O
8/H.18 to 22 Clay minerals, regularly stratified
8/H.18 to- 20 Smectite - montmorillonite group
LUNIJIANLAITE Li0,72Al6(Si7AlO20)(OH,O)10 M
SALIOTITE Li0,5Na0,5Al3AlSi3O10(OH)5 M
KULKEITE Na0,35Mg8Al(AlSi7)O20(OH)10 M
ALIETTITE Ca0,2Mg6(Si,Al)8O20(OH)4.4H2O  
RECTORITE (Na,Ca)Al4(Si,Al)8O20(OH)4.2H2O M
TOSUDITE Na0,5(Al,Mg)6(Si,Al)8O18(OH)12.5H2O M (?)
CORRENSITE (Mg,Fe,Al)9(Si,Al)8O20(OH)10.nH2O O
HYDROBIOTITE K(Mg,Fe)6(Si,Al)8O20(OH)4.xH2O M
BRINROBERTSITE Na0,3Al4(Si4O10)2(OH)4.3,5H2O M ps H
MONTMORILLONITE (Na,Ca)0,3(Al,Mg)2Si4O10(OH)2.nH2O M
BEIDELLITE (Na,Ca0,5)0,3Al2(Si,Al)4O10(OH)2.nH2O M
NONTRONITE Na0,3Fe+++2(Si,Al)4O10(OH)2.nH2O M
VOLKONSKOITE Ca0,3(Cr+++,Mg,Fe+++)2(Si,Al)4O10(OH)2.4H2O M
SWINEFORDITE (Ca,Na)0,3(Al,Li,Mg)2(Si,Al)4O10(OH,F)2.2H2O M
YAKHONTOVITE (Ca,Na)0,5(Cu++Fe++Mg)2Si4O10(OH)2.3H2O M
HECTORITE Na0,3(Mg,Li)3Si4O10(F,OH)2 M
SAPONITE (Ca0,5,Na)0,3(Mg,Fe++)3(Si,Al)4O10(OH)2.4H2O M
FERROSAPONITE Ca0,3(Fe++,Mg,Fe+++)3(Si,Al)4O10(OH)2.4H2O M
SPADAITE MgSiO2(OH)2.H2O (?) (?)
STEVENSITE (Ca,Na)xMg3-x(Si4O10)(OH)2 M
SAUCONITE Na0,3Zn3(Si,Al)4O10(OH)2.4H2O M
ZINCSILITE Zn3Si4O10(OH)2.4H2O (?) M
VERMICULITE (Mg,Fe++,Al)3(Al,Si)4O10(OH)2.4H2O M
RILANDITE (Cr+++,Al)6SiO11.5H2O (?) (?)
8/H.23- Chlorite group
SUDOITE Mg2(Al,Fe+++)3Si3AlO10(OH)8 M
CLINOCHLORE (Mg,Fe++)5Al(Si3Al)O10(OH)8 M
CHAMOSITE (Fe++,Mg,Fe+++)5Al(Si3Al)O10(OH,O)8 M
ORTHOCHAMOSITE (Fe++,Mg,Fe+++)5Al(Si3Al)O10(OH,O)8 O
BAILEYCHLORE (Zn,Fe++,Al,Mg)6(Si,Al)4O10(OH)8 A
PENNANTITE Mn++5Al(Si3Al)O10(OH)8 M
NIMITE (Ni,Mg,Fe++)5Al(Si3Al)O10(OH)8 M
GONYERITE (Mn++,Mg)5Fe+++(Si3Fe+++)O10(OH)8 O (?)
COOKEITE LiAl4(Si3Al)O10(OH)8 M
BOROCOOKEITE Li1+3xAl4-x(B,Al)Si3O10(OH,F)8 M
MANANDONITE LiAl2(SiAl0,5B0,5)O5(OH)4 O
JADARITE NaLiB3SiO7(OH) M
FRANKLINFURNACEITE Ca2(Fe+++Al)Mn+++Mn++3Zn2Si2O10(OH)8 M
MOLYBDOPHYLLITE Pb8Mg9[Si10O30(OH)8(CO3)3].H2O R
NIKSERGIEVITE [Ba1,33Ca0,67Al(CO3)(OH)4][Al2(AlSi3O10)(OH)2].nH2O M
BRITVINITE Pb8Mg9[Si10O30(OH)8(CO3)3].H2O A
SURITE Pb2Ca(Al,Mg)2(Si,Al)4O10(OH)2(CO3,OH)3.0,5H2O M
FERRISURITE Pb2Ca(Fe+++,Al)2(Si,Al)4O10(OH,F)2(CO3,OH)3.0,5H2O M
8/H.25- Kaolinite group
KAOLINITE Al2Si2O5(OH)4 A
DICKITE Al2Si2O5(OH)4 M
NACRITE Al2Si2O5(OH)4 M
HALLOYSITE Al2Si2O5(OH)4 M
ALLOPHANE Al2O3.(SiO2)1,3-2.(H2O)2,5-3 am.
PIANLINITE (?) Al2Si2O6(OH)2 (?) am. (?)
IMOGOLITE (?) Al2SiO3(OH)4 (?)
ODINITE (1M,-2R,-1T) (Fe+++,Mg,Al,Fe++,Ti,Mn)2,5(SiAl)O5(OH)4 M/R
HISINGERITE Fe+++2Si2O5(OH)4.2H2O M
NEOTOCITE (Mn,Fe++)SiO3.H2O (?) am. or M
8/H.27- Serpentine group
ANTIGORITE (Mg,Fe++)3Si2O5(OH)4 M
LIZARDITE (-1T,-2H) Mg3Si2O5(OH)4 R/H
CHRYSOTILE Mg3Si2O5(OH)4 M
PARACHRYSOTILE (?) Mg3Si2O5(OH)4 O
CARYOPILITE (1M,-1Q) (Mn++,Mg)3Si2O5(OH)4 M
GREENALITE (Fe++,Fe+++)2-3Si2O5(OH)4 M
BERTHIERINE (-1M,-1H) (Fe++,Fe+++,Mg)2-3(Si,Al)2O5(OH)4 M
FRAIPONTITE (Zn,Al)3(Si,Al)2O5(OH)4 M
DOZYITE (Mg7Al2)(Si4Al2)O15(OH)12 M
AMESITE Mg2Al(SiAl)O5(OH)4 A
KELLYITE (Mn++,Mg,Al)3(Si,Al)2O5(OH)4 H
CRONSTEDTITE Fe++2Fe+++(SiFe+++)O5(OH)4 M
GUIDOTTIITE (Mn2Fe+++)(SiFe+++)O5(OH)4 H
KARPINSKITE (Mg,Ni)2Si2O5(OH)2 (?) M (?)
NEPOUITE Ni3Si2O5(OH)4 M
PECORAITE Ni3Si2O5(OH)4 M
BRINDLEYITE (Ni,Mg,Fe++)2Al(SiAl)O5(OH)4 M
CARLOSTURANITE (Mg,Fe++,Ti)21(Si,Al)12O28(OH)34.H2O M
8/H.28 to 37 Phyllosilicates with other simple layers [Si6O15], etc.
PYROSMALITE-(Fe) (Fe++,Mn++)8Si6O15(OH,Cl)10 H
PYROSMALITE-(Mn) (Mn++,Fe++)8Si6O15(OH,Cl)10 H
BROKENHILLITE (Mn++,Fe++)8(Si6O15)(OH,Cl)10 H
NELENITE (Mn++,Fe++)16Si12As+++3O36(OH)17 R
SCHALLERITE (Mn++,Fe++)16Si12As+++3O36(OH)17 R
FRIEDELITE Mn8Si6O15(OH,Cl)10 M ps R
MCGILLITE (Mn,Fe++)8Si6O15(OH)8Cl2 R
BEMENTITE Mn8Si6O15(OH)10 M
INNSBRUCKITE Mn++33(Si2O5)14(OH)38 M
VARENNESITE Na8Mn++2Si10O25(OH,Cl)2.12H2O O
NAUJAKASITE Na6(Fe++,Mn)Al4Si8O26 M
MANGANONAUJAKASITE Na6(Mn++,Fe++)Al4Si8O26 M
SPODIOPHYLLITE (Na,K)4(Mg,Fe++)3(Fe+++,Al)2(Si8O24) M (?)
SAZHINITE-(La) Na3(La,Ce)Si6O15.2H2O O ps Q
SAZHINITE-(Ce) Na2CeSi6O14(OH).nH2O (n = about 5) O
PLUMBOPHYLLITE Pb2Si4O10.H2O O
TUPERSSUATSIAITE NaFe+++3Si8O20(OH)2.8H2O M
WINDHOEKITE (Ca,Mn++)2Fe+++3(Si8O20)(OH)4.10H2O M
PALYGORSKITE (Mg,Al)2Si4O10(OH).4H2O M
YOFORTIERITE (Mn,Mg)5Si8O20(OH)2.8-9H2O M
SEPIOLITE Mg4Si6O15(OH)2.6H2O O
FERRISEPIOLITE (Fe+++,Fe++,Mg)4(Si,Fe+++)6O15(O,OH)2.6H2O O
FALCONDOITE (Ni,Mg)4Si6O15(OH)2.6H2O O
RAITE Na3Mn++3Ti++++0,25[Si4O10(OH)]2.10H2O M
LOUGHLINITE Na2Mg3Si6O16.8H2O O
INTERSILITE (Na,K)Na5Mn++(Ti,Nb)[Si10O24(OH)4].4H2O M
KALIFERSITE (K,Na)5Fe+++7(Si20O50)(OH)6.12H2O A ps O
MINEHILLITE (K,Na)2-3Ca28(Zn4Al4Si40)O112(OH)16 H
TRUSCOTTITE (Ca,Mn)14Si24O58(OH)8.2H2O H
ORLYMANITE Ca4Mn++3Si8O20(OH)6.2H2O R
FEDORITE (Na,K)2-3(Ca,Na)7(Si4O8)(Si4O10)3(F,Cl,OH)2.3,5H2O A
MARTINITE (Na,[],Ca)12Ca4(Si,S,B)14B2O38(OH,Cl)2F2.4H2O A ps H
REYERITE (Na,K)4Ca14Si22Al2O58(OH)8.6H2O R
LALONDEITE (Na,Ca)6(Ca,Na)3Si16O38(F,OH)2.3H2O A
ELLINGSENITE Na5Ca6Si18O38(OH)13.6H2O A
GYROLITE NaCa16AlSi23O60(OH)5.15H2O A ps H
TUNGUSITE Ca14(OH)8(Si8O20)Fe++9(OH)14 A (?)
ZEOPHYLLITE Ca4Si3O8(OH,F)4.2H2O A ps H
ARMSTRONGITE CaZrSi6O15.2.5H2O M
JAGOITE Pb3Fe+++Si4O12(Cl,OH) H
HYTTSJOITE Pb18Ba2Ca5Mn++2Fe+++2Si30O90Cl.6H2O R
MARICOPAITE (Pb7Ca2)[Al12Si36(O,OH)100].n(H2O,OH) (n=near 32) O
RONGIBBSITE Pb2(Si4Al)O11(OH) M
CAVANSITE Ca(VO)Si4O10.4H2O O
PENTAGONITE Ca(VO)Si4O10.4H2O O
WEEKSITE K2(UO2)2(Si5O13).4H2O M
COUTINHOITE (Th,Ba)0,5(UO2)2Si5O13.1-3,5H2O O
HAIWEEITE Ca(UO2)2Si5O12(OH)2.4,5H2O O
METAHAIWEEITE Ca(UO2)2Si6O15.nH2O M (?)
8/H.38 to 40 Two layers of tetrahedrons and related structures
MONTEREGIANITE-(Y) (Na,K)6(Y,Ca)2Si16O38.10H2O M
MOUNTAINITE Ca8Si6O19(OH).6H2O M
RHODESITE (Ca,Na2,K2)8Si16O40.11H2O O
GUNTERBLASSITE (?,??)3-xF?[(Si,?l)13O25(??,O)4].7?2O O
HILLESHEIMITE (K,Ca,[])2(Mg,Fe,Ca,[])2[(Si,Al)13O23(OH)6](OH).8H2O O
FIVEGITE K4Ca2[AlSi7O17(O2-xOHx)][(H2O)2-xOHx]Cl (x = 0-2) O
UMBRIANITE K7Na2Ca2[Al3Si10O29]F2Cl2 O
DELHAYELITE (Na,K)10Ca5Al6Si32O80(Cl2,F2,SO4)3.18H2O O
HYDRODELHAYELITE KCa2AlSi7O17(OH)2.6H2O O
MACDONALDITE BaCa4Si16O36(OH)2.10H2O O
SEIDITE-(Ce) Na4(Ce,Sr)2TiSi8O18(O,OH,F)5(OH).5H2O M
ILIMAUSSITE-(Ce) (Na,K)7-8(Ba,K)10Ce5(Nb,Ti)6(Si12O36)(Si9O18)(O,OH)24O6 R ps H
CYMRITE BaAl2Si2(O,OH)8.H2O M ps O
ESQUIREITE Ba(Si6O13).7H2O M
KAMPFITE Ba6[(Si,Al)O2]8(CO3)2Cl2.(Cl,H2O)2 H
LOURENSWALSITE (K,Ba)2(Ti,Mg,Ca,Fe)4(Si,Al,Fe)6O14(OH)12 H
WICKENBURGITE Pb3CaAl2Si10O27.3H2O R
BURCKHARDTITE Pb2(Fe+++Te++++++)[AlSi3O8]O6 M ps H
SILHYDRITE 3SiO2.H2O O
MAGADIITE NaSi7O13(OH)3.4H2O M
STRATLINGITE Ca8Al4(Al4Si4)O8(OH)40.10H2O R
VERTUMNITE Ca2Al[(OH)6AlSiO2-3(OH)4-3].2,5H2O M ps H
ZUSSMANITE K(Fe++,Mg,Mn)13(Si,Al)18O42(OH)14 R
COOMBSITE K(Mn++,Fe++,Mg)13(Si,Al)18O42(OH)14 R
SHAFRANOVSKITE K2Na3(Mn,Fe,Na)4[Si9(O,OH)27](OH)2.nH2O (n=2,33) R
8/J. Tectosilicates: frames (Si,Al)O2, Si:O = 1:2
8/J.01 to 08 Tectosilicates without tetrahedron's additional anion
LISETITE Na2CaAl4Si4O16 O
NEPHELINE (Na,K)AlSiO4 H
TRINEPHELINE NaAlSiO4 H
KALSILITE KAlSiO4 H
MEGAKALSILITE KAlSiO4 H
TRIKALSILITE (K,Na)AlSiO4 H
PANUNZITE (K,Na)AlSiO4 H
KALIOPHILITE KAlSiO4 H
YOSHIOKAITE Ca(Al,Si)2O4 H
MALINKOITE NaBSiO4 H
PETALITE LiAlSi4O10 M
VIRGILITE LixAlxSi3-xO6 H
LISITSYNITE KBSi2O6 O
CHKALOVITE Na2BeSi2O6 O
LEUCITE K[AlSi2O6] Q
AMMONIOLEUCITE (NH4)[AlSi2O6] Q
8/J.06 to 07 Feldspar group
BUDDINGTONITE (NH4)AlSi3O8.0,5H2O M
KOKCHETAVITE KAlSi3O8 H
SANIDINE (K,Na)(Si,Al)3O8 M
MICROCLINE KAlSi3O8 A
RUBICLINE (Rb,K)AlSi3O8 A
ORTHOCLASE KAlSi3O8 M
HYALOPHANE (K,Ba)Al(Si,Al)3O8 M
CELSIAN BaAl2Si2O8 M
PARACELSIAN BaAl2Si2O8 M
SLAWSONITE (Sr,Ca)Al2Si2O8 M
HEXACELSIAN BaAl2Si2O8 H
ANORTHOCLASE (Na,K)AlSi3O8 A
ALBITE NaAlSi3O8 A
ANDESINE (a variety of albite) (Na,Ca)[Al(Si,Al)Si2O8] A
LABRADORITE (a variety of anorthite) (Ca,Na)[Al(Al,Si)Si2O8] A
BYTOWNITE (a variety of anorthite) (Ca,Na)[Al(Al,Si)Si2O8] A
ANORTHITE CaAl2Si2O8 A
DMISTEINBERGITE CaAl2Si2O8 H
KUMDYKOLITE NaAlSi3O8 O
SVYATOSLAVITE CaAl2Si2O8 O
STRONALSITE SrNa2Al4Si4O16 O
BANALSITE BaNa2Al4Si4O16 O
FILATOVITE K(Al,Zn)2(As+++++,Si)2O8 M
REEDMERGNERITE NaBSi3O8 A
DANBURITE CaB2(SiO4)2 O
PEKOVITE SrBi2Si2O8 O
MALEEVITE BaBi2Si2O8 O
8/J.09 to 14 Tectosilicates with tetrahedron's additional anions
HYDROXYCANCRINITE Na8Al6Si6O24(OH)2.2H2O H
CANCRINITE Na6Ca2Al6Si6O24(CO3)2 H
KYANOXALITE Na7(Al5-6Si6-7O24)(C2O4)0,5-1.5H2O H
CANCRISILITE Na7Al5Si7O24(CO3).3H2O H
DEPMEIERITE Na8[Al6Si6O24](PO4,CO3)1-x.3H2O (x smaller than 0,5) H
DAVYNE (Na,Ca,K)8Al6Si6O24(Cl,SO4,CO3)2-3 H
QUADRIDAVYNE [(Na,K)6Cl2](Ca2Cl2)Al6Si6O24 H
BALLIRANOITE (Na,K)6Ca2(Si6Al6O24)Cl2(CO3) H
MICROSOMMITE (Na,Ca,K)7-8(Si,Al)12O24(Cl,SO4,CO3)2-3 H
KIRCHERITE [Na90Ca36K18]sigma=144(Si108Al108O432)(SO4)36.6H2O R ps H
FANTAPPIEITE [Na82.5Ca33K16.5](Si99Al99O396)(SO4)33.6H2O R
FARNESEITE [(Na,K)46Ca10](Si42Al42O168)(SO4)12.6H2O H
BIACHELLAITE (Na,Ca,K)8Al6Si6O24(SO4)2(OH)0,5.H2O R
GIUSEPPETTITE (Na,K,Ca)7-8(Si,Al)12O24(SO4,Cl)1-2 H
BYSTRITE Ca(Na,K)7Si6Al6O24(S--)1,5.H2O R
CARBOBYSTRITE Na8[Al6Si6O24](CO3).4H2O R
ALLORIITE (Na,Ca,K)13Ca2(Al6Si6O24)2(SO4)3Cl2.2H2O R ps H
AFGHANITE (Na,Ca,K)8(Si,Al)12O24(SO4,Cl,CO3)3.H2O H
TOUNKITE (Na,Ca,K)8Al6Si6O24(SO4)2Cl.H2O H
SACROFANITE (Na,Ca,K)9(Si,Al)12O24[(OH)2,(SO4),(CO3),Cl2)]3.nH2O H
MARINELLITE (Na,K,Ca)48(SO4)8(Al6Si6O24)6Cl2.3H2O H
PITIGLIANOITE K2Na6Si6Al6O24(SO4).2H2O H
VISHNEVITE (Na,Ca,K)6(Si,Al)12O24[(SO4),(CO3),Cl2]2-4.nH2O H
FRANZINITE (Na,K)6Ca2(SO4)2Al6Si6O24.0,5H2O H
LIOTTITE (Ca,Na,K)8(Si,Al)12O24[(SO4),(CO3),Cl,OH]4.H2O H
WENKITE Ba4Ca6(Si,Al)20O41(OH)2(SO4)3.H2O H
8/J.09- Cancrinite group
LEIFITE Na2(Si,Al,Be)7(O,OH,F)14 R
EIRIKITE KNa6Be2Al3Si15O39F2 R
TELYUSHENKOITE (Cs,Na,K)Na6Be2Al3Si15O39F2 R
8/J.11- Sodalite group (complex feldspathoids)
TSAREGORODTSEVITE N(CH3)4[Si2(Si0,5Al0,5)O6]2 O ps C
SODALITE Na8Al6Si6O24Cl2 C
HYDROSODALITE (?) Na6[AlSiO4]6.8H2O C
NOSEAN Na8Al6Si6O24(SO4).H2O C
HAUYNE (Na,Ca,K)8-4(SO4)2-1(AlSiO4)6 C
LAZURITE (Na,Ca)7-8(Al,Si)12(O,S)24[(SO4),Cl2,(OH)2] C M A
VLADIMIRIVANOVITE Na6Ca2[Al6Si6O24](SO4,S3,S2,Cl)2.H2O O
TUGTUPITE Na4AlBeSi4O12Cl Q
KAMAISHILITE Ca2Al2SiO6(OH)2 Q
BICCHULITE Ca2Al2SiO6(OH)2 C
DANALITE Fe++4Be3(SiO4)3S C
HELVITE Mn4Be3(SiO4)3S C
GENTHELVITE Zn4Be3(SiO4)3S C
MARIALITE Na4Al3Si9O24Cl Q
MEIONITE Ca4Al6Si6O24(CO3,SO4) Q
SILVIALITE Ca4Al6Si6O24(SO4) Q
SARCOLITE NaCa6Al4Si6O24F (?) Q
KALBORSITE K6[Al4Si6O20]B(OH)4Cl Q
USSINGITE Na2AlSi3O8(OH) A
8/J.15 to 20 Tectosilicates with zeolite structure
BIKITAITE Li[AlSi2O6].H2O M/A
HSIANGHUALITE Li2Ca3[Be3Si3O12]F2 C
NABESITE Na2BeSi4O10.4H2O O
LOVDARITE K4Na12[Be8Si28O72].18H2O O
GAULTITE Na4[Zn2Si7O18].5H2O O
PARTHEITE Ca2[Al4Si4O15(OH)2].4H2O M
ROGGIANITE Ca2[Be(OH)2Al2Si4O13].2,5H2O Q
KRASNOITE Ca3Al7,7Si3P4O23,5(OH)12,1F2.8H2O R ps H
PERHAMITE (Ca,Sr)3Al7,7Si3P4O23,5(OH)14,1.8H2O R ps H
TSCHORTNERITE Ca4(K,Ca,Sr,Ba)3Cu3(OH)8(Si12Al12O48).nH2O (n more than 20) C
LITHOSITE K6Al4Si8O25.2H2O M ps O
THORNASITE Na12Th3(Si8O19)4.18H2O R
MENDELEEVITE-(Ce) (Cs6[]6)([]10K2)(REE22Ca6)(Si70O175)(OH,F)16(H2O)19 C
MENDELEEVITE-(Nd) Cs6[(Nd,REE)23Ca7](Si70O175)(OH,F)19(H2O)16 C
8/J.21 to 27 Zeolite group
8/J.21 to- 22 Fibrous zeolites
NATROLITE Na2[Al2Si3O10].2H2O O
PARANATROLITE Na2[Al2Si3O10].3H2O M ps O
GONNARDITE (Na,Ca)6-8[(Al,Si)20O40].12H2O O
MESOLITE Na16Ca16[Al48Si72O240].64H2O O
SCOLECITE Ca[Al2Si3O10].3H2O M
THOMSONITE-Ca Ca2Na[Al5Si5O20].6H2O O
THOMSONITE-Sr (Sr,Ca)2Na[Al5Si5O20].6-7H2O O
FERRIERITE-Na (Na,K,Mg0,5,Ca0,5)6[Al6Si30O72].18H2O M
FERRIERITE-K (K,Na,Mg0,5,Ca0,5)6[Al6Si30O72].18H2O O
FERRIERITE-Mg (Mg0,5,K,Na,Ca0,5)6[Al6Si30O72].18H2O O
MUTINAITE Na3Ca4[Al11Si85O192].60H2O O
TERRANOVAITE NaCa[Al3Si17O40].7H2O O
GOTTARDIITE Na3Mg3Ca5[Al19Si117O272].93H2O O ps H
BOGGSITE Ca8Na3[Al19Si77O192].70H2O O
DACHIARDITE-K K4(Si20Al4O48).13H2O M
DACHIARDITE-Na (Na,K,Ca0,5)4-5[Al4-5Si20-19O48].12-13H2O M
DACHIARDITE-Ca (Ca0,5,K,Na)4-5[Al4-5Si20-19O48].12-13H2O M
DIRENZOITE K6Na(Ca,Mg)3(Si,Al)60O120.36H2O O
MORDENITE (Na2,Ca,K2)4[Al8Si40O96].28H2O O
EDINGTONITE Ba[Al2Si3O10].4H2O O/Q
LAUMONTITE Ca4[Al8Si16O48].18H2O M
8/J.23 to 25 Lamellar zeolites
HEULANDITE-Na (Na,Ca0,5,K)9[Al9Si27O72].24H2O M
HEULANDITE-K (K,Ca0,5,Na,Mg0,5,Sr0,5)9[Al9Si27O72].24H2O M
HEULANDITE-Ca (Ca0,5,Na,K)9[Al9Si27O72].24H2O M
HEULANDITE-Sr (Sr0,5,Ca0,5,Na,K)9[Al9Si27O72].24H2O M
HEULANDITE-Ba (Ba,Ca,Sr,K,Na)5Al9Si27O72.22H2O M
CLINOPTILOLITE-Na (Na,K,Ca0,5)6[Al6Si30O72].20H2O M
CLINOPTILOLITE-K (K,Na)6[Al6Si30O72].20H2O M
CLINOPTILOLITE-Ca (Ca0,5,Na,K)6[Al6Si30O72].20H2O M
STILBITE-Na (Na,Ca0,5,K)9[Al9Si27O72].28H2O M
STILBITE-Ca (Ca0,5,Na,K)9[Al9Si27O72].28H2O M
BARRERITE Na2[Al2Si7O18].6H2O O
STELLERITE Ca[Al2Si7O18].7H2O O
GOOSECREEKITE Ca[Al2Si6O16].5H2O M
EPISTILBITE (Ca,Na2)[Al2Si6O16].5H2O M/A
BREWSTERITE-Sr (Sr,Ba)2[Al4Si12O32].10H2O M/A
BREWSTERITE-Ba (Ba,Sr)2[Al4Si12O32].10H2O M
COWLESITE Ca[Al2Si3O10].5,3H2O O
AMICITE K4Na4[Al8Si8O32].10H2O M
GISMONDINE Ca[Al2Si2O8].4,5H2O M
GOBBINSITE Na5[Al5Si11O32].12H2O O ps Q
GARRONITE NaCa2,5[Al6Si10O32].14H2O Q/O
PHILLIPSITE-Na (Na,K,Ca0,5,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M
PHILLIPSITE-K (K,Na,Ca0,5,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M
PHILLIPSITE-Ca (Ca0,5,K,Na,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M ps O
FLORKEITE K3NaCa2(Al8Si8O32) A ps M
HARMOTOME Ba2(Ca0,5,Na)Al6Si10O32.12H2O M
MONTESOMMAITE K9[Al9Si23O64].10H2O O ps Q
MERLINOITE K5Ca2[Al9Si23O64].22H2O O
YUGAWARALITE Ca[Al2Si6O16].4H2O M
8/J.26 to 27 Cubic and pseudocubic zeolites
WILLHENDERSONITE K0-1Ca1,5-1[Al3Si3O12].5H2O A
CHABAZITE-Na (Na,K,Ca0,5)4[Al4Si8O24].12H2O R
CHABAZITE-K (K,Na,Ca0,5)4[Al4Si8O24].12H2O R
CHABAZITE-Mg Mg0,7K0,5Ca0,5Na0,1)[Al3Si9O24].10H2O R
CHABAZITE-Ca (Ca0,5,K,Na)4[Al4Si8O24].12H2O R ps H/A
CHABAZITE-Sr (Sr,Ca)[Al2Si4O12].6H2O R
TSCHERNICHITE Ca[Al2Si6O16].8H2O Q
GMELINITE-Na (Na,K,Ca0,5)4[Al8Si16O48].22H2O H
GMELINITE-K (K,Na,Ca)6[Al7Si17O48].22H2O H
GMELINITE-Ca (Ca0,5,Sr0,5,Na,K)4[Al8Si16O48].22H2O H
LEVYNE-Na (Na,Ca0,5,K)6[Al6Si12O36].17H2O R
LEVYNE-Ca (Ca0,5,Na,K)6[Al6Si12O36].17H2O R
OFFRETITE CaKMg[Al5Si13O36].16H2O H
MAZZITE-Mg (Mg2,5K2Ca1,5)[Al10Si26O72].30H2O H
MAZZITE-Na Na4[Al4Si14O36].15H2O H
ERIONITE-Na (Na,K,Ca0,5)10[Al10Si26O72].30H2O H
ERIONITE-K (K,Na,Ca0,5)10[Al10Si26O72].30H2O H
ERIONITE-Ca (Ca0,5,K,Na)10[Al10Si26O72].30H2O H
BELLBERGITE (K,Ba,Sr)2Sr2Ca2(Ca,Na)4[Al18Si18O72].30H2O H
PERLIALITE K9Na(Ca,Sr)[Al12Si24O72].15H2O H
ANALCIME (-1C,-1Q,-1O,-1M) Na[AlSi2O6].H2O C Q O M
POLLUCITE (Cs,Na)[AlSi2O6].nH2O (Cs+n=1) C
KIRCHHOFFITE CsBSi2O6 Q
WAIRAKITE Ca[Al2Si4O12].2H2O M/Q
FAUJASITE-Na (Na,Ca0,5,Mg0,5,K)3-4[Al3-4Si9-8O24].16H2O C
FAUJASITE-Mg (Mg0,5,Ca0,5,Na,K)3-4[Al3-4Si9-8O24].16H2O C
FAUJASITE-Ca (Ca0,5,Na,Mg0,5,K)3-4[Al3-4Si9-8O24].16H2O C
PAULINGITE-K (K,Ca0,5,Na)10[Al10Si32O84].27-44H2O C
PAULINGITE-Ca (Ca0,5,K,Na)10[Al10Si32O84].27-44H2O C

Class IX - Organic compounds

Mineral Formula System
9/A. Salts of organic acids
9/A.01- Oxalates [C2O4]--
NATROXALATE Na2C2O4 M
WHEWELLITE Ca(C2O4) M
WEDDELLITE Ca(C2O4).2H2O Q
CAOXITE Ca(C2O4).3H2O A
NOVGORODOVAITE Ca2(C2O4)Cl2.2H2O M
OXAMMITE (NH4)2(C2O4).H2O O
GLUSHINSKITE Mg(C2O4).2H2O M
HUMBOLDTINE Fe++(C2O4).2H2O M
LINDBERGITE Mn(C2O4).2H2O M
FALOTTAITE MnC2O4.3H2O O
MINGUZZITE K3Fe+++(C2O4)3.3H2O M
ZHEMCHUZHNIKOVITE NaMg(Al,Fe+++)(C2O4)3.8H2O R
STEPANOVITE NaMgFe+++(C2O4)3.8-9H2O R
MOOLOOITE Cu++(C2O4).0,5H2O O
WHEATLEYITE Na2Cu(C2O4)2.2H2O A
ANTIPINITE KNa3Cu2(C2O4)4 A
DEVEROITE-(Ce) (Ce,Nd,La)2(C2O4)3.10H2O M
COSKRENITE-(Ce) (Ce,Nd,La)2(SO4)2(C2O4).8H2O A
LEVINSONITE-(Y) (Y,Nd,Ce)Al(SO4)2(C2O4).12H2O M
ZUGSHUNSTITE-(Ce) (Ce,Nd,La)Al(SO4)2(C2O4).12H2O M
9/A.02- Other organic salts: mellates, citrates, etc.
DASHKOVAITE Mg(HCO3)2.2H2O M
FORMICAITE Ca(HCO2)2 Q
MELLITE Al2[C6(COO)6].16H2O Q
HOGANITE Cu(CH3COO)2.H2O M
PACEITE CaCu(CH3COO)4.6H2O Q
CALCLACITE (?) CaCl2.Ca(C2H3O2)2.10H2O M/A
EARLANDITE Ca3[C(OH)(CH2)2(COO)3]2.4H2O M
KAFEHYDROCYANITE (?) K4Fe++(CN)6.3H2O Q (?)
JULIENITE Na2Co++(SCN)4.8H2O Q
ABELSONITE C31H32N4Ni A
JOANNEUMITE Cu(C3N3O3H2)2(NH3)2 A
CHANABAYAITE CuCl(N3C2H2)(NH3).0,25H2O O
9/A.03-
ERNSTBURKEITE Mg[CH3SO3]2.12H2O R
9/B. Hydrocarbon without N
9/B.01- Chain structures
EVENKITE CxH2x+2 (x=19 to 28) O
9/B.02- Ringstructures
KRATOCHVILITE (C6H4)2CH2 O
SIMONELLITE C19H24 O
HOELITE (C6H4)2(CO)2 O
REFIKITE C19H31COOH O
HARTITE C20H34 A
FICHTELITE C19H34 M
DINITE C20H36 O
KARPATITE C24H12 M
IDRIALITE C22H14 O
RAVATITE C14H10 O
FLAGSTAFFITE C10H22O3 O
9/C. Resins compounds
AMBER [C,H,O] am.
9/D. Hydrocarbons with N
UREA CO(NH2)2 Q
ACETAMIDE CH3CONH2 R
TINNUNKULITE C5H4N4O3.2H2O M
KLADNOITE C6H4(CO)2NH M
URICITE C5H4N4O3 M
GUANINE C5H3(NH2)N4O M
BINDHEIMITE = OXYPLUMBOROMEITE or PLUMBOROMEITE Pb2Sb2O6O C

mlevy

[Mineral Search]     [Abbreviations]     [Pictures]     [Athena]

mlevy

Send comments on page to mail pp

Copyright © 1986, 1994, 2014 ATHENA - Pierre Perroud. All Rights Reserved.