


Systematic List of Minerals



Class VIII - Silicates (Strunz VIII th ed.)

Silicates, nesosilicates, sorosilicates, unclassified silicates, cyclosilicates, inosilicates, phyllosilicates, tectosilicates.


Mineral Formula System
8/A. Nesosilicates: isolated tetrahedrons [SiO4]----, Si:O = 1:4
8/A.01 to 03 Cations in tetrahedral coordination [4]
8/A.04 to 07 Cations in octahedral coordination [6]
8/A.04- Olivine group
LAIHUNITE Fe++Fe+++2(SiO4)2 M
8/A.08 to 12 Cations in cubic and octahedral coordination [8+6]
8/A.08- Garnet group
PYROPE {Mg3}[Al2](Si3)O12 C
ALMANDINE {Fe++3}[Al2](Si3)O12 C
SPESSARTINE {Mn++3}[Al2](Si3)O12 C
CALDERITE {Mn++3}[Fe+++2](Si3)O12 C
KNORRINGITE {Mg3}[Cr+++2](Si3)O12 C
MAJORITE {Mg3}[SiMg](Si3)O12 C
MENZERITE-(Y) {Y2Ca}[Mg2](Si3)O12 C
GROSSULAR {Ca3}[Al2](Si3)O12 C
ANDRADITE {Ca3}[Fe+++2](Si3)O12 C
SCHORLOMITE {Ca3}[Ti2](SiFe+++2)O12 C
MORIMOTOITE {Ca3}[TiFe++](Si3)O12 C
RUBINITE Ca3Ti+++2Si3O12 C
UVAROVITE {Ca3}[Cr+++2](Si3)O12 C
MOMOIITE {Mn++3}[V+++2](Si3)O12 C
GOLDMANITE {Ca3}[V+++2](Si3)O12 C
ERINGAITE {Ca3}[Sc2](Si3)O12 C
KIMZEYITE {Ca3}[Zr2](SiAl2)O12 C
IRINARASSITE {Ca3}[Sn++++2](SiAl2)O12 C
TOTURITE {Ca3}[Sn++++2](SiFe+++2)O12 C
KERIMASITE {Ca3}[Zr2](SiFe+++2)O12 C
WADALITE Ca12Al010Si4O32Cl6 C
ELTYUBYUITE Ca12Fe+++10Si4O32Cl6 C
HOLTSTAMITE Ca3(Al,Mn+++)2(SiO4)2(OH)4 Q
KATOITE Ca3Al2(SiO4)3-x(OH)4x (x = 1,5-3) C
HENRITERMIERITE {Ca3}[Mn+++2](Si2)( [])O8(OH)4 Q
MONTENEVEITE Ca3Sb+++++2(Fe+++2Fe++)O12 C
KHOHARITE Mg3Fe+++2(SiO4)3 C
UMBOZERITE Na3Sr4ThSi8(O,OH)24 am.
8/B. Nesosilicates with tetrahedron's additional anion
8/B.01 to 08 Cations in tetrahedral or octahedral coordination [4/6]
MULLITE Al8(Si,Al)4O16(O,OH,F)4 O
YODERITE (Mg,Al,Fe+++)8Si4(O,OH)20 M
MAGNESIOSTAUROLITE []4Mg4Al16(Al2[]2)Si8O40[(OH)2O6] M
STAUROLITE (Fe++,Mg,Zn)2Al9(Si,Al)4O22(OH)2 M ps O
8/B.04- Humite group
CHONDRODITE (Mg,Fe++)5(SiO4)2(F,OH)2 M
HUMITE (Mg,Fe++)7(SiO4)3(F,OH)2 O
CLINOHUMITE (Mg,Fe++)9(SiO4)4(F,OH)2 M
RIBBEITE (Mn++,Mg)5(SiO4)2(OH)2 O
SONOLITE Mn++9(SiO4)4(OH,F)2 M
CHAPMANITE Sb+++Fe+++2(SiO4)2(OH) M
BRAUNITE Mn++Mn+++6SiO12 Q
BRAUNITE II (?) Ca(Mn+++,Fe+++)14SiO24 Q
OREBROITE Mn++3(Sb+++++,Fe+++)Si(O,OH)7 H
BARWOODITE Mn++6(Nb+++++,[])2(SiO4)2(O,OH)6 H
WELINITE Mn++3(W++++++,Mg)0,7SiO4(O,OH)3 H
LANGBANITE (Mn++,Ca)4(Mn+++,Fe+++)9Sb+++++Si2O24 R
YEATMANITE Mn++9Zn6Sb+++++2Si4O28 A
KATOPTRITE (Mn,Mg)13(Al,Fe+++)4Sb+++++2Si2O28 M
HOLDENITE (Mn,Mg)6Zn3(AsO4)2(SiO4)(OH)8 O
KOLICITE Mn7Zn4(AsO4)2(SiO4)2(OH)8 O
MANGANOSTIBITE (Mn++,Fe++)7(SbO4)(AsO4,SiO4)O4 O
DIXENITE Cu+Mn++14Fe+++(As+++O3)5(SiO4)2(As+++++O4)(OH)6 R
TURTMANNITE (Mn,Mg)22,5Mg33x[(V,As)O4]3[SiO4]3[AsO3]xO55x(OH)20+x R ps H
MCGOVERNITE (Mn,Mg,Zn)22(AsO3)(AsO4)3(SiO4)3(OH)20 R
CARLFRANCISITE Mn++3(Mn++,Mg,Fe+++,Al)42[As+++O3]2(As+++++O4)4[(Si,As+++++)O4]6[(As+++++,Si)O4]2(OH)42 R
WIKLUNDITE Pb2(Mn++,Zn)3(Fe+++,Mn++)2(Mn++,Mg)19(As+++O3)2(Si,As+++++O4)6(OH)18Cl6 R
KRAISSLITE (Mn++,Mg)24Zn3Fe+++(As+++O3)2(As+++++O4)3(SiO4)6(OH)18 H
ASBECASITE Ca3(Ti,Fe,Sn)(Be,B,Al)2(As+++,Sb+++)3O6(SiO4)2 R
8/B.12 to 38 Cations with coordination number between [8] and [12]
TRIMOUNSITE-(Y) (Y,Dy,Er,Yb,Gd,Ho,Tb,Sm)2Ti2SiO9 M
IVANYUKITE-Cu Cu[Ti4(OH)2O2(SiO4)3].7H2O C
IVANYUKITE-Na-C Na2[Ti4O2(OH)2(SiO4)3].6H2O C
IVANYUKITE-Na-T Na3[Ti4(OH)O3(SiO4)3].7H2O R
YFTISITE-(Y) (Y,Dy,Er)4(Ti,Sn++++)O(SiO4)2(F,OH)6 O
MONGOLITE Ca4Nb6Si5O24(OH)10.5-6H2O Q
ILMAJOKITE (Na,Ce,Ba)2TiSi3O5(OH)10.nH2O M
TUNDRITE-(Ce) Na2(Ce,La,Nd)2(Ti,Nb)(O,OH)2(SiO4)(CO3)2 A
TUNDRITE-(Nd) Na3(Nd,La)4(Ti,Nb)2(SiO4)2(CO3)3O4(OH).2H2O A
KULIOKITE-(Y) (Y,Yb,Er,Dy,Lu,Gd,Tm,Ho)4Al(SiO4)2(OH)2F5 A
ULFANDERSSONITE-(Ce) (Ce15Ca)Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 M
ALUMINOCERITE-(Ce) (Ce,Ca,La,Nd)9(Al,Fe+++)(SiO4)3[SiO3(OH)]4(OH)3 R
CERITE-(Ce) Ce+++9Fe+++(SiO4)6[(SiO3)(OH)](OH)3 R
CERITE-(La) (La,Ce,Ca)9(Fe,Ca,Mg)(SiO4)3[(SiO3)(OH)]4(OH)3 R ps H
SARYARKITE-(Y) Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7.6H2O H
KITTATINNYITE Ca4Mn++2Mn+++4Si4O16(OH)8.18H2O H
NAGELSCHMIDTITE Ca3(PO4)2.2(alpha-Ca2SiO4) H
HARRISONITE Ca(Fe++,Mg)6(PO4)2(SiO4)2 R
CEBOLLITE Ca2(Mg,Fe++,Al)Si2(O,OH)7 O
CHLORITOID (Fe++,Mg,Mn)2Al4Si2O10(OH)4 M/A
OTTRELITE (Mn,Fe++,Mg)2Al4Si2O10(OH)4 M/A
CHESSEXITE Na4Ca2(Mg,Zn)3Al8(SiO4)2(SO4)10(OH)10.40H2O O
8/B.27 to 28 Nesosilicates with [SO4]--, [CrO4]--, [PO4]---
BRITHOLITE-(Ce) (Ce,Ca)5(SiO4,PO4)3(OH,F) H
IRANITE Pb10Cu(CrO4)6(SiO4)2(F,OH)2 A
WHERRYITE Pb7Cu2(SO4)4(SiO4)2(OH)2 M
8/B.29 to 33 Be and B nesosilicates
8/B.29- Datolite - gadolinite group
HOMILITE Ca2(Fe++,Mg)B2Si2O10 M
GADOLINITE-(Ce) (Ce,La,Nd,Y)2Fe++Be2Si2O10 M
GADOLINITE-(Nd) Nd2Fe++Be2O2(SiO4)2 M
KORNERUPINE Mg4(Al,Fe+++)6(Si,B)4O21(OH) O
PRISMATINE (Mg,Al,Fe++)5-6Al4((Si,Al)O4)4(BO3)(O,OH,F)3 O
MAGNESIODUMORTIERITE (Mg,Ti,-)(Al,Mg)2Al4Si3O18-y(OH)yB (y=2-3) O
TITANOHOLTITE (Ti0,75[]0,25)Al6BSi3O18 O
HOLTITE Al6(Al,Ta)(Si,Sb)3BO15(O,OH)2 O
NIOBOHOLTITE (Nb0,6[]0,4)Al6BSi3O18 O
WERDINGITE (Mg,Fe)2Al12(Al,Fe)2Si4B2(B,Al)2O37 A
HARKERITE Ca24Mg8Al2(SiO4)8(BO3)6(CO3)10.2H2O C
OKANOGANITE-(Y) Na(Y,Ce,Nd,Ca,Na)15Fe+++(Si3B3O18)(SiO4)4F10(OH)4 R
VICANITE-(Ce) (Ca,REE,Th)15Fe+++(SiO4)3(Si3B3O18)(BO3)(As+++++O4)(As+++O3)x(NaF3)1-xF7.0,2H2O (x=0.4) R
PROSHCHENKOITE-(Y) (Y,REE,Ca,Na,Mn)15(Fe++,Mn)Ca(P,Si)Si6B3O34F14 R
LAPTEVITE-(Ce) Ca6(Fe++,Mn++)Y3REE7(SiO4)3(PO4)(B3Si3O18)(BO3)F11 H
HUNDHOLMENITE-(Y) (Y,REE,Ca,Na)15(Al,Fe+++)(CaxAs+++1-x)(Si,As+++++)Si6B3(O,F)48 (x = 0,78) R
TRITOMITE-(Y) Y5(SiO4,BO4)3(O,OH,Cl) R (?)
8/B.34 to 38 Uranyl nesosilicates with [UO2]++ and [SiO4]----
OURSINITE (Co,Mg)(UO2)2Si6(OH)2.6H2O O
SWAMBOITE-(Nd) Nd0.33[(UO2)(SiO3OH)].2,5(H2O) M
LEPERSONNITE-(Gd) CaO.(Gd,Dy)2O3.24UO3.8CO2.4SiO2.60H2O O
8/C. Sorosilicates: paired tetrahedrons, Si:O = 2:7
8/C.01 to 06 Sorosilicates [Si2O7]------ without tetrahedron's additional anion
KEIVIITE-(Yb) (Yb,Y)2Si2O7 M
YTTRIALITE-(Y) (Y,Th)2Si2O7 H (?)
PERCLEVEITE-(Ce) (Ce,La,Nd)2(Si2O7) Q
CERVANDONITE-(Ce) (Ce,Nd,La)(Fe+++,Fe++,Ti++++,Al)3O2(Si2O7)1-x+y(AsO3)1+x-y(OH)3x-3y (x=0,47 y=0,31) M
8/C.02- Melilite group
MELILITE (Ca,Na)2(Al,Mg)(Si,Al)2O7 Q
JEFFREYITE (Ca,Na)2(Be,Al)Si2(O,OH)7 O ps Q
8/C.07 to 20 Sorosilicates [Si2O7]6- with tetrahedron's additional anion: O,OH,F
KILLALAITE Ca6,4[H0,6Si2O7]2(OH)2 M
ILVAITE CaFe++2Fe+++Si2O7O(OH) O
MANGANILVAITE CaFe++Fe+++(Mn,Fe++)(Si2O7)O(OH) M
WOHLERITE Na4Ca8(Zr,Nb)4(Si2O7)4(O,OH,F)8 M
MARIANOITE Na2Ca4Nb(Nb,Zr)(Si2O7)2(O,F)4 M
JANHAUGITE Na6Mn++6Ti4(Si2O7)4[O2(OH,F,O)6] M
NORMANDITE NaCa(Mn++,Fe++)(Zr,Ti)(Si2O7)OF M
LAVENITE (Na,Ca)8(Mn++,Fe++)4(Zr,Ti)4(Si2O7)4(O,OH,F)8 M
BAGHDADITE Ca12(Zr,Ti)4(Si2O7)4(O,F)8 M
ROUMAITE (Ca,Na,Ce,La)6-7(Nb,Ti++++)(Si2O7)(OH)F3 M
NIOCALITE Ca14Nb2(Si2O7)4(O6F2) M
HIORTDAHLITE-I (Na3Ca)Ca8Zr2(Y,Zr,REE,Na)+++2(Si2O7)4(O3F5) (?) A
HIORTDAHLITE-II (Na,Ca)4Ca8Zr2(Y,Zr,REE,Na)2(Si2O7)4(O3F5) A
8/C.12- Mosandrite-Rosenbuschite series
MOSANDRITE-(Ce) (Ca3REE)[(H2O)2Ca0,5[]0,5]Ti(Si2O7)2(OH)2(H2O)2 M
RINKITE-(Ce) (Ca3Ce)Na(NaCa)Ti(Si2O7)2(OF)F2 M
NACARENIOBSITE-(Ce) Na3Ca3(Ce,La,Pr,Nd)(Nb,Ti)(Si2O7)2OF3 M
ROSENBUSCHITE (Ca,Na)12(Zr,Ti)4(Si2O7)4(O4F4) A
GOTZENITE Na(Na,Ca)4Ca2Ti(Si2O7)2(O,F)2 A
KOCHITE Na2(Na,Ca)4Ca4(Mn,Ca)2Zr2(Si2O7)4(O,F)4F4 A
HAINITE-(Y) Na2Ca4(Y,REE)Ti(Si2O7)2OF3 A
FOGOITE-(Y) Na3Ca2Y2Ti(Si2O7)2OF3 A
BATIEVAITE-(Y) Y2Ca2Ti(Si2O7)2(OH)2(H2O)4 A
8/C.13- Lamprophyllite series
GRENMARITE (Na,Ca)4(Mn,Na)(Zr,Mn)2(Zr,Ti)(Si2O7)2(O,F)2 M
LILEYITE Ba2(Na,Fe,Ca)3MgTi2(Si2O7)2O2F2 M
EMMERICHITE Ba2Na(Na,Fe++)2(Fe+++,Mg)Ti2(Si2O7)2O2F2 M
ERICSSONITE (-2O) BaMn2(Fe+++O)Si2O7(OH) O
8/C.14- Murmanite-Lomonosovite series
SHKATULKALITE Na10(Mn++,Ca,Sr)Ti3Nb3(Si2O7)6(OH)2F.12H2O M
JINSHAJIANGITE (Na,Ca)(Ba,K)(Fe++,Mn++)4(Ti,Fe+++)2(Si2O7)2O2(F,O,OH)2-3 M
PERRAULTITE (Na,Ca)(Ba,K)(Mn++,Fe++)4(Ti,Zr)2(Si2O7)2O2(OH,F,O)3 M
BOBSHANNONITE Na2KBa(Mn++,Na)8(Nb,Ti)4(Si2O7)4O4(OH)4(O,F)2 A
SURKHOBITE (Ba,K)2CaNa(Mn,Fe++,Fe+++)8Ti4(Si2O7)4O4(F,OH,O)6 M
MURMANITE Na4Ti++++Nb2(Si2O7)2O4.4H2O A
CALCIOMURMANITE (Na,[])2Ca(Ti,Mg,Nb)4[Si2O7]2O2(OH,O)2(H2O)4 A
ZVYAGINITE NaZnNb2Ti[Si2O7]2O(OH,F)3(H2O)4+x (x less than 1) A
EPISTOLITE Na4Ti++++4(Si2O7)2O2(OH,F)2.4H2O A
BORNEMANITE (Na,Ba)4(Na,Ti,Mn++)4(Ti,Nb)2(PO4)(Si2O7)2O2(OH,F,O)2 M
LOMONOSOVITE Na8Mn++Ti++++3Si4O12(PO4)2O4 A
VUONNEMITE Na11Ti++++Nb2(Si2O7)2(PO4)2O3(F,OH) A
INNELITE-1A (Ba,K)4(Na,Ca)3Ti3(Si2O7)(SO4)O4 A
YOSHIMURAITE (Ba,Sr)2(Mn++,Fe++)2(Ti++++,Fe+++)(PO4,SO4,SiO4)(Si2O7)(O,OH) A
BUSSENITE Na2(Ba,Sr)2(Fe++,Mn++)TiSi2O7(CO3)(OH)3F A
QUADRUPHITE Na14Ca(Mg,Mn)(Ti,Mn,Zr,Nb)4Si4O12(PO4)4O6F2 A
SOBOLEVITE Na12Ca(NaCaMn)Ti2(TiMn)[Si2O7]2(PO4)4O3F3 M
POLYPHITE Na5(Na4Ca2)Ti2[Si2O7](PO4)3O2F2 A
8/C.15- Bafertisite series
HEJTMANITE Ba(Mn,Fe++)2TiO(Si2O7)(OH,F)2 M
DELINDEITE (Na,K)3Ba2(Ti,Fe+++)3(Si2O7)2(O,OH,H2O)6 A
CAMARAITE Ba3NaTi4(Fe++,Mn)8(Si2O7)4O4(OH,F)7 A
SCHULLERITE (Na,Ca,Mn)2Ba2(Mg,Fe++)2(Ti,Fe+++)2(Si2O7)2O2F2 A
BYKOVAITE (Ba,Na,K)2{(Na,Ti,Mn)4[(Ti,Nb)2O2Si4O14](H2O,F,OH)2}.3,5H2O M
NECHELYUSTOVITE (Ba,Sr,K)2{(Na,Ti,Mn)4[(Ti,Nb)2O2Si4O14](O,H2O,F)2}.4,5H2O M
KAZANSKYITE Ba[]TiNbNa3Ti(Si2O7)2O2(OH)2(H2O)4 A
LAURENTIANITE [NbO(H2O)]3(Si2O7)2[Na(H2O)2]3 R
FERSMANITE (Ca,Na)8(Ti,Nb)4(Si4O12)O10(F,OH)4 M
BELKOVITE Ba3(Nb,Ti)6(Si2O7)2O12 H
PERRIERITE-(Ce) (Ce,La,Ca,Sr)4(Fe++,Mg,Mn++)(Ti,Fe+++)4Si4O22 M
PERRIERITE-(La) (La,Ce,Ca)4(Fe++,Mn++,Mg)(Ti,Fe)4Si4O22 M
HEZUOLINITE (Sr,REE)4Zr(Ti,Fe+++,Fe++)2Ti2O8(Si2O7)2 M
RENGEITE (Sr,Ce)4Zr(Ti++++,Al)4Si4O22 M
CHEVKINITE-(Ce) (Ca,Ce,La)4(Fe++,Mg)2(Ti,Fe+++)3O8(Si2O7)2 M
DINGDAOHENGITE-(Ce) Ce4Fe++(Ti,Fe++,Mg,Fe+++)2Ti2Si4O22 M
POLYAKOVITE-(Ce) (Ce,La,Nd,Ca)4(Mg,Fe++)(Cr+++,Fe+++)2(Ti,Nb)2Si4O22 M
CHRISTOFSCHAFERITE-(Ce) (Ce,La,Ca)4Mn(Ti,Fe)3(Fe,Ti)(Si2O7)2O8 M
STRONTIOCHEVKINITE (Sr,La,Ce,Ca)4Zr(Ti++++,Fe++,Fe+++)2Ti2O4(Si2O7)2 M
MAONIUPINGITE-(Ce) (Ca,Ce)4(Fe+++,Ti,Fe++,[])(Ti,Fe+++,Fe++,Nb)4Si4O22 M
STAVELOTITE-(La) La3Mn++3Cu++(Mn+++,Fe+++,Mn++++)26[Si2O7]6O30 R
BIRAITE-(Ce) (Fe++,Mg)(Ce,La,Nd)2(CO3)(Si2O7) M
ROWLANDITE-(Y) Y4Fe++Si4O14F2 am.
KARNASURTITE-(Ce) (Ce,La,Th)(Ti,Nb)(Al,Fe+++)(Si,P)2O7(OH)4.3H2O (?) H (?)
8/C.21 to 27 Structures with neso-[SiO4]-- and soro-[Si2O7]------
HARSTIGITE Ca6MnBe4(SiO4)2(Si2O7)2(OH)2 O
DELLAITE Ca6Si3O11(OH)2 M (?)
RUSTUMITE Ca10(Si2O7)2(SiO4)Cl2(OH)2 M
8/C.23- Epidote group
EPIDOTE Ca2Al2Fe+++[Si2O7][SiO4]O(OH) M
EPIDOTE-(Sr) CaSr(Al,Fe+++,Mn+++)3(Si2O7)(SiO4](OH) M
PIEMONTITE Ca2(Al,Mn+++,Fe+++)3Si3O11O(OH) M
PIEMONTITE-(Sr) CaSr(Al,Mn+++,Fe+++)3Si3O11O(OH) M
TWEDDILLITE CaSr(Mn+++,Fe+++)2Al(SiO4)(Si2O7)O(OH) M
PIEMONTITE-(Pb) CaPbAl2Mn+++[Si2O7][SiO4]O(OH) M
ALLANITE-(Y) Ca(Y,Ce,La)(Al,Fe++,Fe+++)3(SiO4)3(OH) M
ALLANITE-(La) Ca(La,REE,Ca)Al2(Fe2+,Fe3+)(SiO4)(Si2O7)O(OH) M
ALLANITE-(Ce) (Ce,Ca,Y)2(Al,Fe++,Fe+++)3(SiO4)3(OH) M
ALLANITE-(Nd) CaNdAl2Fe++(SiO4)(Si2O7)O(OH) M
FERRIALLANITE-(La) Ca(La,Ce,Th)(Fe+++,Al)(Al,Fe+++)(Fe++,Mn,Ti,Mg)(SiO4)(Si2O7)O(OH) M
FERRIALLANITE-(Ce) CaCeFe+++AlFe++[Si2O7][SiO4]O(OH) M
DISSAKISITE-(La) Ca(La,Ce,Th)(Mg,Fe++)(Al,Fe+++,Cr)2(SiO4)(Si2O7)O(OH) M
DISSAKISITE-(Ce) Ca(Ce,La)(Mg,Fe++)(Al,Fe+++)2(SiO4)3(OH) M
UEDAITE-(Ce) (Mn++,Ca,Fe++)(Ce,Nd)Fe++(Al,Fe+++)2(Si2O7)(SiO4)OOH M
ASKAGENITE-(Nd) Mn++NdAl2Fe+++(Si2O7)(SiO4)O2 M
MANGANIANDROSITE-(La) (Mn++,Ca)(La,Ce,Ca,Nd)AlMn+++Mn++(SiO4)(Si2O7)O(OH) M
MANGANIANDROSITE-(Ce) (Mn++,Ca)(Ce,La)Mn++(Mn+++,Fe+++)Al(SiO4)(Si2O7)O(OH) M
VANADOANDROSITE-(Ce) (Mn++,Ca)(Ce,La)Mn++(V+++,Mg,Al)Al(SiO4)(Si2O7)(O,F)(OH) M
KHRISTOVITE-(Ce) (Ca,REE)REE(Mg,Fe++)AlMn++Si3O11(OH)(F,O) M
VASTMANLANDITE-(Ce) (Ce,La)3CaAl2Mg2[Si2O7][SiO4]3F(OH)2 M
GATELITE-(Ce) Ca(Ce,Nd,La,Pr)3(Mg,Fe++,Al)(Al,Mg)3(SiO4)3(Si2O7)(O,F)(OH,O)2 M
PERBOEITE-(Ce) Ca(Ce,Nd,La)3Al3Fe++Si2O7[SiO4]3O(OH)2 M
ALNAPERBOEITE-(Ce) Na0,5Ca(Ce,Nd,La)2,5Al4Si2O7[SiO4]3O(OH)2 M
FERRIPERBOEITE-(La) (CaLa3)(Fe+++Al2Fe++)[Si2O7][SiO4]3O(OH)2 M
FERRIPERBOEITE-(Ce) (CaCe3)(Fe+++Al2Fe++)(Si2O7)(SiO4)3O(OH)2 M
ZOISITE Ca2Al3[Si2O7][SiO4]O(OH) O
8/C.24- Pumpellyite group
MACFALLITE Ca2Mn+++3(SiO4)(Si2O7)(OH)3 M
SURSASSITE Mn++2Al3(SiO4)(Si2O7)(OH)3 M
PUMPELLYITE-(Mg) Ca2MgAl2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Fe++) Ca2Fe++Al2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Mn++) Ca2(Mn++,Mg)(Al,Mn+++,Fe)2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Al) Ca2(Al,Fe++,Mg)Al2(SiO4)(Si2O7)(O,OH)2.H2O M
PUMPELLYITE-(Fe+++) Ca2(Fe+++,Mg,Fe++)(Al,Fe+++)2(SiO4)(Si2O7)(OH)2.H2O M
POPPIITE Ca2(V+++,Fe+++,Mg)(V+++,Al)2(SiO4)(Si2O7)(O,OH)3 M
JULGOLDITE-(Mg) Ca2(Mg,Fe++)(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
JULGOLDITE-(Fe++) Ca2Fe++(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
JULGOLDITE-(Fe+++) Ca2Fe+++(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
SHUISKITE Ca2(Mg,Al)(Cr,Al)2(SiO4)(Si2O7)(OH)2.H2O M
OKHOTSKITE-(Mn++) Ca2(Mn++,Mg)(Mn+++,Al,Fe+++)2Si3O10(OH)4 M
SAMFOWLERITE Ca28Mn++6Zn4(Be,Zn)4Be12(SiO4)12(Si2O7)8(OH)12 M
FLUORVESUVIANITE Ca19(Al,Mg,Fe++)13(SiO4)10(Si2O7)4(F,OH,O)10 Q
VESUVIANITE Ca10Mg2Al4(SiO4)5(Si2O7)2(OH)4 Q
MANAEVITE-(Ce) Ca11(Ce,H2O,Ca)8Mg(Al,Fe)4(Mg,Ti,Fe+++)8[Si2O7]4[(SiO4)8(H4O4)2](OH)9 Q
CYPRINE Ca19Cu++(Al10Mg2)Si18O68(OH)10 Q
WILUITE Ca19(Al,Mg,Fe,Ti)13(B,Al,[])5Si18O68(O,OH)10 Q
MANGANVESUVIANITE Ca19Mn+++(Al,Mn+++,Fe+++)10(Mg,Mn++)2Si18O69(OH)9 Q
MILANRIEDERITE Ca19Fe3+Al4(Mg4Al4)Si18O67(OH)11 Q
QUEITITE Pb4Zn2(SiO4)(Si2O7)(SO4) M
8/C.28 to 33 Sorosilicates with [Si3O10]--------
8/C.34 to 36 Other sorosilicates
KANNANITE Ca4Al4(MgAl)(VO4)(SiO4)2(Si3O10)(OH)6 Ca4Al4(MgAl)(VO4)(SiO4)2(Si3O10)(OH)6 O
ARDENNITE-(As) Mn4[Al4(AlMg)][Si5As]O22(OH)6 O
ARDENNITE-(V) Mn4[Al4(AlMg)][Si5V]O22(OH)6 O
CASSAGNAITE (Ca,Mn++)4(Fe+++,Mn+++,Al)4(V+++,Mg,Al)2(SiO4)2(Si3O10)(OH,O)8 O
MEDAITE (Mn,Ca)6(V+++++,As)Si5O18(OH) M
SCHEUCHZERITE Na(Mn,Mg,Zn)9V+++++Si9O28(OH)4 A
LAVOISIERITE Mn++8[Al10(Mn+++Mg)][Si11P]O44(OH)12 O
SANEROITE Na2(Mn++,Mn+++)10Si11VO34(OH)4 A
ALPEITE Ca4Mn+++2Al2(Mn+++Mg)(SiO4)2(Si3O10)(VO4)(OH)6 O
ORIENTITE Ca2Mn++Mn+++2Si3O10(OH)4 O
HUBEITE Ca2Mn++Fe+++Si4O12(OH).2H2O A
AKATOREITE (Mn++,Fe++)9Al2Si8O24(OH)8 A
BRACCOITE NaMn++5[Si5O14(OH)](AsO3)(OH) A
ZUNYITE Al13Si5O20(OH,F)18Cl C
8/D. Unclassified silicates
8/D.02 to 11 Small cations: Mg, Fe, Mn, Cu
AJOITE (K,Na)Cu++7AlSi9O24(OH)6.3H2O A
AERINITE (Ca5,1Na0,5)(Fe+++AlFe++1,7Mg0,3)(Al5,1Mg0,7)[Si12O36(OH)12H].[(CO3)1,2(H2O)12] H
ALMBOSITE Fe++5Fe+++4V+++++4Si3O27 (?)
KURUMSAKITE (Zn,Ni,Cu)8Al8V2Si5O35.27H2O (?) O (?)
8/D.12 to 22 Large cations: Na, K, Ca, Sr, Pb
TIETTAITE (Na,K)17Fe+++TiSi16O29(OH)30.2H2O O
JUANITE Ca10Mg4Al2Si11O39.4H2O (?) O (?)
JENNITE Ca9[Si6O18(OH)6].8H2O A
OYELITE Ca10B2Si8O29.12H2O O
WAWAYANDAITE Ca12Mn++4B2Be18Si12O46(OH,Cl)30 M
CREASEYITE Pb2Cu2Fe+++2Si5O17.6H2O O
8/E. Cyclosilicates: SiO3 rings, Si:O = 1:3
8/E.01 to 05 Three tetrahedrons rings [Si3O9]6-
BOBTRAILLITE (Na,Ca)13Sr11(Zr,Y,Nb)14Si42B6O132(OH)12.12H2O R
ROGERMITCHELLITE Na12(Sr,Na)24Ba4Zr26Si78(B,Si)12O246(OH)24.18H2O R ps H
ROEBLINGITE Pb2Ca6Mn++(Si6O18)2(SO4)2(OH)2.4H2O M
JONESITE Ba4(K,Na)2Ti4Al2Si10O36.6H2O O
DIVERSILITE-(Ce) Na2(Ba,K)6CeFe++2Ti3[Si3O9]3[SiO3OH]3.9(OH,H2O) R
8/E.06 to 08 Four tetrahedrons rings [Si4O12]8-
8/E.06- Axinite group
AXINITE-(Mg) Ca2MgAl2BO3Si4O12(OH) A
AXINITE-(Fe) Ca2Fe++Al2BO3Si4O12(OH) A
AXINITE-(Mn) Ca2Mn++Al2BO3Si4O12(OH) A
TINZENITE Ca2Mn++4Al4[B2Si8O30](OH)2 A
BOBMEYERITE Pb4(Al3Cu)(Si4O12)(S0,5Si0,5O4)(OH)7Cl(H2O)3 O
8/E.07- Labuntsovite Group
TSEPINITE-Na Na(Na,H3O,K,Sr,Ba)12-xTi8(Si4O12)4(OH,O)8.nH2O (x=0-6, n=12-16) M
TSEPINITE-K (K,Ba,Na)4(Ti,Nb)4(Si4O12)2(OH,O)4.6H2O M
TSEPINITE-Ca (Ca,K,Na)4(Ti,Nb)4(Si4O12)2(OH,O)4.8H2O M
TSEPINITE-Sr (Sr,Ba,K)2-x(Ti,Nb)4(Si4O12)(OH,O)2.5-6H2O M
PARATSEPINITE-Ba (Ba,Na,K)2-x(Ti,Nb)2(Si4O12)(OH,O)2.4H2O M
PARATSEPINITE-Na Na(NaSrKCa)7(TiNb)8(Si4O12)4(O,OH)8.H2O M
VUORIYARVITE-K (K,Na)12-xNb8(Si4O12)4(O)8.nH2O (x=0-6, n=12-16) M
KUZMENKOITE-Zn K2Zn(Ti,Nb)4(Si4O12)2(OH,O)4.6-8H2O M
KUZMENKOITE-Mn K4Mn2Ti8(Si4O12)4(OH)8.nH2O (n=10-12) M
GJERDINGENITE-Fe K2(Fe++,Mn++)(Nb,Ti)4(Si4O12)2(O,OH)4.7-8H2O M ps O
GJERDINGENITE-Mn (K,Na)2(Mn++,Fe++)(Nb,Ti)4(Si4O12)2(O,OH)4.6H2O M ps O
GJERDINGENITE-Na (K,Na,Sr)2Na(Nb,Ti)4(Si4O12)2(O,OH)2.5H2O M
GJERDINGENITE-Ca (K,Na,Sr)2Ca(Nb,Ti)4(Si4O12)2(O,OH)2.6H2O M
BUROVAITE-Ca (K,Na)4Ca2(Ti,Nb)8[Si4O12]4(OH,O)8.12H2O M
KARUPMOLLERITE-Ca (Na,Ca,K)2Ca2(Nb,Ti)4(Si4O12)2(O,OH)4.7H2O M
LEMMLEINITE-K Na4K4K4Ti8(Si4O12)4(O,OH)8.8H2O M ps O
LEMMLEINITE-Ba Na4K4Ba2+xTi8(Si4O12)4(O,OH)8.8H2O M
PARALABUNTSOVITE-Mg Na8K8Mg4Ti16(Si4O12)8(O,OH)8.nH2O (n=20-24) M
LABUNTSOVITE-Mg Na4K4Mg2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
LABUNTSOVITE-Fe Na4K4Fe2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
LABUNTSOVITE-Mn Na4K4Mn2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
PARAKUZMENKOITE-Fe (K,Ba)8Fe4Ti16(Si4O12)8(OH,O)16.nH2O (n=20-28) M
ORGANOVAITE-Zn K8Zn4Nb16(Si4O12)8O16.nH2O (n=20-28) M
ORGANOVAITE-Mn K8Mn4Nb16(Si4O12)8O16.nH2O (n=20-28) M
GUTKOVAITE-Mn CaK2Mn(Ti,Nb)4(Si4O12)2(O,OH)4.5H2O M
NESKEVAARAITE-Fe K3Na2Fe++(Ti,Nb)4(Si4O12)2(O,OH)4.5-6H2O M
ALSAKHAROVITE-Zn (Na,Ca)Sr(K,Ba)Zn(Ti,Nb)4(Si4O12)2(O,OH)4.7H2O M
LEPKHENELMITE-Zn (Ba,K)2Zn(Ti,Nb)4Si8O24(O,OH)4.7H2O M
8/E.08- Joaquinite group
BAOTITE Ba4(Ti,Nb)8Si4O28Cl Q
CERCHIARAITE-(Al) Ba4(Al,Fe+++)4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl Q
CERCHIARAITE-(Fe) Ba4(Fe+++,Al)4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl Q
CERCHIARAITE-(Mn) Ba4(Mn+++,Fe+++,Al)4(Si6O18)(OH)7Cl Q
TITANTARAMELLITE Ba4(Ti,Fe+++,Fe++,Mg)4(B2Si8O27)O2Clx O
TARAMELLITE Ba4(Fe+++,Ti,Fe++,Mg)4(B2Si8O27)O2Clx O
JOAQUINITE-(Ce) Ba2NaCe2Fe++(Ti,Nb)2Si8O26(OH,F).H2O M
BYELORUSSITE-(Ce) NaMn++Ba2(Ce,La)2Ti2Si8O26(F,OH).H2O O
ORTHOJOAQUINITE-(La) Ba2Na(La,Ce)2Fe++(Ti,Nb)2Si8O26(O,OH,F).H2O O
8/E.09 to 10 Double rings of four tetrahedrons [Si8O20]8-
KAINOSITE-(Y) Ca2(Y,Ce)2Si4O12(CO3).H2O O
PHOSINAITE-(Ce) Na13Ca2(Ce,La,Th,Nd,Pr)(Si4O12)(PO4)4 O
IRAQITE-(La) K(La,Ce,Th)2(Ca,Na)4(Si,Al)16O40 Q
STEACYITE Th(Ca,Na)2K1-xSi8O20 Q
TURKESTANITE Th(Ca,Na)2(K1-x[]x)Si8O20.nH2O Q
ARAPOVITE (U,Th)(Ca,Na)2(K1-x[]x)Si8O20.H2O (x=0,5) Q
8/E.11- Combination of four-membered rings and pairs
HYALOTEKITE (Ba,Pb,Ca,K)6(B,Si,Al)2(Si,Be)10O28(F,Cl) A ps M
KAPITSAITE-(Y) (Ba,K,Pb++)4(Y,Ca,Na)2Si8(B,Si)4O28F A ps Q
8/E.12 to 21 Six-membered rings [Si6O18]12-
BERYL Be3Al2Si6O18 H
BAZZITE Be3(Sc,Al)2Si6O18 H
STOPPANIITE (Fe,Al,Mg)4(Be6Si12O36)(H2O)2(Na,[]) H
GERENITE-(Y) (Ca,Na)2(Y,REE)3(Si6O18).2H2O A
BARATOVITE KCa7(Ti,Zr)2Li3Si12O36F2 M ps H
8/E.16- Lovozerite group
IMANDRITE Na6Ca1,5Fe+++Si6O18 O
KAPUSTINITE Na5(Na,Mn++)Zr(Si6O16)(OH)2 M
LITVINSKITE Na2([],Na,Mn++)ZrSi6O12(O,OH)6 M
KOASHVITE Na6(Ca,Mn)(Ti,Fe)Si6O18.H2O O
TISINALITE Na3H3(Mn++,Ca,Fe)TiSi6(O,OH)18.2H2O R
ABENAKIITE-(Ce) Na26(Ce,Nd,La,Pr,Th,Sm)6(SiO3)6(PO4)6(CO3)6(S++++O2)O R
STEENSTRUPINE-(Ce) Na14Mn++2(Fe+++,Mn+++)2Ce6(Zr,Th)(Si6O18)2(PO4)6(HPO4)(OH)2.2H2O R
8/E.19- Tourmaline group
OXYROSSMANITE [](LiAl2)Al6(Si6O18)(BO3)3(OH)3O R
ROSSMANITE [](LiAl2)Al6(Si6O18)(BO3)3(OH)3OH R
FLUORELBAITE Na(Li1,5Al1,5)Al6(Si6O18)(BO3)3(OH)3F R
ELBAITE Na(Li1,5Al1,5)Al6(Si6O18)(BO3)3(OH)3OH R
MAGNESIOFOITITE [](Mg2Al)Al6(Si6O18)(BO3)3(OH)3OH R ps H
MARUYAMAITE K(MgAl2)(Al5Mg)(BO3)3(Si6O18)(OH)3O R ps H
OXYDRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3FNa(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O R
DRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3OH R
FOITITE [](Fe++2Al)Al6(Si6O18)(BO3)3(OH)3OH R
OXYFOITITE [](Fe++Al2)Al6(Si6O18)(BO3)3(OH)3O R
OXYSCHORL Na(Fe++Al)3Al6(Si6O18)(BO3)3(OH)3O R
FLUORSCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3F R
SCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3OH R
OLENITE NaAl3Al6(Si6O18)(BO3)3(O3)OH R
LUINAITE-(OH) (Na,[](Fe++,Mg)3Al6(BO3)3Si6O18(OH)4 R
BOSIITE NaFe+++3(Al4Mg2)(Si6O18)(BO3)3(OH)3O R
POVONDRAITE NaFe+++3(Fe+++4Mg2)(Si6O18)(BO3)3(OH)3O R
FLUORUVITE CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F R
FERUVITE CaFe++3(Al5Mg)(Si6O18)(BO3)3(OH)3OH R
LUCCHESIITE CaFe++3Al6(Si6O18)(BO3)3(OH)3O R
ADACHIITE CaFe++3Al6(Si5AlO18)(BO3)3(OH)3(OH) R
ODINTSOVITE K2(Na,Li)4Ca3Ti2Be4Si12O38 O
TIENSHANITE KNa3(Na,K,[])6(Ca,Y,REE)2Ba6(Mn++,Fe++,Zn,Ti)6(Ti,Nb)6Si36B12O114[O5,5(OH,F)3,5]F2 H
VERPLANCKITE Ba2(Mn,Fe++,Ti)Si2O6(O,OH,Cl,F)2.3H2O H
8/E.22- Double six-membered rings [Si12O30]12- Milarite-osumilite group
MILARITE KCa2AlBe2Si12O30.0,5H2O H
OFTEDALITE (Sc,Ca,Mn++)2K(Be,Al)3Si12O30 H
FRIEDRICHBECKEITE K([]0,5Na0,5)2(Mg0,8Mn0,1Fe0,1)2(Be0,6Mg0,4)3[Si12O30] H
ALMARUDITE (K,Na)(Mn++,Fe++,Mg)2(Be,Al)3(Si12O30) H
TRATTNERITE (Mg,Fe++)3Fe+++2(Si12O30) H
ROEDDERITE (Na,K)2(Mg,Fe++)5Si12O30 H
CHAYESITE K(Mg,Fe++)4Fe+++Si12O30 H
MERRIHUEITE (K,Na)2(Fe++,Mg)5Si12O30 H
KLOCHITE ([]1Na1)KFe2Zn3(Si12O30) H
YAGIITE (Na,K)1,5Mg2(Al,Mg)3(Si,Al)12O30 H
OSUMILITE-(Mg) KMg2Al3(Al2Si10)O30 H
OSUMILITE (K,Na)(Fe++,Mg)2(Al,Fe+++)3(Si,Al)12O30 H
LIPUITE KNa8Mn+++5Mg0,5[Si12O30(OH)4](PO4)O2(OH)2.4H2O O
EMELEUSITE Na4Li2Fe+++2Si12O30 O ps H
SUGILITE KNa2(Fe++,Mn++,Al)2Li3Si12O30 H
SOGDIANITE (Zr,Ti++++,Fe+++,Al)2([],Na)2K[Li3Si12O30] H
DARAPIOSITE NaxK(Li,Zn,Fe++)2(Mn,Zr,Y)2(Si12O30) (x = less than 2) H
DUSMATOVITE K(K,Na,[])(Mn++,Y,Zr)2(Zn,Li)3Si12O30 H
SHIBKOVITE K(Ca,Mn,Na)2(K2-x[]x)2Zn3Si12O30 H
FAIZIEVITE K2Li6Na(Ca6Na)Ti4[Si6O18]2[Si12O30]F2 A
8/E.23- Eight-membered rings
MUIRITE Ba10Ca2MnTiSi10O30(OH,Cl,F)10 Q
8/E.24- Nine-membered rings
8/E.25- Nine-membered rings. Eudialyte group.
AQUALITE (H3O)8(Na,K,Sr)5Ca6Zr3Si26O66(OH)9Cl R
ILYUKHINITE (H3O,Na)14Ca6Mn2Zr3Si26O72(OH)2.3H2O R
FENGCHENGITE Na12[]3(Ca,Sr)6Fe+++3Zr3Si(Si25O73)(H2O,OH)3(OH,Cl)2 R
EUDIALYTE Na15Ca6(Fe++,Mn)3Zr3(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
IKRANITE (Na,H3O)15(Ca,Mn,REE)6Fe+++2Zr3([],Zr)([],Si)Si24O66(O,OH)6Cl.nH2O R
RASLAKITE Na15Ca3Fe3(Na,Zr)3Zr3Nb0,5(Si3O9)2(Si9O27)2(SiO)(Cl,OH).3(OH,H2O) R
KENTBROOKSITE (Na,REE)15(Ca,REE)6(Mn++,Fe++)3Zr3Nb(Si25O73)(O,OH,H2O)3(F,Cl)2 R
CARBOKENTBROOKSITE (Na,[])12(Na,Ce)3Ca6Mn3Zr3Nb(Si25O73)(OH)3(CO3).H2O R
ANDRIANOVITE Na12(K,Sr,Ce)3Ca6Mn3Zr3Nb(Si25O73)(O,H2O,OH)5 R
VORONKOVITE Na15(Na,Ca,Ce)3(Mn,Ca)3Fe3Zr3Si26O72(OH,O)4Cl.H2O R
ONEILLITE Na15Ca3Mn3Fe3Zr3Nb(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
DAVINCIITE Na12K3Ca6Fe++3Zr3(Si26O73OH)Cl2 R
MOGOVIDITE Na9(Ca,Na)5Ca6Zr3Fe2(Si,Nb)[(OH,H2O)3|Cl0,3|CO3|(Si3O9)2(Si9O27)2] R
GOLYSHEVITE [Na10Ca3]Ca6Zr3Fe2SiNb[(OH)3|CO3|(Si3O9)2|(Si9O27)2].H2O R
FEKLICHEVITE Na11Ca9(Fe+++,Fe++)2Zr3Nb[Si25O73](OH,H2O,Cl,O)5 R
SIUDAITE Na8(Mn++2Na)Ca6(Fe+++,Mn++)3Zr3NbSi24(Si,[],Ti)O74(OH)2Cl.5H2O R
ZIRSILITE-(Ce) Na11-12Ca6(Ce,Na)3Mn3Zr3Nb(CO3)2(Si3O9)4(Si9O27)2(SiO)(OH)6.H2O R
JOHNSENITE-(Ce) Na12(Ce,La,Sr,Ca,M)3Ca6Mn3Zr3W(Si25O73)(CO3)(OH,Cl)2 R
TASEQITE Na12Sr3Ca6Fe3Zr3NbSi25O73(O,OH,H2O)3Cl2 R
KHOMYAKOVITE Na12Sr3Ca6Fe++3Zr3W(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
ALLUAIVITE Na19(Ca,Mn++)6(Ti,Nb)3(Si3O9)2(Si10O28)2Cl.2H2O R
RASTSVETAEVITE Na27K8Ca12Fe3Zr6Si4[Si3O9]4[Si9O27]4(O,OH,H2O)6Cl2 R
DUALITE Na30(Ca,Na,Ce,Sr)12(Na,Mn,Fe,Ti)6Zr3Ti3MnSi51O144(OH,H2O,Cl)9 R
LABYRINTHITE (Na,K,Sr)35Ca12Fe3Zr6TiSi51O144(O,OH,H2O)9Cl3 R
8/E.26- Twelve-membered and larger rings
TRASKITE Ba9Fe++2Ti2(SiO3)12(OH,Cl,F)6.6H2O H
8/F. Inosilicates: chains and ribbons, Si:O=1:3 or 4:11
8/F.01 to 06 Infinite single chains [Si2O6]----
8/F.01 to- 02 Pyroxenes group
KANOITE (Mn++,Mg)2Si2O6 M
PIGEONITE (Mg,Fe++,Ca)(Mg,Fe++)Si2O6 M
PETEDUNNITE Ca(Zn,Mn++,Fe++,Mg)Si2O6 M
AUGITE (Ca,Na)(Mg,Fe,Al,Ti)(Si,Al)2O6 M
OMPHACITE (Ca,Na)(Mg,Fe++,Fe+++,Al)Si2O6 M
JADEITE Na(Al,Fe+++)Si2O6 M
JERVISITE (Na,Ca,Fe++)(Sc,Mg,Fe++)Si2O6 M
NATALYITE Na(V+++,Cr+++)Si2O6 M
8/F.01- Clinopyroxenes
8/F.02- Orthopyroxenes
ELISEEVITE Na1,5Li[Ti2Si4O12,5(OH)1,5].2H2O M
VINOGRADOVITE Na8Ti8O8(Si2O6)4[(Si3Al)O10]2[(H2O),(Na,K)2] M
LAVINSKYITE-1M K(LiCu)Cu6(Si4 O11)2(OH)4 M
8/F.07 to 13 Infinite double bands [Si4O11]6-
8/F.07 to- 12 Amphibole group
GRUNERITE []Fe++7Si8O22(OH)2 M
8/F.07- Amphibole with Mg, Fe, Mn
8/F.08- Alcali amphiboles
GLAUCOPHANE []Na2(Mg3Al2)Si8O22(OH)2 M
RIEBECKITE []Na2(Fe++3Fe+++2)Si8O22(OH)2 M
NYBOITE NaNa2(Mg3Al2)Si7AlO22(OH)2 M
FLUORONYBOITE Na(Na,Ca)2(Mg,Fe++)3(Al,Mg,Fe+++)2Si7AlO22(F,OH)2 M
FERRICNYBOITE (?) NaNa2(Mg3Fe+++2)Si7AlO22(OH)2 (?) M
FERRONYBOITE (?) NaNa2(Fe++3Al2)Si7AlO22(OH)2 (?) M
FERRICFERRONYBOITE (?) NaNa2(Fe++3Fe+++2)Si7AlO22(OH)2 (?) M
FERROFERRINYBOITE NaNa2(Fe++3 Fe+++2)(Si7Al)O22(OH)2 M
FERRIPEDRIZITE NaLi3(Mg,Fe++)2Fe+++2Si8O22(OH,F)2 M
PEDRIZITE Li2(Li,MgFe++Al)5(Si,Al)8O22(OH,F)2 M
SODICPEDRIZITE (?) NaLi2(LiMg2Fe+++Al)(Si8O22)(OH,F)2 M
OTTOLINIITE []Na,Li(Mg3Fe+++Al)(Si8O22)(OH)2 M
FERRIOTTOLINIITE Na0,5(Na,Li)2Li0,5(Mg,Fe++,Zn)3Fe+++2(Si8O22)(OH,F)2 M
FERROOTTOLINIITE (?) []NaLi(Fe++3Fe+++Al)Si8O22(OH)2 M
WHITTAKERITE Na(NaLi)(Mg2AlFe+++Li)(Si8O22)(OH)2 M
FERROWHITTAKERITE (?) Na(NaLi)2(Fe++2AlFe+++Li)(Si8O22)(OH)2 M
LEAKEITE NaNa2(Mg2Fe+++2Li)Si8O22(OH)2 M
FERROLEAKEITE (?) NaNa2(Fe++2Fe+++2Li)Si8O22(OH)2 (?) M
KORNITE (Na,K)Na2(Mg2Mn+++2Li)Si8O22(OH)2 M
UNGARETTIITE NaNa2(Mn++2Mn+++3)Si8O22O2 M
OBERTIITE NaNa2(Mg3Fe+++Ti++++)Si8O22O2 M
FERRIOBERTIITE Na(Na2)(Mg3Fe+++Ti)(Si8O22)O2 M
ARFVEDSONITE NaNa2(Fe++,Mg)4Fe+++Si8O22(OH)2 M
KOZULITE NaNa2Mn++4(Fe+++,Al)Si8O22(OH)2 M
8/F.09- Na, Ca Amphiboles
KATOPHORITE Na(CaNa)Fe++4(Al,Fe+++)Si7AlO22(OH)2 M
FERRIKATOPHORITE (?) Na2Ca(Fe++,Mg)4Fe+++(Si7Al)O22(OH)2 (?) M
ALUMINOTARAMITE Na2Ca(Fe++,Mg)3Al2(AlSi3O11)2(OH)2 M
POTASSICALUMINOTARAMITE (K,Na)2(Ca,Na)(Fe++,Mg)3(Al,Fe+++)2(AlSi3O11)2(OH)2 M
TARAMITE Na(CaNa)Fe++3AlFe+++Si6Al2O22(OH)2 M
FERRITARAMITE (?) Na(CaNa)Fe++3Fe+++2Si6Al2O22(OH)2 (?) M
PARVOWINCHITE Na(Na,Mn++)2Mg4Fe+++Si8O22(OH,F)2 M
WINCHITE [](CaNa)Mg4(Al,Fe+++)Si8O22(OH)2 M
FERROWINCHITE (?) [](CaNa)Fe++4(Al,Fe+++)Si8O22(OH)2 M
FERRIWINCHITE []NaCa(Mg,Fe++)4Fe+++Si8O22(OH)2 M
ALUMINOBARROISITE (?) [](CaNa)Mg3Al2Si7AlO22(OH)2 (?) M
BARROISITE [](CaNa)Mg3AlFe+++Si7AlO22(OH)2 M
FERRIFERROBARROISITE (?) [](CaNa)Fe++3Fe+++2Si7AlO22(OH)2 (?) M
8/F.10- Ca2 amphiboles
PARVOMANGANOTREMOLITE Nax(CaMn++)2Mg5Si8O22(OH)2 (x = less than 0,5) M
ACTINOLITE []Ca2(Mg,Fe++)5Si8O22(OH)2 M
FERROHORNBLENDE []Ca2[Fe++4(Al,Fe+++)]Si7AlO22(OH)2 M
ALUMINOTSCHERMAKITE (?) []Ca2(Mg3Al2)Si6Al2O22(OH)2 (?) M
TSCHERMAKITE []Ca2(Mg3AlFe+++)Si6Al2O22(OH)2 M
FERRITSCHERMAKITE (?) []Ca2(Mg3Fe+++2)Si6Al2O22(OH)2 (?) M
FERRIFERROTSCHERMAKITE (?) []Ca2(Fe++3Fe+++2)Si6Al2O22(OH)2 (?) M
EDENITE NaCa2(Mg,Fe++)5(Si7Al)O22(OH)2 M
CANNILLOITE (?) CaCa2(Mg4Al)Si5Al3O22(OH)2 (?) M
PARGASITE NaCa2(Mg4Al)Si6Al2O22(OH)2 M
POTASSICPARGASITE (K,Na)Ca2(Mg,Fe++,Al,Fe+++)5(Si,Al)8O22(OH,F)2 M
HASTINGSITE NaCa2(Fe++4Fe+++)Si6Al2O22(OH)2 M
POTASSICSADANAGAITE (K,Na)Ca2[Fe++3(Al,Fe+++)2]Si5Al3O22(OH)2 M
MAGNESIOSADANAGAITE NaCa2Mg3(Al,Fe++,Ti)2(Al,Si)4(Si2O11)2(OH)2 M
SADANAGAITE NaCa2[Fe++3(Al,Fe+++)2]Si5Al3O22(OH)2 (?) M
8/F.11- Pb, Ca amphiboles
JOESMITHITE PbCa2(Mg,Fe++,Fe+++)5Si6Be2O22(OH)2 M
8/F.12- Orthorhombic amphiboles
GEDRITE [](Mg,Fe++)5Al2Si6Al2O22(OH)2 O
FERROGEDRITE [](Fe++,Mg)5Al2Si6Al2O22(OH)2 O
PROTOFERROSUENOITE (Mn++,Fe++)2(Fe++,Mg)5(Si4O11)2(OH)2 O
8/F.14 to 17 Modified double bands
8/F.14- Aenigmatite group
AENIGMATITE Na2Fe++5Ti++++Si6O20 A
HOGTUVAITE (Ca,Na)2(Fe++,Fe+++,Ti,Mg,Sn,Mn)6(Si,Be,Al)6O20 A
DORRITE Ca2Mg2Fe+++4Si2Al4O20 A
RHONITE Ca2(Mg,Fe++)4Fe+++Ti++++Si3Al3O20 A
KURATITE Ca2(Fe++5Ti)O2[Si4Al2O18] A
SERENDIBITE Ca2Mg3Al3Si3Al1,5B1,5O20 A
WELSHITE Ca4Mg9Sb+++++3Be3Si6(Fe+++,Al)3O20 A
SAPPHIRINE (-1A,-2A,-2M,-4M,-5A) (Mg,Al)8(Al,Si)6O20 M/A
KHMARALITE Mg5,5Al14Fe2Si5Be1,5O40 M
SURINAMITE (Mg,Fe+++)3(Al,Fe+++)3BeSi3O16 M
MESAITE CaMn++5(V2O7)3.12H2O M
DEERITE (Fe++,Mn)6(Fe+++,Al)3Si6O20(OH)5 M ps O
HOWIEITE Na(Fe++,Mn)10(Fe+++,Al)2Si12O31(OH)13 A
TANEYAMALITE Na(Mn++,Mg,Fe++)12Si12(O,OH)44 A
JOHNINNESITE Na2Mn++9(Mg,Mn++)7(OH)8(AsO4)2(Si6O17)2 A
8/F.18 to 20 Three chains [Si3O9]6-
WOLLASTONITE (1A, 1T, 2M, 3A, 4A, 5A, 7A, 7T polytypes) CaSiO3 M/A
VISTEPITE (Mn++,Ca)4Sn++++B2(SiO7)(Si3O9)(OH)2 A
SCHIZOLITE NaCaMnSi3O8(OH) 8/F.18-078
CHESTERITE (Mg,Fe++)17Si20O54(OH)6 O
TOBERMORITE [Ca4Si6O17.2H2O].(Ca.3H2O) O
WHELANITE Cu2Ca6[Si6O17(OH)](CO3)(OH)3(H2O)2 O
8/F.21 to 23 Three bands [Si6O15]6-, [Si6O17]10- and modified
ZORITE Na2Ti(Si,Al)3O9.nH2O O
HAINEAULTITE (Na,Ca)5Ca(Ti,Nb)5(Si12O34)(OH,F)4.5H2O O
ESCHEITE Ca2NaMnTi5[Si12O34]O2(OH)3.12H2O O
CHIVRUAIITE Ca4(Ti,Nb)5[(Si6O17)2[(OH,O)5].13-14H2O O
TINAKSITE K2Na(Ca,Fe++,Mn++,Mg)2(Ti,Fe)Si7O19(OH) A
8/F.24 to 26 Four chains [Si4O12]8-
BALANGEROITE (Mg,Fe+++,Fe++,Mn++)42Si16O54(OH)40 M
GAGEITE (-1A,-2M) (Mn,Mg,Zn)42Si16O54(OH)40 M/A
BATISITE (Ba,K,Na)3Ti2Si4O14 O
TAIKANITE (Ba,Sr)2Mn+++2Si4O12 M
OHMILITE Sr3(Ti,Fe+++)(Si2O6)2(O,OH).2-3H2O M
HARADAITE Sr2V++++2O2(Si4O12) O
8/F.27- Five chains [Si5O15]10-
RHODONITE (Mn++,Fe++,Mg,Ca)SiO3 A
BABINGTONITE Ca2(Fe++,Mn)Fe+++Si5O14(OH) A
NAMBULITE (Li,Na)(Mn,Ca)4Si5O14(OH) A
INESITE Ca2Mn7Si10O28(OH)2.5H2O A
8/F.28 to 30 Six chains [Si6O18]12- and six bands [Si12O30]12-
PYATENKOITE-(Y) Na5(Y,Dy,Gd)(Ti,Nb)Si6O18.6H2O R
SAZYKINAITE-(Y) (Na,K)5Y(Zr,Ti)Si6018.6H2O R
TUHUALITE (Na,K)Fe++Fe+++Si6O15 O
PELLYITE Ba2Ca(Fe++,Mg)2Si6O17 O
8/F.31- Seven chains [Si7O21]14-
PLUMALSITE (?) Pb4Al2(SiO3)7 (?) O
8/F.32- Twelve chains [Si12O36]24-
8/F.33- Chains and pairs combinations
STRAKHOVITE NaBa3(Mn++,Mn+++)4Si6O19(OH)3 M
8/F.34 to 38 Complex chain structures (cylinders, etc)
NARSARSUKITE Na2(Ti,Fe+++)Si4(O,F)11 Q
PENKVILKSITE Na4(Ti++++,Zr)Si8O22.4H2O M
YUKSPORITE K4(Sr,Ba)2(Ca,Na)14(Mn,Fe)0.5(Ti,Nb)4(Si2O7)3(Si6O17)2(O,OH)4.3(OH,H2O) M
CHAROITE (K,Sr,Ba,Mn)15-16(Ca,Na)32[(Si70(O,OH)180)](OH,F)4.nH2O M
EVESLOGITE (Ca,K,Na,Sr,Ba)48[(Ti,Nb,Fe,Mn)12(OH)12Si48O144](F,OH,Cl)14 M
CAYSICHITE-(Y) Y4(Ca3REE)(OH)(H2O)5(Si8O20)(CO3)6.2H2O O
HELLANDITE-(Yb) (Ca,Y)4(Yb,Y)2(Al,Fe+++,Ti++++)(Be,Li)2B4Si4O22(O,F,OH)2 (?) M
HELLANDITE-(Y) (Ca3REE)4Y2Al[]2[Si4B4O22](OH)2 M
HELLANDITE-(Gd) (Ca,Y)4(Gd,Y)2(Al,Fe+++,Ti++++)(Be,Li)2B4Si4O22(O,F,OH)2 (?) M
HELLANDITE-(Ce) (Ca3REE)4Ce2Al[]2[Si4B4O22](OH)2 M
TADZHIKITE-(Ce) Ca4Ce2Ti[]2[Si4B4O22](OH)2 M
ASHCROFTINE-(Y) K5Na5(Y,Ca)12Si28O70(OH)2(CO3)8.8H2O Q
MOTTANAITE-(Ce) Ca4Ce2Al(Be1,5[]0,5)[B4Si4O22]O2 M
FERRIMOTTANAITE-(Ce) Ca4Ce2Fe+++(Be1,5[]0,5)[Si4B4O22]O2 M
CIPRIANIITE Ca4[(Th,U)Ca]2Al(Be0,5[]1,5)[B4Si4O22](OH)2 M
PIERGORITE-(Ce) Ca8Ce2(Al0,5Fe3+++0,5)([],Li,Be)2Si6B8O36(OH,F)2 M
NEPTUNITE KNa2Li(Fe++,Mn)2Ti2Si8O24 M
8/G. Transition inosilicates - phyllosilicates
BUSSYITE-(Ce) (Ce,REE)3(Na,H2O)6MnSi9Be5(O,OH)30F4 M
BUSSYITE-(Y) (Y,REE,Ca)3(Na,Ca)6MnSi9Be5(O,OH,F)34 M
SEMENOVITE-(Ce) (Ca,Ce,La,Na)10-12(Fe++,Mn)(Si,Be)20(O,OH,F)48 O
NORDITE-(La) Na3SrLaZnSi6O17 O
NORDITE-(Ce) Na3SrCeZnSi6O17 O
FERRONORDITE-(La) Na3Sr(La,Ce)Fe++Si6O17 O
VLADYKINITE Na3Sr4(Fe++Fe+++)Si8O24 M
BOHSEITE Ca4Be3+xAl1-xSi9O25-x(OH)3+x (x=0-1) O
TVEDALITE (Ca,Mn++)4Be3Si6O17(OH)4.3H2O O
RUDENKOITE Sr3Al3(Si,Al)4O10(OH,O)8Cl2.H2O M
CHIAPPINOITE-(Y) (Y,Ce)2(Mn++,Ca)(Si3O7)4 O
PERETTIITE-(Y) Y+++2Mn++4Fe++[Si2B8O24] O?
LEMOYNITE (Na,K)2CaZr2Si10O26.5-6H2O M
LOUDOUNITE NaCa5Zr4Si16O40(OH)11.8H2O (?)
8/G.12- Astrophyllite group
NALIVKINITE Li2Na(Fe++,Mn++)7Ti2Si8O26(OH)4F A
BULGAKITE Li2(Ca,Na)Fe++7Ti2(Si4O12)2O2(OH)4(F,O)(H2O)2 A
LOBANOVITE K2Na2(Fe++,Fe+++,Mn)4Mg2Ti2Si8O26(OH)4 M
TARBAGATAITE (K,[])2(Ca,Na)(Fe++,Mn)7Ti2(Si4O12)2O2(OH)4(OH,F) A
KUPLETSKITE K2Na(Mn,Fe++)7(Ti,Nb)2Si8O26(OH)4F A
KUPLETSKITE-(Cs) (Cs,K)2Na(Mn,Fe,Li)7(Ti,Nb)2Si8O26(OH)4F A
NIOBOKUPLETSKITE K2Na(Mn++,Zn,Fe++)7(Nb,Zr,Ti)2Si8O26(OH)4(O,F) A
ZIRCOPHYLLITE K2(Na,Ca)(Fe++,Mn)7(Zr,Nb)2Si8O26(OH)4F A
NIOBOPHYLLITE K2Na(Mn,Fe++)7(Nb,Ti)2Si8O26(OH)4(F,O) A
SVEINBERGITE Ca(Fe++6Fe+++)Ti2(Si4O12)2O2(OH)5(H2O)4 A
DEVITOITE [Ba6(PO4)2(CO3)][Fe++7(OH)4Fe+++2O2(SiO3)8] A
NAFERTISITE Na3Fe++10Ti2(Si6O17)2O2(OH)6F(H2O)2 M
CARYOCHROITE (Na,Sr,Ca,Mn,K)3(Fe+++,Mg,Mn,Fe++)10Ti2Si12O37(H2O,O,OH)17 M
VEBLENITE KNa(Fe++5Fe+++4Mn7)Nb4(Si2O7)2(Si8O22)2O6(OH)10(H2O)3 A
8/H. Phyllosilicates: layers Si2O5, Si:O = 2:5
8/H.01 to 08 Tetragonal or pseudotetragonal layer structures [Si4O10]4-, etc.
WESSELSITE (Sr,Ba)Cu++(Si4O10) Q
FENAKSITE (K,Na,Ca)4(Fe++,Fe+++,Mn)2Si8O20(OH,F) A
ERSHOVITE Na4K3(Fe++,Mn++,Ti)2Si8O20(OH)4.4H2O A
LATIUMITE (Ca,K)8(Al,Mg,Fe)(Si,Al)10O25(SO4) M
TUSCANITE K(Ca,Na)6(Si,Al)10O22(SO4,CO3,(OH)2).H2O M
8/H.09 to 27 Mica-like phyllosilicates with [Si4O10] and related structures
MACAULAYITE (Fe+++,Al)24Si4O43(OH)2 M
TALC Mg3Si4O10(OH)2 M/A
KEGELITE Pb8Al4Si8(SO4)2(CO3)4(OH)8O20 M ps H
8/H.10 to 14 Mica group
CELADONITE KFe+++(Mg,Fe++)[]Si4O10(OH)2 M
MUSCOVITE KAl2[]AlSi3O10(OH)2 M ps H
GANTERITE (Ba,Na,K)(Al,Mg)2(Al,Si)AlSi3O10(OH)2 M
TOBELITE (NH4)Al2[]AlSi3O10(OH)2 M
8/H.10- Celadonite-Muscovite series
8/H.11- Lithionite-Biotite series
MONTDORITE KFe++1,5Mn++0,5Mg0,5[]0,5Si4O10F2 M
LUANSHIWEIITE KLiAl1,5(Si3,5Al0,5)O10(OH)2 M
ANNITE KFe++3AlSi3O10(OH)2 M
8/H.12- Brittle micas. Margarite series
ANANDITE (-2O) BaFe++3Fe+++Si3O10S(OH) M
BITYITE LiCaAl2(AlBeSi2O10)(OH)2 M
HANJIANGITE (1M, 2M, 3T) Ba2Ca(V+++Al)[Si3AlO10(OH)2]F(CO3)2 M
8/H.13- Interlayer-deficient micas
WONESITE Na0,5[]0,5Mg2,5Al0,5AlSi3O10(OH)2 M
BRAMMALLITE Na0,65Al2[]Al0,65Si3,35O10(OH)2 M
ILLITE K0,65Al2[]Al0,65Si3,35O10(OH)2 M
GLAUCONITE (K,Na)(Mg,Fe++,Fe+++)(Fe+++,Al)(Si,Al)4O10(OH)2 M
ERLIANITE (Fe++,Fe+++,Mg)24(Fe+++V)6Si36O90(OH,O)48 O
BANNISTERITE KCa(Mn,Fe++,Zn)21(Si,Al)32O76(OH)16.12H2O M
BARIUMBANNISTERITE (?) (K,H3O)(Ba,Ca)(Mn++,Fe++,Mg)21(Si,Al)32O80(O,OH)16.4-12H2O M
LENNILENAPEITE K6-7(Mg,Mn,Fe++,Fe+++,Zn)48(Si,Al)72(O,OH)216.16H2O A
STILPNOMELANE K(Fe++,Mg,Fe+++,Al)8(Si,Al)12(O,OH)27.2H2O M/A
FRANKLINPHILITE (K,Na)4(Mn++,Mg,Zn,Fe+++)48(Si,Al)72(O,OH)216.6H2O A ps H
PARSETTENSITE (K,Na,Ca)(Mn,Al)7Si8O20(OH)8.2H2O (?) M ps H
EGGLETONITE (Na,K,Ca)2(Mn,Fe)8(Si,Al)12O29(OH)7.11H2O M
TAMAITE (Ca,K,Ba,Na)3-4Mn++24(Si,Al)40(O,OH)112.21H2O M
GANOPHYLLITE (K,Na)2(Mn,Al,Mg)8(Si,Al)12O29(OH)7.8-9H2O M
EKMANITE (?) (Fe++,Mg,Mn,Fe+++)3(Si,Al)4O10(OH)2.2H2O (?) O
8/H.18 to 22 Clay minerals, regularly stratified
8/H.18 to- 20 Smectite - montmorillonite group
SALIOTITE Li0,5Na0,5Al3AlSi3O10(OH)5 M
KULKEITE Na0,35Mg8Al(AlSi7)O20(OH)10 M
ALIETTITE Ca0,2Mg6(Si,Al)8O20(OH)4.4H2O  
RECTORITE (Na,Ca)Al4(Si,Al)8O20(OH)4.2H2O M
TOSUDITE Na0,5(Al,Mg)6(Si,Al)8O18(OH)12.5H2O M (?)
CORRENSITE (Mg,Fe,Al)9(Si,Al)8O20(OH)10.nH2O O
BRINROBERTSITE Na0,3Al4(Si4O10)2(OH)4.3,5H2O M ps H
MONTMORILLONITE (Na,Ca)0,3(Al,Mg)2Si4O10(OH)2.nH2O M
BEIDELLITE (Na,Ca0,5)0,3Al2(Si,Al)4O10(OH)2.nH2O M
NONTRONITE Na0,3Fe+++2(Si,Al)4O10(OH)2.nH2O M
VOLKONSKOITE Ca0,3(Cr+++,Mg,Fe+++)2(Si,Al)4O10(OH)2.4H2O M
SWINEFORDITE (Ca,Na)0,3(Al,Li,Mg)2(Si,Al)4O10(OH,F)2.2H2O M
YAKHONTOVITE (Ca,Na)0,5(Cu++Fe++Mg)2Si4O10(OH)2.3H2O M
HECTORITE Na0,3(Mg,Li)3Si4O10(F,OH)2 M
SAPONITE (Ca0,5,Na)0,3(Mg,Fe++)3(Si,Al)4O10(OH)2.4H2O M
FERROSAPONITE Ca0,3(Fe++,Mg,Fe+++)3(Si,Al)4O10(OH)2.4H2O M
SPADAITE MgSiO2(OH)2.H2O (?) (?)
STEVENSITE (Ca,Na)xMg3-x(Si4O10)(OH)2 M
SAUCONITE Na0,3Zn3(Si,Al)4O10(OH)2.4H2O M
ZINCSILITE Zn3Si4O10(OH)2.4H2O (?) M
VERMICULITE (Mg,Fe++,Al)3(Al,Si)4O10(OH)2.4H2O M
RILANDITE (Cr+++,Al)6SiO11.5H2O (?) (?)
8/H.23- Chlorite group
SUDOITE Mg2(Al,Fe+++)3Si3AlO10(OH)8 M
CLINOCHLORE (Mg,Fe++)5Al(Si3Al)O10(OH)8 M
CHAMOSITE (Fe++,Mg,Fe+++)5Al(Si3Al)O10(OH,O)8 M
ORTHOCHAMOSITE (Fe++,Mg,Fe+++)5Al(Si3Al)O10(OH,O)8 O
BAILEYCHLORE (Zn,Fe++,Al,Mg)6(Si,Al)4O10(OH)8 A
NIMITE (Ni,Mg,Fe++)5Al(Si3Al)O10(OH)8 M
GONYERITE (Mn++,Mg)5Fe+++(Si3Fe+++)O10(OH)8 O (?)
BOROCOOKEITE Li1+3xAl4-x(B,Al)Si3O10(OH,F)8 M
NIKSERGIEVITE [Ba1,33Ca0,67Al(CO3)(OH)4][Al2(AlSi3O10)(OH)2].nH2O M
BRITVINITE Pb8Mg9[Si10O30(OH)8(CO3)3].H2O A
SURITE Pb2Ca(Al,Mg)2(Si,Al)4O10(OH)2(CO3,OH)3.0,5H2O M
FERRISURITE Pb2Ca(Fe+++,Al)2(Si,Al)4O10(OH,F)2(CO3,OH)3.0,5H2O M
8/H.25- Kaolinite group
ALLOPHANE Al2O3.(SiO2)1,3-2.(H2O)2,5-3 am.
PIANLINITE (?) Al2Si2O6(OH)2 (?) am. (?)
IMOGOLITE (?) Al2SiO3(OH)4 (?)
ODINITE (1M,-2R,-1T) (Fe+++,Mg,Al,Fe++,Ti,Mn)2,5(SiAl)O5(OH)4 M/R
NEOTOCITE (Mn,Fe++)SiO3.H2O (?) am. or M
8/H.27- Serpentine group
LIZARDITE (-1T,-2H) Mg3Si2O5(OH)4 R/H
CARYOPILITE (1M,-1Q) (Mn++,Mg)3Si2O5(OH)4 M
GREENALITE (Fe++,Fe+++)2-3Si2O5(OH)4 M
BERTHIERINE (-1M,-1H) (Fe++,Fe+++,Mg)2-3(Si,Al)2O5(OH)4 M
DOZYITE (Mg7Al2)(Si4Al2)O15(OH)12 M
KELLYITE (Mn++,Mg,Al)3(Si,Al)2O5(OH)4 H
CRONSTEDTITE Fe++2Fe+++(SiFe+++)O5(OH)4 M
GUIDOTTIITE (Mn2Fe+++)(SiFe+++)O5(OH)4 H
KARPINSKITE (Mg,Ni)2Si2O5(OH)2 (?) M (?)
BRINDLEYITE (Ni,Mg,Fe++)2Al(SiAl)O5(OH)4 M
CARLOSTURANITE (Mg,Fe++,Ti)21(Si,Al)12O28(OH)34.H2O M
8/H.28 to 37 Phyllosilicates with other simple layers [Si6O15], etc.
PYROSMALITE-(Fe) (Fe++,Mn++)8Si6O15(OH,Cl)10 H
PYROSMALITE-(Mn) (Mn++,Fe++)8Si6O15(OH,Cl)10 H
BROKENHILLITE (Mn++,Fe++)8(Si6O15)(OH,Cl)10 H
NELENITE (Mn++,Fe++)16Si12As+++3O36(OH)17 R
SCHALLERITE (Mn++,Fe++)16Si12As+++3O36(OH)17 R
FRIEDELITE Mn8Si6O15(OH,Cl)10 M ps R
MCGILLITE (Mn,Fe++)8Si6O15(OH)8Cl2 R
INNSBRUCKITE Mn++33(Si2O5)14(OH)38 M
VARENNESITE Na8Mn++2Si10O25(OH,Cl)2.12H2O O
SPODIOPHYLLITE (Na,K)4(Mg,Fe++)3(Fe+++,Al)2(Si8O24) M (?)
SAZHINITE-(La) Na3(La,Ce)Si6O15.2H2O O ps Q
SAZHINITE-(Ce) Na2CeSi6O14(OH).nH2O (n = about 5) O
WINDHOEKITE (Ca,Mn++)2Fe+++3(Si8O20)(OH)4.10H2O M
FERRISEPIOLITE (Fe+++,Fe++,Mg)4(Si,Fe+++)6O15(O,OH)2.6H2O O
RAITE Na3Mn++3Ti++++0,25[Si4O10(OH)]2.10H2O M
INTERSILITE (Na,K)Na5Mn++(Ti,Nb)[Si10O24(OH)4].4H2O M
KALIFERSITE (K,Na)5Fe+++7(Si20O50)(OH)6.12H2O A ps O
MINEHILLITE (K,Na)2-3Ca28(Zn4Al4Si40)O112(OH)16 H
TRUSCOTTITE (Ca,Mn)14Si24O58(OH)8.2H2O H
FEDORITE (Na,K)2-3(Ca,Na)7(Si4O8)(Si4O10)3(F,Cl,OH)2.3,5H2O A
MARTINITE (Na,[],Ca)12Ca4(Si,S,B)14B2O38(OH,Cl)2F2.4H2O A ps H
REYERITE (Na,K)4Ca14Si22Al2O58(OH)8.6H2O R
LALONDEITE (Na,Ca)6(Ca,Na)3Si16O38(F,OH)2.3H2O A
GYROLITE NaCa16AlSi23O60(OH)8.14H2O A ps H
TUNGUSITE Ca14(OH)8(Si8O20)Fe++9(OH)14 A (?)
JAGOITE Pb3Fe+++Si4O12(Cl,OH) H
HYTTSJOITE Pb18Ba2Ca5Mn++2Fe+++2Si30O90Cl.6H2O R
MARICOPAITE (Pb7Ca2)[Al12Si36(O,OH)100].n(H2O,OH) (n=near 32) O
WEEKSITE K2(UO2)2(Si5O13).4H2O M
COUTINHOITE (Th,Ba)0,5(UO2)2Si5O13.1-3,5H2O O
HAIWEEITE Ca(UO2)2Si5O12(OH)2.4,5H2O O
8/H.38 to 40 Two layers of tetrahedrons and related structures
MONTEREGIANITE-(Y) (Na,K)6(Y,Ca)2Si16O38.10H2O M
RHODESITE (Ca,Na2,K2)8Si16O40.11H2O O
GUNTERBLASSITE (?,??)3-xF?[(Si,?l)13O25(??,O)4].7?2O O
HILLESHEIMITE (K,Ca,[])2(Mg,Fe,Ca,[])2[(Si,Al)13O23(OH)6](OH).8H2O O
FIVEGITE K4Ca2[AlSi7O17(O2-xOHx)][(H2O)2-xOHx]Cl (x = 0-2) O
UMBRIANITE K7Na2Ca2[Al3Si10O29]F2Cl2 O
DELHAYELITE (Na,K)10Ca5Al6Si32O80(Cl2,F2,SO4)3.18H2O O
SEIDITE-(Ce) Na4(Ce,Sr)2TiSi8O18(O,OH,F)5(OH).5H2O M
ILIMAUSSITE-(Ce) (Na,K)7-8(Ba,K)10Ce5(Nb,Ti)6(Si12O36)(Si9O18)(O,OH)24O6 R ps H
CYMRITE BaAl2Si2(O,OH)8.H2O M ps O
KAMPFITE Ba6[(Si,Al)O2]8(CO3)2Cl2.(Cl,H2O)2 H
LOURENSWALSITE (K,Ba)2(Ti,Mg,Ca,Fe)4(Si,Al,Fe)6O14(OH)12 H
BURCKHARDTITE Pb2(Fe+++Te++++++)[AlSi3O8]O6 M ps H
VERTUMNITE Ca2Al[(OH)6AlSiO2-3(OH)4-3].2,5H2O M ps H
ZUSSMANITE K(Fe++,Mg,Mn)13(Si,Al)18O42(OH)14 R
COOMBSITE K(Mn++,Fe++,Mg)13(Si,Al)18O42(OH)14 R
SHAFRANOVSKITE K2Na3(Mn,Fe,Na)4[Si9(O,OH)27](OH)2.nH2O (n=2,33) R
8/J. Tectosilicates: frames (Si,Al)O2, Si:O = 1:2
8/J.01 to 08 Tectosilicates without tetrahedron's additional anion
8/J.06 to 07 Feldspar group
ANDESINE (a variety of albite) (Na,Ca)[Al(Si,Al)Si2O8] A
LABRADORITE (a variety of anorthite) (Ca,Na)[Al(Al,Si)Si2O8] A
BYTOWNITE (a variety of anorthite) (Ca,Na)[Al(Al,Si)Si2O8] A
FILATOVITE K(Al,Zn)2(As+++++,Si)2O8 M
8/J.09 to 14 Tectosilicates with tetrahedron's additional anions
KYANOXALITE Na7(Al5-6Si6-7O24)(C2O4)0,5-1.5H2O H
DEPMEIERITE Na8[Al6Si6O24](PO4,CO3)1-x.3H2O (x smaller than 0,5) H
DAVYNE (Na,Ca,K)8Al6Si6O24(Cl,SO4,CO3)2-3 H
QUADRIDAVYNE [(Na,K)6Cl2](Ca2Cl2)Al6Si6O24 H
BALLIRANOITE (Na,K)6Ca2(Si6Al6O24)Cl2(CO3) H
MICROSOMMITE (Na,Ca,K)7-8(Si,Al)12O24(Cl,SO4,CO3)2-3 H
KIRCHERITE [Na90Ca36K18]sigma=144(Si108Al108O432)(SO4)36.6H2O R ps H
FANTAPPIEITE [Na82.5Ca33K16.5](Si99Al99O396)(SO4)33.6H2O R
FARNESEITE [(Na,K)46Ca10](Si42Al42O168)(SO4)12.6H2O H
BIACHELLAITE (Na,Ca,K)8Al6Si6O24(SO4)2(OH)0,5.H2O R
GIUSEPPETTITE (Na,K,Ca)7-8(Si,Al)12O24(SO4,Cl)1-2 H
BYSTRITE Ca(Na,K)7Si6Al6O24(S--)1,5.H2O R
ALLORIITE (Na,Ca,K)13Ca2(Al6Si6O24)2(SO4)3Cl2.2H2O R ps H
AFGHANITE (Na,Ca,K)8(Si,Al)12O24(SO4,Cl,CO3)3.H2O H
TOUNKITE (Na,Ca,K)8Al6Si6O24(SO4)2Cl.H2O H
SACROFANITE (Na,Ca,K)9(Si,Al)12O24[(OH)2,(SO4),(CO3),Cl2)]3.nH2O H
MARINELLITE (Na,K,Ca)48(SO4)8(Al6Si6O24)6Cl2.3H2O H
VISHNEVITE (Na,Ca,K)6(Si,Al)12O24[(SO4),(CO3),Cl2]2-4.nH2O H
FRANZINITE (Na,K)6Ca2(SO4)2Al6Si6O24.0,5H2O H
LIOTTITE (Ca,Na,K)8(Si,Al)12O24[(SO4),(CO3),Cl,OH]4.H2O H
WENKITE Ba4Ca6(Si,Al)20O41(OH)2(SO4)3.H2O H
8/J.09- Cancrinite group
LEIFITE Na2(Si,Al,Be)7(O,OH,F)14 R
8/J.11- Sodalite group (complex feldspathoids)
TSAREGORODTSEVITE N(CH3)4[Si2(Si0,5Al0,5)O6]2 O ps C
NOSEAN Na8Al6Si6O24(SO4).H2O C
HAUYNE (Na,Ca,K)8-4(SO4)2-1(AlSiO4)6 C
LAZURITE (Na,Ca)7-8(Al,Si)12(O,S)24[(SO4),Cl2,(OH)2] C M A
8/J.15 to 20 Tectosilicates with zeolite structure
LOVDARITE K4Na12[Be8Si28O72].18H2O O
GAULTITE Na4[Zn2Si7O18].5H2O O
PARTHEITE Ca2[Al4Si4O15(OH)2].4H2O M
ROGGIANITE Ca2[Be(OH)2Al2Si4O13].2,5H2O Q
KRASNOITE Ca3Al7,7Si3P4O23,5(OH)12,1F2.8H2O R ps H
PERHAMITE (Ca,Sr)3Al7,7Si3P4O23,5(OH)14,1.8H2O R ps H
TSCHORTNERITE Ca4(K,Ca,Sr,Ba)3Cu3(OH)8(Si12Al12O48).nH2O (n more than 20) C
THORNASITE Na12Th3(Si8O19)4.18H2O R
MENDELEEVITE-(Ce) (Cs6[]6)([]10K2)(REE22Ca6)(Si70O175)(OH,F)16(H2O)19 C
MENDELEEVITE-(Nd) Cs6[(Nd,REE)23Ca7](Si70O175)(OH,F)19(H2O)16 C
8/J.21 to 27 Zeolite group
8/J.21 to- 22 Fibrous zeolites
GONNARDITE (Na,Ca)6-8[(Al,Si)20O40].12H2O O
MESOLITE Na16Ca16[Al48Si72O240].64H2O O
THOMSONITE-Sr (Sr,Ca)2Na[Al5Si5O20].6-7H2O O
FERRIERITE-NH4 (NH4,Mg0,5)5(Al5Si31O72).22H2O O
FERRIERITE-Na (Na,K,Mg0,5,Ca0,5)6[Al6Si30O72].18H2O M
FERRIERITE-K (K,Na,Mg0,5,Ca0,5)6[Al6Si30O72].18H2O O
FERRIERITE-Mg (Mg0,5,K,Na,Ca0,5)6[Al6Si30O72].18H2O O
MUTINAITE Na3Ca4[Al11Si85O192].60H2O O
GOTTARDIITE Na3Mg3Ca5[Al19Si117O272].93H2O O ps H
BOGGSITE Ca8Na3[Al19Si77O192].70H2O O
DACHIARDITE-Na (Na,K,Ca0,5)4-5[Al4-5Si20-19O48].12-13H2O M
DACHIARDITE-Ca (Ca0,5,K,Na)4-5[Al4-5Si20-19O48].12-13H2O M
DIRENZOITE K6Na(Ca,Mg)3(Si,Al)60O120.36H2O O
MORDENITE (Na2,Ca,K2)4[Al8Si40O96].28H2O O
LAUMONTITE Ca4[Al8Si16O48].18H2O M
8/J.23 to 25 Lamellar zeolites
HEULANDITE-Na (Na,Ca0,5,K)9[Al9Si27O72].24H2O M
HEULANDITE-K (K,Ca0,5,Na,Mg0,5,Sr0,5)9[Al9Si27O72].24H2O M
HEULANDITE-Ca (Ca0,5,Na,K)9[Al9Si27O72].24H2O M
HEULANDITE-Sr (Sr0,5,Ca0,5,Na,K)9[Al9Si27O72].24H2O M
HEULANDITE-Ba (Ba,Ca,Sr,K,Na)5Al9Si27O72.22H2O M
CLINOPTILOLITE-Na (Na,K,Ca0,5)6[Al6Si30O72].20H2O M
CLINOPTILOLITE-Ca (Ca0,5,Na,K)6[Al6Si30O72].20H2O M
STILBITE-Na (Na,Ca0,5,K)9[Al9Si27O72].28H2O M
STILBITE-Ca (Ca0,5,Na,K)9[Al9Si27O72].28H2O M
EPISTILBITE (Ca,Na2)[Al2Si6O16].5H2O M/A
BREWSTERITE-Sr (Sr,Ba)2[Al4Si12O32].10H2O M/A
BREWSTERITE-Ba (Ba,Sr)2[Al4Si12O32].10H2O M
COWLESITE Ca[Al2Si3O10].5,3H2O O
AMICITE K4Na4[Al8Si8O32].10H2O M
GOBBINSITE Na5[Al5Si11O32].12H2O O ps Q
GARRONITE-Ca Na2Ca5Al12Si20O64.27H2O Q/O
PHILLIPSITE-Na (Na,K,Ca0,5,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M
PHILLIPSITE-K (K,Na,Ca0,5,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M
PHILLIPSITE-Ca (Ca0,5,K,Na,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M ps O
FLORKEITE K3NaCa2(Al8Si8O32) A ps M
HARMOTOME Ba2(Ca0,5,Na)Al6Si10O32.12H2O M
MERLINOITE K5Ca2[Al9Si23O64].22H2O O
8/J.26 to 27 Cubic and pseudocubic zeolites
CHABAZITE-Na (Na,K,Ca0,5)4[Al4Si8O24].12H2O R
CHABAZITE-K (K,Na,Ca0,5)4[Al4Si8O24].12H2O R
CHABAZITE-Mg Mg0,7K0,5Ca0,5Na0,1)[Al3Si9O24].10H2O R
CHABAZITE-Ca (Ca0,5,K,Na)4[Al4Si8O24].12H2O R ps H/A
CHABAZITE-Sr (Sr,Ca)[Al2Si4O12].6H2O R
GMELINITE-Na (Na,K,Ca0,5)4[Al8Si16O48].22H2O H
GMELINITE-K (K,Na,Ca)6[Al7Si17O48].22H2O H
GMELINITE-Ca (Ca0,5,Sr0,5,Na,K)4[Al8Si16O48].22H2O H
LEVYNE-Na (Na,Ca0,5,K)6[Al6Si12O36].17H2O R
LEVYNE-Ca (Ca0,5,Na,K)6[Al6Si12O36].17H2O R
MAZZITE-Mg (Mg2,5K2Ca1,5)[Al10Si26O72].30H2O H
MAZZITE-Na Na4[Al4Si14O36].15H2O H
ERIONITE-Na (Na,K,Ca0,5)10[Al10Si26O72].30H2O H
ERIONITE-K (K,Na,Ca0,5)10[Al10Si26O72].30H2O H
ERIONITE-Ca (Ca0,5,K,Na)10[Al10Si26O72].30H2O H
BELLBERGITE (K,Ba,Sr)2Sr2Ca2(Ca,Na)4[Al18Si18O72].30H2O H
PERLIALITE K9Na(Ca,Sr)[Al12Si24O72].15H2O H
ANALCIME (-1C,-1Q,-1O,-1M) Na[AlSi2O6].H2O C Q O M
POLLUCITE (Cs,Na)[AlSi2O6].nH2O (Cs+n=1) C
FAUJASITE-Na (Na,Ca0,5,Mg0,5,K)3-4[Al3-4Si9-8O24].16H2O C
FAUJASITE-Mg (Mg0,5,Ca0,5,Na,K)3-4[Al3-4Si9-8O24].16H2O C
FAUJASITE-Ca (Ca0,5,Na,Mg0,5,K)3-4[Al3-4Si9-8O24].16H2O C
PAULINGITE-K (K,Ca0,5,Na)10[Al10Si32O84].27-44H2O C
PAULINGITE-Ca (Ca0,5,K,Na)10[Al10Si32O84].27-44H2O C


[Mineral Search]     [Abbreviations]     [Pictures]     [Athena]


Send comments on page to mail pp

Copyright © 1986, 1994, 2014 ATHENA - Pierre Perroud. All Rights Reserved.