


Systematic List of Minerals

List sorted according to Strunz 10 th ed. (pending). Strunz Br: courtesy D. Barthelmy


* ELEMENTS, metals and intermetallic alloys; metalloids and nonmetals; carbides, silicides, nitrides, phosphides
Metals and Intermetallic Alloys
Copper-cupalite family
Zinc-brass family
Indium-tin family
Mercury-amalgam family
Iron-chromium family
KAMACITE alpha-(Fe,Ni) C
FERCHROMIDE Cr3Fe1-x (x=0,6) C
CHROMFERIDE Fe3Cr1-x (x=0,6) C
Platinum group elements
PGE-metal alloys
Miscellaneous Elements, alloys
DECAGONITE Al71Ni24Fe5 Icosaedre
Metallic Carbides, Silicides, Nitrides and Phosphides
PERRYITE (Ni,Fe)8(Si,P)3 H
Metalloids and Nonmetals
Arsenic group elements
Carbon-silicon family
Nonmetallic Carbides and Nitrides
Nonmetallic carbides
Nonmetallic nitrides
Unclassified Strunz ELEMENTS, metals and intermetallic alloys; metalloids and nonmetals; carbides, silicides, nitrides, phosphides
Elements, etc. unclassified
WENJIITE Ti10SixPy (x+y between 6 and 7) H
TSIKOURASITE Mo3Ni2P1+x (x smaller than 0,25) C
* SULFIDES and SULFOSALTS, selenides, tellurides; arsenides, antimonides, bismuthides; sulfarsenites, sulfantimonites, sulfbismuthites, etc.
Alloys of metalloids with Cu, Ag, Au
NOVAKITE (Cu,Ag)21As10 M ps Q
KUTINAITE (K,Tl)0,25Cu14Ag6As6,75 Q
Ni-metalloid alloys
ORCELITE Ni5-xAs2 (x about 0,25) H
Alloys of metalloids with PGE
ATHENEITE Pd2(As0,75Hg0,25) H
VINCENTITE (Pd,Pt)3(As,Sb,Te) (?)
MERTIEITE-I Pd11(Sb,As)4 ps H
BORISHANSKIITE Pd1+x(As,Pb)2 (x=0-0,2) O
Metal Sulfides, M: S > 1: 1 (mainly 2: 1)
With Cu, Ag, Au
HENRYITE (Cu,Ag)3,4Te2 C
GACHINGITE Au(Te1-xSex) (x between 0,2 and 0,5) O
SPRYITE Ag8(As++3+0,5As+++++0,5)S6 O
With Ni
With Rh, Pd, Pt, etc.
VASILITE (Pd,Cu)16(S,Te)7 C
OULANKAITE (Pd,Pt)5(Cu,Fe)4SnTe2S2 Q
With Hg, Tl
With Pb (Bi)
Metal Sulfides, M: S = 1: 1 (and similar)
With Cu
With Zn, Fe, Cu, Ag, etc.
PUTORANITE Cu16-18(Fe,Ni)18-19S32 C
MAWSONITE Cu+6Fe+++2Sn++++S8 Q
COLUSITE Cu26V2(As,Sn,Sb)6S32 C
OVAMBOITE Cu10(Fe,Zn,Cu)3W(Ge,As)3S16 C
MAIKAINITE Cu10(Fe,Cu)3Mo(Ge,As)3S16 C
RENIERITE (Cu,Zn)11(Ge,As)2Fe4S16 Q ps C
VINCIENNITE Cu10Fe4Sn(As,Sb)S16 Q ps C
POLKOVICITE (Fe,Pb)3(Ge,Fe)1-xS4 C
HEMUSITE Cu+4Cu++Sn++++Mo++++S8 C
With Ni, Fe, Co, PGE, etc.
PYRRHOTITE Fe1-xS (x=0-0,17) M/H
SMYTHITE (Fe,Ni)9S11 or (Fe,Ni)13S16 R
With Sn, Pb, Hg, etc.
Metal Sulfides, M: S = 3 :4 and 2:3
M:S = 3:4
HEIDEITE (Fe,Cr)1+x(Ti,Fe)2S4 M
M:S = 2:3
BOWIEITE (Rh,Ir,Pt)1,77S3 O
MONTBRAYITE (Au,Ag,Sb,Bi,Pb)23(TeSb,Bi,Pb)38 A
CAMERONITE Cu5-x(Cu,Ag)3+xTe10 (x = 0,43) Q
Variable M:S
Metal Sulfides, M: S <= 1:2
M:S = 1:2 - With Cu, Ag, Au
M:S = 1:2, with Fe, Co, Ni, PGE, etc.
PAXITE Cu2As3 M ps O
M:S = 1:>2
Sulfides of arsenic, alkalies; sulfides with halide, oxide, hydroxide, H2O
With As, (Sb), S
With alkalies (without Cl, etc.)
With Cl, Br, I (halide-sulfides)
OWENSITE (Ba,Pb)6(Cu,Fe,Ni)25S27 C
KENHSUITE gamma-Hg3S2Cl2 O
ZOHARITE (Ba,K)6(Fe,Cu,Ni)25S27 C
With O, OH, H2O
VALLERIITE 4(Fe,Cu)S.3(Mg,Al)(OH)2 H
HAAPALAITE 4(Fe,Ni)S.3(Mg,Fe++)(OH)2 H
TOCHILINITE 2(Fe,Ni,Cu)S.1-2(Mg,Fe,Al,Ca)(OH,CO3)1-2 A
Sulfarsenites, sulfantimonites, sulfbismuthites
Neso-sulfarsenites, etc. without additional S
STALDERITE (Tl,Cu)(Zn,Fe,Hg)2As2S6 Q
Neso-sulfarsenites, etc. with additional S
TETRAHEDRITE-(Ni) Cu6(Cu4Ni2)Sb4S13 Cu6(Cu4Ni2)Sb4S13 Cu6(Cu4Ni2)Sb4S13 Cu6(Cu4Ni2)Sb4S13 C
TENNANTITE-(Ni) Cu6(Cu4Ni2)As4S13 C
HAKITE-(Hg) Cu6(Cu4Hg2)Sb4Se13 C
HAKITE-(Zn) Cu6(Cu4Zn2)Sb4Se13 C
POSEPNYITE (Cu+3[]3)(Hg++4Cu+2)Sb4Se12(Se0,5[]0,5) C
TENNANTITE-(Cu) Cu6(Cu4Cu2)As4S13 C
TENNANTITE-(Hg) Cu6(Cu4Hg2)As4S13 C
HAKITE-(Fe) Cu6(Cu4Fe2)Sb4Se13 C
HAKITE-(Cu) Cu6(Cu4Cu2)Sb4Se13 C
HAKITE-(Cd) Cu6(Cu4Cd2)Sb4Se13 C
GIRAUDITE-(Zn) Cu6(Cu4Zn2)As4Se13 C
GIRAUDITE-(Hg) Cu6(Cu4Hg2)As4Se13 C
GIRAUDITE-(Fe) Cu6(Cu4Fe2)As4Se13 C
GIRAUDITE-(Cu) Cu6(Cu4Cu2)As4Se13 C
TENNANTITE-(Mn) Cu6(Cu4Mn2)As4S13 C
ZVESTOVITE-(Zn) Ag6(Ag4Zn2)As4S13 C
PEARCEITE [(Ag8CuS4)][(AgCu)6(As,Sb)2S7] M
POLYBASITE [(Ag8CuS4)][(AgCu)6(Sb,As)2S7] M ps H
GALKHAITE (Cs,Tl)(Hg,Cu,Zn)6(As,Sb)4S12 C
POSEPNYITE (Cu+++[]3)(Hg++4Cu+2)Sb4Se12(Se0,5[]0,5) C
Sulfosalts of SnS archetype
With Cu, Ag, Fe (without Pb)
With Cu, Ag, Fe, Sn and Pb
SALZBURGITE Cu1,6Pb1,6Bi6,4S12 O
PAARITE Cu1,7Pb1,7Bi6,3S12 O
PEKOITE PbCuBi11(S,Se)18 O
EMILITE Cu2,68Pb2,68Bi5,32S12 O
JASKOLSKIITE Pb2+xCux(Sb,Bi)2-xS5 (x=0,2) O
KOBELLITE Pb22Cu4(Bi,Sb)30S69 O
TINTINAITE Pb22Cu+4(Sb,Bi)30S69 O
GIESSENITE 2(Cu2Pb26(Bi,Sb)20S57) M
IZOKLAKEITE Pb27(Cu,Fe)2(Sb,Bi)19S57 O
ECLARITE Pb9(Cu,Fe)Bi12S28 O
NAGYAGITE (Au,Te)3Pb3(Pb,Sb,Bi)3S6 M
With only Pb
RATHITE (Pb,Tl)3As5S10 M
CHABOURNEITE AgzTl8-x-zPb4+2xSb40-x-yAsyS68 A
DALNEGROITE Tl5-xPb2x(As,Sb)21-xS34 A
RAYITE (Ag,Tl)2Pb8Sb8S21 M
DADSONITE Pb23Sb25S60Cl A ps M
With Tl
With alkalies, H2O
With SnS and PbS archetype structure units
CYLINDRITE Pb4Fe++Sn++++4Sb+++2S16 A
LEVYCLAUDITE Pb8Sn7Cu3(Bi,Sb)3S28 M ps Q/H
FRANCKEITE (Pb,Sn++)6Sn++++2FeSb2S14 A
COIRAITE (Pb,Sn++)12,5Fe++Sn++++5As3S28 M ps Q/H
Sulfosalts of PbS archetype
Galena derivatives with little or no Pb
DANTOPAITE (Ag,Cu)5(Bi,Pb)13S22 M
PAVONITE (Ag,Cu)(Bi,Pb)3S5 M
MAKOVICKYITE (Ag,Cu)1,5(Bi,Pb)5,5S9 M
MUMMEITE Cu0,58Ag3,11Pb1,10Bi6,65S13 M
KUPCIKITE Cu3,4Fe0,6Bi5S10 M
Galena derivatives, with Pb
JUNOITE Pb3Cu2Bi8(S,Se)16 M
PROUDITE (Pb,Cu)8Bi9-10(S,Se)22 M
WEIBULLITE (Pb,Ag)6Bi8(S,Se)18 O
NEYITE Pb7(Cu,Ag)2Bi6S17 M
ROUXELITE Cu2HgPb22Sb28S64(O,S)2 M
CHOVANITE Pb14,6Sb14,4S36O0,2 M
ROSHCHINITE Ag19Pb10Sb51S96 or Pb(Ag,Cu)2(Sb,As)5S10 O
RAMDOHRITE Pb5,9Fe0,1Mn0,1In0,1Cd0,2Ag2,8Sb10,8S24 M
SCHIRMERITE PbAgBi3S6 - Pb3Ag1,5Bi3,5S9 O
USTARASITE Pb(Bi,Sb)6S10 O (?)
VURROITE Pb10Sn(Bi,As)11S27Cl3 ps O
STAROCESKEITE Ag0,70Pb1,60(Bi1,35Sb1,35)S6 O
JASROUXITE Ag16Pb4(Sb24As16)S72 A
OYONITE Ag3Mn2Pb4Sb7As4S24 M
ARSENQUATRANDORITE Ag17,6Pb12,8Sb38,1As11,5S96 M
Galena derivatives, with Tl
Sulfarsenates, Sulfantimonates
Sulfarsenates with (As,Sb)S4 tetrahedra
PETRUKITE (Cu,Fe,Zn)2(Sn,In)S4 O
Sulfarsenates with additional S
Unclassified Sulfosalts
Without essential Pb
FETTELITE Ag164HgAs4S15 R ps H
With essential Pb
STERRYITE Ag2Pb10(Sb,As)12S29 O
SORBYITE Pb19(Sb,As)20S49 M
MADOCITE Pb17(Sb,As)16S41 O
ARDAITE Pb19Sb13S35Cl7 M
LAROSITE (Cu,Ag)21(Pb,Bi)2S13 O
CRERARITE (Pt,Pb)Bi3(S,Se)4-x (x=0,7) C
CIRIOTTIITE Cu(Cu,Ag)3Pb19(Sb,As)22(As2)S56 M
Oxysulfosalts of Alkalies and Alkali Earths
CETINEITE (K,Na)3-3,5(Sb2O3)(SbS3)(OH)x.2,5-3H2O (x = less than 0,5) H
OTTENSITE Na3(Sb2O3)3(SbS3).3H2O H
Sulfides, etc. unclassified
SHIMENITE Tl5Sb21-yAsyS34 (y between 9 and 10) A
DEWITITE AgzTl10-x-zPb2xSb42-x-yAsyS68 A
SLUZHENIKINITE Pd15(Sb7-xSnx) (x between 3 and 4) M
RATHITE IV (Pb,Tl)3As5S10  
SANGENAROITE Ag8(Sb8-xAsx)S16 (x between = and 2) M
MEERSCHAUTITE Pb42(Ag,Cu)6(Sb,As)45S112 M
RAMOSITE Pb25,7Sn8,3Mn3,4Sb6,4S56,2 M
TENNANTITE-(Zn) Cu6(Cu4Zn2)As4S13 C
TENNANTITE-(Fe) Cu6(Cu4Fe2)As4S13 C
TAZIEFFITE Pb20Cd2(As,Bi)22S50Cl10 M
EKPLEXITE (Nb,Mo,W)S2.(Mg1-xAlx)(OH)2+x R
KOJONENITE Pd7-xSnTe2 (x between 0,3 and 0,8) Q
IRIDISITE (Ir,Cu,Rh,Ni,Pt)S2 ps C
KASKASITE (Mo,Nb)S2.(Mg1-xAlx)(OH)2+x R
Simple halides, without H2O
M:X = 1:1, 2:3, 3:5, etc.
M:X = 1:2
TVEITITE-(Y) Ca1-xYxF2+x M ps C
M:X = 1:3
Simple halides, with H2O
M:X = 1:1 and 2:3
M:X = 1:2
M:X = 1:3
Simple halides with H2O and additional OH
CADWALADERITE Al5(H2O)3(OH)12.n(Cl,H2O) am.
Complex halides
JORGENSENITE Na2(Sr,Ba)14Na2Al12F64(OH,F)4 M
JARLITE Na(Sr,Na)7MgAl6F32(OH,H2O)2 M
Aluminofluorides with CO3, SO4, PO4
CHUKHROVITE-(Ca) Ca4,5Al2(SO4)F13.12H2O C
CHUKHROVITE-(Ce) Ca3(Ce,Y)Al2(SO4)F13.10H2O C
CHUKHROVITE-(Nd) Ca3(Nd,Y)Al2(SO4)F13.12H2O C
CHUKHROVITE-(Y) Ca3(Y,Ce)Al2(SO4)F13.10H2O C
With MX6 complexes; M = Fe, Mn, Cu
ZIRKLERITE (Fe++,Mg)9Al4Cl18(OH)12.14H2O (?) R
Halides of Bi, etc.
Oxyhalides, hydroxyhalides and related double halides
With Cu, etc., without Pb
ABHURITE Sn++21Cl16(OH)14O6 R
DRONINOITE Ni6Fe+++2(OH)16Cl2.4H2O R
CENTENNIALITE CaCu3Cl2(OH)6.nH2O (n near 0.7) R
With Pb, Cu, etc.
BOLEITE KPb26Ag9Cu24Cl62(OH)48 C
CUMENGEITE Pb21Cu20Cl42(OH)40.6H2O Q
MURDOCHITE PbCu++6O8-x(Cl,Br)2x (x smaller or = 0,5) C
With Pb (As,Sb,Bi), without Cu
THORIKOSITE Pb3(Sb+++,As+++)O3(OH)Cl2 Q
MEREHEADITE Pb47(BO3)2(CO3)O24(OH)13Cl25 M
SYMESITE Pb10(SO4)O7Cl4.H2O A ps Q
With Hg
COMANCHEITE Hg++55N---24(NH2,OH)4(Cl,Br)34 O
GAILDUNNINGITE Hg++3[NHg++2]18(Cl,I,OH,Br,S)24 O
With Rare-Earth Elements
Halogenides, etc. unclassified
HEREROITE [Pb32(O,[])21](AsO4)2[(Si,As,V,Mo]O4)2Cl10 M
JANCHEVITE Pb7V+++++(O8,5[]0,5)Cl2 Q
* OXIDES, hydroxides, V[5,6] vanadates, arsenites, antimonites, bismuthites, sulfites, selenites, tellurites, iodates
Metal: Oxygen = 2:1 and 1:1
Cation:Anion (M:O) = 2:1 (and 1.8:1)
M:O = 1:1 (and up to 1:1.25); with small to medium-sized cations only
M:O = 1:1 (and up to 1:1.25); with large cations (+- smaller ones)
Metal: Oxygen = 3:4 and similar
With small and medium-sized cations
MANGANOSTIBITE (Mn++,Fe++)7(SbO4)(AsO4,SiO4)O4 O
With only medium-sized cations
JACOBSITE (Mn++,Fe++,Mg)(Fe+++,Mn+++)2O4 C
MANGANOCHROMITE (Mn++,Fe++)(Cr+++,V+++)2O4 C
QANDILITE (Mg,Fe++)2(Ti,Fe+++,Al)O4 C
VUORELAINENITE (Mn++,Fe++)(V+++,Cr+++)2O4 C
COCHROMITE (Co,Ni,Fe++)(Cr,Al)2O4 C
GALAXITE (Mn++,Fe++,Mg)(Al,Fe+++)2O4 C
FRANKLINITE (Zn,Mn++,Fe++)(Fe+++,Mn+++)2O4 C
FILIPSTADITE (Mn,Mg)2Sb+++++Fe+++O8 O
NICHROMITE (Ni,Co,Fe++)(Cr+++,Fe+++,Al)2O4 C
JACOBSITE-Q Mn++(Fe+++,Mn+++)2O4 Q
MAGHEMITE (Fe+++0,67[]0,33)Fe+++2O4 C
TITANOMAGHEMITE (Ti0,5[]0,5)Fe+++2O4 C
TEGENGRENITE (Mg,Mn++)2Sb+++++0,5(Mn+++,Si,Ti)0,5O4 R ps C
DELTALUMITE (Al0,67[]0,33)Al2O4 Q
GUITE Co++Co+++2O4 Co++Co+++2O4 C
With medium-sized and large cations
With only large cations
MINIUM Pb++2Pb++++O4 Q
Metal: Oxygen = 2: 3,3: 5, and similar
With small cations
BYRUDITE (Be,[])(V3+++,Ti++++,Cr)3O6 O
With medium-sized cations
HEMATITE alpha-Fe2O3 R
BIXBYITE (Mn+++,Fe+++)2O3 C
PSEUDOBROOKITE (Fe+++,Fe++)2(Fe++,Ti)O5 O
FERROHOGBOMITE-6N12S [(Fe++,Mg,Zn)5(Al,Ti,Fe+++)12O23(OH)]6 R
FERROHOGBOMITE-2N2S (Fe++,Zn,Mg)3(Al,Fe+++,Ti++++)8O15(OH) H
KLEBERITE Fe+++Ti++++6O11(OH)5 M ps H
OXYVANITE (V+++,Cr+++)2(V++++,Ti++++)O5 M
OLKHONSKITE (Cr+++,V+++)2Ti3O9 M (?)
NOLANITE (V+++,Fe++,Fe+++,Ti)10O14(OH)2 H
RINMANITE (Zn,Mn++)2Sb+++++2Mg2Fe+++4O14(OH)2 H
SILLENITE Bi+++12(SiO4)O16 C
With large and medium-sized cations
YAFSOANITE {Ca3}[Te++++++2](Zn3)O12 C
LOPARITE-(Ce) (Na,Ce,Ca)(Ti,Nb)O3 Q/O ps Q
DAVIDITE-(La) (La,Ce)(Y,U,Fe++)(Ti,Fe+++)20(O,OH)38 R
SENAITE Pb(Ti,Fe,Mn)21O38 R
MATHIASITE (K,Ca,Sr)(Ti,Cr,Fe,Mg)21O38 R
LOVERINGITE (Ca,Ce)(Ti,Fe+++,Cr,Mg)21O38 R
LINDSLEYITE (Ba,Sr)(Ti,Cr,Fe,Mg,Zr)21O38 R
LANDAUITE NaMn++Zn2(Ti,Fe+++)6Ti12O38 M ps R
DAVIDITE-(Y) (Y,Ce,La)2Fe+++2(Ti,Fe+++)18O38 (?) R
DESSAUITE-(Y) (Sr,Pb)(Y,U)(Ti,Fe+++)20O38 R ps H
DAVIDITE-(Ce) (Ce,La)(Y,U,Fe++)(Ti,Fe+++)20(O,OH)38 R
CRICHTONITE (Sr,La,Ce,Y)(Ti,Fe+++,Mn)21O38 R
CLEUSONITE (Pb,Sr)(U++++,U++++++)(Fe+++,Zn)2(Ti,Fe++,Fe+++)18(O,OH)38 R
GRAMACCIOLIITE-(Y) (Pb,Sr)(Y,Mn)(Ti,Fe+++)18Fe+++2O38 R ps H
YIMENGITE K[Ti3Cr5Fe+++2Mg++2]O19 H
PLUMBOFERRITE Pb[Fe10,67Mn++0,33Pb]O18,33 H
NEZILOVITE Pb[Mn++++2e7AlZn2]O19 H
LINDQVISTITE Pb2(Mn++,Mg)Fe+++16O27 H
HAGGERTYITE Ba[Ti5Fe+++2Fe++4Mg]O19 H
BATIFERRITE Ba[Ti2Fe+++8Fe++2]O19 H
HAWTHORNEITE Ba[Ti3Cr4Fe+++2Fe++2Mg]O19 H
JEPPEITE (K,Ba)2(Ti,Fe+++)6O13 M
ZENZENITE Pb3(Fe+++,Mn+++)4Mn++++3O15 H
SARANOVSKITE-(Y) SrCaFe++2(Cr4Ti2)Ti12O38 R
BOTUOBINSKITE SrFe++(Ti++++12Cr+++6)Mg2[O36(OH)2] A
BITIKLEITE {Ca3}[Sb+++++Sn++++](Al3)O12 C
ANZAITE-(Ce) Ce4Fe++Ti6O18(OH)2 M
NATALIAKULIKITE Ca4Ti2(Fe+++,Fe++)(Si,Fe+++,Al)O11 O
Metal: Oxygen = 1:2 and similar
ACHALAITE (Fe++,Mn)(Ti,Fe+++,Ta)(Nb,Ta)2O8 M
With small cations: Silica family
CHIBAITE SiO2.0,15(CH4,C2H6,C3H8) C
OPAL SiO2.nH2O am.
With medium-sized cations; chains of edge-sharing octahedra
TRIPUHYITE Fe+++(Sb+++++,Sn,W++++++,Ti++++)O4 Q
TAPIOLITE-(Mn) (Mn++,Fe++)(Ta,Nb)2O6 Q
TAPIOLITE-(Fe) (Fe++,Mn++)(Ta,Nb)2O6 Q
AKHTENSKITE epsilon-Mn++++O2 H
NSUTITE (gamma-MnO2)Mn++xMn++++1-xO2-2x(OH)2x (x is small) H
SAMARSKITE-(Yb) (Yb,Y,U,Th,Ca,Fe)(Nb,Ta)O4 M ps O
IXIOLITE (Ta,Nb,Sn,Fe,Mn)4O8 M
ISHIKAWAITE (U,Y,Fe+++,Fe++)(Nb,Ti)O4 O
SAMARSKITE-(Y) (Y,Ce,U,Fe+++)3(Nb,Ta,Ti)5O16 M
HEFTETJERNITE (Sc,Sn++++,Mn++)(Ta,Nb)O4 M
COLUMBITE-(Mg) (Mg,Fe++,Mn)(Nb,Ta)2O6 O
COLUMBITE-(Mn) (Mn,Fe++)(Nb,Ta)2O6 O
QITIANLINGITE (Fe++,Mn)2(Nb,Ta)2W++++++O10 O
TANTALITE-(Mg) (Mg,Fe++)(Ta,Nb)2O6 O
FERROWODGINITE (Fe++,Mn++)(Sn,Ti,Fe+++,Ta)(Ta,Nb)2O8 M
TITANOWODGINITE (Mn++,Fe++)(Ti,Sn,Ta,Sc)(Ta,Nb)2O8 M
WODGINITE (Ta,Nb,Sn,Mn,Fe)16O32 M
FERROTITANOWODGINITE (Fe++,Mn++)(Ti,Sn++++,Ta,Fe+++)(Ta,Nb)2O8 M
BIEHLITE (Sb+++,As+++)2(MoO6) M
With medium-sized cations; sheets of edge-sharing octahedra
BAHIANITE Al5Sb+++++3O14(OH)2 M
With medium-sized cations; frameworks of edge-sharing octahedra
With medium-sized cations; * With various polyhedra
KORAGOITE (Mn++,Mn+++,Fe++)3(Nb,Ta,Ti)3(Nb,Mn)2(W,Ta)2O20 M
With large (+- medium-sized) cations; dimers and trimers of edgesharing octahedra
NIOBOAESCHYNITE-(Y) (Y,Ce,Nd)0,5(Ca,Th)0,5(Nb,Ti)2(O,OH)6 O
AESCHYNITE-(Y) (Y,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 O
AESCHYNITE-(Nd) (Nd,Ce,Ca)(Ti,Nb)2(O,OH)6 O
AESCHYNITE-(Ce) (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 O
VIGEZZITE (Ca,Ce)(Nb,Ta,Ti)2O6 O
MURATAITE-(Y) (Y,Na)6(Zn,Fe+++)5Ti12O29(O,F)10F4 C
With large (+- medium-sized) cations; chains of edge-sharing octahedra
FERSMITE (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 O
YTTROCRASITE-(Y) (Y,Th,Ca,U)(Ti,Fe+++)2(O,OH)6 O
TANTEUXENITE-(Y) (Y,Ce,Ca)(Ta,Nb,Ti)2(O,OH)6 O
POLYCRASE-(Y) (Y,Ca,Ce,U,Th)(Ti,Nb,Ta)2O6 O
KOBEITE-(Y) (Y,U)(Ti,Nb)2(O,OH)6 (?) am.
EUXENITE-(Y) (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 O
LORANSKITE-(Y) (Y,Ce,Ca)ZrTaO6 (?) O (?)
FERGUSONITE-(Ce)-Beta (Ce,La,Nd)NbO4 M
With large (+- medium-sized) cations; sheets of edge-sharing octahedra
LUCASITE-(Ce) (Ce,La)Ti2(O,OH)6 M
LAACHITE (Ca,Mn)2Zr2Nb2TiFeO14 M
INGERSONITE Ca3Mn++Sb+++++4O14 H
PITTONGITE Na2(W,Fe+++)9(O,OH)27.4H2O H
OXYCALCIOROMEITE (Ca,Fe++,Sb+++,Na)2Sb+++++2O7 C
SCHETELIGITE (Ca,Y,Sb,Mn)2(Ti,Ta,Nb,W)2O6(O,OH) O (?)
YTTROMICROLITE (Ca,Y+++,U,Na)2-x(Ta,Nb,Ti,Fe+++)2O7 C
CESIOKENOPYROCHLORE []Nb2(O,OH)6Cs1-x (x about 0,20) C
HYDROXYKENOELSMOREITE ([],Pb)2(W,Fe+++,Al)2(O,OH)6(OH) ([],Pb)2(W,Fe+++,Al)2(O,OH)6(OH) R
With large (+- medium-sized) cations; polyhedral frameworks
With large (+- medium-sized) cations; tunnel structures
AKAGANEITE beta-Fe+++(O,OH,Cl) M ps Q
CRYPTOMELANE K(Mn++++,Mn++)8O16 M ps Q
HOLLANDITE BaMn++++6Mn++2O16 M
CORONADITE Pb(Mn++++,Mn++)8O16 M ps Q
MANJIROITE (Na,K)(Mn++++,Mn++)8O16.nH2O Q
PRIDERITE (K,Ba)(Ti,Fe+++)8O16 Q
ROMANECHITE (Ba,H2O)2(Mn++++,Mn+++)5O10 M
TODOROKITE (Mn++,Ca,Mg)Mn++++3O7.H2O M
FERRIHOLLANDITE BaMn++++6(Fe+++,Mn+++)2O16 M
THALLIOMELANE TlMn++++7,5Cu++0,5O16 Q
With large (+- medium-sized) cations; fluorite-type structures
CERIANITE-(Ce) (Ce++++,Th)O2 C
ZIRKELITE (Ca,Th,Ce)Zr(Ti,Nb)2O7 C
HIARNEITE (Ca,Mn++,Na)2(Zr,Mn+++)5(Sb+++++,Ti,Fe+++)2O16 Q
With large (+- medium-sized) cations; unclassified
RANKAMAITE (Na,K,Pb,Li)3(Ta,Nb,Al)11(O,OH)30 O
SOSEDKOITE (K,Na)5Al2(Ta,Nb)22O60 O
CESPLUMTANTITE (Cs,Na)2(Pb,Sb+++)3Ta8O24 Q
EYSELITE Fe+++Ge++++3O7(OH) O
KURANAKHITE PbMn++++Te++++++O6 O
Metal: Oxygen = < 1 :2
Oxides with metal : oxygen < 1:2 (M2O5, MO3)
Hydroxides (without V or U)
Hydroxides with OH, without H2O; corner-sharing tetrahedra
Hydroxides with OH, without H2O; insular octahedra
OMSITE (Ni,Cu)2Fe+++(OH)6[Sb(OH)6] R
Hydroxides with OH, without H2O; corner-sharing octahedra
MUSHISTONITE (Cu++,Zn,Fe++)Sn++++(OH)6 C
NATANITE Fe++Sn++++(OH)6 C
JEANBANDYITE (Fe+++,[])(Sn++++,[])(OH)6 Q ps C
TETRAWICKMANITE omsitedritsite Q
FERRONIGERITE-2N1S (Fe,Mg)4(Al10Sn2)O22(OH)2 R
FERRONIGERITE-6N6S (Fe,Mg)18(Al42Sn6)O90(OH)6 R
MAGNESIONIGERITE-2N1S (Mg,Fe++)4(Al10Sn2)[]12O22(OH)2 R
MAGNESIONIGERITE-6N6S (Mg,Fe++)18(Al42Sn6)[]48O90(OH)6 R
Hydroxides with OH, without H2O; chains of edge-sharing octahedra
KHINITE-3T Pb++Cu++3Te++++++O6(OH)2 R
KHINITE-4O Pb++Cu++3Te++++++O6(OH)6 O
GOETHITE alpha-Fe+++O(OH) O
Hydroxides with OH, without H2O; sheets of edge-sharing octahedra
LITHIOPHORITE Li6Al14Mn++3Mn++++18O42(OH)42 H or M
VERNADITE (MnO2)(Mn++++,Fe+++,Ca,Na)(O,OH)2.nH2O H
Hydroxides with OH, without H2O; various polyhedra
Hydroxides with OH, without H2O; unclassified
JANGGUNITE Mn++++5-x(Mn++,Fe+++)1+xO8(OH)6 (x=0,2) O
CESAROLITE PbH2Mn++++3O8 (?)
Hydroxides with H2O +- (OH); insular octahedra
BOTTINOITE NiSb+++++2(OH)12.6H2O H
Hydroxides with H2O +- (OH); corner-sharing octahedra
Hydroxides with H2O +- (OH); chains of edge-sharing octahedra
Hydroxides with H2O +- (OH); sheets of edge-sharing octahedra
WOODALLITE Mg6(Cr,Fe+++)2(OH)16Cl2.4H2O R
MUSKOXITE Mg7Fe+++4(OH)13.10H2O H
IOWAITE Mg6Fe+++2(OH)16Cl2.4H2O H
FOUGERITE Fe++4Fe+++2(OH)12[CO3].3H2O R
AURORITE (Mn,Ag,Ca)Mn++++3O7.3H2O A (?)
JIANSHUIITE (Mg,Mn++)Mn++++3O7.3H2O A
CHALCOPHANITE (Zn,Fe++,Mn++)Mn++++3O7.3H2O R
WOODRUFFITE Zn++(Mn++++,Mn+++)5O10.3,5H2O M ps Q
ASBOLANE (Co,Ni)1-y(Mn++++O2)2-x(OH)2-2y+2x.nH2O H
BUSERITE Na4Mn14O27.21H2O ?
RANCIEITE (Ca,Mn++)Mn++++4O9.3H2O H (?)
TAKANELITE (Mn++,Ca)Mn++++4O8.H2O H
CIANCIULLIITE Mn++++(Mg,Mn++)2Zn+2(OH)10.2-4H2O M
JENSENITE Cu++3Te++++++O6.2H2O M
LEISINGITE (Cu,Mg,Zn)2(Mg,Fe)Te++++++O6.6H2O R
MOURITE U++++Mo++++++5O12(OH)10 M
DELORYITE Cu++4(UO2)(MoO4)2(OH)6 M
Hydroxides with H2O +- (OH); unclassified
BELYANKINITE Ca1-2(Ti,Zr,Nb)5O12.9H2O (?) am.
GERASIMOVSKITE (Mn,Ca)(Nb,Ti)5O12.9H2O am.
CUZTICITE Fe+++2Te++++++O6.3H2O H
Hydroxides with H2O±(OH); frameworks of corner and/or face-sharing octahedra
ASPEDAMITE []12(Fe+++,Fe++)3Nb4[Th(Nb,Fe+++)12O42]{(H2O),(OH)}12 C
Uranyl Hydroxides
Without additional cations
METASCHOEPITE UO3.nH2O (n smaller than 2) O
SCHOEPITE [(UO2)8O2(OH)12](H2O)12 O
With additional cations (K, Ca, Ba, Pb, etc.); * With mainly UO2(O,OH)5 pentagonal polyhedra
RICHETITE PbU++++++4O13.4H2O A
METAVANDENDRIESSCHEITE PbU7O22.nH2O (n smaller than12) O
CURITE Pb3(UO2)8O8(OH)6.2H2O O
HOLFERTITE U++++++1,75Ti++++Ca0,25O7,5(H2O)3 or U++++++1,75Ti++++Ca0,25O7,17(OH)0,67(H2O)3 H
With additional cations; * With mainly UO2(O,OH)6 hexagonal polyhedra
V[5,6] Vanadates
V[>4] Nesovanadates
Uranyl Sorovanodates
FRITZSCHEITE Mn++(UO2)2[(P,V)O4]2.10H2O (?) Q
VANURALITE Al(UO2)2(V+++++O4)2(OH).11H2O M
UVANITE U++++++2V+++++6O21.15H2O (?) O (?)
RAUVITE Ca(UO2)2V+++++10O28.16H2O  
LASALITE Na2Mg2(V10O28).20H2O M
SHERWOODITE Ca9Al2V++++4V+++++24O80.56H2O Q
METAMUNIRITE Na2[V+++++2O6] or NaVO3 O
ANSERMETITE Mn++(V+++++2O6).4H2O M
MELANOVANADITE Ca(V+++++2V++++2)O10.5H2O A
CORVUSITE (Na,Ca,K)(V+++++,V++++,Fe++)8O20.4H2O M
FERNANDINITE Ca(V+++++,V++++,Fe++)80O20.4H2O M
BOKITE (Al,Fe+++)1,3(V+++++,V++++,Fe+++)8O20.7,4H2O M
BARIANDITE Al3(V+++++,V++++)40O100.45H2O M
STRACZEKITE (Ca,K,Ba)(V+++++,V++++)8O20.3H2O M
BANNERMANITE (Na,K)xV++++xV+++++6-xO15 (x=0,7) M
Unclassified V oxides
HUEMULITE Na4MgV+++++10O28.24H2O A
VANOXITE V++++4V+++++2O13.8H2O R (?)
NAVAJOITE (V+++++,Fe+++)10O24.12H2O M
BARNESITE (Na,Ca)2V+++++6O16.3H2O M
HENDERSONITE (Ca,Sr)x(V+++++,V++++)12O32.12H2O (x = about 2,6) O
GRANTSITE (NaCa)x(V+++++,V++++)6O16.4H2O (x = about 2,3) M
LENOBLITE V++++2O4.2H2O O (?)
SATPAEVITE Al12V++++2V+++++6O37.30H2O O (?)
Arsenites, antimonites, bismuthites, sulfites, selenites, tellurites; iodates
Arsenites, antimonites, bismuthites; without additional anions, without H2O
KARIBIBITE Fe+++2As+++4(O,OH)9 O
APUANITE Fe++Fe+++4Sb+++4O12S Q
ZIMBABWEITE (Na,K)2PbAs+++4(Ta,Nb,Ti)4O18 O
LUDLOCKITE Pb++Fe+++4As+++10O22 A
STIBIVANITE (-2M,-2O) Sb+++2V++++O5 O/M
Arsenites, antimonites, bismuthites; with additional anions, without H2O
FETIASITE (Fe++,Fe+++,Ti++++)3O2(As+++2O5) M
ARMANGITE Mn++26As+++18O50(OH)4(CO3) R
NANLINGITE NaLiCa5Mg12Fe++(AsO3)8F14 R
ASBECASITE Ca3(Ti,Fe,Sn)(Be,B,Al)2(As+++,Sb+++)3O6(SiO4)2 R
STENHUGGARITE CaFe+++(As+++O2)(As+++Sb+++O5) Q
TRIGONITE Pb3Mn(As+++O3)2(As+++O2OH) M
DERBYLITE Fe+++4Ti++++3Sb+++O13(OH) M
GRAESERITE Fe+++4Ti3As+++O13(OH) M
HEMLOITE (As,Sb)2(Ti,V,Fe,Al)12O23OH A
FREEDITE Pb8Cu+(As+++O3)2O3Cl5 M
EKATITE (Fe+++,Fe++,Zn)12(OH)6(AsO3)6[AsO3,HOSiO3]2 H
Arsenites, antimonites, bismuthites; without additional anions, with H2O
CAFARSITE (Ca,Na,[])19Ti8Fe+++4Fe++4(AsO3)28F C
LAZARENKOITE (Ca,Fe++)Fe+++As+++3O7.3H2O O
ROUSEITE Pb2Mn++(As+++O3)2.2H2O A
VAJDAKITE [(Mo++++++O2)2(H2O)2As+++2O5)].H2O M
Arsenites, antimonites, bismuthites; with additional anions, with H2O
NEALITE Pb4Fe++(As+++++O3)2Cl4.2H2O A
SEELITE Mg(UO2)(AsO4)0,6(AsO3)1,4.7H2O M
TOOELEITE Fe+++6(As+++O3)4SO4(OH)4.4H2O O
Selenites without additional anions, without H2O
Selenites with additional anions, without H2O
SOFIITE Zn2(Se++++O3)Cl2 O ps H
Selenites without additional anions, with H2O
LARISAITE (H3O)(Na,K)(UO2)3O2(SeO3)2.4H2O M
Selenites with additional anions, with H2O
PIRETITE Ca(UO2)3(SeO3)2(OH)4.4H2O O
Tellurites without additional anions, without H2O
WALFORDITE (Fe+++,Te++++++)(Te++++3O8) C
RAJITE CuTe++++2O5 M
CARLFRIESITE CaTe++++2Te++++++O8 M
DENNINGITE (Ca,Mn)(Mn,Zn)(Te2O5)2 Q
CHOLOALITE PbCu++(Te++++O3)2.H2O C
FAIRBANKITE Pb12++(Te++++O3)11(SO4) A
Tellurites with additional anions, without H2O
PINGGUITE Bi6Te++++++2O15 O
TLAPALLITE H6(Ca,Pb)2(Cu,Zn)3(SO4)(Te++++O3)4(Te++++++O6) M
Tellurites without additional anions, with H2O
ILIRNEYITE Mg0,5[ZnMn+++(TeO3)3].4,5H2O H
KEYSTONEITE Mg0,5[Ni++Fe+++(TeO3)3].4,5H2O H
KINICHILITE Mg0,5[Mn++Fe+++(TeO3)3].4,5H2O H
ZEMANNITE Mg0,5[Zn++Fe+++(Te++++O3)3].4,5H2O H
BLAKEITE Fe+++2(TeO3)3 (?)
EMMONSITE Fe+++2Te++++3O9.2H2O A
Tellurites with additional anions, with H2O
POUGHITE Fe+++2(TeO3)2(SO4).3H2O O
CESBRONITE Cu++3Te++++++O4(OH)4 O
EZTLITE Pb++2Fe+++3(Te++++O3)3(SO4)O2Cl M
JUABITE CaCu10(Te++++O3)4(As+++++O4)4(OH)2.4H2O A
Iodates: Trigonal [IO3] pyramids (mostly).
Iodates without additional anions, without H2O
Iodates with additional anions, without H2O
Iodates without additional anions, with H2O
Iodates with additional anions, with H2O
Oxides, etc. unclassified
XUITE Ca3Fe2[(AlO3(OH)]3 C
PSEUDOPOMITE Ca3,5[V++++6V+++++9O37(CO3)].29H2O A
POMITE Ca3[V++++5V+++++10O37(CO3)].37H2O A
PANDORAITE-Ba BaV++++5V+++++2O16.3H2O M
NOGGERATHITE-(Ce) (Ce,Ca)2Zr2(Nb,Ti)(Ti,Nb)2Fe++O14 O
NOLLMOTZITE Mg[U+++++(U++++++O2)2O4F3].4H2O M
OTTOITE Pb2Te++++++O5 M
PACKRATITE Ca11(As+++V+++++10V++++2As+++++6O51)2.83H2O A
PANDORAITE-Ca CaV++++5V+++++2O16.3H2O M
PANGUITE (Ti++++,Sc,Al,Mg,Zr,Ca)1,8O3 O
PASEROITE PbMn++(Fe+++,[])2(V+++++,Ti,[])18O38 R
MILLSITE Cu++(Te++++O3).2H2O M
PARATIMROSEITE Pb2Cu++4(Te++++++O6)2(H2O)2 O
MAGNESIOHOGBOMITE-2N4S [(Mg8,43Fe++1,57)Al22Ti++++2O46(OH)2] R
MAPIQUIROITE (Sr,Pb)(U,Y)Fe2(Ti,Fe+++,Cr+++)18O38 R
MOJAVEITE Cu6[Te++++++O4(OH)2](OH)7Cl R
NASHITE Na3Ca2[(V++++V+++++9)O28].24H2O M
MENGXIANMINITE (Ca,Na)2Sn2(Mg,Fe)3Al8[(BO3)(BeO4)O6]2 O
MIANNINGITE ([],Pb,Ce,Na)(U++++,Mn,U++++++)Fe+++2(Ti,Fe+++)18O38 R
VESTAITE (Ti++++Fe++)Ti++++3O9 M
MIRNYITE SrZr++++(Ti++++12Cr+++6)Mg2O38 A
MORRISONITE Ca11(As3+V4+2V5+10As5+6O51)2.78H2O M
VORLANITE (CaU++++++)O4 C ps H
TSCHAUNERITE (Fe++)(Fe++Ti++++)O4 O
TULULITE Ca14(Fe+++,Al)(Al,Zn,Fe+++,Si,P,Mn,Mg)15O36 C
USTURITE {Ca3}[Sb+++++Zr](Fe+++3)O12 C
PISEKITE-(Y) (Y,As,Ca,Fe,U)(Nb,Ti,Ta)O4  
TEWITE (K1,5[]0,5)(Te1,25W0,25[]0,5)W5O19 O
WERNERBAURITE (NH4)4Ca[V+++++10O28].16H2O A
WERNERKRAUSEITE Ca(Fe+++,Mn+++)2Mn++++O6 O
WUMUITE KAl0,33W2,67O9 H
ZINCOVELESITE-6N6S Zn3(Fe+++,Mn+++,Al,Ti)8O15(OH) R
VANARSITE NaCa12(As+++V+++++8,5V4++++3,5As+++++6O51)2.78H2O M
SEGERSTROMITE Ca3(As+++++O4)2[As+++(OH)3]2 C
RAKOVANITE (NH4)3Na3[V10O28].12H2O. M
ROWLEYITE [Na(NH4,K)9Cl4][V2(P,As)O8]6.n[H2O,Na,NH4,K,Cl] C
SACCOITE Ca2Mn+++2F(OH)8.0,5(SO4) Q
TIMROSEITE Pb2Cu++5(Te++++++O6)2(OH)2 O
SCHINDLERITE (NH4)4Na2[V+++++10O28].10H2O A
THORNEITE Pb6(Te++++++2O10)(CO3)Cl2(H2O) M
SHINKOLOBWEITE Pb1,25[U+++++(H2O)2(U++++++O2)5O8(OH)2](H2O)5 O
TAZZOLIITE Ba2CaSr0.5Na0.5Ti2Nb3SiO17[PO2(OH)2]0.5 O
RAISAITE Cu++Mg[Te++++++O4(OH)2].6H2O M
DZHULUITE {Ca3}[Sb+++++Sn++++](Fe+++3)O12 C
ECKHARDITE (Ca,Pb)Cu++Te++++++O5(H2O) M
ELBRUSITE {Ca3}[U+++++0,5Zr1,5](Fe+++3)O12 C
FEIITE Fe++2(Fe++Ti++++)O5 O
FUETTERERITE Pb3Cu++6Te++++++O6(OH)7Cl5 R ps H
GAJARDOITE KCa0,5As+++4O6Cl2.5H2O H / A
GATEWAYITE Ca6(As+++V++++3V+++++9As+++++6O51).31H2O M
EUREKADUMPITE (Cu,Zn)16(Te++++O3)2(AsO4)3Cl(OH)18.7H2O O ps H
ADANITE Pb2(Te++++O3)(SO4) M
ALMEIDAITE PbZn2(Mn,Y)(Ti,Fe+++)18O37(OH,O) R
BICAPITE [KNa2Mg2(H2O)25][H2PV+++++12O40(V+++++O)2] Q
CUYAITE Ca2Mn+++As+++14O24Cl M
BLUESTREAKITE K4Mg2(V++++2V+++++8O28).14H2O M
BURROITE Ca2(NH4)2(V10O28).15H2O A
CASEYITE [(V+++++O2)Al7,5(OH)15(H2O)13]2[H2V++++V+++++9O28][V+++++10O28]2.90H2O M
GELOSAITE Bi(Mo++++++,Mo+++++)2-2,5O7(OH).H2O M
KEGGINITE Pb3Ca3[AsV12O40(VO)].20H2O R
KOKINOSITE Na2Ca2(V+++++10O28).24H2O A
KROUPAITE KPb0,5[(UO2)8O4(OH)10].10H2O O
KANGITE (Sc,Ti,Al,Zr,Mg,Ca,[])2O3 C
LAGALYITE Ca2xMn1-xO2.1,5-2H2O (x = 0,05-0,08) M
LEESITE K(H2O)2[(UO2)4O2(OH)5].3H2O O
LUMSDENITE NaCa3Mg2(As+++V++++2V+++++10As+++++6O51).45H2O A
GORERITE Ca[AlFe+++11]O19 H
GREENWOODITE Ba2-x(V+++OH)xV9(Fe+++,Fe++)2Si2O22 R
POSTITE Mg(H2O)6Al2(OH)2(H2O)8(V10O28).13H2O O
GUNTERITE Na4Ca[V10O28].20H2O M ps H
HAGSTROMITE Pb8Cu++(Te++++++O6)2(CO3)Cl4 O
HAITAITE-(La) LaU++++Fe+++2(Ti13Fe++4Fe+++)O38 R
HEAMANITE-(Ce) (K0,5Ce0,5)TiO3 C
LEPAGEITE Mn++3(Fe+++7Fe++4)O3[Sb+++5As+++8O34] A
JOELBRUGGERITE Pb3Zn3(Sb+++++,Te++++++)As2O13(OH,O) H
Carbonates without additional anions, without H2O
Alkali carbonates
Alkali-earth (and other M2+) carbonates
KUTNOHORITE Ca(Mn++,Mg,Fe++)(CO3)2 R
ANKERITE Ca(Fe++,Mg,Mn)(CO3)2 R
BENSTONITE (Ba,Sr)6(Ca,Mn)6Mg(CO3)13 R
Alkali and alkali-earth carbonates
KHANNESHITE (NaCa)3(Ba,Sr,Ce,Ca)3(CO3)5 H
BURBANKITE (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 H
With rare-earth elements (REE)
SAHAMALITE-(Ce) (Mg,Fe++)Ce2(CO3)4 M
PETERSENITE-(Ce) (Na,Ca)4(Ce,La,Nd,Sr,Pr,Sm,Ba)2(CO3)5 M
REMONDITE-(Ce) Na3(Ce,La,Ca,Na,Sr)3(CO3)5 M ps H
REMONDITE-(La) Na3(La,Ce,Ca)3(CO3)5 M ps H
PARATOOITE-(La) (REE,Ca,Na,Sr)6Cu(CO3)8 or REE3(Ca,Sr)2NaCu(CO3)8 O
Carbonates with additional anions, without H2O
With Cu, Co, Ni, Zn, Mg, Mn
GEORGEITE Cu++5(CO3)3(OH)4.6H2O am.
KOLWEZITE (Cu++,Co)2(CO3)(OH)2 A
ROSASITE (Cu++,Zn)2(CO3)(OH)2 M
DEFERNITE Ca6(CO3)2-x(SiO4)x(OH)7(Cl,OH)1-2x (x=0,5) O
LOSEYITE (Mn,Zn)7(CO3)2(OH)10 M
SCLARITE (Zn,Mg,Mn++)4Zn3(CO3)2(OH)10 M
With alkalies, etc.
With alkali-earth cations
With rare earth elements (REE)
CORDYLITE-(La) (Na,Ca)Ba(La,Ce,Sr)2(CO3)4F H
CEBAITE-(Ce) Ba3Ce2(CO3)5F2 M
CEBAITE-(Nd) Ba3(Nd,Ce)2(CO3)5F2 M
ARISITE-(Ce) NaCe2(CO3)2[(CO3)1-xF2x]F H
ARISITE-(La) NaLa2(CO3)2[F2x(CO3)1-x]F H
PARISITE-(La) Ca(La,Nd,Ce)2F2(CO3)3 M ps R ?
PARISITE-(Nd) Ca(Nd,Ce,La)2(CO3)3F2 R
SYNCHYSITE-(Nd) Ca(Nd,La)(CO3)2F M ps H
RONTGENITE-(Ce) Ca2(Ce,La)3(CO3)5F3 R
With Pb, Bi
With (Cl), SO4, PO4, TeO3
MANGANOTYCHITE Na6(Mn++,Fe++,Mg)2(SO4)(CO3)4 C
DAQINGSHANITE-(Ce) (Sr,Ca,Ba)3(Ce,La)(PO4)(CO3)3-x(OH,F)x H
REEDERITE-(Y) (Na,Al,Mn,Ca)15(Y,Ce,Nd,La)2(CO3)9(SO3F)(Cl,F) H
MINEEVITE-(Y) Na25Ba(Y,Gd,Dy)2(HCO3)4(CO3)11(SO4)2ClF2 H
PHILOLITHITE Pb12O6Mn(Mg,Mn++)2(Mn,Mg)4(SO4)(CO3)4Cl4(OH)12 Q
Carbonates without additional anions, with H2O
With medium-sized cations
With large cations (alkali and alkali-earth carbonates)
MCKELVEYITE-(Nd) (Ba,Sr)(Nd,Ce,La)(CO3)2. 4-10H2O A
MCKELVEYITE-(Y) Ba3Na(Ca,U)Y(CO3)6.3H2O A ps R
EWALDITE (Ba,Sr)(Ca,Na,Y,Ce)(CO3)2.10-12H2O H
DONNAYITE-(Y) Sr3NaCaY(CO3)6.3H2O A ps R
LANTHANITE-(Nd) (Nd,La)2(CO3)3.8H2O O
LANTHANITE-(La) (La,Ce)2(CO3)3.8H2O O
CALKINSITE-(Ce) (Ce,La)2(CO3)3.4H2O O
LANTHANITE-(Ce) (Ce,La)2(CO3)3.8H2O O
DECRESPIGNYITE-(Y) (Y,Gd,Dy)4Cu(CO3)4Cl(OH)5.2H2O M ps H
With rare earth elements (REE)
HIZENITE-(Y) Ca2Y6(CO3)11.14H2O O
Carbonates with additional anions, with H2O
With medium-sized cations
GIORGIOSITE Mg5(CO3)4(OH)2.5-6H2O (?)
DYPINGITE Mg5(CO3)4(OH)2.5H2O M (?)
INDIGIRITE Mg2Al2(CO3)4(OH)2.15H2O M (?)
CLARAITE (Cu,Zn)15(AsO4)2(CO3)4(SO4)(OH)14.7H2O A
CARESITE (Fe++,Mg)4Al2(OH)12(CO3).3H2O R
QUINTINITE (Mg,Fe++)4Al2(OH)12(CO3).3H2O H/R
QUINTINITE [Mg4Al2(OH)12][(CO3)(H2O)3] M
QUINTINITE (Mg,Fe++)4Al2(OH)12(CO3).3H2O H/R
PYROAURITE Mg6Fe+++2(CO3)(OH)16.4H2O R
REEVESITE Ni6Fe+++2(CO3)(OH)16.4H2O R
STICHTITE Mg6Cr+++2(CO3)(OH)16.4H2O R
COMBLAINITE Ni++6Co+++2(CO3)(OH)16.4H2O R
COALINGITE Mg10Fe+++2(CO3)(OH)24.2H2O R
With large and medium-sized cations
NASLEDOVITE PbMn3Al4(CO3)4(SO4)O5.5H2O (?)
MONTROYALITE Sr4Al8(CO3)3(OH,F)26.10-11H2O A (?)
SCHUILINGITE-(Nd) PbCu(Nd,Gd,Sm,Y)(CO3)3(OH).1,5H2O O
SERGEEVITE Ca2Mg11(CO3)13-x(HCO3)x(OH)x.10-xH2O (x=4) R
SZYMANSKIITE Hg+16(Ni,Mg)6(CO3)12(OH)12(H3O8).3H2O H
With large cations
KOZOITE-(Nd) (Nd,La)(CO3)(OH) O
KOZOITE-(La) (La,Ce,Nd)(CO3)(OH) O
GYSINITE-(Nd) Pb(Nd,La)(CO3)2(OH).H2O O
ANCYLITE-(La) Sr(La,Ce)(CO3)2(OH).H2O O
Uranyl Carbonates
UO2:CO3 > 1:1
WYARTITE CaU+++++(UO2)2(CO3)O4(OH).7H2O O
KAMOTOITE-(Y) (Y,Nd,Gd)2U++++++4(CO3)3O12.14,5H2O M
UO2:CO3 = 1:1
BIJVOETITE-(Y) [(Y,REE)8(H2O)25(UO2)16O8(OH)8(CO3)16](H2O)14 M ps O
UO2:CO3 < 1:1 - 1:2
UO2:CO3 = 1:3
RABBITTITE Ca3Mg3(UO2)2(CO3)6(OH)4.18H2O M
ZNUCALITE CaZn11(UO2)(CO3)3(OH)20.4H2O A
UO2:CO3= 1:4
VOGLITE Ca2Cu++(UO2)(CO3)4.6H2O M
SHABAITE-(Nd) Ca(Nd,Ce,Sm,Gd,Y)2[(UO2)(CO3)3](CO3)2(H2O)10,5 M
UO2:CO3 = 1:5
ASTROCYANITE-(Ce) Cu+2(Ce,Nd,La,Pr,Sm,Ca,Y)2(UO2)(CO3)5(OH)2.3H2O H
With SO4 or SiO4
LEPERSONNITE-(Gd) CaO.(Gd,Dy)2O3.24UO3.8CO2.4SiO2.60H2O O
Without OH or H2O
With OH
With H2O
With OH (etc.) and H2O
MBOBOMKULITE (Ni,Cu)Al4[(NO3)2,(SO4)](OH)12.3H2O M
SVEITE KAl7(NO3)4Cl2(OH)16.8H2O M
Carbonates, etc. unclassified
PUTNISITE SrCa4Cr+++8(CO3)8SO4(OH)16.25H2O O
JEZEKITE Na8[UO2(CO3)3(SO4)2].2H2O H
LINEKITE K2Ca3[(UO2)(CO3)3]2.8H2O O
MARKEYITE Ca9(UO2)4(CO3)13.28H2O O
BO3, without additional anions; 1(D).
TUSIONITE Mn++Sn++++(BO3)2 R
BO3, with additional anions; 1(D) + OH, etc.
YUANFULIITE Mg(Fe+++,Fe++,Al,Ti,Mg)(BO3)O O
KARLITE (Mg,Al)6(BO3)3(OH,Cl)4 O
AZOPROITE (Mg,Fe++)2(Fe+++,Ti,Mg)BO5 O
PINAKIOLITE (Mg,Mn++)2(Mn+++,Sb+++)BO5 M
FOLVIKITE Sb+++++9Mn+++(Mg,Mn++)10O8(BO3)4 M
TAKEUCHIITE Mn+++11[(Mn++,Mg)xFe+++y[]z](BO3)12O24 (sum x,y,z=25) O
ORTHOPINAKIOLITE Mn+++7[(Mn++,Mg)xFe+++y[]z](BO3)8O16 (sum x,y,z=17) O
CHESTERMANITE Sb+++++(Mn+++,Fe+++)5[(Mn++,Mg)xFe+++y](BO3)8O16 (sum x,y=18) O
BLATTERITE Sb+++++3(Mn+++,Fe+++)9(Mn++,Mg)35(BO3)16O32 O
HULSITE Fe++2Fe+++O2(BO3) M
MAGNESIOHULSITE (Mg,Fe++)2(Fe+++,Sn++++,Mg)BO5 M
GAUDEFROYITE Ca4Mn+++3-x(BO3)3(CO3)(O,OH)3 H
SAKHAITE Ca48Mg16(BO3)32(CO3)16.2(H2O,HCl) C
HARKERITE Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16.2(H2O,HCl) C
PERTSEVITE-(F) Mg2(BO3,SiO4)(F,OH)0,5-1 O
PERTSEVITE-(OH) Mg2(BO3,SiO4)(OH,F)0,5-1 O
B(O,OH)4, without and with additional anions; 1(T), 1(T)+OH, etc
Neso-diborates with double triangles B2(O,OH)5; 2(2D); 2(2D) + OH, etc.
WISERITE (Mn++,Mg)14B8(Si,Mg)O22(OH)10Cl Q
Neso-diborates with double tetrahedra B2O(OH)6; 2(2T)
Ino-diborates with triangles and/or tetrahedra
Tektodiborates with tetrahedra
PEPROSSIITE-(Ce) (Ce,La)Al2(B4O10)O0,5 H
FONTARNAUITE (Na,K)2(Sr,Ca)(SO4)[B5O8(OH)](H2O)2 M
TERTSCHITE Ca4B10O19.20H2O M (?)
VEATCHITE-A = Discredited Sr2B11O16(OH)5.H2O A
TERUGGITE Ca4MgAs2B12O22(OH)12.12H2O M
Heptaborates and other megaborates
ERICAITE (Fe++,Mg,Mn)3B7O13Cl O
CONGOLITE (Fe++,Mg,Mn)3B7O13Cl R
Phyllo-nonborates, etc.
WALKERITE Ca16(Mg,Li)2Cl6B52O68(OH)56.28H2O O
LONDONITE (Cs,K,Rb)Al4Be4(B,Be)12O28 C
RHODIZITE (K,Cs)Al4Be4(B,Be)12O28 C
Unclassified borates
BRAITSCHITE-(CE) (Ca,Na)7(Ce,La,Nd)2[B6O7(OH)3(O,OH)3]4.(H2O) H
SATIMOLITE KNa2(Al5Mg2)[B12O18(OH)12](OH)6Cl4.4H2O R
IQUIQUEITE K3Na4Mg(Cr++++++O4)B24O39(OH).12H2O H
Bromates, etc. unclassified
SHIMAZAKIITE-4M Ca2B2-xO5-3x(OH)3x (x=0-0,06) M
RHABDOBORITE-(Mo) Mg12Mo++++++1,33O6(BO3)6F2 H
RHABDOBORITE-(V) Mg12(V+++++,Mo++++++,W++++++)1,5O6{[BO3]6-x[(P,As)O4]xF2-x} (x smaller than 1) H
RHABDOBORITE-(W) Mg12(W++++++,V+++++)1,5O6{[BO3]6-x[(P,As)O4]xF2-x} (x smaller than 1) H
EWINGITE Mg8Ca8(UO2)24(CO3)30O4(OH)12(H2O)138 Q
* SULFATES, selenates, tellurates, chromates, molybdates, wolframates
Sulfates (selenates, etc.) without additional anions, without H2O
With small cations
With medium-sized cations
MIKASAITE (Fe+++,Al)2(SO4)3 R
With medium-sized and large cations
PYRACMONITE (NH4)3Fe+++(SO4)3 R ps H
With only large cations
Sulfates (selenates, etc.) with additional anions, without H2O
With small cations
With medium-sized cations
BRUMADOITE Cu3Te++++++O4(OH)4.5H2O M
HAUCKITE Fe+++3(Mg,Mn++)24Zn18(SO4)4(CO3)2(OH)81 H
With medium-sized and large cations
BACKITE Pb2AlTe++++++O6Cl R
ADRANOSITE-(Fe) (NH4)4NaFe2(SO4)4Cl(OH)2 Q
AGAITE Pb3Cu++Te++++++O5(OH)2(CO3) O
DANSITE-Mn Na21Mn++(SO4)10Cl3 C
DANSITE Na21Mg(SO4)10Cl3 C
DANSITE-Fe Na21Fe++(SO4)10Cl3 C
JAROSITE K2Fe+++6(SO4)4(OH)12 R
NATROALUNITE-2c (Na,Ca,K)2Al6(SO4)4(OH)12 R
BEAVERITE-Cu Pb(Cu++,Fe+++,Al)6(SO4)4(OH)12 R
ATLASOVITE Cu6Fe+++Bi+++O4(SO4)5.KCl Q
NABOKOITE Cu++7Te++++O4(SO4)5.KCl Q
WHERRYITE Pb7Cu2(SO4)4(SiO4)2(OH)2 M
MAMMOTHITE Pb6Cu4AlSb+++++O2(SO4)2Cl4(OH)16 M
SCHMIEDERITE Pb2Cu++2(Se++++O3)(Se++++++O4)(OH)4 M
ADRANOSITE-(Fe) (NH4)4NaFe+++2(SO4)4Cl(OH)2 Q
With only large cations
CARACOLITE Na2(Pb2Na)(SO4)3Cl M ps H
CHILUITE Bi6Te++++++2Mo++++++2O21 H
Sulfates (selenates, etc.) without additional anions, with H2O
With small cations
With only medium-sized cations
ILESITE (Mn++,Zn,Fe++)SO4.4H2O M
COQUIMBITE AlFe+++3(SO4)6(H2O)12.6H2O R
ROMERITE Fe++Fe+++2(SO4)4.14H2O A
BILINITE Fe++Fe+++2(SO4)4.22H2O M
DIETRICHITE (Zn,Fe++,Mn++)Al2(SO4)4.22H2O M
REDINGTONITE (Fe++,Mg,Ni)(Cr,Al)2(SO4)4.22H2O M
WUPATKIITE (Co,Mg,Ni)Al2(SO4)4.22H2O M
With medium-sized and large cations
AMMONIOVOLTAITE (NH4)2Fe++5Fe+++3Al(SO4)12(H2O)18 C
KALINITE KAl(SO4)2.11H2O M (?)
LONECREEKITE (NH4)(Fe+++,Al)(SO4)2.12H2O C
ALUM-(Na) NaAl(SO4)2.12H2O C
ALUM-(K) KAl(SO4)2.12H2O C
PERTLIKITE K2(Fe++,Mg,Mn++)2(Mg,Fe+++)4Fe+++2Al(SO4)12.18H2O Q ps C
VOLTAITE K2Fe++5Fe+++4(SO4)12.18H2O C
LOWEITE Na12Mg7(SO4)13.15H2O R
MOHRITE (NH4)2Fe++(SO4)2.6H2O M
WATTEVILLEITE Na2Ca(SO4)2.4H2O (?) O (?)
XOCOLATLITE Ca2Mn++++2Te++++++2O12.H2O M
With only large cations
ARGESITE (NH)4Bi3Cl16 R ps H
MONTANITE Bi2Te++++++O6.2H2O M (?)
OMONGWAITE (Na,K)2Ca5(SO4)6.3H2O M ps H
Sulfates (selenates, etc.) with additional anions, with H2O
With small cations
With only medium-sized cations; insular octahedra and finite units
SVYAZHINITE (Mg,Mn)(Al,Fe+++)(SO4)2F.14H2O A
COPIAPITE Fe++Fe+++4(SO4)6(OH)2.20H2O A
FERRICOPIAPITE (Fe+++,Al,Mg)Fe+++5(SO4)6(OH)2.20H2O A
With only medium-sized cations; chains of edge-sharing octahedra
With only medium-sized cations; sheets of edge-sharing octahedra
KTENASITE (Cu,Zn)5(SO4)2(OH)6.6H2O M
EDWARDSITE Cd2(Cu,Zn)3(SO4)2(OH)3.4H2O M
KARCHEVSKYITE [Mg18Al9(OH)54][Sr2(CO3,PO4)9(H2O,H3O)11] R
ZINCOWOODWARDITE (Zn,Cu)5,5-4Al2,5-4(SO4)1,5-2(OH)16.5-8H2O R ps H
WOODWARDITE Cu6Al2[(OH)16(SO)4].2,5-3H2O R
WERMLANDITE Mg7Al2(OH)18[Ca(H2O)6][SO4]2.6H2O R
SHIGAITE NaMn++6Al3(SO4)2(OH)18.12H2O R
CARRBOYDITE (Ni,Cu)14Al9(SO4,CO3)6(OH)43.7H2O (?) H
MOUNTKEITHITE (Mg,Ni)11(Fe+++,Cr,Al)3(OH)24(SO4,CO3)3,5.11H2O H
HYDROWOODWARDITE [Cu1-xAlx(OH)2][(SO4)0,5x(H2O)n] (x lower than 0,67; n = about 1,5x) R
HONESSITE Ni6Fe+++2(SO4)(OH)16.4H2O R
TORREYITE (Mg,Mn)9Zn4(SO4)2(OH)22.8H2O M
MOOREITE (Mg,Zn,Mn)15(SO4)2(OH)26.8H2O M
NAMUWITE (Zn,Cu)4(SO4)(OH)6.4H2O H
RAMSBECKITE (Cu,Zn)15(SO4)4(OH)22.6H2O M
GUARINOITE (Zn,Co,Ni)6(SO4)(OH,Cl)10.5H2O H
With only medium-sized cations; unclassified
TLALOCITE (Cu,Zn)16(Te++++O3)(Te++++++O4)2Cl(OH)25.27H2O M (?)
UTAHITE MgCu++4Zn2Te++++++3O14(OH)4.6H2O A
COQUANDITE Sb6+xO8+x(SO4)(OH)x.(H2O)1-x (x = 0,3) A
ZAHERITE Al12(SO4)5(OH)26.20H2O A
CAMEROLAITE Cu6Al3(OH)18(H2O)2[Sb(OH)6](SO4) M
With large and medium-sized cations
MALLESTIGITE Pb3Sb+++++(SO4)(AsO4)(OH)6.3H2O H
SLAVIKITE (H3O+)3Mg6Fe15(SO4)21(OH)18.98H2O R
METAVOLTINE K2Na6Fe++Fe+++6(SO4)12O2.18H2O H
PERETAITE CaSb+++4O4(OH)2(SO4)2.2H2O M
CLAIRITE (NH4)2(Fe+++,Mn+++)3(SO4)4(OH)3.3H2O A
ARZRUNITE Cu4Pb2(SO4)(OH)4Cl6.2H2O (?) O
YECORAITE Bi5Fe+++3(Te++++O3)(Te++++++O4)2O9.9H2O Q or H
DUKEITE Bi+++24Cr++++++8O57(OH)6.3H2O R
FLAGGITE Pb4Cu++4Te++++++2(SO4)2O11(OH)2(H2O) A
ALDRIDGEITE (Cd,Ca)(Cu,Zn)4(SO4)2(OH)6.3H2O M
BAIRDITE Pb2Cu++4Te++++++2O10(OH)2(SO4)(H2O) M
With large and medium-sized cations; * With NO3, CO3, B(OH)4, SiO4 or IO3
THAUMASITE Ca6Si2(CO3)2(SO4)2(OH)12.24H2O H
STURMANITE Ca6(Fe+++,Al,Mn++)2(SO4)2[B(OH)4](OH)12.25H2O H
JOURAVSKITE Ca6Mn++++2(SO4,CO3)4(OH)12.26H2O H
SIWAQAITE Ca6Al2(CrO4)3(OH)12.26H2O R
CHARLESITE Ca6(Al,Si)2(SO4)2B(OH)4(OH,O)12.26H2O H
CARRARAITE Ca3Ge++++(OH)6(SO4)(CO3).12H2O H
BENTORITE Ca6(Cr,Al)2(SO4)3(OH)12.26H2O H
BURYATITE Ca3(Si,Fe+++,Al)(SO4)[B(OH)4](O,OH)5O.12H2O R ps H
TATARSKITE Ca6Mg2(SO4)2(CO3)2Cl4(OH)4.7H2O O
CHESSEXITE Na4Ca2(Mg,Zn)3Al8(SiO4)2(SO4)10(OH)10.40H2O O
CARLOSRUIZITE K6(Na,K)4Na6Mg10(Se++++++O4)12(IO3)12.12H2O R
FUENZALIDAITE K6(Na,K)4Na6Mg10(SO4)12(IO3)12.12H2O R
BIRUNITE Ca18(SiO3)8,5(CO3)8,5(SO4).15H2O ?
Uranyl sulfates
Without cations
JACHYMOVITE (UO2)8(SO4)(OH)14.13H2O M (?)
With medium-sized cations
With medium-sized and large cations
ZIPPEITE K1,85H+0,15[(UO2)4O2(SO4)2(OH)2](H2O)4 M
RABEJACITE Ca2[(UO2)4O4(SO4)2](H2O)8 A
MARECOTTITE Mg3(H2O)18[(UO2)4O3(OH)(SO4)2]2.10H2O A
SEJKORAITE-(Y) (Y1,98Dy0,24)H+0,34[(UO2)8O88O7OH(SO4)4](OH)(H2O)26 A
Without additional anions
With additional O,V, S, Cl
WATTERSITE Hg+4Hg++Cr++++++O6 M
EDOYLERITE Hg++3Cr++++++O4S2 M
With PO4, AsO4, SiO4
FORNACITE (Pb,Cu++)3[(Cr,As)O4]2(OH) M
IRANITE Pb10Cu(CrO4)6(SiO4)2(F,OH)2 A
Molybdates, Wolframates and Niobates
BAUMOITE Ba0,5[(UO2)3O8Mo2(OH)3](H2O)3 M
Without additional anions or H2O
FERGUSONITE-(Ce) (Ce,Nd,La)NbO4.0,3H2O M
With additional anions and/or H2O
RANKACHITE CaFe++V+++++4W++++++8O36.12H2O O
MPOROROITE W++++++AlO3(OH)3.2H2O A (?)
OBRADOVICITE-Kcu H4(K,Na)Cu++Fe+++2(AsO4)(MoO4)5.12H2O O
MENDOZAVILITE-NaFe (Na,K)(Ca,Mg)2Fe+++3(PO4)2(Mo++++++8O28)(OH).9H2O M
PARAMENDOZAVILITE NaAl4Fe+++7(PO4)5(P+++++Mo++++++12O40)(OH)16.56H2O M/A
TANCAITE-(Ce) Fe+++(Ce,La,Nd)(MoO4)3.3H2O R ps C
MENDOZAVILITE-NaCu [Na2(H2O)15Cu(H2O)6][Mo8P2Fe+++3O34(OH)3] M
OBRADOVICITE-NaCu Na2(H2O)17Cu(H2O)6][Mo8As2Fe+++3O34(OH)3] O
OBRADOVICITE-NaNa [Na2(H2O)16Na(H2O)6][Mo8As2Fe+++3O33(OH)4] O
Uranium and uranyl molybdates and wolframates
With U4+
MOLURANITE H4U++++(UO2)3(MoO4)7.18H2O am.
With U6+
CALCURMOLITE ((Ca1-xNax)2(UO2)3(MoO4)2(OH)6-x.nH2O M
TENGCHONGITE CaU++++++6Mo++++++2O25.12H2O O
Thiosulfates of Pb
STEVERUSTITE Pb++5Cu+(S++++++O3S--)3(OH)5.2H2O M
Sulfates, etc. unclassified
TOMBSTONEITE (Ca0,5Pb0,5)Pb3Cu++6Te++++++2O6(Te++++O3)6(Se++++O3)2(SO4)2.3H2O R
SCENICITE [(UO2)(H2O)2(SO4)]2.3H2O O
OZERNOVSKIITE Fe++4(Te++++O4)(Te++++O3)4.7H2O M
ERSSONITE CaMg7Fe+++2(OH)18(SO4)2.12H2O R
TOMIOLLOITE Al12(Te++++O3)5[(SO3)0,5(SO4)0,5](OH)24 H
NITSCHEITE (NH4)2[(UO2)2(SO4)3(H2O)2].3H2O M
METATAMBOITE Fe+++3(OH)(H2O)2(SO4)(Te++++O3)3(Te++++O(OH)2)(H2O) M
OPHIRITE Ca2Mg4[Zn2Mn+++2(H2O)2(Fe+++W9O34)2].46H2O A
NORTHSTARITE Pb6(Te++++O3)5(S++++++O3S--) H
MULLERITE Pb2Fe+++(Te++++++O6)Cl R
LUSSIERITE Na10[(UO2)(SO4)4](SO4)2(H2O)3 M
MINOHLITE (Cu,Zn)7(SO4)2(OH)10.8H2O R ps H
SCORDARIITE K8(Fe+++0,67[]0,33)[Fe+++3O(SO4)6]2.14H2O R
WILDCATITE CaFe+++Te++++++O5(OH) R
WETHERILLITE Na2Mg(UO2)2(SO4)4.18H2O Na2Mg(UO2)2(SO4)4.18H2O M
THERASIAITE (NH4)3KNa2Fe++Fe+++(SO4)3Cl5 M
TAMBOITE Fe+++3(OH)(H2O)2(SO4)(Te++++O3)3[Te++++O(OH)2](H2O)3 M
COSSAITE (Mg0,5,[])Al6(SO4)6(HSO4)F6.36H2O R ps H
PLAVNOITE K0,8Mn0,6[(UO2)2O2(SO4)].3,5H2O M
PHILOXENITE (K,Na,Pb)4(Na,Ca)2(Mg,Cu)3(Fe+++0,5Al0,5)(SO4)8 A
BRIDGESITE-(Ce) CaCe2Cu6(SO4)4(OH)12.H2O M
HUIZINGITE-(Al) (NH4)9Al3(SO4)8(OH)2.4H2O A
Phosphates, etc. without additional anions, without H2O
With small cations (some also With larger ones)
With medium-sized cations
SIMFERITE Li0,5(Mg,Mn+++)5(PO4)3 O
CHOPINITE (Mg,Fe++)3(PO4)2 M
SARCOPSIDE (Fe++,Mn,Mg)3(PO4)2 M
BEUSITE Mn++Mn++2(PO4)2 M
LYONSITE Cu++3Fe+++4(VO4)6 O
BEUSITE-(Ca) CaMn++2(PO4)2 M
ZAVALIAITE (Mn++,Fe++,Mg)3(PO4)2 M
With medium-sized and large cations
FERROALLUAUDITE NaCaFe++(Fe++,Mn++,Fe+++)2(PO4)3 M
NICKENICHITE Na(Ca0,5Cu0,5)MgMg2(AsO4)3 M
YAZGANITE []NaMgFe+++2(AsO4)3.H2O M
VARULITE Na2Mn(MnFe+++)(PO4)3 M
MANITOBAITE (Na,Ca)3(Mn++,Fe++)5(Al,Fe+++)1,5(PO4)6 M
SCHAFERITE {Ca2Na}[Mg2](V+++++3)O12 C
PALENZONAITE {Ca2Na}[Mn++2](V+++++3)O12 C
BERZELIITE {Ca2Na}[Mg2](As+++++3)O12 C
MANGANBERZELIITE {Ca2Na}[Mn++2](As+++++3)O12 C
VITUSITE-(Ce) Na3(Ce,La,Nd)(PO4)2 O
OLGITE Na(Na,Sr)2(Ba,Sr)(PO4)2 H
TUITE gamma-(Ca,Mg,Na)3(PO4)2 R
CHLADNIITE Na12Ca5(Mg,Fe++)43(PO4)36 R
STORNESITE-(Y) (Y,Ca)[]2Na6(Ca,Na)8(Mg,Fe)43(PO4)36 R
FILLOWITE Na12Ca4(Mn++,Fe++)44(PO4)36 M
GALILEIITE (Na,K)12(Fe++,Mn++,Cr)48(PO4)36 R
HARRISONITE Ca(Fe++,Mg)6(PO4)2(SiO4)2 R
KOSNARITE KZr++++2(PO4)3 R ps C
PANETHITE (Na,Ca,K)2(Mg,Fe++,Mn)2(PO4)2 M
FILATOVITE K(Al,Zn)2(As+++++,Si)2O8 M
HAGENDORFITE-(Na)(Na) Fe++Mn++(PO4)-(Na)(Na) M
KEPLERITE Ca9(Ca0,5[]0,5)Mg(PO4)7 R
ALLUAUDITE-Ca[] []4Ca4Mn++4Fe+++8(PO4)12 M
HATERTITE NaNaCa(Cu++Fe+++)(AsO4)3 M
DYRNAESITE-(La) Na8Ce++++(La,REE)2(PO4)6 O
ANGARFITE NaFe+++5(PO4)4(OH)4.4H2O O
ALLUAUDITE-Na[] []4Na4Mn++4Fe+++8(PO4)12 M
CANUTITE Na[]MnMn2(AsO4)[AsO3(OH)]2 M
ERIKAPOHLITE ([]0,5Cu0,5)CuCaZn2(AsO4)3.H2O M
With only large cations
WAKEFIELDITE-(Ce) (Ce,La,Nd,Y,Pr,Sm)(V,As)O4 Q
MONAZITE-(Sm) (Sm,Gd,Ce,Th,Ca)(PO4) M
MONAZITE-(Nd) (Nd,Ce,Sm)(PO4) M
MONAZITE-(Ce) (Ce,La,Nd,Th)PO4 M
Phosphates, etc., with additional anions, without H2O
ARSMIRANDITE Na18Cu12Fe+++O8(AsO4)8Cl5 M
With small and medium-sized cations
AXELITE Na14Cu7(AsO4)8F2Cl2 Q
With only medium-sized cations, (OH, etc.):RO4 about 1:1
TRIPLITE (Mn,Fe++,Mg,Ca)2(PO4)(F,OH) M
WOLFEITE (Fe++,Mn++)2(PO4)(OH) M
JOOSTEITE Mn++(Mn+++,Fe+++)(PO4)O M
STANEKITE Fe+++(Mn++,Fe++,Mg)(PO4)O M
SATTERLYITE (Fe++,Mg,Fe+++)2(PO4)(OH) H
AURIACUSITE Fe+++Cu++(AsO4,Sb+++++O4)(O,OH) O
LAZULITE (Mg,Fe)Al2(PO4)2(OH)2 M
SCORZALITE (Fe++,Mg)Al2(PO4)2(OH)2 M
AVERIEVITE Cu++5O2(VO4)2.n(CuCl) or Cu++5O2(VO4)2.n(CuCl2) or Cu++5O2(VO4)2.n(K,Rb,Cs)Cl M
RICHELLITE CaFe+++2(PO4)2(OH,F)2 am.
LIPSCOMBITE (Fe++,Mn++)Fe+++2(PO4)2(OH)2 Q
KHORIXASITE (Bi0,67[]0,33)Cu(VO4)(OH) M
With only medium-sized cations, (OH, etc.):RO4 > 1:1 and < 2:1
ROCKBRIDGEITE (Fe++,Mn)Fe+++4(PO4)3(OH)5 O
FRONDELITE Mn++Fe+++4(PO4)3(OH)5 O
FERRIROCKBRIDGEITE (Fe+++0,67[]0,33)2(Fe+++)3(PO4)3(OH)4(H2O) O
FERROROCKBRIDGEITE (Fe++,Mn++)2(Fe+++)3(PO4)3(OH)4(H2O) O
With only medium-sized cations, (OH, etc.):RO4= 2:1
PARWELITE (Mn,Mg)5Sb(As,Si)2O12 M
With only medium-sized cations, (OH, etc.):RO4 > 2:1
FLINKITE Mn++2Mn+++(AsO4)(OH)4 O
GERDTREMMELITE (Zn,Fe++)(Al,Fe+++)2(AsO4)(OH)5 A
TURTMANNITE (Mn,Mg)22,5Mg3-3x[(V,As)O4]3[SiO4]3[AsO3]xO5-5x(OH)20+x R ps H
ARAKIITE (Zn,Mn++)(Mn++,Mg)12(Fe+++,Al)2(As+++O3)(As+++++O4)2(OH)23 M
CARLFRANCISITE Mn++3(Mn++,Mg,Fe+++,Al)42[As+++O3]2(As+++++O4)4[(Si,As+++++)O4]6[(As+++++,Si)O4]2(OH)42 R
DIXENITE Cu+Mn++14Fe+++(As+++O3)5(SiO4)2(As+++++O4)(OH)6 R
HEMATOLITE (Mn,Mg,Al)15(AsO3)(AsO4)2(OH)23 R
KRAISSLITE (Mn++,Mg)24Zn3Fe+++(As+++O3)2(As+++++O4)3(SiO4)6(OH)18 H
MCGOVERNITE (Mn,Mg,Zn)22(AsO3)(AsO4)3(SiO4)3(OH)20 R
SYNADELPHITE Mn++9(As+++++O4)2(As+++O3)(OH)9.2H2O A ps O
HOLDENITE (Mn,Mg)6Zn3(AsO4)2(SiO4)(OH)8 O
KOLICITE Mn7Zn4(AsO4)2(SiO4)2(OH)8 O
SABELLIITE (Cu,Zn)2Zn[(As,Sb)O4](OH)3 R
THEISITE Cu5Zn5(As+++++,Sb+++++)2O8(OH)14 O
With medium-sized and large cations, (OH, etc.):RO4< 0.5:1
ARROJADITE-(BaNa) BaNa3(NaCa)Fe++13Al(PO4)11(PO3OH)(OH) M
ARROJADITE-(KFe) KNa3CaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(KNa) KNa5CaFe++13Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(PbFe) Na2PbCaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(SrFe) Na2SrCaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(BaFe) Na2BaCaFe++14Al(PO4)11(PO3OH)(OH)2 M
SAMUELSONITE (Ca,Ba)Ca8(Fe++,Mn++)4Al2(PO4)10(OH)2 M
GRIPHITE Na4Ca6(Mn,Fe++,Mg)19Li2Al8(PO4)24(F,OH)8 C
FLUORARROJADITE-(NaFe) {Na2}{Fe++[]}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)F2 M
FLUORCARMOITE-(BaNa) (Ba[])(NaNa)Ca(Na2[])Mg13Al(PO4)11(PO3OH)F2 M
FLUORARROJADITE-(KNa) {KNa}{Na2}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)F2 M
FERRIARROJADITE-(BaNa) {Ba[]}{Na2}{Ca}{Na2[]}{Fe++13}{Fe+++}(PO4)11(HPO4)(OH)2 M
ARROJADITE-(NaFe) {Na2}{Fe++[]}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)(OH)2 M
ARROJADITE-(KFeNa) {KNa}{Fe++[]}{Ca}{Na3}{Fe++13}{Al}(PO4)11(HPO4)(OH)2 M
With medium-sized and large cations, (OH, etc.):RO4 = 0.5:1
FEINGLOSITE Pb2(Zn,Fe++)[(As,S)O4]2.H2O M
GAMAGARITE Ba2(Fe+++,Mn+++)(VO4)2(OH) M
BUSHMAKINITE Pb2(Al,Cu++)PO4(V+++++,Cr++++++)O4(OH) M
With medium-sized and large cations, (OH,etc.):RO4 = 1:1
THADEUITE (Ca,Mn++)(Mg,Fe++,Mn+++)3(PO4)2(OH,F)2 O
MAXWELLITE (Na,Ca)(Fe+++,Al,Mg)(AsO4)(F,O) M
DRUGMANITE Pb2(Fe+++,Al)H(PO4)2(OH)2 M
KULANITE Ba(Fe++,Mn,Mg)2Al2(PO4)3(OH)3 A
PENIKISITE Ba(Mg,Fe++)2Al2(PO4)3(OH)3 A
JOHNTOMAITE Ba(Fe++,Ca,Mn++)2Fe3+++2(PO4)3(OH)3 M
CIRROLITE Ca3Al2(PO4)3(OH)3 (?)  
BJAREBYITE (Ba,Sr)(Mn++,Fe++,Mg)2Al2(PO4)3(OH)3 M
PERLOFFITE Ba(Mn,Fe++)2Fe+++2(PO4)3(OH)3 M
PALERMOITE (Sr,Ca)(Li,Na)2Al4(PO4)4(OH)4 O
CARMINITE PbFe+++2(AsO4)2(OH)2 O
SEWARDITE Ca2Fe+++2(AsO4)2(OH)2 O
CECHITE Pb(Fe++,Mn)(VO4)(OH) O
PAGANOITE (Ni,Co)Bi+++As+++++O5 A
ATTAKOLITE (Ca,Sr)Mn++(Al,Fe+++)4[(Si,P)O4]H(PO4)3(OH)4 M
With medium-sized and large cations, (OH, etc.):RO4= 1:5:1
With medium-sized and large cations, (OH, etc.):RO4 = 2:1, 2.5:1
MEDENBACHITE Bi2Fe+++(Cu,Fe++)O2(OH)2(AsO4)2 A
NEUSTADTELITE Bi2Fe+++(Fe+++,Co++)O2(OH)2(AsO4)2 A
HEYITE Pb5Fe++2(VO4)2O4 M
JAMESITE Pb2ZnFe+++2(Fe+++2,8Zn1,2)(AsO4)4(OH)8[(OH)1,2O0,8] A
LULZACITE Sr2Fe++(Fe++,Mg)2Al4(PO4)4(OH)10 A
With medium-sized and large cations, (OH, etc.):RO4 = 3:1
CORKITE PbFe+++3(PO4)(SO4)(OH)6 R
VISEITE Ca10Al24(SiO4)6(PO4)7O22F3.72H2O (?) C
EYLETTERSITE (Th,Pb)1-xAl3(PO4,SiO4)2(OH)6 R
BENAUITE (Sr,Ba)(Fe+++,Al)3(PO4)2(SO4)2(OH,H2O)6 R
GRAULICHITE-(La) LaFe+++3(AsO4)2(OH)6 R
FLORENCITE-(Sm) (Sm,Nd)Al3(PO4)2(OH)6 R
ZAIRITE Bi(Fe+++,Al)3(PO4)2(OH)6 R
GRAULICHITE-(Ce) (Ce,Ba)(Fe+++,Al)3(AsO4)2(OH,H2O)6 A
FLORENCITE-(La) (La,Ce)Al3(PO4)2(OH)6 R
FLORENCITE-(Nd) (Nd,Ce)Al3(PO4)2(OH)6 A
GALLOPLUMBOGUMMITE Pb(Ga,Al)3-xGexH1-x(PO4)2(OH)6 (x between 0 and 1) R
With medium-sized and large cations, (OH, etc.):RO4 = 4:1
RETZIAN-(Ce) Mn2Ce(AsO4)(OH)4 O
RETZIAN-(La) (Mn,Mg)2(La,Ce,Nd)(AsO4)(OH)4 O
RETZIAN-(Nd) Mn2(Nd,Ce,La)(AsO4)(OH)4 O
KOLITSCHITE Pb[Zn0,5[]0,5]Fe3(AsO4)2(OH)6 M ps R
BRENDELITE (Bi+++,Pb++)2(Fe+++,Fe++)O2(OH)(PO4) M
BETPAKDALITE-NaNa [Na2(H2O)16Na(H2O)6][Mo8As2Fe+++3O33(OH)4] M
With only large cations, (OH, etc.):RO4 = 0.33:1
MORELANDITE (Ba,Pb)3(Ca,Pb)2(AsO4,PO4)3Cl H
MIMETITE-M Pb5(AsO4)3Cl M ps H
KUANNERSUITE-(Ce) NaBa3(Ce,Nd,La)(PO4)3(F,Cl) R ps H
BELOVITE-(La) Sr3Na(La,Ce)(PO4)3(F,OH) R
DELONEITE (Na,Ca,Ce)2Sr3(Ca,Ce)5(PO4)6(OH)F R
BELOVITE-(Ce) Sr3Na(Ce,La)(PO4)3(F,OH) R
ZADOVITE BaCa6[(SiO4)(PO4)](PO4)2F R
ARADITE BaCa6[(SiO4)(VO4)](VO4)2F R
With only large cations, (OH, etc.):RO4 about 1:1
ARTSMITHITE Hg+4Al(PO4)2-x(OH)1+3x (x = 0,26) M
DARGAITE BaCa12(SiO4)4(SO4)2O3 R
ARAVAITE Ba2Ca18(SiO4)6(PO4)3(CO3)F3O R
Phosphates without additional anions, with H2O
BATAGAYITE CaZn2(Zn,Cu)6(PO4)4[PO3(OH)]3.12H2O M
With small and large/medium cations
FAHEYITE (Mn,Mg)Fe+++2Be2(PO4)4.6H2O H
GAINESITE Na(Na,K)(Be,Li)(Zr,Zn)2(PO4)4.1-2H2O Q
PAHASAPAITE (Ca5,5Li3,6K1,2Na0,2[]13,5)Li8[Be24P24O96].38H2O C
KEYITE ([]0,5Cu0,5)CuCdZn2(AsO4)3.H2O M
PUSHCHAROVSKITE K0,6Cu18(AsO4)(HAsO4)10(H2AsO4)4(OH)9,6.18,6H2O A
BRANDAOITE [BeAl2(PO4)2(OH)2(H2O)4](H2O) A
With only medium-sized cations, RO4:H2O = 1:1
SCHUBNELITE Fe+++2-x(V+++++,V++++)2O4(OH)4 A
RADOVANITE Cu2Fe+++(As+++O2)(As+++++O4)(OH)2.H2O O
KAZAKHSTANITE Fe+++5V++++3V+++++12O39(OH)9.9H2O M
KOLOVRATITE Hydrous vanadate of Ni and Zn (?)
CHONGITE Ca3Mg2(AsO4)2(AsO3OH)2.4H2O M
With only medium-sized cations, RO4:H2O = 1:1.5
LANDESITE Fe+++Mn++2(PO4)2(OH).2H2O O
GARYANSELLITE (Mg,Fe+++)3(PO4)2(OH,O).1,5H2O O
KAATIALAITE Fe+++As+++++3O9.6-8H2O M
With only medium-sized cations, RO4:H2O = 1:2
REDONDITE = A variety of Variscite Al(PO4).2H2O  
LUDLAMITE (Fe++,Mg,Mn)3(PO4)2.4H2O M
With only medium-sized cations, RO4:H2O about 1:2.5
CHUDOBAITE (Mg,Zn)5H2(AsO4)4.10H2O A
GEIGERITE Mn5(H2O)8(AsO3OH)2(AsO4)2.2H2O A
SWITZERITE (Mn++,Fe++)3(PO4)2.7H2O M
KLAJITE MnCu4(AsO4)2(AsO3OH)2.9-10H2O A
BARICITE (Mg,Fe++,Fe+++)3(PO4)2.8(H2O,OH) M
ARUPITE (Ni,Fe++)3(PO4)2.8H2O M
KANKITE Fe+++AsO4.3,5H2O M
METAKOTTIGITE (Zn,Fe+++,Fe++)3(AsO4)2.8(H2O,OH) A
HLOUSEKITE (Ni,Co)Cu4(AsO4)2(AsO3OH)2.9H2O A
BABANEKITE (Cu,Zn,Co,Ni)3(AsO4)2.8H2O M
With large and medium-sized cations, RO4:H2O > 1:1
TASSIEITE (Na,[])Ca2(Mg,Fe++,Fe+++)2(Fe+++,Mg)2(Fe++,Mg)2(PO4)6.2H2O O
WICKSITE NaCa2(Fe++,Mn++)4MgFe+++(PO4)6.2H2O O
GRISCHUNITE NaCa2Mn++5Fe+++(AsO4)6.2H2O O
BEDERITE []Ca2Mn++2Fe+++2Mn++2(PO4)6.2H2O O
ESPADAITE Na4Ca3Mg2[AsO3(OH)]2[AsO2(OH)2]10.7H2O O
LIRAITE NaCa2Mn++2[Fe+++Fe++]Mn++2(PO4)6(H2O)2 O
MANECKIITE (Na[])Ca2Fe++2(Fe+++Mg)Mn2(PO4)6.2H2O O
With large and medium-sized cations, RO4:H2O = 1:1
MESSELITE Ca2(Fe++,Mn)(PO4)2.2H2O A
COLLINSITE Ca2(Mg,Fe++)(PO4)2.2H2O A
HILLITE Ca2(Zn,Mg)(PO4)2.2H2O A
BRANDTITE Ca2(Mn++,Mg)(AsO4)2.2H2O M
ROSELITE Ca2(Co++,Mg)(AsO4)2.2H2O M
MAWBYITE Pb(Fe+++,Zn)2(AsO4)2(OH,H2O)2 M
TSUMCORITE Pb(Zn,Fe+++)2(AsO4)2(OH,H2O)2 M
THOMETZEKITE Pb(Cu,Zn)2(AsO4)2(OH,H2O)2 M/A (?)
SCHNEEBERGITE (Bi+++,Ca)(Co,Ni,Fe+++)2(AsO4)2[(H2O)(OH)] M
NICKELSCHNEEBERGITE (Bi+++,Ca)(Ni,Co,Fe+++)2(AsO4)2[(H2O)(OH)] M
CABALZARITE Ca(Mg,Al,Fe+++)2(AsO4)2(H2O,OH)2 M
RAPPOLDITE Pb(Co,Ni,Zn)2(AsO4)2.2H2O A ps M
LUKRAHNITE Ca(Cu,Zn)(Fe+++,Zn)(AsO4)2.2(H2O,OH) A
With large and medium-sized cations, RO4:H2O < 1:1
WALENTAITE Fe+++3(P0,84As0,16O4)2(O,OH)6As+++2,56Ca0,42Na0,28Mn++0,35Fe++0,30O6,1(OH)0,9(H2O)5,2 O
NIAHITE (NH4)(Mn++,Mg,Ca)PO4.H2O O
FRANCOANELLITE H6(K,Na)3(Al,Fe+++)5(PO4)8.13H2O R
RIMKOROLGITE (Mg,Mn)5(Ba,Sr,Ca)(PO4)4.8H2O M ps H
FAHLEITE Zn5CaFe+++2(AsO4)6.14H2O O
SMOLYANINOVITE (Co,Ni,Mg,Ca)3(Fe+++,Al)2(AsO4)4.11H2O O
BARAHONAITE-(Fe) (Ca,Cu,Na,Fe+++,Al)6Fe+++(AsO4)4.6(H2O,OH,Cl) M
BARAHONAITE-(Al) (Ca,Cu,Na,Al)6Al(AsO4)4.6-6,5(H2O,OH) M
NATROWALENTAITE [Fe+++0,5Na0,5(H2O)6][NaAs+++2(Fe+++2,33W++++++0,67)(PO4)2O7] O
HALILSARPITE [Mg(H2O)6][CaAs+++2(Fe+++2,67Mo++++++0,33)(AsO4)2O7] O
With only large cations
MACHATSCHKIITE (Ca,Na)6(As+++++O4)(As+++++O3OH)3(PO4,SO4).15H2O R
TRISTRAMITE (Ca,U++++,Fe+++)(PO4,SO4).2H2O H
GRAYITE (Th,Pb,Ca)PO4.H2O ps H
SINCOSITE CaV++++2(PO4)2(OH)4.3H2O Q
NINGYOITE (U,Ca,Ce)2(PO4)2.1-2H2O O ps H
AIRDITE Sr(V++++O)2(PO4)2.4H2O M
Phosphates, etc. with additional anions, with H2O
With small (and occasionally larger) cations
ROSCHERITE Ca2Be4(Mn,Fe++)5(PO4)6(OH)4.6H2O M/A
RUIFRANCOITE Ca2([],Mn)2(Fe+++,Mn,Mg)4Be4(PO4)6(OH)6.4H2O M
GUIMARAESITE Ca2(Zn,Mg,Fe++)5Be4(PO4)6(OH)4.6H2O M
GREIFENSTEINITE Ca2Be4(Fe++,Mn)5(PO4)6(OH)4.6(H2O) M
FOOTEMINEITE Ca2Be4(Mn++,Fe++)5(PO4)6(OH)4.6H2O A
ATENCIOITE Ca2Mg2Fe++2-3Be4(PO4)6(OH)4.6H2O A
ZANAZZIITE Ca2Be4(Mg,Fe++)5(PO4)6(OH)4.6(H2O) M
TIPTOPITE [(Li,Na,Ca,[])6](OH)2(H2O)(K2)(Be6P6O24) H
GLUCINE CaBe4(PO4)2(OH)4.0,5H2O (?)
OKRUSCHITE Ca2Mn++5Be4(AsO4)6(OH)4.6H2O M
With only medium-sized cations, (OH, etc.):RO4< 1:1
PITTICITE Hydrous ferric arsenate sulfate am.
VASHEGYITE Al11(PO4)9(OH)6.38H2O or Al6(PO4)5(OH)3.23H2O O
SCHOONERITE [ZnMnFe++2Fe+++(PO4)3(OH)2(H2O)7].2H2O O
ZYKAITE Fe+++4(AsO4)3(SO4)(OH).15H2O O
GINIITE Fe++Fe+++4(PO4)4(OH)2.2H2O M
SASAITE (Al,Fe+++)6[(PO4),(SO4)]5(OH)3.35-36H2O O
BRAITHWAITEITE NaCu++5(Sb+++++Ti4++++)O2(AsO4)4(AsO3OH)2(H2O)8 A
SCHMIDITE [Zn2(Fe+++,Mn++)2Fe+++(PO4)3(OH)3(H2O)6].2H2O  
WILDENAUERITE Zn(Fe+++,Mn++)2MnFe+++(PO4)3(OH)3(H2O)6.2H2O O
With only medium-sized cations, (OH, etc.):RO4 = 1:1 and < 2:1
WHITMOREITE Fe++Fe+++2(PO4)2(OH)2.4H2O M
ARTHURITE Cu++Fe+++2(AsO4,PO4,SO4)2(O,OH)2.4H2O M
BENDADAITE Fe++Fe+++2(AsO4)2(OH)2.4H2O M
COBALTARTHURITE (Co++,Mg)Fe+++2(AsO4)2(OH)2.4H2O M
EARLSHANNONITE (Mn++,Fe++)Fe+++2(PO4)2(OH)2.4H2O M
KUNATITE CuFe+++2(PO4)2(OH)2.4H2O M
OJUELAITE ZnFe+++2(AsO4)2(OH)2.4H2O M
CORALLOITE Mn++Mn+++2(AsO4)2(OH)2.4H2O M
BERMANITE Mn++Mn+++2(PO4)2(OH)2.4H2O M
STRUNZITE Mn++Fe+++2(PO4)2(OH)2.6H2O A ps M
PSEUDOLAUEITE Mn++Fe+++2(PO4)2(OH)2.7-8H2O M
USHKOVITE MgFe+++2(PO4)2(OH)2.8H2O A
SIGLOITE Fe+++Al2(PO4)2(OH)3.7H2O A
LAUEITE Mn++Fe+++2(PO4)2(OH)2.8H2O A
KASTNINGITE (Mn++,Fe++,Mg)Al2(PO4)2(OH)2.8H2O A
STEWARTITE Mn++Fe+++2(PO4)2(OH)2.8H2O A
TINTICITE Fe+++11(PO4,VO4)8(OH)8.13H2O A
VAUXITE Fe++Al2(PO4)2(OH)2.6H2O A
CACOXENITE (Fe+++,Al)25(PO4)17O6(OH)12.75H2O H
GORMANITE Fe++3Al4(PO4)4(OH)6.2H2O A
SOUZALITE (Mg,Fe++)3(Al,Fe+++)4(PO4)4(OH)6.2H2O M
MAPIMITE Zn2Fe+++3(AsO4)3(OH)4.10H2O M
OGDENSBURGITE Ca2(Zn,Mn)Fe+++4(AsO4)4(OH)6.6H2O O ps H
NEVADAITE (Cu++,Al,V+++)2-3Al4(PO4)4(OH)F4.11H2O M
CLONCURRYITE Cu0,5Al2(VO)0,5(PO4)2(F,OH)2.5H2O M
TVRDYITE Fe++Fe+++2Al3(PO4)4(OH)5(H2O)4.2H2O M
KUMMERITE Mn++Fe+++Al(PO4)2(OH)2.8H2O A
With only medium-sized cations, (OH, etc.):RO4= 2:1
GUANACOITE Cu2(Mg,Cu)Mg2(AsO4)2(OH)4.4H2O M
TURQUOISE Cu++(Al,Fe+++)6(PO4)4(OH)8.4H2O A
AHEYLITE (Fe++,Zn)Al6(PO4)4(OH)8.4H2O A
CHALCOSIDERITE Cu++(Fe+++,Al)6(PO4)4(OH)8.4H2O A
FAUSTITE (Zn,Cu++)Al6(PO4)4(OH)8.4H2O A
ERNSTITE (Mn++1-xFe+++x)Al(PO4)(OH)2-xOx M
With only medium-sized cations, (OH, etc.):RO4 = 3:1
BULACHITE Al6(AsO4)3(OH)9(H2O)4.2H2O O
ALDERMANITE [Mg(H2O)6][Na(H2O)2Al3(PO4)2(OH,F)6].H2O O
JUANITAITE (Cu,Ca,Fe++)10Bi(AsO4)4(OH)11.H2O Q
With only medium-sized cations, (OH,etc.):RO4 > 3:1
ROSIERESITE [Pb,Cu,Al,(PO4),H2O] (?) am.
BOLIVARITE Al2(PO4)(OH)3·4H2O amorphous
EVANSITE Al3(PO4)(OH)6.6H2O am.
LISKEARDITE [(Al,Fe)32(AsO4)18(OH)42(H2O)22].52H2O O (?)
RUSAKOVITE (Fe+++,Al)5(VO4,PO4)2(OH)9.3H2O (?)
CHALCOPHYLLITE Cu++18Al2(AsO4)3(SO4)3(OH)27.33H2O R
TIBERIOBARDIITE {Cu9Al[SiO3(OH)]2(OH)12(H2O)6}(SO4)1,5.10H2O R
PARNAUITE Cu9(AsO4)2(SO4)(OH)10.7H2O O
GLADIUSITE (Fe++,Mg)4Fe+++2(PO4)(OH)11.H2O M ps O
KERNOWITE Cu2Fe+++(AsO4)(OH)4.4H2O M
With large and medium-sized cations, (OH, etc.):RO4< 0.5:1
ZDENEKITE Na(Pb,Ca)Cu++5(AsO4)4Cl.5H2O Q
SHUBNIKOVITE Ca2Cu++8(AsO4)6Cl(OH).7H2O O (?)
With large and medium-sized cations, (OH, etc.):RO4 < 1:1
KALUGINITE (Mn++,Ca)MgFe+++(PO4)2(OH).4H2O O
WHITEITE-(CaMnMn) CaMnMn2Al2[PO4]4(OH)2.8H2O M
WHITEITE-(MnMnMg) Mn++Mn++Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(MnFeMg) (Mn++,Ca)(Fe++,Mn++)Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(CaMnMg) CaMn++Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(CaFeMg) Ca(Fe++,Mn++)Mg2Al2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaFeFe) {Ca}{Fe++}{Fe++2}{Fe+++2}(PO4)4(OH)2.8H2O M
KECKITE CaMn(Fe+++,Mn)2Fe+++2(PO4)4(OH)3.7H2O M
JAHNSITE-(NaMnMg) {(Na,Ca)}{(Mn++,Fe+++)}{(Mg,Fe+++)2}{Fe+++2}(PO4)4(OH)2.8H2O M
JAHNSITE-(NaFeMg) NaMg2Fe+++3(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnMn) (Mn++,Ca)Mn++(Mn++,Fe++)2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnMn) CaMn++Mn++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnMg) CaMn++(Mg,Fe++)2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnFe) CaMn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
WHITEITE-(CaMgMg) CaMg3Al2(PO4)4(OH)2.8H2O M
RITTMANNITE (Mn++,Ca)Mn++(Fe++,Mn++)2(Al,Fe+++)2(PO4)4(OH)2.8H2O M
WHITEITE-(MnMnMn) Mn++Mn++Mn++2Al2(PO4)4(OH)2.8H2O M
MANGANOSEGELERITE (Mn++,Ca)(Mn++,Fe++,Mg)Fe+++(PO4)2(OH).4H2O O
CALCIOFERRITE Ca4Fe++(Fe+++,Al)4(PO4)6(OH)4.13H2O M
ZODACITE Ca4Mn++Fe+++4(PO4)6(OH)4.12H2O M
ROBERTSITE Ca6Mn+++9(PO4)9O6(H2O)6.3H2O M
SAILAUFITE NaCaMn+++3O2(AsO4)2(CO3).3H2O M
KOLFANITE Ca2Fe+++3O2(AsO4)3.2H2O M
MANTIENNEITE (H2O,K)2(Mg,Fe++)2(Al,Fe+++)2Ti(PO4)4(O,F)2.14H2O O
PAULKERRITE (H2O,K)2(Mg,Mn++)2(Fe+++,Al)2Ti(PO4)4(O,F)2.14H2O O
BENYACARITE (H2O,K)2(Mn++,Fe++)2(Fe+++,Ti)2Ti(PO4)4(O,F)2.14H2O O
MAHNERTITE (Na,Ca,K)Cu++3(AsO4)2Cl.5H2O Q
ENGLISHITE K3Na2Ca10Al15(PO4)21(OH)7.26H2O O
BOUAZZERITE Mg5,5Bi3Fe+++7(AsO4)9O6(OH)2.43H2O M
JAHNSITE-(CaFeMg) CaFe++Mg2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnZn) CaMn++Zn2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnFe) Mn++Mn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnFe++) MnMn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnMg) Mn++Mn++Mg2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnZn) Mn++Mn++Zn2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(NaMnMn) NaMn++Mn++Fe+++Fe+++2(PO4)4(OH)2.8H2O M
LUNOKITE (Mn++,Ca)(Mg,Fe++,Mn++)Al(PO4)2(OH).4H2O O
With large and medium-sized cations, (OH, etc.):RO4 = 1:1
JOHNWALKITE K(Mn++,Fe+++,Fe++)2(Nb,Ta)(PO4)2O2(H2O,OH)2 O
MEURIGITE-K KFe+++8(PO4)6(OH)7.6,5H2O M
MEURIGITE-Na Na(Fe+++,Al)8(PO4)6(OH)7.6,5H2O M
PHOSPHOFIBRITE [K0,5(H2O)3][(Fe+++,Cu)8(PO4)6(OH)7(H2O)4] M
JUNGITE Ca2Zn4Fe+++8(PO4)9(OH)9.16H2O O
ERCITITE Na(Mn+++,Fe+++)(PO4)(OH).2H2O M
MRAZEKITE Bi+++2Cu++3(PO4)2O2(OH)2.2H2O M
With large and medium-sized cations, (OH, etc.):RO4 > 1:1 and < 2:1
BURANGAITE (Na,Ca)2(Fe++,Mg)2Al10(PO4)8(OH,O)12.4H2O M
DUFRENITE Fe++Fe+++4(PO4)3(OH)5.2H2O M
GAYITE NaMn++Fe+++5(PO4)4(OH)6.2H2O M
MATIOLIITE Na(Mg,Fe++)Al5(PO4)4(OH)6.2H2O M
NATRODUFRENITE Na(Fe+++,Fe++)(Fe+++,Al)5(PO4)4(OH)6.2H2O M
KIDWELLITE NaFe+++9(PO4)6(OH)10.5H2O M
BLEASDALEITE (Ca,Fe+++)2Cu5(Bi+++,Cu++)(PO4)4(H2O,OH,Cl)13 M ps Q
MATULAITE Fe+++Al7(PO4)4(PO3OH)2(OH)8(H2O)8.8H2O M
With large and medium-sized cations, (OH, etc.):RO4 = 2:1
AGARDITE-(Y) (Y,Ca)Cu6(AsO4)3(OH)6.3H2O H
ZALESIITE CaCu++6(AsO4)2(AsO3OH)(OH)6.3H2O H
PETERSITE-(Y) (Y,Ce,Nd,Ca)Cu++6(PO4)3(OH)6.3H2O H
MIXITE BiCu++6(AsO4)3(OH)6.3H2O H
AGARDITE-(Nd) (Nd,La,Y)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(La) LaCu++6(AsO4)3(OH)6.3H2O H
AGARDITE-(Ce) (Ce,Ca,La)Cu6(AsO4)3(OH)6.3H2O H
GOUDEYITE (Al,Y)Cu6(AsO4)3(OH)6.3H2O H
WALLKILLDELLITE Ca4Mn++6As+++++4O16(OH)8.18H2O H
KUKSITE (Pb,Ca)3Zn3Te++++++O6(PO4,VO4)2 O
DUGGANITE Pb3Zn3Te(As,V,Si)2(O,OH)14 H
WALLKILLDELLITE-Fe (Ca,Cu)4Fe6[(As,Si)O4]4(OH)8.18H2O H
PETERSITE-(Ce) Cu6Ce(PO4)3(OH)6.3H2O H
PETERSITE-(La) Cu6La(PO4)3(OH)6.3H2O H
With large and medium-sized cations, (OH, etc.):RO4 > 2:1
TYROLITE CaCu5(AsO4)2(CO3)(OH)4.6H2O O
BETPAKDALITE-CaCa MgCa2Fe+++3(Mo++++++8O28)(AsO4)2(OH).23H2O M
BETPAKDALITE-NaCa (Na,Ca)3Fe+++2(As2O4)(MoO4)6.15H2O M
MELKOVITE CaFe+++H6(MoO4)4(PO4).6H2O M
PHOSPHOVANADYLITE-Ba (Ba,Ca,K,Na)0,66[P2(V++++,Al)4(O,OH)16].12H2O C
YUKONITE Ca3Fe+++(AsO4)2(OH)3.5H2O am.
DELVAUXITE CaFe+++4(PO4,SO4)2(OH)8.4-6H2O (?) am.
SANTAFEITE (Na,Ca,Sr)3(Mn++,Fe+++)2Mn++++2(VO4)4(OH,O)5.2H2O O
BETPAKDALITE-CaMg [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe+++3O36(OH)] M
MENDOZAVILITE-KCa [K2(H2O)15Ca(H2O)6][Mo8P2Fe+++3O34(OH)3] M
BETPAKDALITE-FeFe [Fe+++2(H2O)15(OH)2Fe+++(H2O)6][Mo8As2Fe+++3O37] M
With only large cations
With CO3, SO4, SiO4
PEISLEYITE Na3Al16(SO4)2(PO4)10(OH)17.20H2O M
KRASNOITE Ca3Al7,7Si3P4O23,5(OH)12,1F2.8H2O R ps H
PERHAMITE (Ca,Sr)3Al7,7Si3P4O23,5(OH)14,1.8H2O R ps H
SARYARKITE-(Y) Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7.6H2O H
PARWANITE (Na,K)(Mg,Ca)4Al8(CO3)(PO4)8(OH)7.30H2O M ps H
Uranyl phosphates and arsenates
DYMKOVITE (Ni,Mg)(UO2)2(As+++O3).7H2O M
UO2:RO4 = 1:2
LAKEBOGAITE NaCa(Fe+++,Al)2H(UO2)2(PO4)4(OH)2.8H2O M
UO2:RO4 = 1:1
SALEEITE Mg(UO2)2(PO4)2.10H2O M ps Q
ZEUNERITE Cu++(UO2)2(AsO4)2.10-16H2O Q
TORBERNITE Cu++(UO2)2(PO4)2.8-12H2O Q
NOVACEKITE I Mg(UO2)2(AsO4)2.10-12H2O Q
KAHLERITE Fe++(UO2)2(AsO4)2.10-12H2O Q
AUTUNITE Ca(UO2)2(PO4)2.10-12H2O Q
XIANGJIANGITE (Fe+++,Al)(UO2)4(PO4)2(SO4)2(OH).22H2O Q
RAUCHITE (Ni,Mg)(UO2)2(AsO4)2.10H2O A
LEHNERITE Mn++U++++++(PO4)2O.8H2O M
URAMPHITE (NH4)(UO2)(PO4).3H2O O (?)
URANOSPATHITE Al0,5-1(UO2)2(PO4)2F.20-21H2O O ps Q
VOCHTENITE (Fe++,Mg)Fe+++[(UO2)(PO4)]4(OH).12-13H2O M
COCONINOITE Fe+++2Al2(UO2)2(PO4)4(SO4)(OH)2.20H2O M (?)
FURONGITE Al4[(UO2)4(PO4)6](OH)2(H2O)19,5H2O A
SABUGALITE H0,5Al0,5(UO2)2(PO4)2.8H2O M ps Q
NOVACEKITE = See Novacekite I or Novacekite II Mg(UO2)2(AsO4)2.10-12H2O Q
UO2:RO4 = 3:2
FRANCOISITE-(Ce) (Ce,Nd,Ca)(UO2)3(PO4)2O(OH).6H2O M
FRANCOISITE-(Nd) (Nd,Y,Sm,Ce)(UO2)3(PO4)2O(OH).6H2O M
DEWINDTITE Pb3[H(UO2)3O2(PO4)2]2.12H2O O
HUGELITE Pb2(UO2)3(AsO4)2O2.5H2O M
MUNDITE Al(UO2)3(PO4)2(OH)3,5.5H2O O
BERGENITE Ba4Ca2(UO2)6(PO4)6O6.16H2O M
ASSELBORNITE (BiO)3(Pb,Ba)(UO2)4(OH)7(AsO4)2.4H2O C
SREINITE (BiO)3Pb(UO2)4(OH)7(PO4,AsO4)2.4H2O C
KAMITUGAITE PbAl(UO2)5[(P,As)O4]2(OH)9.9.5H2O A
Polyphosphates, Polyarsenates, [4]-Polyvanadates
Polyphosphates, etc., without OH and H2O; dimers of corner-sharing RO4 tetrahedra
ZIESITE Cu2V+++++2O7 M
Polyphosphates, etc., with OH only
Polyphosphates, etc., with H2O only
FIANELITE Mn++2V+++++(V+++++,As+++++)O7.2H2O M
RUDLINGERITE Mn++2V+++++As+++++O7.2H2O M
Polyphosphates, etc., with OH and H2O
MARTYITE (Zn,Co)3(V2O7)(OH)2.2H2O R ps H
VOLBORTHITE Cu++3V+++++2O7(OH)2.2H2O M
ALVANITE ZnAl4(VO3)2(OH)12(H2O)2 M
Phosphates, etc. unclassified
PHOXITE (NH4)2Mg2(C2O4)(PO3OH)2(H2O)4 M
PRACHARITE CaSb+++++2(As+++2O5)2O2.10H2O R
RAMAZZOITE [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0,33SO4)3(H2O)36] C
PEATITE-(Y) Li4Na12(Y,Na,Ca,HREE)12(PO4)12(CO3)4(F,OH)8 O ps C
RAMIKITE-(Y) Li4Na12(Y,Ca,HREE)6Zr6(PO4)12(CO3)4O4(OH,F)4 A ps C
PUTTAPAITE Pb2Mn++2ZnCr+++4O2(AsO4)4(OH)6.12H2O M
MANGANFLURLITE ZnMn++3Fe+++(PO4)3(OH)2(H2O)7.2H2O ZnMn++3Fe+++(PO4)3(OH)2(H2O)7.2H2O M
MATYHITE Ca9(Ca0,5[]0,5)Fe++(PO4)7 R
MENGEITE Ba(Mg,Mn++)Mn+++4(PO4)4(OH)4.4H2O A
MICHALSKIITE Fe+++1,33Cu++2(MgFe+++)2(VO4)6 Fe+++1,33Cu++2(MgFe+++)2(VO4)6 O
OKIEITE Mg3[V10O28].28H2O A
NIASITE Ni++4,5(AsO4)3 Q
PANSNERITE K3Na3(Fe+++,Al)6(AsO4)8 O
VARGITE Cu2Mn3(AsO4)2(OH)4(H2O)4 M
VYSOKYITE U++++[As+++++O2(OH)2]4.4H2O A
WHITECAPSITE H16Fe2++5Fe+++14Sb+++6(AsO4)18O16.120H2O H
SMAMITE Ca2Sb(OH)4[H(AsO4)2].6H2O A
YURMARINITE Na7(Fe+++,Mg,Cu)4(AsO4)6 R
WILANCOOKITE (Ba5Li2[])Ba6Be24P24O96.26H2O C
TANGDANITE Ca2Cu9(AsO4)4(SO4)0.5(OH)9.9H2O M
VANINIITE Ca2Mn++3Mn+++2O2(AsO4)4.2H2O M
TAPIAITE Ca5Al2(AsO4)4(OH)4.12H2O M
ERIKJONSSONITE (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 M
CUATROCAPAITE-(NH4) (NH4)3(NaMg[])(As2O3)6Cl6.16H2O R
FALSTERITE Ca2MgMn++2(Fe++0,5Fe+++0,5)4Zn4(PO4)8(OH)4(H2O)14 M
FERRAIOLOITE MgMn++4(Fe++0,5Al+++0,5)4Zn4(PO4)8(OH)4(H2O)20 M
FLURLITE Zn4Fe+++(PO4)3(OH)2(H2O)7.2H2O M
ACHYROPHANITE (K,Na)3(Fe+++,Ti,Al,Mg)5O2(AsO4)5 O
BOHUSLAVITE Fe+++4(PO4)3(SO4)(OH).nH2O (n between 15 and 24) A
ALEUTITE [Cu5O2](AsO4)(VO4).(Cu,K,Pb,Rb,Cs,)Cl M
ANATOLYITE Na6(Ca,Na)(Mg,Fe+++)3Al(AsO4)6 R
ARMELLINOITE-(Ce) Ca4Ce++++(AsO4)4.H2O Q
BARROTITE Cu9Al(HSiO4)2[(SO4)(HAsO4)0,5](OH)12.8H2O R
CARDITE Zn5,5(AsO4)2(AsO3OH)(OH)3.3H2O O
CUATROCAPAITE-(K) K3(NaMg[])(As2O3)6Cl6.16H2O R
KENNGOTTITE Mn++3Fe+++4(PO4)4(OH)6(H2O)2 M
KAPUNDAITE (Na,Ca)2Fe+++4(PO4)4(OH)3.5H2O A
LASNIERITE (Ca,Sr)(Mg,Fe++)2Al(P[O,F]4)3 O
ALCANTARILLAITE [Fe+++0,5(H2O)4][CaAs+++2(Fe+++2,5W++++++0,5)(AsO4)2O7] O
KAMPELITE Ba6Mg3Sc8(PO4)12(OH)6.7H2O O
HORAKITE (Bi7O7OH)[(UO2)4(PO4)2(AsO4)2(OH)2] M
JOTEITE Ca2CuAl[AsO4][AsO3(OH)]2(OH)2.5H2O A
JUANSILVAITE Na5Al3[AsO3(OH)]4[AsO2(OH)2]2(SO4)2.4H2O M
MIKEHOWARDITE Fe+++4(V+++++O4)4(H2O)2.H2O A
RELIANCEITE-(K) K4Mg(V++++O)2(C2O4)(PO3OH)4(H2O)10 M
DONOWENSITE a(H2O)3Fe+++2(V2O7)2 A
PROTOCASEYITE [Al4(OH)6(H2O)12][V10O28].8H2O A
* SILICATES, Germanates
Nesosilicates without additional anions; cations in tetrahedral [4] coordination
Nesosilicates without additional anions; cations in [4] and greater coordination
Nesosilicates without additional anions; cations in octahedral [6] coordination
LAIHUNITE Fe++Fe+++2(SiO4)2 M
Nesosilicates without additional anions; cations in [6] and/or greater coordination
ADRIANITE Ca12(Al4Mg3Si7)O32Cl6 C
SCHORLOMITE {Ca3}[Ti2](SiFe+++2)O12 C
KNORRINGITE {Mg3}[Cr+++2](Si3)O12 C
MAJORITE {Mg3}[SiMg](Si3)O12 C
MOMOIITE {Mn++3}[V+++2](Si3)O12 C
MORIMOTOITE {Ca3}[TiFe++](Si3)O12 C
WADALITE Ca12Al010Si4O32Cl6 C
ERINGAITE {Ca3}[Sc2](Si3)O12 C
SPESSARTINE {Mn++3}[Al2](Si3)O12 C
TOTURITE {Ca3}[Sn++++2](SiFe+++2)O12 C
UVAROVITE {Ca3}[Cr+++2](Si3)O12 C
KIMZEYITE {Ca3}[Zr2](SiAl2)O12 C
PYROPE {Mg3}[Al2](Si3)O12 C
CALDERITE {Mn++3}[Fe+++2](Si3)O12 C
GROSSULAR {Ca3}[Al2](Si3)O12 C
ANDRADITE {Ca3}[Fe+++2](Si3)O12 C
KERIMASITE {Ca3}[Zr2](SiFe+++2)O12 C
ELTYUBYUITE Ca12Fe+++10Si4O32Cl6 C
GOLDMANITE {Ca3}[V+++2](Si3)O12 C
HENRITERMIERITE {Ca3}[Mn+++2](Si2)([])O8(OH)4 Q
HOLTSTAMITE Ca3(Al,Mn+++)2(SiO4)2(OH)4 Q
KATOITE Ca3Al2(SiO4)3-x(OH)4x (x = 1,5-3) C
ALMANDINE {Fe++3}[Al2](Si3)O12 C
IRINARASSITE {Ca3}[Sn++++2](SiAl2)O12 C
KHOHARITE Mg3Fe+++2(SiO4)3 C
MENZERITE-(Y) {Y2Ca}[Mg2](Si3)O12 C
MONTENEVEITE Ca3Sb+++++2(Fe+++2Fe++)O12 C
NIKMELNIKOVITE Ca12Fe++Fe+++3Al3(SiO4)6(OH)20 R
Nesosilicates with additional anions (O,OH,F,H2O); cations in tetrahedral [4] coordination
KATOPTRITE (Mn,Mg)13(Al,Fe+++)4Sb+++++2Si2O28 M
YEATMANITE Mn++9Zn6Sb+++++2Si4O28 A
Nesosilicates with additional anions; cations in [4], [5] and/or only [6] coordination
MULLITE Al4+2xSi2-2xO10-x (x about 0,4) O
YODERITE (Mg,Al,Fe+++)8Si4(O,OH)20 M
STAUROLITE (Fe++,Mg,Zn)2Al9(Si,Al)4O22(OH)2 M ps O
MAGNESIOSTAUROLITE []4Mg4Al16(Al2[]2)Si8O40[(OH)2O6] M
CHONDRODITE (Mg,Fe++)5(SiO4)2(F,OH)2 M
HUMITE (Mg,Fe++)7(SiO4)3(F,OH)2 O
CLINOHUMITE (Mg,Fe++)9(SiO4)4(F,OH)2 M
SONOLITE Mn++9(SiO4)4(OH,F)2 M
RIBBEITE (Mn++,Mg)5(SiO4)2(OH)2 O
WELINITE Mn++3(W++++++,Mg)0,7SiO4(O,OH)3 H
OREBROITE Mn++3(Sb+++++,Fe+++)Si(O,OH)7 H
CHLORITOID (Fe++,Mg,Mn)2Al4Si2O10(OH)4 M/A
OTTRELITE (Mn,Fe++,Mg)2Al4Si2O10(OH)4 M/A
BARWOODITE Mn++6(Nb+++++,[])2(SiO4)2(O,OH)6 H
SCORTICOITE Mn6(Sb,[])2(SiO4)2O3(OH)3 R
Nesosilicates with additional anions; cations in > [6] +- [6] coordination
BRAUNITE Mn++Mn+++6SiO12 Q
BRAUNITE-II Ca(Mn+++,Fe+++)14SiO24 Q
LANGBANITE (Mn++,Ca)4(Mn+++,Fe+++)9Sb+++++Si2O24 R
FERRICERITE-(La) (La,Ce,Ca)9Fe+++(SiO4)3(SiO3OH)4(OH)3 R ps H
ALUMINOCERITE-(Ce) (Ce,Ca,La,Nd)9(Al,Fe+++)(SiO4)3[SiO3(OH)]4(OH)3 R
CERITE-(Ce) Ce+++9Fe+++(SiO4)6[(SiO3)(OH)](OH)3 R
YFTISITE-(Y) (Y,Dy,Er)4(Ti,Sn++++)O(SiO4)2(F,OH)6 O
MIEITE-(Y) Y4Ti(SiO4)2O[F,(OH)]6 O
TRIMOUNSITE-(Y) (Y,Dy,Er,Yb,Gd,Ho,Tb,Sm)2Ti2SiO9 M
KITTATINNYITE Ca4Mn++2Mn+++4Si4O16(OH)8.18H2O H
KULIOKITE-(Y) (Y,Yb,Er,Dy,Lu,Gd,Tm,Ho)4Al(SiO4)2(OH)2F5 A
ZOLTAIITE BaV+++12(Ti,V++++)2(Si2O8)O19 R
TAIPINGITE-(Ce) Ce+++7Ca2Mg(SiO4)3[SiO3(OH)]4F3 R
Nesosilicates with CO3, SO4, PO4, etc.
TUNDRITE-(Nd) Na3(Nd,La)4(Ti,Nb)2(SiO4)2(CO3)3O4(OH).2H2O A
TUNDRITE-(Ce) Na2(Ce,La,Nd)2(Ti,Nb)(O,OH)2(SiO4)(CO3)2 A
TRITOMITE-(Y) Y5(SiO4,BO4)3(O,OH,Cl) R (?)
BRITHOLITE-(Ce) (Ce,Ca)5(SiO4,PO4)3(OH,F) H
Nesosilicates with BO3 triangles and/or B[4], Be[4] tetrahedra, cornersharing with SiO4
NIOBOHOLTITE (Nb0,6[]0,4)Al6BSi3O18 O
MAGNESIODUMORTIERITE (Mg,Ti,-)(Al,Mg)2Al4Si3O18-y(OH)yB (y=2-3) O
HOLTITE Al6(Al,Ta)(Si,Sb)3BO15(O,OH)2 O
TITANOHOLTITE (Ti0,75[]0,25)Al6BSi3O18 O
HOMILITE Ca2(Fe++,Mg)B2Si2O10 M
GADOLINITE-(Ce) (Ce,La,Nd,Y)2Fe++Be2Si2O10 M
CALCYBEBOROSILITE-(Y) (Y,Ca)2([],Fe++)(B,Be)2[SiO4]2(OH,O)2 M
HUNDHOLMENITE-(Y) (Y,REE,Ca,Na)15(Al,Fe+++)(CaxAs+++1-x)(Si,As+++++)Si6B3(O,F)48 (x = 0,78) R
OKANOGANITE-(Y) Na(Y,Ce,Nd,Ca,Na)15Fe+++(Si3B3O18)(SiO4)4F10(OH)4 R
PROSHCHENKOITE-(Y) (Y,REE,Ca,Na,Mn)15(Fe++,Mn)Ca(P,Si)Si6B3O34F14 R
VICANITE-(Ce) (Ca,REE,Th)15Fe+++(SiO4)3(Si3B3O18)(BO3)(As+++++O4)(As+++O3)x(NaF3)1-xF7.0,2H2O (x=0.4) R
HINGGANITE-(Nd) Nd2[]Be2Si2O8(OH)2 M
LAPTEVITE-(Ce) Ca6(Fe++,Mn++)Y3REE7(SiO4)3(PO4)(B3Si3O18)(BO3)F11 H
GADOLINITE-(Nd) Nd2Fe++Be2O2(SiO4)2 M
ARRHENIUSITE-(Ce) CaMg[(Ce7Y3)Ca5](SiO4)3(Si3B3O18)(AsO4)(BO3)F11 R
Uranyl neso- and polysilicates
OURSINITE (Co,Mg)(UO2)2Si6(OH)2.6H2O O
SWAMBOITE-(Nd) Nd0.33[(UO2)(SiO3OH)].2,5(H2O) M
HAIWEEITE Ca(UO2)2Si5O12(OH)2.4,5H2O O
COUTINHOITE (Th,Ba)0,5(UO2)2Si5O13.1-3,5H2O O
WEEKSITE K2(UO2)2(Si5O13).4H2O M
Si2O7 groups, without non-tetrahedral anions; cations in tetrahedral [4] coordination
Si2O7 groups, without non-tetrahedral anions; cations in tetrahedral [4] and greater coordination
JEFFREYITE (Ca,Na)2(Be,Al)Si2(O,OH)7 O ps Q
CEBOLLITE Ca2(Mg,Fe++,Al)Si2(O,OH)7 O
MELILITE (Ca,Na)2(Al,Mg)(Si,Al)2O7 Q
HYDROXYLGUGIAITE (Ca,[])2(Be,Si)[(Si,Be)2O5(OH)2] Q
Si2O7 groups, without non-tetrahedral anions; cations in octahedral [6] and greater coordination
KEIVIITE-(Yb) (Yb,Y)2Si2O7 M
YTTRIALITE-(Y) (Y,Th)2Si2O7 H (?)
PERCLEVEITE-(Ce) (Ce,La,Nd)2(Si2O7) Q
Si2O7 groups, with additional anions; cations in tetrahedral [4] and greater coordination
AXINITE-(Fe) Ca2Fe++Al2BO3Si4O12(OH) A
TINZENITE Ca2Mn++4Al4[B2Si8O30](OH)2 A
AXINITE-(Mg) Ca2MgAl2BO3Si4O12(OH) A
AXINITE-(Mn) Ca2Mn++Al2BO3Si4O12(OH) A
VISTEPITE (Mn++,Ca)4Sn++++B2(SiO7)(Si3O9)(OH)2 A
WERDINGITE (Mg,Fe)2Al12(Al,Fe)2Si4B2(B,Al)2O37 A
Si2O7 groups, with additional anions; cations in octahedral [6] and greater coordination
ILVAITE CaFe++2Fe+++Si2O7O(OH) O
MANGANILVAITE CaFe++Fe+++(Mn,Fe++)(Si2O7)O(OH) M
HIORTDAHLITE-I Na4Ca8Zr2(Nb,Mn,Ti,Fe,Mg,Al)2(Si2O7)4O3F5 A
WOHLERITE Na4Ca8(Zr,Nb)4(Si2O7)4(O,OH,F)8 M
NORMANDITE NaCa(Mn++,Fe++)(Zr,Ti)(Si2O7)OF M
NIOCALITE Ca14Nb2(Si2O7)4(O6F2) M
JANHAUGITE Na6Mn++6Ti4(Si2O7)4[O2(OH,F,O)6] M
LAVENITE (Na,Ca)8(Mn++,Fe++)4(Zr,Ti)4(Si2O7)4(O,OH,F)8 M
BAGHDADITE Ca12(Zr,Ti)4(Si2O7)4(O,F)8 M
HIORTDAHLITE-II (Na,Ca)4Ca8Zr2(Y,Zr,REE,Na)2(Si2O7)4(O3F5) A
MOSANDRITE-(Ce) (Ca3REE)[(H2O)2Ca0,5[]0,5]Ti(Si2O7)2(OH)2(H2O)2 M
NACARENIOBSITE-(Ce) Na3Ca3(Ce,La,Pr,Nd)(Nb,Ti)(Si2O7)2OF3 M
HAINITE-(Y) Na2Ca4(Y,REE)Ti(Si2O7)2OF3 A
ROSENBUSCHITE (Ca,Na)12(Zr,Ti)4(Si2O7)4(O4F4) A
GOTZENITE Na(Na,Ca)4Ca2Ti(Si2O7)2(O,F)2 A
KOCHITE Na2(Na,Ca)4Ca4(Mn,Ca)2Zr2(Si2O7)4(O,F)4F4 A
KAZANSKYITE Ba[]TiNbNa3Ti(Si2O7)2O2(OH)2(H2O)4 A
LILEYITE Ba2(Na,Fe,Ca)3MgTi2(Si2O7)2O2F2 M
GRENMARITE (Na,Ca)4(Mn,Na)(Zr,Mn)2(Zr,Ti)(Si2O7)2(O,F)2 M
SCHULLERITE (Na,Ca,Mn)2Ba2(Mg,Fe++)2(Ti,Fe+++)2(Si2O7)2O2F2 A
EMMERICHITE Ba2Na(Na,Fe++)2(Fe+++,Mg)Ti2(Si2O7)2O2F2 M
MURMANITE Na2Ti2Na2Ti2(Si2O7)2O4(H2O)4 A
EPISTOLITE Na4Ti++++4(Si2O7)2O2(OH,F)2.4H2O A
LOMONOSOVITE Na8Mn++Ti++++3Si4O12(PO4)2O4 A
VUONNEMITE Na11Ti++++Nb2(Si2O7)2(PO4)2O3(F,OH) A
SOBOLEVITE Na12Ca(NaCaMn)Ti2(TiMn)[Si2O7]2(PO4)4O3F3 M
INNELITE (Ba,K)4(Na,Ca)3Ti3(Si2O7)(SO4)O4 A
YOSHIMURAITE (Ba,Sr)2(Mn++,Fe++)2(Ti++++,Fe+++)(PO4,SO4,SiO4)(Si2O7)(O,OH) A
QUADRUPHITE Na14Ca(Mg,Mn)(Ti,Mn,Zr,Nb)4Si4O12(PO4)4O6F2 A
POLYPHITE Na5(Na4Ca2)Ti2[Si2O7](PO4)3O2F2 A
BORNEMANITE (Na,Ba)4(Na,Ti,Mn++)4(Ti,Nb)2(PO4)(Si2O7)2O2(OH,F,O)2 M
NECHELYUSTOVITE (Ba,Sr,K)2{(Na,Ti,Mn)4[(Ti,Nb)2O2Si4O14](O,H2O,F)2}.4,5H2O M
HEJTMANITE Ba(Mn,Fe++)2TiO(Si2O7)(OH,F)2 M
BYKOVAITE (Ba,Na,K)2{(Na,Ti,Mn)4[(Ti,Nb)2O2Si4O14](H2O,F,OH)2}.3,5H2O M
DELINDEITE (Na,K)3Ba2(Ti,Fe+++)3(Si2O7)2(O,OH,H2O)6 A
BUSSENITE Na2(Ba,Sr)2(Fe++,Mn++)TiSi2O7(CO3)(OH)3F A
PERRAULTITE (Na,Ca)(Ba,K)(Mn++,Fe++)4(Ti,Zr)2(Si2O7)2O2(OH,F,O)3 M
DINGDAOHENGITE-(Ce) Ce4Fe++(Ti,Fe++,Mg,Fe+++)2Ti2Si4O22 M
HEZUOLINITE (Sr,REE)4Zr(Ti,Fe+++,Fe++)2Ti2O8(Si2O7)2 M
MAONIUPINGITE-(Ce) (Ca,Ce)4(Fe+++,Ti,Fe++,[])(Ti,Fe+++,Fe++,Nb)4Si4O22 M
PERRIERITE-(Ce) (Ce,La,Ca,Sr)4(Fe++,Mg,Mn++)(Ti,Fe+++)4Si4O22 M
STRONTIOCHEVKINITE (Sr,La,Ce,Ca)4Zr(Ti++++,Fe++,Fe+++)2Ti2O4(Si2O7)2 M
RENGEITE (Sr,Ce)4Zr(Ti++++,Al)4Si4O22 M
POLYAKOVITE-(Ce) (Ce,La,Nd,Ca)4(Mg,Fe++)(Cr+++,Fe+++)2(Ti,Nb)2Si4O22 M
KARNASURTITE-(Ce) (Ce,La,Th)(Ti,Nb)(Al,Fe+++)(Si,P)2O7(OH)4.3H2O H (?)
PERRIERITE-(La) (La,Ce,Ca)4(Fe++,Mn++,Mg)(Ti,Fe)4Si4O22 M
CHEVKINITE-(Ce) (Ca,Ce,La)4(Fe++,Mg)2(Ti,Fe+++)3O8(Si2O7)2 M
FERSMANITE (Ca,Na)8(Ti,Nb)4(Si4O12)O10(F,OH)4 M
BELKOVITE Ba3(Nb,Ti)6(Si2O7)2O12 H
KILLALAITE Ca6,4[H0,6Si2O7]2(OH)2 M
STAVELOTITE-(La) La3Mn++3Cu++(Mn+++,Fe+++,Mn++++)26[Si2O7]6O30 R
BIRAITE-(Ce) Ce2Fe++(Si2O7)(CO3) M
BIRAITE-(La) La2Fe++(CO3)(Si2O7) M
CERVANDONITE-(Ce) (Ce,Nd,La)(Fe+++,Fe++,Ti++++,Al)3O2(Si2O7)1-x+y(AsO3)1+x-y(OH)3x-3y (x=0,47 y=0,31) M
BATISIVITE Ba(V+++,Cr+++)8Ti++++6(Si2O7)O22 A
ZINKGRUVANITE Ba4Mn++4Fe+++2(Si2O7)2(SO4)2O2(OH)2 A
SELIVANOVAITE (Na,Ca)3(Ti,Fe)5[Si4O18(OH)3].7H2O A
SAAMITE Ba[]Na3Ti2Nb(Si2O7)2O2(OH)F(H2O)2 A
ROUMANITE (Ca,Na,REE,[])7(Nb,Ti)[Si2O7]2OF3 M
ROUMAITE (Ca,Na,Ce,La)6-7(Nb,Ti++++)(Si2O7)(OH)F3 M
RINKITE-(Y) Na2Ca4YTi(Si2O7)2OF3 M
RINKITE-(Ce) (Ca3Ce)Na(NaCa)Ti(Si2O7)2(OF)F2 M
FOGOITE-(Y) Na3Ca2Y2Ti(Si2O7)2OF3 A
CHRISTOFSCHAFERITE-(Ce) (Ce,La,Ca)4Mn(Ti,Fe)3(Fe,Ti)(Si2O7)2O8 M
BATIEVAITE-(Y) Y2Ca2Ti(Si2O7)2(OH)2(H2O)4 A
ZVYAGINITE NaZnNb2Ti[Si2O7]2O(OH,F)3(H2O)4+x (x less than 1) A
BOBSHANNONITE Na2KBa(Mn++,Na)8(Nb,Ti)4(Si2O7)4O4(OH)4(O,F)2 A
DELHUYARITE-(Ce) Ce4Mg(Fe+++2W)[](Si2O7)2O6(OH)2 M
CALCIOMURMANITE (Na,[])2Ca(Ti,Mg,Nb)4[Si2O7]2O2(OH,O)2(H2O)4 A
CAMARAITE Ba3NaTi4(Fe++,Mn)8(Si2O7)4O4(OH,F)7 A
CHEVKINITE-(Nd) (Nd,REE)4(Fe++,Mg)(Fe++,Ti,Fe+++)2(Ti,Fe+++)2(Si2O7)2O8 (?) M ?
Sorosilicates with mixed SiO4 and Si2O7 groups; cations in tetrahedral [4] and greater coordination
HARSTIGITE Ca6MnBe4(SiO4)2(Si2O7)2(OH)2 O
SAMFOWLERITE Ca14Mn++3Zn2Be2Be6Si14O52(OH)6 M
QUEITITE Pb4Zn2(SiO4)(Si2O7)(SO4) M
Sorosilicates with mixed SiO4 and Si2O7 groups; cations in octahedral [6] and greater coordination
VANADOANDROSITE-(Ce) (Mn++,Ca)(Ce,La)Mn++(V+++,Mg,Al)Al(SiO4)(Si2O7)(O,F)(OH) M
UEDAITE-(Ce) (Mn++,Ca,Fe++)(Ce,Nd)Fe++(Al,Fe+++)2(Si2O7)(SiO4)OOH M
TWEDDILLITE CaSr(Mn+++,Fe+++)2Al(SiO4)(Si2O7)O(OH) M
PIEMONTITE-(Pb) CaPbAl2Mn+++[Si2O7][SiO4]O(OH) M
MANGANIANDROSITE-(Ce) (Mn++,Ca)(Ce,La)Mn++(Mn+++,Fe+++)Al(SiO4)(Si2O7)O(OH) M
DISSAKISITE-(La) Ca(La,Ce,Th)(Mg,Fe++)(Al,Fe+++,Cr)2(SiO4)(Si2O7)O(OH) M
PIEMONTITE-(Sr) CaSr(Al,Mn+++,Fe+++)3Si3O11O(OH) M
KHRISTOVITE-(Ce) (Ca,REE)REE(Mg,Fe++)AlMn++Si3O11(OH)(F,O) M
PIEMONTITE Ca2(Al,Mn+++,Fe+++)3Si3O11O(OH) M
MUKHINITE Ca2(Al2V+++)[Si2O7][SiO4]O(OH) M
EPIDOTE Ca2Al2Fe+++[Si2O7][SiO4]O(OH) M
EPIDOTE-(Sr) CaSr(Al,Fe+++,Mn+++)3(Si2O7)(SiO4](OH) M
FERRIALLANITE-(Ce) CaCeFe+++AlFe++[Si2O7][SiO4]O(OH) M
ALLANITE-(Y) Ca(Y,Ce,La)(Al,Fe++,Fe+++)3(SiO4)3(OH) M
FERRIALLANITE-(La) Ca(La,Ce,Th)(Fe+++,Al)(Al,Fe+++)(Fe++,Mn,Ti,Mg)(SiO4)(Si2O7)O(OH) M
DISSAKISITE-(Ce) Ca(Ce,La)(Mg,Fe++)(Al,Fe+++)2(SiO4)3(OH) M
ASKAGENITE-(Nd) Mn++NdAl2Fe+++(Si2O7)(SiO4)O2 M
ALLANITE-(La) Ca(La,REE,Ca)Al2(Fe2+,Fe3+)(SiO4)(Si2O7)O(OH) M
ALLANITE-(Ce) (Ce,Ca,Y)2(Al,Fe++,Fe+++)3(SiO4)3(OH) M
MANGANIANDROSITE-(La) (Mn++,Ca)(La,Ce,Ca,Nd)AlMn+++Mn++(SiO4)(Si2O7)O(OH) M
ALLANITE-(Nd) CaNdAl2Fe++(SiO4)(Si2O7)O(OH) M
ZOISITE Ca2Al3[Si2O7][SiO4]O(OH) O
MACFALLITE Ca2Mn+++3(SiO4)(Si2O7)(OH)3 M
SURSASSITE Mn++2Al3(SiO4)(Si2O7)(OH)3 M
PUMPELLYITE-(Mg) Ca2MgAl2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Mn++) Ca2(Mn++,Mg)(Al,Mn+++,Fe)2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Fe+++) Ca2(Fe+++,Mg,Fe++)(Al,Fe+++)2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Fe++) Ca2Fe++Al2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Al) Ca2(Al,Fe++,Mg)Al2(SiO4)(Si2O7)(O,OH)2.H2O M
POPPIITE Ca2(V+++,Fe+++,Mg)(V+++,Al)2(SiO4)(Si2O7)(O,OH)3 M
JULGOLDITE-(Mg) Ca2(Mg,Fe++)(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
JULGOLDITE-(Fe+++) Ca2Fe+++(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
JULGOLDITE-(Fe++) Ca2Fe++(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
SHUISKITE-(Mg) Ca2(Mg,Al)(Cr,Al)2(SiO4)(Si2O7)(OH)2.H2O M
OKHOTSKITE Ca2Mn++Mn+++2(Si2O7)(SiO4)(OH)2.H2O M
RUSTUMITE Ca10(Si2O7)2(SiO4)Cl2(OH)2 M
FLUORVESUVIANITE Ca19(Al,Mg,Fe++)13(SiO4)10(Si2O7)4(F,OH,O)10 Q
WILUITE Ca19(Al,Mg,Fe,Ti)13(B,Al,[])5Si18O68(O,OH)10 Q
MANGANVESUVIANITE Ca19Mn+++(Al,Mn+++,Fe+++)10(Mg,Mn++)2Si18O69(OH)9 Q
CYPRINE Ca19Cu++(Al10Mg2)Si18O68(OH)10 Q
VESUVIANITE Ca10Mg2Al4(SiO4)5(Si2O7)2(OH)4 Q
DELLAITE Ca6Si3O11(OH)2 M (?)
GATELITE-(Ce) Ca(Ce,Nd,La,Pr)3(Mg,Fe++,Al)(Al,Mg)3(SiO4)3(Si2O7)(O,F)(OH,O)2 M
VASTMANLANDITE-(Ce) (Ce,La)3CaAl2Mg2[Si2O7][SiO4]3F(OH)2 M
SHUISKITE-(Cr) Ca2CrCr2[SiO4][Si2O6(OH)](OH)2O M
MANAEVITE-(Ce) Ca11(Ce,H2O,Ca)8Mg(Al,Fe)4(Mg,Ti,Fe+++)8[Si2O7]4[(SiO4)8(H4O4)2](OH)9 Q
ALNAPERBOEITE-(Ce) Na0,5Ca(Ce,Nd,La)2,5Al4Si2O7[SiO4]3O(OH)2 M
FERRIPERBOEITE-(La) (CaLa3)(Fe+++Al2Fe++)[Si2O7][SiO4]3O(OH)2 M
MILANRIEDERITE (Ca18[REE])Fe+++Al4(Mg4Al4)([]4)[][Si2O7]4[(SiO4)10](OH)(OH)9 Q
PERBOEITE-(Ce) Ca(Ce,Nd,La)3Al3Fe++Si2O7[SiO4]3O(OH)2 M
PERBOEITE-(La) (CaLa3)(Al3Fe++)[Si2O7][SiO4]3O(OH)2 M
FERRIPERBOEITE-(Ce) (CaCe3)(Fe+++Al2Fe++)(Si2O7)(SiO4)3O(OH)2 M
ZOISITE-(Pb) CaPbAl3[Si2O7][SiO4]O(OH) O
FLUORVESUVIANITE Ca19Fe+++Al4(Al6Mg2)([]4)[][Si2O7]4[(SiO4)10]O(F,OH)9 Q
Sorosilicates with Si3O10, Si4O11, etc. anions; cations in tetrahedral [4] and greater coordination
AKATOREITE (Mn++,Fe++)9Al2Si8O24(OH)8 A
Sorosilicates with Si3O10, Si4O11, etc. anions; cations in octahedral [6] and greater coordination
ORIENTITE Ca2Mn++Mn+++2Si3O10(OH)4 O
MEDAITE (Mn,Ca)6(V+++++,As)Si5O18(OH) M
ARDENNITE-(As) Mn4[Al4(AlMg)][Si5As]O22(OH)6 O
ARDENNITE-(V) Mn4[Al4(AlMg)][Si5V]O22(OH)6 O
PRISMATINE (Mg,Al,Fe++)5-6Al4((Si,Al)O4)4(BO3)(O,OH,F)3 O
KORNERUPINE Mg4(Al,Fe+++)6(Si,B)4O21(OH) O
ZUNYITE Al13Si5O20(OH,F)18Cl C
HUBEITE Ca2Mn++Fe+++Si4O12(OH).2H2O A
CASSAGNAITE (Ca,Mn++)4(Fe+++,Mn+++,Al)4(V+++,Mg,Al)2(SiO4)2(Si3O10)(OH,O)8 O
ALPEITE Ca4Mn+++2Al2(Mn+++Mg)(SiO4)2(Si3O10)(VO4)(OH)6 O
ARDENNITE-(Si) Mn++4Al4(AlMg)(SiO4,AsO4)(SiO4)2(Si3O10)(OH)6 (?) O
KANNANITE Ca4Al4(MgAl)(VO4)(SiO4)2(Si3O10)(OH)6 Ca4Al4(MgAl)(VO4)(SiO4)2(Si3O10)(OH)6 O
Unclassified sorosilicates
[Si3O9]6- 3-membered single rings (dreier-Einfachringe), without insular complex anions
BOBTRAILLITE (Na,Ca)13Sr11(Zr,Y,Nb)14Si42B6O132(OH)12.12H2O R
[Si3O9]6- 3-membered single rings, with insular complex anions
ROEBLINGITE Pb2Ca6Mn++(Si6O18)2(SO4)2(OH)2.4H2O M
DIVERSILITE-(Ce) Na2(Ba,K)6CeFe++2Ti3[Si3O9]3[SiO3OH]3.9(OH,H2O) R
ILIMAUSSITE-(Ce) (Na,K)7-8(Ba,K)10Ce5(Nb,Ti)6(Si12O36)(Si9O18)(O,OH)24O6 R ps H
[Si3O9]6- - branched 3-membered single rings
[Si3O9]6- 3-membered double rings
[Si4O12]8- 4-membered single rings (vierer-Einfachringe), without insular complex anions
VERPLANCKITE Ba2(Mn,Fe++,Ti)Si2O6(O,OH,Cl,F)2.3H2O H
BAOTITE Ba4(Ti,Nb)8Si4O28Cl Q
TARAMELLITE Ba4(Fe+++,Ti,Fe++,Mg)4(B2Si8O27)O2Clx O
TITANTARAMELLITE Ba4(Ti,Fe+++,Fe++,Mg)4(B2Si8O27)O2Clx O
BYELORUSSITE-(Ce) NaMn++Ba2(Ce,La)2Ti2Si8O26(F,OH).H2O O
JOAQUINITE-(Ce) Ba2NaCe2Fe++(Ti,Nb)2Si8O26(OH,F).H2O M
ORTHOJOAQUINITE-(La) Ba2Na(La,Ce)2Fe++(Ti,Nb)2Si8O26(O,OH,F).H2O O
PARATSEPINITE-Ba (Ba,Na,K)2-x(Ti,Nb)2(Si4O12)(OH,O)2.4H2O M
PARATSEPINITE-Na Na(NaSrKCa)7(TiNb)8(Si4O12)4(O,OH)8.H2O M
TSEPINITE-Ca (Ca,K,Na)4(Ti,Nb)4(Si4O12)2(OH,O)4.8H2O M
TSEPINITE-K (K,Ba,Na)4(Ti,Nb)4(Si4O12)2(OH,O)4.6H2O M
TSEPINITE-Na Na(Na,H3O,K,Sr,Ba)12-xTi8(Si4O12)4(OH,O)8.nH2O (x=0-6, n=12-16) M
TSEPINITE-Sr (Sr,Ba,K)2-x(Ti,Nb)4(Si4O12)(OH,O)2.5-6H2O M
VUORIYARVITE-K (K,Na)12-xNb8(Si4O12)4(O)8.nH2O (x=0-6, n=12-16) M
KUZMENKOITE-Zn K2Zn(Ti,Nb)4(Si4O12)2(OH,O)4.6-8H2O M
LEPKHENELMITE-Zn (Ba,K)2Zn(Ti,Nb)4Si8O24(O,OH)4.7H2O M
KUZMENKOITE-Mn K4Mn2Ti8(Si4O12)4(OH)8.nH2O (n=10-12) M
KARUPMOLLERITE-Ca (Na,Ca,K)2Ca2(Nb,Ti)4(Si4O12)2(O,OH)4.7H2O M
GJERDINGENITE-Mn (K,Na)2(Mn++,Fe++)(Nb,Ti)4(Si4O12)2(O,OH)4.6H2O M ps O
GJERDINGENITE-Fe K2(Fe++,Mn++)(Nb,Ti)4(Si4O12)2(O,OH)4.7-8H2O M ps O
GJERDINGENITE-Ca (K,Na,Sr)2Ca(Nb,Ti)4(Si4O12)2(O,OH)2.6H2O M
BUROVAITE-Ca (K,Na)4Ca2(Ti,Nb)8[Si4O12]4(OH,O)8.12H2O M
GJERDINGENITE-Na (K,Na,Sr)2Na(Nb,Ti)4(Si4O12)2(O,OH)2.5H2O M
LEMMLEINITE-K Na4K4K4Ti8(Si4O12)4(O,OH)8.8H2O M ps O
LEMMLEINITE-Ba Na4K4Ba2+xTi8(Si4O12)4(O,OH)8.8H2O M
LABUNTSOVITE-Fe Na4K4Fe2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
LABUNTSOVITE-Mg Na4K4Mg2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
LABUNTSOVITE-Mn Na4K4Mn2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
PARALABUNTSOVITE-Mg Na8K8Mg4Ti16(Si4O12)8(O,OH)8.nH2O (n=20-24) M
PARAKUZMENKOITE-Fe (K,Ba)8Fe4Ti16(Si4O12)8(OH,O)16.nH2O (n=20-28) M
ORGANOVAITE-Mn K8Mn4Nb16(Si4O12)8O16.nH2O (n=20-28) M
ORGANOVAITE-Zn K8Zn4Nb16(Si4O12)8O16.nH2O (n=20-28) M
ALSAKHAROVITE-Zn (Na,Ca)Sr(K,Ba)Zn(Ti,Nb)4(Si4O12)2(O,OH)4.7H2O M
GUTKOVAITE-Mn CaK2Mn(Ti,Nb)4(Si4O12)2(O,OH)4.5H2O M
NESKEVAARAITE-Fe K3Na2Fe++(Ti,Nb)4(Si4O12)2(O,OH)4.5-6H2O M
KOMAROVITE (Ca,Sr,Na)2(Nb,Ti)6(Si4O12)(O,OH)14(F,OH)2.6-7H2O O
NATROKOMAROVITE Na6Ca(Nb,Ti)6(Si4O12)(O,OH)14(F,OH)2.3-4H2O O
[Si4O12]8- 4-membered single rings, with insular complex anions
KAINOSITE-(Y) Ca2(Y,Ce)2Si4O12(CO3).H2O O
PHOSINAITE-(Ce) Na13Ca2(Ce,La,Th,Nd,Pr)(Si4O12)(PO4)4 O
STRAKHOVITE NaBa3(Mn++,Mn+++)4Si6O19(OH)3 M
CERCHIARAITE-(Mn) Ba4(Mn+++,Fe+++,Al)4(Si6O18)(OH)7Cl Q
CERCHIARAITE-(Al) Ba4(Al,Fe+++)4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl Q
CERCHIARAITE-(Fe) Ba4(Fe+++,Al)4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl Q
BOBMEYERITE Pb4(Al3Cu)(Si4O12)(S0,5Si0,5O4)(OH)7Cl(H2O)3 O
[Si4O12]8- branched 4-membered single rings
[Si4O12]8- 4-membered double rings
HYALOTEKITE (Ba,Pb,Ca,K)6(B,Si,Al)2(Si,Be)10O28(F,Cl) A ps M
KAPITSAITE-(Y) (Ba,K,Pb++)4(Y,Ca,Na)2Si8(B,Si)4O28F A ps Q
TURKESTANITE Th(Ca,Na)2(K1-x[]x)Si8O20.nH2O Q
ARAPOVITE (U,Th)(Ca,Na)2(K1-x[]x)Si8O20.H2O (x=0,5) Q
IRAQITE-(La) K(La,Ce,Th)2(Ca,Na)4(Si,Al)16O40 Q
STEACYITE Th(Ca,Na)2K1-xSi8O20 Q
KHVOROVITE (Pb,Ba,K)4Ca2[Si8B2(Si,B)2O28]F A
[Si6O18]12- 6-membered single rings (sechser-Einfachringe), without insular complex anions
BAZZITE Be3(Sc,Al)2Si6O18 H
BERYL Be3Al2Si6O18 H
STOPPANIITE (Fe,Al,Mg)4(Be6Si12O36)(H2O)2(Na,[]) H
KAPUSTINITE Na5(Na,Mn++)Zr(Si6O16)(OH)2 M
LITVINSKITE Na2([],Na,Mn++)ZrSi6O12(O,OH)6 M
TISINALITE Na3H3(Mn++,Ca,Fe)TiSi6(O,OH)18.2H2O R
IMANDRITE Na12Ca3Fe+++2Si12O36 O
KOASHVITE Na6(Ca,Mn)(Ti,Fe)Si6O18.H2O O
BARATOVITE KCa7(Ti,Zr)2Li3Si12O36F2 M ps H
GERENITE-(Y) (Ca,Na)2(Y,REE)3(Si6O18).2H2O A
ODINTSOVITE K2(Na,Li)4Ca3Ti2Be4Si12O38 O
AVDEEVITE (Na,Cs)(Be2Li)Al2(Si6O18) H
[Si6O18]12- 6-membered single rings, with insular complex anions
SCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3OH R
MAGNESIOFOITITE [](Mg2Al)Al6(Si6O18)(BO3)3(OH)3OH R ps H
OLENITE NaAl3Al6(Si6O18)(BO3)3(O3)OH R
OXYDRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3FNa(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O R
OXYROSSMANITE [](LiAl2)Al6(Si6O18)(BO3)3(OH)3O R
OXYUVITE CaMg3Al6(Si6O18)(BO3)3(OH)3O R
ROSSMANITE [](LiAl2)Al6(Si6O18)(BO3)3(OH)3OH R
TSILAISITE NaMn++3Al6(Si6O18)(BO3)3(OH)3(OH) R ps H
LUINAITE-(OH) (Na,[](Fe++,Mg)3Al6(BO3)3Si6O18(OH)4 R
OXYSCHORL Na(Fe++Al)3Al6(Si6O18)(BO3)3(OH)3O R
POVONDRAITE NaFe+++3(Fe+++4Mg2)(Si6O18)(BO3)3(OH)3O R
ELBAITE Na(Li1,5Al1,5)Al6(Si6O18)(BO3)3(OH)3OH R
FOITITE [](Fe++2Al)Al6(Si6O18)(BO3)3(OH)3OH R
DUTROWITE Na(Fe++2,5Ti0,5)Al6(Si6O18)(BO3)3(OH)3O R
FERUVITE CaFe++3(Al5Mg)(Si6O18)(BO3)3(OH)3OH R
FLUORUVITE CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F R
FLUORELBAITE Na(Li1,5Al1,5)Al6(Si6O18)(BO3)3(OH)3F R
FLUORFERUVITE Ca(Fe++)3MgAl5(Si6O18)(BO3)3(OH)3F R
DRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3OH R
LIDDICOATITE Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) R
ABENAKIITE-(Ce) Na26(Ce,Nd,La,Pr,Th,Sm)6(SiO3)6(PO4)6(CO3)6(S++++O2)O R
STEENSTRUPINE-(Ce) Na14Mn++2(Fe+++,Mn+++)2Ce6(Zr,Th)(Si6O18)2(PO4)6(HPO4)(OH)2.2H2O R
OXYFOITITE [](Fe++Al2)Al6(Si6O18)(BO3)3(OH)3O R
BOSIITE NaFe+++3(Al4Mg2)(Si6O18)(BO3)3(OH)3O R
MARUYAMAITE K(MgAl2)(Al5Mg)(BO3)3(Si6O18)(OH)3O R ps H
UVITE CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3OH R
FLUORSCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3F R
CELLERIITE [](?Mn++2Al)Al6(Si6O18)(BO3)3(OH)3(OH) R
ADACHIITE CaFe++3Al6(Si5AlO18)(BO3)3(OH)3(OH) R
LUCCHESIITE CaFe++3Al6(Si6O18)(BO3)3(OH)3O R
[Si6O18]12- branched 6-membered single rings
TIENSHANITE KNa3(Na,K,[])6(Ca,Y,REE)2Ba6(Mn++,Fe++,Zn,Ti)6(Ti,Nb)6Si36B12O114[O5,5(OH,F)3,5]F2 H
YAGIITE (Na,K)1,5Mg2(Al,Mg)3(Si,Al)12O30 H
OSUMILITE (K,Na)(Fe++,Mg)2(Al,Fe+++)3(Si,Al)12O30 H
DARAPIOSITE NaxK(Li,Zn,Fe++)2(Mn,Zr,Y)2(Si12O30) (x = less than 2) H
OSUMILITE-(Mg) KMg2Al3(Al2Si10)O30 H
ROEDDERITE (Na,K)2(Mg,Fe++)5Si12O30 H
SHIBKOVITE K(Ca,Mn,Na)2(K2-x[]x)2Zn3Si12O30 H
SOGDIANITE (Zr,Ti++++,Fe+++,Al)2([],Na)2K[Li3Si12O30] H
TRATTNERITE (Mg,Fe++)3Fe+++2(Si12O30) H
OFTEDALITE (Sc,Ca,Mn++)2K(Be,Al)3Si12O30 H
SUGILITE KNa2(Fe++,Mn++,Al)2Li3Si12O30 H
MERRIHUEITE (K,Na)2(Fe++,Mg)5Si12O30 H
DUSMATOVITE K(K,Na,[])(Mn++,Y,Zr)2(Zn,Li)3Si12O30 H
MILARITE KCa2AlBe2Si12O30.0,5H2O H
CHAYESITE K(Mg,Fe++)4Fe+++Si12O30 H
ALMARUDITE (K,Na)(Mn++,Fe++,Mg)2(Be,Al)3(Si12O30) H
FAIZIEVITE K2Li6Na(Ca6Na)Ti4[Si6O18]2[Si12O30]F2 A
FRIEDRICHBECKEITE K([]0,5Na0,5)2(Mg0,8Mn0,1Fe0,1)2(Be0,6Mg0,4)3[Si12O30] H
KLOCHITE ([]1Na1)KFe2Zn3(Si12O30) H
[Si8O24]16- 8-membered rings
MUIRITE Ba10Ca2MnTiSi10O30(OH,Cl,F)10 Q
[Si9O27]18- 9-membered rings
JOHNSENITE-(Ce) Na12(Ce,La,Sr,Ca,M)3Ca6Mn3Zr3W(Si25O73)(CO3)(OH,Cl)2 R
VORONKOVITE Na15(Na,Ca,Ce)3(Mn,Ca)3Fe3Zr3Si26O72(OH,O)4Cl.H2O R
TASEQITE Na12Sr3Ca6Fe3Zr3NbSi25O73(O,OH,H2O)3Cl2 R
RASTSVETAEVITE Na27K8Ca12Fe3Zr6Si4[Si3O9]4[Si9O27]4(O,OH,H2O)6Cl2 R
RASLAKITE Na15Ca3Fe3(Na,Zr)3Zr3Nb0,5(Si3O9)2(Si9O27)2(SiO)(Cl,OH).3(OH,H2O) R
ONEILLITE Na15Ca3Mn3Fe3Zr3Nb(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
MOGOVIDITE Na9(Ca,Na)5Ca6Zr3Fe2(Si,Nb)[(OH,H2O)3|Cl0,3|CO3|(Si3O9)2(Si9O27)2] R
KHOMYAKOVITE Na12Sr3Ca6Fe++3Zr3W(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
LABYRINTHITE (Na,K,Sr)35Ca12Fe3Zr6TiSi51O144(O,OH,H2O)9Cl3 R
ZIRSILITE-(Ce) Na11-12Ca6(Ce,Na)3Mn3Zr3Nb(CO3)2(Si3O9)4(Si9O27)2(SiO)(OH)6.H2O R
KENTBROOKSITE (Na,REE)15(Ca,REE)6(Mn++,Fe++)3Zr3Nb(Si25O73)(O,OH,H2O)3(F,Cl)2 R
CARBOKENTBROOKSITE (Na,[])12(Na,Ce)3Ca6Mn3Zr3Nb(Si25O73)(OH)3(CO3).H2O R
ALLUAIVITE Na19(Ca,Mn++)6(Ti,Nb)3(Si3O9)2(Si10O28)2Cl.2H2O R
IKRANITE (Na,H3O)15(Ca,Mn,REE)6Fe+++2Zr3([],Zr)([],Si)Si24O66(O,OH)6Cl.nH2O R
AQUALITE (H3O)8(Na,K,Sr)5Ca6Zr3Si26O66(OH)9Cl R
DUALITE Na30(Ca,Na,Ce,Sr)12(Na,Mn,Fe,Ti)6Zr3Ti3MnSi51O144(OH,H2O,Cl)9 R
EUDIALYTE Na15Ca6(Fe++,Mn)3Zr3(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
FEKLICHEVITE Na11Ca9(Fe+++,Fe++)2Zr3Nb[Si25O73](OH,H2O,Cl,O)5 R
GOLYSHEVITE [Na10Ca3]Ca6Zr3Fe2SiNb[(OH)3|CO3|(Si3O9)2|(Si9O27)2].H2O R
HYDRORASTSVETAEVITE (Na11(H3O)11K6(H2O)1,5Sr)Ca12Fe3Na2MnZr6Si52O144(OH)4,5Cl3,5 R
ANDRIANOVITE Na12(K,Sr,Ce)3Ca6Mn3Zr3Nb(Si25O73)(O,H2O,OH)5 R
SIUDAITE Na8(Mn++2Na)Ca6(Fe+++,Mn++)3Zr3NbSi24(Si,[],Ti)O74(OH)2Cl.5H2O R
FENGCHENGITE Na12[]3(Ca,Sr)6Fe+++3Zr3Si(Si25O73)(H2O,OH)3(OH,Cl)2 R
ILYUKHINITE (H3O,Na)14Ca6Mn2Zr3Si26O72(OH)2.3H2O R
ODIKHINCHAITE Na9Sr3[(H2O)2Na]Ca6Mn3Zr3NbSi(Si24O72)O(OH)3(CO3).H2O R
SERGEVANITE Na15(Ca3Mn3)(Na2Fe)Zr3Si26O72(OH)3.H2O R
12-membered and larger rings
TRASKITE Ba9Fe++2Ti2(SiO3)12(OH,Cl,F)6.6H2O H
Inosilicates with 2-periodic single chains, Si2O6; pyroxene family
PIGEONITE (Mg,Fe++,Ca)(Mg,Fe++)Si2O6 M
KANOITE (Mn++,Mg)2Si2O6 M
AUGITE (Ca,Na)(Mg,Fe,Al,Ti)(Si,Al)2O6 M
PETEDUNNITE Ca(Zn,Mn++,Fe++,Mg)Si2O6 M
OMPHACITE (Ca,Na)(Mg,Fe++,Fe+++,Al)Si2O6 M
JADEITE Na(Al,Fe+++)Si2O6 M
JERVISITE (Na,Ca,Fe++)(Sc,Mg,Fe++)Si2O6 M
NATALYITE Na(V+++,Cr+++)Si2O6 M
Inosilicates with 2-periodic single chains, Si2O6; Pyroxene-related minerals
ELISEEVITE Na1,5Li[Ti2Si4O12,5(OH)1,5].2H2O M
VINOGRADOVITE Na8Ti8O8(Si2O6)4[(Si3Al)O10]2[(H2O),(Na,K)2] M
AERINITE (Ca5,1Na0,5)(Fe+++AlFe++1,7Mg0,3)(Al5,1Mg0,7)[Si12O36(OH)12H].[(CO3)1,2(H2O)12] H
Inosilicates with branched 2-periodic single chains; Si2O6 + 2SiO3 Si4O12
NALIVKINITE Li2Na(Fe++,Mn++)7Ti2Si8O26(OH)4F A
ZIRCOPHYLLITE K2(Na,Ca)(Fe++,Mn)7(Zr,Nb)2Si8O26(OH)4F A
SVEINBERGITE Ca(Fe++6Fe+++)Ti2(Si4O12)2O2(OH)5(H2O)4 A
NIOBOKUPLETSKITE K2Na(Mn++,Zn,Fe++)7(Nb,Zr,Ti)2Si8O26(OH)4(O,F) A
LOBANOVITE K2Na2(Fe++,Fe+++,Mn)4Mg2Ti2Si8O26(OH)4 M
KUPLETSKITE K2Na(Mn,Fe++)7(Ti,Nb)2Si8O26(OH)4F A
NIOBOPHYLLITE K2Na(Mn,Fe++)7(Nb,Ti)2Si8O26(OH)4(F,O) A
KUPLETSKITE-(Cs) (Cs,K)2Na(Mn,Fe,Li)7(Ti,Nb)2Si8O26(OH)4F A
TARBAGATAITE (K,[])2(Ca,Na)(Fe++,Mn)7Ti2(Si4O12)2O2(OH)4(OH,F) A
DEVITOITE [Ba6(PO4)2(CO3)][Fe++7(OH)4Fe+++2O2(SiO3)8] A
BULGAKITE Li2(Ca,Na)Fe++7Ti2(Si4O12)2O2(OH)4(F,O)(H2O)2 A
Inosilicates with 2-periodic double chains, Si4O11; Orthoamphiboles
GEDRITE [](Mg,Fe++)5Al2Si6Al2O22(OH)2 O
PROTOFERROSUENOITE (Mn++,Fe++)2(Fe++,Mg)5(Si4O11)2(OH)2 O
FERROGEDRITE [](Fe++,Mg)5Al2Si6Al2O22(OH)2 O
FERROHOLMQUISTITE []{Li2}{Fe++3Al2}(Si8O22)(OH)2 O
FERRIHOLMQUISTITE []{Li2}{Mg3Fe+++2}(Si8O22)(OH)2 O
FERROPAPIKEITE NaFe++2(Fe++3Al2)(Si5Al3)O22(OH)2 O
PAPIKEITE NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 O
Inosilicates with 2-periodic double chains, Si4O11; Clinoamphiboles
GRUNERITE []Fe++7Si8O22(OH)2 M
LEAKEITE NaNa2(Mg2Fe+++2Li)Si8O22(OH)2 M
FERROHORNBLENDE []Ca2[Fe++4(Al,Fe+++)]Si7AlO22(OH)2 M
JOESMITHITE PbCa2(Mg,Fe++,Fe+++)5Si6Be2O22(OH)2 M
FLUORHORNBLENDE ([]/Na,K)Ca2({Fe++/Mg}4{Fe+++/Mg})(AlSi7O22)F2 M
TSCHERMAKITE []Ca2(Mg3AlFe+++)Si6Al2O22(OH)2 M
ACTINOLITE []Ca2(Mg,Fe++)5Si8O22(OH)2 M
POTASSICSADANAGAITE (K,Na)Ca2[Fe++3(Al,Fe+++)2]Si5Al3O22(OH)2 M
PARGASITE NaCa2(Mg4Al)Si6Al2O22(OH)2 M
SADANAGAITE NaCa2Mg3(Al,Fe++,Ti)2(Al,Si)4(Si2O11)2(OH)2 M
SADANAGAITE {Na}{Ca2}{Mg3Al2}(Si5Al3O22)(OH)2 M
POTASSICPARGASITE (K,Na)Ca2(Mg,Fe++,Al,Fe+++)5(Si,Al)8O22(OH,F)2 M
EDENITE NaCa2(Mg,Fe++)5(Si7Al)O22(OH)2 M
FERRISADANAGAITE {Na}{Ca2}{Mg3Fe+++2}(Al3Si5O22)(OH)2 M
HASTINGSITE NaCa2(Fe++4Fe+++)Si6Al2O22(OH)2 M
FERROFERRISADANAGAITE {Na}{Ca2}{Fe++3Fe+++2}(Al3Si5O22)(OH)2 M
KATOPHORITE Na(NaCa)(Mg4Al)(Si7Al)O22(OH)2 M
KATOPHORITE Na(CaNa)Fe++4(Al,Fe+++)Si7AlO22(OH)2 M
GHOSEITE [][Mn++Na][Mg4Al]Si8O22(OH)2 m
FLUOROTARAMITE {Na}{CaNa}{Mg3Al2}(Al2Si6O22)F2 M
FERROWINCHITE [](CaNa)Fe++4(Al,Fe+++)Si8O22(OH)2 M
TARAMITE Na(CaNa)Fe++3AlFe+++Si6Al2O22(OH)2 M
WINCHITE [](CaNa)Mg4(Al,Fe+++)Si8O22(OH)2 M
FERROTARAMITE Na2Ca(Fe++,Mg)3Al2(AlSi3O11)2(OH)2 M
FERRIGHOSEITE [][Mn++Na][Mg4Fe+++]Si8O22(OH)2 M
BARROISITE [](CaNa)Mg3AlFe+++Si7AlO22(OH)2 M
FERRIKATOPHORITE Na2Ca(Fe++,Mg)4Fe+++(Si7Al)O22(OH)2 M
FERRITARAMITE Na(NaCa)(Mg3Fe+++2)(Si6Al2)O22(OH)2 M
FERRIWINCHITE []NaCa(Mg,Fe++)4Fe+++Si8O22(OH)2 M
FERROFERRITARAMITE Na(CaNa)(Fe++3Fe+++2)(Al2Si6O22)(OH)2 M
FERROFERRIWINCHITE [][CaNa][Fe++4(Fe+++,Al)]Si8O22(OH)2 M
LEAKEITE NaNa2(Mg2Al2Li)(Si8O22)(OH)2 M
GLAUCOPHANE []Na2(Mg3Al2)Si8O22(OH)2 M
FLUORONYBOITE Na(Na,Ca)2(Mg,Fe++)3(Al,Mg,Fe+++)2Si7AlO22(F,OH)2 M
RIEBECKITE []Na2(Fe++3Fe+++2)Si8O22(OH)2 M
NYBOITE NaNa2(Mg3Al2)Si7AlO22(OH)2 M
PEDRIZITE Li2(Li,MgFe++Al)5(Si,Al)8O22(OH,F)2 M
ARFVEDSONITE NaNa2(Fe++,Mg)4Fe+++Si8O22(OH)2 M
FERRILEAKEITE [Na][Na2][Mg2Fe+++2Li]Si8O22(OH)2 M
FERRIPEDRIZITE [Na][Li2][Mg2Fe+++2Li]Si8O22(OH)2 M
FERROLEAKEITE NaNa2(Fe++2Fe+++2Li)Si8O22(OH)2 M
FERROFERRILEAKEITE [Na][Na2][Fe++2Fe+++2Li]Si8O22(OH)2 M
SUENOITE []Mn2Mg5Si8O22(OH)2 O
PERMANGANOGRUNERITE = Theoretical []Mn4Fe++3Si8O22(OH)2 M
OXOPARGASITE NaCa2(Mg3(Al2-x,Tix))5(Si6Al2O22)O2 M
CLINOFERROSUENOITE []{Mn++2}{Fe++5}(Si8O22)(OH)2 M
Inosilicates with 2-periodic multiple chains
CHESTERITE (Mg,Fe++)17Si20O54(OH)6 O
ERSHOVITE Na4K3(Fe++,Mn++,Ti)2Si8O20(OH)4.4H2O A
TVEDALITE (Ca,Mn++)4Be3Si6O17(OH)4.3H2O O
BOHSEITE Ca4Be3+xAl1-xSi9O25-x(OH)3+x (x=0-1) O
Inosilicates with 3-periodic single and multiple chains
TOBERMORITE [Ca4Si6O17.2H2O].(Ca.3H2O) O
JENNITE Ca9[Si6O18(OH)6].8H2O A
CHIVRUAIITE Ca4(Ti,Nb)5[(Si6O17)2[(OH,O)5].13-14H2O O
ZORITE Na2Ti(Si,Al)3O9.nH2O O
HAINEAULTITE (Na,Ca)5Ca(Ti,Nb)5(Si12O34)(OH,F)4.5H2O O
TINAKSITE K2Na(Ca,Fe++,Mn++,Mg)2(Ti,Fe)Si7O19(OH) A
MISERITE K1,5-x(Ca,Y,REE )5[Si6O15][Si2O7](OH,F)2.yH2O A
CHAROITE (K,Sr,Ba,Mn)15-16(Ca,Na)32[(Si70(O,OH)180)](OH,F)4.nH2O M
YUKSPORITE K4(Sr,Ba)2(Ca,Na)14(Mn,Fe)0.5(Ti,Nb)4(Si2O7)3(Si6O17)2(O,OH)4.3(OH,H2O) M
EVESLOGITE (Ca,K,Na,Sr,Ba)48[(Ti,Nb,Fe,Mn)12(OH)12Si48O144](F,OH,Cl)14 M
SCHIZOLITE NaCaMnSi3O8(OH) 8/F.18-078
ESCHEITE Ca2NaMnTi5[Si12O34]O2(OH)3.12H2O O
PARATOBERMORITE Ca4(Al0,5Si0,5)2Si4O16(OH)(H2O)2.(Ca.3H2O) M
Inosilicates with 4-periodic single chains, Si4O12
OHMILITE Sr3(Ti,Fe+++)(Si2O6)2(O,OH).2-3H2O M
HARADAITE Sr2V++++2O2(Si4O12) O
BATISITE (Ba,K,Na)3Ti2Si4O14 O
TAIKANITE (Ba,Sr)2Mn+++2Si4O12 M
BALANGEROITE (Mg,Fe+++,Fe++,Mn++)42Si16O54(OH)40 M
GAGEITE (Mn,Mg,Zn)42Si16O54(OH)40 M
DORRITE Ca2Mg2Fe+++4Si2Al4O20 A
WELSHITE Ca4Mg9Sb+++++3Be3Si6(Fe+++,Al)3O20 A
SERENDIBITE Ca2Mg3Al3Si3Al1,5B1,5O20 A
RHONITE Ca2(Mg,Fe++)4Fe+++Ti++++Si3Al3O20 A
HOGTUVAITE (Ca,Na)2(Fe++,Fe+++,Ti,Mg,Sn,Mn)6(Si,Be,Al)6O20 A
AENIGMATITE Na2Fe++5Ti++++Si6O20 A
SAPPHIRINE (Mg,Al)8(Al,Si)6O20 M/A
KHMARALITE Mg5,5Al14Fe2Si5Be1,5O40 M
SURINAMITE (Mg,Fe+++)3(Al,Fe+++)3BeSi3O16 M
DEERITE (Fe++,Mn)6(Fe+++,Al)3Si6O20(OH)5 M ps O
HOWIEITE Na(Fe++,Mn)10(Fe+++,Al)2Si12O31(OH)13 A
TANEYAMALITE Na(Mn++,Mg,Fe++)12Si12(O,OH)44 A
JOHNINNESITE Na2Mn++9(Mg,Mn++)7(OH)8(AsO4)2(Si6O17)2 A
KURATITE Ca2(Fe++5Ti)O2[Si4Al2O18] A
Inosilicates with 4-periodic double and triple chains
NARSARSUKITE Na2(Ti,Fe+++)Si4(O,F)11 Q
CAYSICHITE-(Y) Y4(Ca3REE)(OH)(H2O)5(Si8O20)(CO3)6.2H2O O
SEIDITE-(Ce) Na4(Ce,Sr)2TiSi8O18(O,OH,F)5(OH).5H2O M
CARLOSTURANITE (Mg,Fe++,Ti)21(Si,Al)12O28(OH)34.H2O M
JONESITE Ba4(K,Na)2Ti4Al2Si10O36.6H2O O
Inosilicates with 5-periodic single chains
BABINGTONITE Ca2(Fe++,Mn)Fe+++Si5O14(OH) A
NAMBULITE (Li,Na)(Mn,Ca)4Si5O14(OH) A
RHODONITE (Mn++,Fe++,Mg,Ca)SiO3 A
SANEROITE Na2(Mn++,Mn+++)10Si11VO34(OH)4 A
HELLANDITE-(Ce) (Ca3REE)4Ce2Al[]2[Si4B4O22](OH)2 M
HELLANDITE-(Y) (Ca3REE)4Y2Al[]2[Si4B4O22](OH)2 M
MOTTANAITE-(Ce) Ca4Ce2Al(Be1,5[]0,5)[B4Si4O22]O2 M
CIPRIANIITE Ca4[(Th,U)Ca]2Al(Be0,5[]1,5)[B4Si4O22](OH)2 M
TADZHIKITE-(Ce) Ca4Ce2Ti[]2[Si4B4O22](OH)2 M
FERRIHELLANDITE-(Ce) (Ca3Ce)Ce2Fe+++[]2B4Si4O22(OH)2 M
FERRIMOTTANAITE-(Ce) Ca4Ce2Fe+++(Be1,5[]0,5)[Si4B4O22]O2 M
Inosilicates with 5-periodic double chains, Si10O28
INESITE Ca2Mn7Si10O28(OH)2.5H2O A
PIERGORITE-(Ce) Ca8Ce2(Al0,5Fe3+++0,5)([],Li,Be)2Si6B8O36(OH,F)2 M
Inosilicates with 6-periodic single chains
PYATENKOITE-(Y) Na5(Y,Dy,Gd)(Ti,Nb)Si6O18.6H2O R
SAZYKINAITE-(Y) (Na,K)5Y(Zr,Ti)Si6018.6H2O R
SCHEUCHZERITE Na(Mn,Mg,Zn)9V+++++Si9O28(OH)4 A
Inosilicates with 6-periodic double chains
TUHUALITE (Na,K)Fe++Fe+++Si6O15 O
EMELEUSITE Na4Li2Fe+++2Si12O30 O ps H
SEMENOVITE-(Ce) (Ca,Ce,La,Na)10-12(Fe++,Mn)(Si,Be)20(O,OH,F)48 O
ASHCROFTINE-(Y) K5Na5(Y,Ca)12Si28O70(OH)2(CO3)8.8H2O Q
Inosilicates with 7-, 8-, 10-, 12- and 14-periodic chains
PELLYITE Ba2Ca(Fe++,Mg)2Si6O17 O
NORDITE-(Ce) Na3SrCeZnSi6O17 O
NORDITE-(La) Na3SrLaZnSi6O17 O
FERRONORDITE-(La) Na3Sr(La,Ce)Fe++Si6O17 O
BRACCOITE NaMn++5[Si5O14(OH)](AsO3)(OH) A
ILLOQITE-(ce) Na2NaBaCeZnSi6O17 O
Transitional ino-phyllosilicate structures
MELIPHANITE Ca4(Na,Ca)4Be4AlSi7O24(F,O)4 Q
LEMOYNITE (Na,K)2CaZr2Si10O26.5-6H2O M
Modular Inosilicate-Sorosilicate Structures
Single nets of tetrahedra with 4-, 5-, (6-), and 8-membered rings
WESSELSITE (Sr,Ba)Cu++(Si4O10) Q
SAZHINITE-(Ce) Na2CeSi6O14(OH).nH2O (n = about 5) O
SAZHINITE-(La) Na3(La,Ce)Si6O15.2H2O O ps Q
PENKVILKSITE Na4(Ti++++,Zr)Si8O22.4H2O M
AJOITE (K,Na)Cu++7AlSi9O24(OH)6.3H2O A
BUSSYITE-(Ce) (Ce,REE)3(Na,H2O)6MnSi9Be5(O,OH)30F4 M
BUSSYITE-(Y) (Y,REE,Ca)3(Na,Ca)6MnSi9Be5(O,OH,F)34 M
Double nets with 4- and 6-membered rings
DELHAYELITE (Na,K)10Ca5Al6Si32O80(Cl2,F2,SO4)3.18H2O O
Phyllosilicates with mica sheets, composed of tetrahedral and octahedral nets
TALC Mg3Si4O10(OH)2 M/A
VOLOSHINITE Rb(LiAl1,5[]0,5)(Al0,5Si3,5)O10F2 M
ILLITE K0,65Al2[]Al0,65Si3,35O10(OH)2 M
TOBELITE (NH4)Al2[]AlSi3O10(OH)2 M
MUSCOVITE KAl2[]AlSi3O10(OH)2 M ps H
MONTDORITE KFe++1,5Mn++0,5Mg0,5[]0,5Si4O10F2 M
LUANSHIWEIITE KLiAl1,5(Si3,5Al0,5)O10(OH)2 M
GANTERITE (Ba,Na,K)(Al,Mg)2(Al,Si)AlSi3O10(OH)2 M
CELADONITE KFe+++(Mg,Fe++)[]Si4O10(OH)2 M
WONESITE Na0,5[]0,5Mg2,5Al0,5AlSi3O10(OH)2 M
ANNITE KFe++3AlSi3O10(OH)2 M
OXYPHLOGOPITE K(Mg,Ti,Fe)3[(Si,Al)4O10](O,F)2 M
BITYITE LiCaAl2(AlBeSi2O10)(OH)2 M
ANANDITE BaFe++3Fe+++Si3O10S(OH) M
KURUMSAKITE (Zn,Ni,Cu)8Al8V2Si5O35.27H2O (?) O (?)
MONTMORILLONITE (Na,Ca)0,3(Al,Mg)2Si4O10(OH)2.nH2O M
NONTRONITE Na0,3Fe+++2(Si,Al)4O10(OH)2.nH2O M
VOLKONSKOITE Ca0,3(Cr+++,Mg,Fe+++)2(Si,Al)4O10(OH)2.4H2O M
YAKHONTOVITE (Ca,Na)0,5(Cu++Fe++Mg)2Si4O10(OH)2.3H2O M
BEIDELLITE (Na,Ca0,5)0,3Al2(Si,Al)4O10(OH)2.nH2O M
HECTORITE Na0,3(Mg,Li)3Si4O10(F,OH)2 M
ZINCSILITE Zn3Si4O10(OH)2.4H2O (?) M
SWINEFORDITE (Ca,Na)0,3(Al,Li,Mg)2(Si,Al)4O10(OH,F)2.2H2O M
STEVENSITE (Ca,Na)xMg3-x(Si4O10)(OH)2 M
SPADAITE MgSiO2(OH)2.H2O (?) (?)
SAPONITE Ca0,25(Mg,Fe)3((Si,Al)4O10)(OH)2.nH2O M
FERROSAPONITE (Ca,Na)0,3(Fe++,Mg,Fe+++)3(Si,Al)4O10(OH)2.4H2O M
SAUCONITE Na0,3Zn3(Si,Al)4O10(OH)2.4H2O M
VERMICULITE (Mg,Fe++,Al)3(Al,Si)4O10(OH)2.4H2O M
DONBASSITE Al4,33(Si3Al)O10(OH)8 M
NIMITE (Ni,Mg,Fe++)5Al(Si3Al)O10(OH)8 M
SUDOITE Mg2(Al,Fe+++)3Si3AlO10(OH)8 M
CLINOCHLORE (Mg,Fe++)5Al(Si3Al)O10(OH)8 M
CHAMOSITE (Fe++,Mg,Fe+++)5Al(Si3Al)O10(OH,O)8 M
BOROCOOKEITE Li1+3xAl4-x(B,Al)Si3O10(OH,F)8 M
BAILEYCHLORE (Zn,Fe++,Al,Mg)6(Si,Al)4O10(OH)8 A
GONYERITE (Mn++,Mg)5Fe+++(Si3Fe+++)O10(OH)8 O (?)
CORRENSITE (Mg,Fe,Al)9(Si,Al)8O20(OH)10.nH2O O
TOSUDITE Na0,5(Al,Mg)6(Si,Al)8O18(OH)12.5H2O M (?)
SALIOTITE Li0,5Na0,5Al3AlSi3O10(OH)5 M
RECTORITE (Na,Ca)Al4(Si,Al)8O20(OH)4.2H2O M
KULKEITE Na0,35Mg8Al(AlSi7)O20(OH)10 M
KARPINSKITE (Mg,Ni)2Si2O5(OH)2 (?) M (?)
DOZYITE (Mg7Al2)(Si4Al2)O15(OH)12 M
BRINROBERTSITE Na0,3Al4(Si4O10)2(OH)4.3,5H2O M ps H
ALIETTITE Ca0,2Mg6(Si,Al)8O20(OH)4.4H2O  
MACAULAYITE (Fe+++,Al)24Si4O43(OH)2 M
BURCKHARDTITE Pb2(Fe+++Te++++++)[AlSi3O8]O6 M ps H
SURITE Pb2Ca(Al,Mg)2(Si,Al)4O10(OH)2(CO3,OH)3.0,5H2O M
NIKSERGIEVITE [Ba1,33Ca0,67Al(CO3)(OH)4][Al2(AlSi3O10)(OH)2].nH2O M
FERRISURITE Pb2Ca(Fe+++,Al)2(Si,Al)4O10(OH,F)2(CO3,OH)3.0,5H2O M
KEGELITE Pb8Al4Si8(SO4)2(CO3)4(OH)8O20 M ps H
GLAUCONITE (K,Na)(Mg,Fe++,Fe+++)(Fe+++,Al)(Si,Al)4O10(OH)2 M
PIMELITE (Ni,Mg)3Si4O10(OH)2.4H2O H
Phyllosilicates with kaolinite layers composed of tetrahedral and octahedral nets
HALLOYSITE-10Angstroem Al2Si2O5(OH)4·2H2O M
GREENALITE (Fe++,Fe+++)2-3Si2O5(OH)4 M
KELLYITE (Mn++,Mg,Al)3(Si,Al)2O5(OH)4 H
GUIDOTTIITE (Mn2Fe+++)(SiFe+++)O5(OH)4 H
CRONSTEDTITE Fe++2Fe+++(SiFe+++)O5(OH)4 M
BRINDLEYITE (Ni,Mg,Fe++)2Al(SiAl)O5(OH)4 M
BERTHIERINE (Fe++,Fe+++,Mg)2-3(Si,Al)2O5(OH)4 M
ALLOPHANE Al2O3(SiO2)1,3-2.2,5-3(H2O) am.
NEOTOCITE (Mn,Fe,Mg)SiO3.H2O am. or M
CHAPMANITE Fe+++2Sb+++(Si2O5)O3(OH) M
ODINITE (Fe+++,Mg,Al,Fe++,Ti,Mn)2,5(SiAl)O5(OH)4 M/R
Single tetrahedral nets of 6-membered rings connected by octahedral nets or octahedral bands
FRIEDELITE Mn8Si6O15(OH,Cl)10 M ps R
MCGILLITE (Mn,Fe++)8Si6O15(OH)8Cl2 R
PYROSMALITE-(Fe) (Fe++,Mn++)8Si6O15(OH,Cl)10 H
PYROSMALITE-(Mn) (Mn++,Fe++)8Si6O15(OH,Cl)10 H
SCHALLERITE (Mn++,Fe++)16Si12As+++3O36(OH)17 R
NELENITE (Mn++,Fe++)16Si12As+++3O36(OH)17 R
WINDHOEKITE (Ca,Mn++)2Fe+++3(Si8O20)(OH)4.10H2O M
KALIFERSITE (K,Na)5Fe+++7(Si20O50)(OH)6.12H2O A ps O
TUNGUSITE Ca14(OH)8(Si8O20)Fe++9(OH)14 A (?)
GYROLITE NaCa16AlSi23O60(OH)8.14H2O A ps H
REYERITE (Na,K)4Ca14Si22Al2O58(OH)8.6H2O R
TRUSCOTTITE (Ca,Mn)14Si24O58(OH)8.2H2O H
VARENNESITE Na8Mn++2Si10O25(OH,Cl)2.12H2O O
RAITE Na3Mn++3Ti++++0,25[Si4O10(OH)]2.10H2O M
INTERSILITE (Na,K)Na5Mn++(Ti,Nb)[Si10O24(OH)4].4H2O M
SHAFRANOVSKITE K2Na3(Mn,Fe,Na)4[Si9(O,OH)27](OH)2.nH2O (n=2,33) R
MINEHILLITE (K,Na)2-3Ca28(Zn4Al4Si40)O112(OH)16 H
FEDORITE (K,Na)2,5(Ca,Na)7Si16O38(OH,F)2.3,5H2O A
MARTINITE (Na,[],Ca)12Ca4(Si,S,B)14B2O38(OH,Cl)2F2.4H2O A ps H
LALONDEITE (Na,Ca)6(Ca,Na)3Si16O38(F,OH)2.3H2O A
KODAMAITE Na3(Ca5Na)Si16O36(OH)4F2.(14-x)H2O (x~5) A
BROKENHILLITE (Mn++,Fe++)8(Si6O15)(OH,Cl)10 H
FERRISEPIOLITE (Fe+++,Fe++,Mg)4(Si,Fe+++)6O15(O,OH)2.6H2O O
Single nets with 6-membered rings, connected by M[4], M[8], etc.
Double nets with 6-membered and larger rings
CYMRITE BaAl2Si2(O,OH)8.H2O M ps O
KAMPFITE Ba6[(Si,Al)O2]8(CO3)2Cl2.(Cl,H2O)2 H
VERTUMNITE Ca2Al[(OH)6AlSiO2-3(OH)4-3].2,5H2O M ps H
TAMAITE (Ca,K,Ba,Na)3-4Mn++24(Si,Al)40(O,OH)112.21H2O M
EGGLETONITE (Na,K,Ca)2(Mn,Fe)8(Si,Al)12O29(OH)7.11H2O M
GANOPHYLLITE (K,Na)2(Mn,Al,Mg)8(Si,Al)12O29(OH)7.8-9H2O M
COOMBSITE K(Mn++,Fe++,Mg)13(Si,Al)18O42(OH)14 R
ZUSSMANITE K(Fe++,Mg,Mn)13(Si,Al)18O42(OH)14 R
STILPNOMELANE K(Fe++,Mg,Fe+++,Al)8(Si,Al)12(O,OH)27.2H2O M/A
FRANKLINPHILITE (K,Na)4(Mn++,Mg,Zn,Fe+++)48(Si,Al)72(O,OH)216.6H2O A ps H
LENNILENAPEITE K6-7(Mg,Mn,Fe++,Fe+++,Zn)48(Si,Al)72(O,OH)216.16H2O A
PARSETTENSITE (K,Na,Ca)7,5(Mn,Mg)49Si72O168(OH)50.nH2O M ps H
TUSCANITE K(Ca,Na)6(Si,Al)10O22(SO4,CO3,(OH)2).H2O M
LATIUMITE (Ca,K)8(Al,Mg,Fe)(Si,Al)10O25(SO4) M
JAGOITE Pb3Fe+++Si4O12(Cl,OH) H
HYTTSJOITE Pb18Ba2Ca5Mn++2Fe+++2Si30O90Cl.6H2O R
BRITVINITE Pb8Mg9[Si10O30(OH)8(CO3)3].H2O A
BANNISTERITE KCa(Mn,Fe++,Zn)21(Si,Al)32O76(OH)16.12H2O M
Transitional structures between phyllosilicate and other silicate units
NEPTUNITE KNa2Li(Fe++,Mn)2Ti2Si8O24 M
SARCOLITE Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) Q
LEIFITE Na2(Si,Al,Be)7(O,OH,F)14 R
NAFERTISITE Na3Fe++10Ti2(Si6O17)2O2(OH)6F(H2O)2 M
Unclassified phyllosilicates
LOURENSWALSITE (K,Ba)2(Ti,Mg,Ca,Fe)4(Si,Al,Fe)6O14(OH)12 H
Tektosilicates without zeolitic H2O
Tektosilicates without additional non-tetrahedral anions
LABRADORITE (a variety of anorthite) (Ca,Na)[Al(Al,Si)Si2O8] A
OLIGOCLASE (Na,Ca)[Al(Si,Al)Si2O8] A
BYTOWNITE (a variety of anorthite) (Ca,Na)[Al(Al,Si)Si2O8] A
ANDESINE (a variety of albite) (Na,Ca)[Al(Si,Al)Si2O8] A
Tektosilicates with additional anions
SACROFANITE (Na,Ca,K)9(Si,Al)12O24[(OH)2,(SO4),(CO3),Cl2)]3.nH2O H
FRANZINITE (Na,K)6Ca2(SO4)2Al6Si6O24.0,5H2O H
TOUNKITE (Na,Ca,K)8Al6Si6O24(SO4)2Cl.H2O H
QUADRIDAVYNE [(Na,K)6Cl2](Ca2Cl2)Al6Si6O24 H
MICROSOMMITE (Na,Ca,K)7-8(Si,Al)12O24(Cl,SO4,CO3)2-3 H
MARINELLITE (Na,K,Ca)48(SO4)8(Al6Si6O24)6Cl2.3H2O H
LIOTTITE (Ca,Na,K)8(Si,Al)12O24[(SO4),(CO3),Cl,OH]4.H2O H
KYANOXALITE Na7(Al5-6Si6-7O24)(C2O4)0,5-1.5H2O H
KIRCHERITE [Na90Ca36K18]sigma=144(Si108Al108O432)(SO4)36.6H2O R ps H
GIUSEPPETTITE (Na,K,Ca)7-8(Si,Al)12O24(SO4,Cl)1-2 H
BIACHELLAITE (Na,Ca,K)8Al6Si6O24(SO4)2(OH)0,5.H2O R
FARNESEITE [(Na,K)46Ca10](Si42Al42O168)(SO4)12.6H2O H
AFGHANITE (Na,Ca,K)8(Si,Al)12O24(SO4,Cl,CO3)3.H2O H
VISHNEVITE (Na,Ca,K)6(Si,Al)12O24[(SO4),(CO3),Cl2]2-4.nH2O H
BALLIRANOITE (Na,K)6Ca2(Si6Al6O24)Cl2(CO3) H
BYSTRITE Ca(Na,K)7Si6Al6O24(S--)1,5.H2O R
DAVYNE (Na,Ca,K)8Al6Si6O24(Cl,SO4,CO3)2-3 H
DEPMEIERITE Na8[Al6Si6O24](PO4,CO3)1-x.3H2O (x smaller than 0,5) H
FANTAPPIEITE [Na82.5Ca33K16.5](Si99Al99O396)(SO4)33.6H2O R
ALLORIITE (Na,Ca,K)13Ca2(Al6Si6O24)2(SO4)3Cl2.2H2O R ps H
NOSEAN Na8Al6Si6O24(SO4).H2O C
TSAREGORODTSEVITE N(CH3)4[Si2(Si0,5Al0,5)O6]2 O ps C
LAZURITE Na7Ca(Al6Si6O24)(SO4)(S3).H2O C M A
HAUYNE (Na,Ca,K)8-4(SO4)2-1(AlSiO4)6 C
BETZITE Na6Ca2(Al6Si6O24)Cl4 H
STEUDELITE Na3[](K17Ca7)Ca4(Al24Si24O96)(SO3)6F6.4H2O H
Tektosilicates with zeolitic H2O; zeolite family
FERRIERITE-NH4 (NH4,Mg0,5)5(Al5Si31O72).22H2O O
MEIERITE Ba44Si66Al30O192Cl25(OH)33 C
Zeolites with T5O10 Units - The Fibrous Zeolites
GONNARDITE (Na,Ca)6-8[(Al,Si)20O40].12H2O O
MESOLITE Na16Ca16[Al48Si72O240].64H2O O
THOMSONITE-Sr (Sr,Ca)2Na[Al5Si5O20].6-7H2O O
Chains of single connected 4-membered rings
POLLUCITE (Cs,Na)[AlSi2O6].nH2O (Cs+n=1) C
LAUMONTITE Ca4[Al8Si16O48].18H2O M
ROGGIANITE Ca2[Be(OH)2Al2Si4O13].2,5H2O Q
PARTHEITE Ca2[Al4Si4O15(OH)2].4H2O M
Chains of doubly-connected 4-membered rings
AMICITE K4Na4[Al8Si8O32].10H2O M
GARRONITE-Ca Ca3(Al6Si10O32).14H2O Q
GOBBINSITE Na5[Al5Si11O32].12H2O O ps Q
PHILLIPSITE-K (K,Na,Ca0,5,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M
PHILLIPSITE-Na (Na,K,Ca0,5,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M
PHILLIPSITE-Ca (Ca0,5,K,Na,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M ps O
HARMOTOME Ba2(Ca0,5,Na)Al6Si10O32.12H2O M
FLORKEITE K3NaCa2(Al8Si8O32) A ps M
MERLINOITE K5Ca2[Al9Si23O64].22H2O O
MAZZITE-Mg (Mg2,5K2Ca1,5)[Al10Si26O72].30H2O H
MAZZITE-Na Na4[Al4Si14O36].15H2O H
PERLIALITE K9Na(Ca,Sr)[Al12Si24O72].15H2O H
BOGGSITE Ca8Na3[Al19Si77O192].70H2O O
PAULINGITE-Ca (Ca0,5,K,Na)10[Al10Si32O84].27-44H2O C
PAULINGITE-K (K,Ca0,5,Na)10[Al10Si32O84].27-44H2O C
Chains of 6-membered rings - tabular zeolites
GMELINITE-K (K,Na,Ca)6[Al7Si17O48].22H2O H
GMELINITE-Ca (Ca0,5,Sr0,5,Na,K)4[Al8Si16O48].22H2O H
GMELINITE-Na (Na,K,Ca0,5)4[Al8Si16O48].22H2O H
CHABAZITE-Na (Na,K,Ca0,5)4[Al4Si8O24].12H2O R
CHABAZITE-Mg Mg0,7K0,5Ca0,5Na0,1)[Al3Si9O24].10H2O R
CHABAZITE-K (K,Na,Ca0,5)4[Al4Si8O24].12H2O R
CHABAZITE-Sr (Sr,Ca)[Al2Si4O12].6H2O R
CHABAZITE-Ca (Ca0,5,K,Na)4[Al4Si8O24].12H2O R ps H/A
LEVYNE-Ca (Ca0,5,Na,K)6[Al6Si12O36].17H2O R
LEVYNE-Na (Na,Ca0,5,K)6[Al6Si12O36].17H2O R
BELLBERGITE (K,Ba,Sr)2Sr2Ca2(Ca,Na)4[Al18Si18O72].30H2O H
ERIONITE-Ca (Ca0,5,K,Na)10[Al10Si26O72].30H2O H
ERIONITE-K (K,Na,Ca0,5)10[Al10Si26O72].30H2O H
ERIONITE-Na (Na,K,Ca0,5)10[Al10Si26O72].30H2O H
WENKITE Ba4Ca6(Si,Al)20O41(OH)2(SO4)3.H2O H
FAUJASITE-Ca (Ca0,5,Na,Mg0,5,K)3-4[Al3-4Si9-8O24].16H2O C
FAUJASITE-Mg (Mg0,5,Ca0,5,Na,K)3-4[Al3-4Si9-8O24].16H2O C
FAUJASITE-Na (Na,Ca0,5,Mg0,5,K)3-4[Al3-4Si9-8O24].16H2O C
MORDENITE (Na2,Ca,K2)4[Al8Si40O96].28H2O O
MARICOPAITE (Pb7Ca2)[Al12Si36(O,OH)100].n(H2O,OH) (n=near 32) O
DACHIARDITE-Ca (Ca0,5,K,Na)4-5[Al4-5Si20-19O48].12-13H2O M
DACHIARDITE-Na (Na,K,Ca0,5)4-5[Al4-5Si20-19O48].12-13H2O M
EPISTILBITE (Ca,Na2)[Al2Si6O16].5H2O M/A
FERRIERITE-Na (Na,K,Mg0,5,Ca0,5)6[Al6Si30O72].18H2O M
FERRIERITE-K (K,Na,Mg0,5,Ca0,5)6[Al6Si30O72].18H2O O
FERRIERITE-Mg (Mg0,5,K,Na,Ca0,5)6[Al6Si30O72].18H2O O
Chains of T10O20 Tetrahedra
HEULANDITE-Sr (Sr0,5,Ca0,5,Na,K)9[Al9Si27O72].24H2O M
HEULANDITE-Na (Na,Ca0,5,K)9[Al9Si27O72].24H2O M
HEULANDITE-K (K,Ca0,5,Na,Mg0,5,Sr0,5)9[Al9Si27O72].24H2O M
CLINOPTILOLITE-Na (Na,K,Ca0,5)6[Al6Si30O72].20H2O M
CLINOPTILOLITE-Ca (Ca0,5,Na,K)6[Al6Si30O72].20H2O M
HEULANDITE-Ba (Ba,Ca,Sr,K,Na)5Al9Si27O72.22H2O M
HEULANDITE-Ca (Ca0,5,Na,K)9[Al9Si27O72].24H2O M
STILBITE-Ca (Ca0,5,Na,K)9[Al9Si27O72].28H2O M
STILBITE-Na (Na,Ca0,5,K)9[Al9Si27O72].28H2O M
BREWSTERITE-Ba (Ba,Sr)2[Al4Si12O32].10H2O M
BREWSTERITE-Sr (Sr,Ba)2[Al4Si12O32].10H2O M/A
Other Rare Zeolites
GOTTARDIITE Na3Mg3Ca5[Al19Si117O272].93H2O O ps H
LOVDARITE K4Na12[Be8Si28O72].18H2O O
GAULTITE Na4[Zn2Si7O18].5H2O O
MUTINAITE Na3Ca4[Al11Si85O192].60H2O O
TSCHORTNERITE Ca4(K,Ca,Sr,Ba)3Cu3(OH)8(Si12Al12O48).nH2O (n more than 20) C
THORNASITE Na12Th3(Si8O19)4.18H2O R
DIRENZOITE K6Na(Ca,Mg)3(Si,Al)60O120.36H2O O
Unclassified zeolites
COWLESITE Ca[Al2Si3O10].5,3H2O O
Unclassified silicates
With Alkali and Alkali-earth Elements
WAWAYANDAITE Ca12Mn++4B2Be18Si12O46(OH,Cl)30 M
RUDENKOITE Sr3Al3(Si,Al)4O10(OH,O)8Cl2.H2O M
NAGELSCHMIDTITE Ca3(PO4)2.2(alpha-Ca2SiO4) H
CARYOCHROITE (Na,Sr,Ca,Mn,K)3(Fe+++,Mg,Mn,Fe++)10Ti2Si12O37(H2O,O,OH)17 M
JUANITE Ca10Mg4Al2Si11O39.4H2O (?) O (?)
OYELITE Ca10B2Si8O29.12H2O O
TIETTAITE K4Na12Fe+++2Si16O41(OH)4.2H2O O
With Ti, V, Cr
ILMAJOKITE-(Ce) Na11KBaCe2Ti12Si37,5O94(OH)30.29H2O M
RILANDITE (Cr+++,Al)6SiO11.5H2O (?) (?)
With Mn, Fe
ERLIANITE (Fe++,Fe+++,Mg)24(Fe+++V)6Si36O90(OH,O)48 O
With Co, Ni
With Cu, Zn
With Nb, Ta, Zr
MONGOLITE Ca4Nb6Si5O24(OH)10.5-6H2O Q
LOUDOUNITE NaCa5Zr4Si16O40(OH)11.8H2O (?)
With REE, Th
UMBOZERITE Na3Sr4ThSi8(O,OH)24 am.
ROWLANDITE-(Y) Y4Fe++Si4O14F2 am.
With Pb
CREASEYITE Pb2Cu2Fe+++2Si5O17.6H2O O
Silicates, etc. unclassified
SPODIOPHYLLITE (Na,K)4(Mg,Fe++)3(Fe+++,Al)2(Si8O24) M (?)
ULFANDERSSONITE-(Ce) (Ce15Ca)Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 M
UMBRIANITE K7Na2Ca2[Al3Si10O29]F2Cl2 O
VEBLENITE KNa(Fe++5Fe+++4Mn7)Nb4(Si2O7)2(Si8O22)2O6(OH)10(H2O)3 A
VLADYKINITE Na3Sr4(Fe++Fe+++)Si8O24 M
WAIPOUAITE Ca3V++++5O9[Si2O5(OH)2][Si3O7(OH)2].11H2O M
WIKLUNDITE Pb2(Mn++,Zn)3(Fe+++,Mn++)2(Mn++,Mg)19(As+++O3)2(Si,As+++++O4)6(OH)18Cl6 R
LIPUITE KNa8Mn+++5Mg0,5[Si12O30(OH)4](PO4)O2(OH)2.4H2O O
MENDELEEVITE-(Ce) (Cs6[]6)([]10K2)(REE22Ca6)(Si70O175)(OH,F)16(H2O)19 C
LAVOISIERITE Mn++8[Al10(Mn+++Mg)][Si11P]O44(OH)12 O
WHELANITE Cu2Ca6[Si6O17(OH)](CO3)(OH)3(H2O)2 O
MESAITE CaMn++5(V2O7)3.12H2O M
PAQUEITE Ca3TiSi2(Al,Ti,Si)3O14 R
PERETTIITE-(Y) Y+++2Mn++4Fe++[Si2B8O24] O?
LAURENTIANITE [NbO(H2O)]3(Si2O7)2[Na(H2O)2]3 R
PILAWITE-(Y) Ca2Y2Al4(SiO4)4O2(OH)2 M
RADEKSKODAITE-(Ce) (CaCe5)(Al4Fe++)[Si2O7][SiO4]5O(OH)3 M
RADEKSKODAITE-(La) (CaLa5)(Al4Fe++)[Si2O7][SiO4]5O(OH)3 M
RIPPITE K2(Nb,Ti)2(Si4O12)O(O,F) Q
ROGERMITCHELLITE Na6Sr12Ba2Zr13Si39B6O123(OH)14.10H2O R ps H
RUBINITE Ca3Ti+++2Si3O12 C
PLUMALSITE Pb4Al2(SiO3)7 (?) O
FIVEGITE K4Ca2[AlSi7O17(O2-xOHx)][(H2O)2-xOHx]Cl (x = 0-2) O
DAVINCIITE Na12K3Ca6Fe++3Zr3(Si26O73OH)Cl2 R
GUNTERBLASSITE (?,??)3-xF?[(Si,?l)13O25(??,O)4].7?2O O
HANJIANGITE Ba2Ca(V+++Al)[Si3AlO10(OH)2]F(CO3)2 M
HILLESHEIMITE (K,Ca,[])2(Mg,Fe,Ca,[])2[(Si,Al)13O23(OH)6](OH).8H2O O
KHESINITE Ca4(Mg3Fe+++9)O4(Fe+++9Si3)O36 A
FLAMITE (Ca,Na,K)2(Si,P)O4 H
HONGHEITE Ca19Fe++Al4(Fe+++,Mg)8([]4)B[Si2O7]4[(SiO4)10]O(OH,O)9 Q
ZOLOTAREVITE Na5Zr[Si6O15(??)3].3H2O R
YUZUXIANGITE Sr3Fe+++(Si2O6)2(OH)·3H2O  
QELTITE Ca3TiSi2(Fe+++2Si)O14 R
DEVILLIERSITE Ca4Ca2Fe+++10O4(Fe+++10Si2)O36 A
DEMAGISTRISITE BaCa2Mn+++4(Si3O10)(Si2O7)(OH)4.3H2O O
BYZANTIEVITE Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1,5 R
CHIAPPINOITE-(Y) (Y,Ce)2(Mn++,Ca)(Si3O7)4 O
CHIRVINSKYITE (Na,Ca)13(Fe,Mn,[])2(Ti,Nb)2(Zr,Ti)3(Si2O7)4(OH,O,F)12 A
INNSBRUCKITE Mn++33(Si2O5)14(OH)38 M
MENDELEEVITE-(Nd) Cs6[(Nd,REE)23Ca7](Si70O175)(OH,F)19(H2O)16 C
KESEBOLITE-(Ce) CeCa2Mn(AsO4)(SiO3)3 M
IVANYUKITE-Na Na3[Ti4(OH)O3(SiO4)3].7H2O R
IVANYUKITE-Cu Cu[Ti4(OH)2O2(SiO4)3].7H2O C
IVANYUKITE-Na-C Na2[Ti4O2(OH)2(SiO4)3].6H2O C
MELANOCERITE-(Ce) (Ce,Ca)5(OH,F)[(Si,B)O4]3.nH2O (?) am.
Salts of organic acids
Formates, Acetates, etc.
COSKRENITE-(Ce) (Ce,Nd,La)2(SO4)2(C2O4).8H2O A
LEVINSONITE-(Y) (Y,Nd,Ce)Al(SO4)2(C2O4).12H2O M
ZUGSHUNSTITE-(Ce) (Ce,Nd,La)Al(SO4)2(C2O4).12H2O M
DEVEROITE-(Ce) (Ce,Nd,La)2(C2O4)3.10H2O M
UROXITE [(UO2)2(C2O4)(OH)2(H2O)2].H2O M
Benzine Salts
PIGOTITE Al4C6H5O10.13H2O (?)  
EVENKITE CxH2x+2 (x=19 to 28) O
Miscellaneous Organic Minerals
Miscellaneous Organic Minerals
Organic minerals unclassified
THEBAITE-(NH4) (NH4)3Al(C2O4)(PO3OH)2(H2O) M
RHYTHMITE Ca4(SiO4)2.3CaCl2  
LEUCORHONITE Ca2(Mg,Fe+++,Al)6(Si,Al)6O20 A
DAVIDBROWNITE-(NH4) (NH4,K)5(V++++O)2(C2O4)[PO2,75(OH)1,25]4.3H2O M
AMBER [C,H,O] am.
ALTERITE Zn2Fe+++4(SO4)4(C2O4)2(OH)4.17H2O M
ELECTRUM = GOLD with Ag (Au,Ag) C
IRITE = Mixture Chromite, Ir, Os, Rutheniridosmine, Platinum, etc.    
OR = GOLD    
ZINN = TIN    
OURO PRETO = oxygenated Pt, Pd, Au, Cu, Fe, Mn compounds    
FER = IRON    
SCHULZITE = As free Geocronite    
MOHAWKITE = Mixture Cu3As + Ni + Co  
GELPYRIT = PYRITE variety FeS2 and FeS and As  
BAYANKHANITE = Mixture Cu and Hg sulfides    
REZBANYITE = Mixture Pb3Cu2Bi10S19 O
ROTHORKE = A ferric hydroxyde    
HASTITE = FERROSELITE (Fe0,99Cu0,01)Se1,99 O
ARIZONITE = mixture    
HORSFORDITE = Artificial product Cu5Sb C (?)
BURSAITE = Mixture of Pb and Bi sulfosalts Pb5Bi4S11 (?) M (?)
VOLFSONITE = STANNITE Cu+10Cu++Fe++Fe+++2Sn++++3S16 Q
POTOSIITE = poor Sn FRANCKEITE Pb6Sn++++2Fe++Sb+++++2S16 (?) A
PARAJAMESONITE = Mixture JAMESONITE and other sulfosalts Pb4FeSb6S14 O
JEROMITE (?) As(S,Se)2 (?) am.
KAIYUHITE (?) Pb,Ag,Bi,Sb sulfosalt (?)  
FREIBERGITE = Now a group name    
CHUBUTITE = LORETTOITE = Discredited Pb7O6Cl2 O ps Q
RADTKEITE (Syntethic) Hg3S2ClI O
LORETTOITE = an artifact Pb7O6Cl2 Q
KEATITE = Synthetic polymorph of SiO2 SiO2  
LAMPADITE = Mixture MnO,CuO,H2O  
FULGURITE = Silica glass caused by lightning    
GIRDITE= OBOYERITE + OTTOITE (?) Pb3H2(Te++++O3)(Te++++++O6) (?) M (?)
ILMENORUTILE = RUTILE variety (Ti,Nb,Fe+++)O2 Q
IDDINGSITE = Mixture iron oxides, clay minerals, etc.    
AMETHYST = purple QUARTZ    
HORNSTONE = cryptocrystalline QUARTZ    
AETITE = LIMONITE concretion    
BAUXITE = Hydroxides and oxides of Al and Fe    
MANGANOMELANE = Mn oxides    
NOVACULITE = cryptocrystalline QUARTZ    
LEUCOXENE = Mixture Fe Ti oxydes    
TAPIOLITE = TAPIOLITE-(Mg) or -(Mn) or -(Fe) (Fe,Mn)(Ta,Nb)2O6 Q
NATROBISTANTITE = zero-valent-dominant MICROLITE (Na,Cs)Bi(Ta,Nb,Sb)4O12 C
COLUMBITE = COLUMBITE-(Fe) or -(Mg) or -(Mn)    
YTTROPYROCHLORE-(Y) = OXYYTTROPYROCHLORE-(Y) or zero-valent-dominant pyrochlore (Y,Na,Ca,U)1-2(Nb,Ta,Ti)2(O,OH)7 (?) C
YTTROBETAFITE-(Y) = OXYCALCIOBETAFITE or zero-valent-dominant pyrochlore (Y,U,Ce)2(Ti,Nb,Ta)2O6(OH) (?) C
STRUVERITE = RUTILE variety (Ti,Ta,Fe+++)O2 Q
UHLIGITE (of Hauser) = PEROVSKITE or ZIRKELITE Ca3(Ti,Al,Zr)9O20 (?) C (?)
CLIACHITE = ALUMOGEL (?) = Mixture (?)    
CITRINE = yellow QUARTZ    
YTTROMICROLITE = Discredited    
CHERT = cryptocrystalline QUARTZ    
FERRITUNGSTITE = HYDROKENOELSMOREITE (W++++++,Fe+++2)(O,OH)6.pH2O (p = up to 1,75) C
URANMICROLITE = discredited (U,Ca,Ce)2(Ta,Nb)2O6(OH,F) (?) C
CHALCEDONY = cryptocrystalline QUARTZ    
HYDROHETAEROLITE = discredited Zn2Mn+++4O8.H2O Q
KHINITE = KHINITE-4O Pb++Cu++3Te++++++O6(OH)2 O
ELBRUZITE-(Zr) = ELBRUSITE {Ca3}[U+++++0,5Zr1,5](Fe+++3)O12 C
TRIPOLITE = DIATOMITE = An opaline silica    
CALCIOBETAFITE = a PYROCHLORE group mineral Ca2(Ti,Nb)2(O,OH)7 (?) C
BARIOPYROCHLORE = zero-valent-dominant pyrochlore (Ba,Sr)2(Nb,Ti)2(O,OH)7 (?) C
PYROCHLORE = a PYROCHLORE group mineral    
ROMANITE = DESSAUITE-(Y) (Fe++,U,Pb)2(Ti,Fe+++)O12 (?) R
FLINT = cryptocrystalline QUARTZ    
PLUMBOBETAFITE = zero-valent-dominant PYROCHLORE (Pb,U,Ca)(Ti,Nb)2O6(OH,F) (?) C
PRASE = Green QUARTZ    
DIATOMITE = An opaline silica    
MARBLE = often CALCITE    
DIOMIGNITE = Discredited Li2B4O7 Q
BALAVINSKITE = discredited Sr2B6O11.4H2O (?)
NATROALUNITE-2R = Synonym of Natroalunite-2c (Na,Ca,K)2Al6(SO4)4(OH)12 R
TEXASITE = Discredited Pr2O2SO4 O
ALUM = hydrous alcali Al sulfates    
WALESITE (?) Cu-Zn sulfate (?)  
GUTSEVICHITE = Discredited (Al,Fe+++)3(PO4,VO4)2(OH)3.8H2O (?) (?)
MENDOZAVILITE = MENDOZAVILITE-NaFe (Na,K)(Ca,Mg)2Fe+++3(PO4)2(Mo++++++8O28)(OH).9H2O M
CHURCHITE-(Dy) (Dy,Sm,Gd,Nd)(PO4).2H2O M
BETPAKDALITE = BETPAKDALITE-CaCa MgCa2Fe+++3(Mo++++++8O28)(AsO4)2(OH).23H2O M
AGARDITE-(Dy) (Dy,La,Ca)Cu6(AsO4)3(OH)6.3H2O (?) H
PSEUDOAUTUNITE = Discredited (H3O)4Ca2(UO2)2(PO4)4.5H2O (?) Q
BOLIVARITE = EVANSITE (?) Al2(PO4)(OH)3.4-5H2O am.
KIVUITE = discredited (Th,Ca,Pb)H2(UO2)4(PO4)2(OH)8.7H2O (?) O (?)
BARIOOLGITE = Ba rich OLGITE Na(Na,Sr)2(Ba,Sr)(PO4)2 H
BARIUMALUMOPHARMACOSIDERITE = inadequately described mineral Ba(Al,Fe+++)4(AsO4)3(OH)5.5H2O Q ps C
CHURCHITE-(Nd) = Nd rich CHURCHITE-(Y) (Y,Nd)(PO4).2H2O M
GAINESITE-(NaNa) = GAINESITE Na(Na,K)(Be,Li)(Zr,Zn)2(PO4)4.1-2H2O Q
PHOSPHORITE = Mixture. Fossile excrements    
ATTACOLITE = ATTAKOLITE (Ca,Sr)Mn++(Al,Fe+++)4[(Si,P)O4]H(PO4)3(OH)4 M
KERTSCHENITE = Oxidation product of VIVIANITE    
CHLOROTILE = AGARDITE (?) (Cu,Fe,?)2Cu12[(OH,H2O)12(AsO4)6]6.H2O  
LEHIITE = Mixture APATITE + CRANDALLITE (Na,K)2Ca5Al8(PO4)8(OH)12.6H2O  
ORPHEITE = HINSDALITE H6Pb10Al20(PO4)12(SO4)5(OH)40.11H2O (?) R
AGARDITE-(Ca) = ZALESIITE CaCu++6(AsO4)3(OH)6.3H2O (?) H
ILMAJOKITE See: ILMAJOKITE-(Ce) Na11KBaCe2Ti12Si37,5O94(OH)31.29H2O M
HYDROUGRANDITE = Discredited (Ca,Mg,Fe++)3(Fe+++,Al)2(SiO4)3-x(OH)4x (?) C
HELLANDITE-(Yb) (Ca,Y)4(Yb,Y)2(Al,Fe+++,Ti++++)(Be,Li)2B4Si4O22(O,F,OH)2 (?) M
HELLANDITE-(Gd) (Ca,Y)4(Gd,Y)2(Al,Fe+++,Ti++++)(Be,Li)2B4Si4O22(O,F,OH)2 (?) M
PARACHRYSOTILE = Discredited Mg3Si2O5(OH)4 O
PIANLINITE = Discredited Al2Si2O6(OH)2 (?) am. (?)
THOROGUMMITE = Discredited    
VALENCIANITE = A variety of K-Feldspar    
FOWLERITE = a variety of RHODONITE (Mn,Zn)SiO3 A
SODICPEDRIZITE = Discredited NaLi2(LiMg2Fe+++Al)(Si8O22)(OH,F)2 M
BARIUMBANNISTERITE (K,H3O)(Ba,Ca)(Mn++,Fe++,Mg)21(Si,Al)32O80(O,OH)16.4-12H2O M
EKMANITE = A Mn rich Stilpnomelane (Fe++,Mg,Mn,Fe+++)3(Si,Al)4O10(OH)2.2H2O (?) O
FERRICFERRONYBOITE = invalid name NaNa2(Fe++3Fe+++2)Si7AlO22(OH)2 (?) M
AEGIRINEAUGITE = AUGITE variety (Ca,Na)(Fe3+,Mg,Fe2+)Si2O6 M
CERITE-(La) = FERRICERITE-(La) (La,Ce,Ca)9Fe+++(SiO4)3(SiO3OH)4(OH)3 R
FERROWHITTAKERITE = Uncertain Na(NaLi)2(Fe++2AlFe+++Li)(Si8O22)(OH)2 M
ERICSSONITE-2O = A polytype of Ericssonite BaMn2(Fe+++O)Si2O7(OH) O
FERROOTTOLINIITE = Uncertain []NaLi(Fe++3Fe+++Al)Si8O22(OH)2 M
FERRINYBOITE = Discredited NaNa2(Mg3Fe+++2)Si7AlO22(OH)2 (?) M
FERRIMAGNESIOTARAMITE = Invalid name Na(CaNa)Mg3Fe+++2Si6Al2O22(OH)2 (?) M
CEROLITE = KEROLITE = disodered TALC    
CARBONATEVISHNEVITE = a variety (?) Na7Al5Si7O24CO3.2,5H2O or Na8(AlSiO4)6CO3.H2O  
BIOTITE (-1M,-2M,-5M1,-6A) = Series name K(Mg,Fe++)3(Al,Fe+++)Si3O10(OH,F)2 (?) M/A
SWAMBOITE = SWAMBOITE-(Nd) Nd0.33[(UO2)(SiO3OH)].2,5(H2O) M
THOROGUMMITE = discredited Th(SiO4)1-x(OH)4x Q
TOMBARTHITE-(Y) = discredited Y4(Si,H4)4O12-x(OH)4+2x M
YAMATOITE = MOMOIITE (Mn++,Ca)3(V+++,Al)2(SiO4)3 (?) C
WHITTAKERITE = discredited Na(NaLi)(Mg2AlFe+++Li)(Si8O22)(OH)2 M
ANOPHORITE = FERRINYBOITE (Na,K)Na2(Mg,Fe++)3(Fe+++,Ti)2(Al0,5Si3,5O11)2(OH)2 M
AXINITE = AXINITE-(Fe) or -(Mg) or -(Mn)    
ALUSHTITE = mixture DICKITE + HYDROMICA (Ca,Mg,K,Na)0,3(Al,Mg,Li,Fe)6.87(Si6.76Al1,24O20)(OH)10.3H2O  
ALVITE = ZIRCON with Hf    
CERITE-(La) = FERRICERITE-(La) (La,Ce,Ca)9Fe+++(SiO4)3(SiO3OH)4(OH)3 R ps H
SURKHOBITE = PERRAULTITE (Ba,K)2CaNa(Mn,Fe++,Fe+++)8Ti4(Si2O7)4O4(F,OH,O)6 M
BITIKLEITE-(ZrFe) = USTURITE {Ca3}[Sb+++++Zr](Fe+++3)O12 C
EPIDOTE-(Pb) = HANCOCKITE (Pb,Ca,Sr)2(Al,Fe+++)3(SiO4)3(OH) M
CALCIOGADOLINITE-(Y) = variety of GADOLINITE-(Y) (YCa)Fe+++Be2Si2O8O2  
AFANASYEVAITE = a synthetic mineral Ca8[Si2O7]OCl2  
ANDROSITE-(La) = MANGANIANDROSITE-(La) (Mn++,Ca)(La,Ce,Ca,Nd)AlMn+++Mn++(SiO4)(Si2O7)O(OH) M
BITIKLEITE-(SnAl) = BITIKLEITE {Ca3}[Sb+++++Sn++++](Al3)O12 C
BITIKLEITE-(SnFe) = DZHULUITE {Ca3}[Sb+++++Sn++++](Fe+++3)O12 C
ALMBOSITE = discredited Fe++5Fe+++4V+++++4Si3O27 (?)
MELANOCERITE-(Ce) (= TRITOMITE-(Ce)?) (Ce,Ca)5(Si,B)3O12(OH,F).nH2O (?) H
ORTHOCHAMOSITE = discredited (Fe++,Mg,Fe+++)5Al(Si3Al)O10(OH,O)8 O
OTTOLINIITE = discredited []Na,Li(Mg3Fe+++Al)(Si8O22)(OH)2 M
BRAMMALLITE = a series name (Na,H3O)(Al,Mg,Fe)2(Si,Al)4O10[(OH)2,H2O] (?) M
MAGNESIOTARAMITE = discredited Na(CaNa)Mg3AlFe+++Si6Al2O22(OH)2 M
PLAGIOCLASE = FELDSPAR group (Na,Ca)Al(Al,Si)Si2O8  
PHENGITE = a series name K(Mg,Fe)0,5Al1,5(Si3,5Al0,5)O10(OH,F)2 (?) M ps H
OXYHORNBLENDE = Volcanic HORNBLENDE (Na,K)0-1Ca2(Mg,Fe++,Fe+++,Al)5(Si,Al)8O22(O,OH)2 M
PYRIBOLE = pyroxene or amphibole OR pyroxene and amphibole    
PYRALSPITE = GARNET subgroup    
ORTHOPYROXENE = series in PYROXENE group    
MASKELYNITE = Glass of PLAGIOCLASE composition    
UGRANDITE = GARNET subgroup    
OLIGOCLASE = ALBITE An10-An30 (Na,Ca)[Al(Si,Al)Si2O8]  
MONREPITE = Ferrian Annite    
MICA = MICA group    
NATRIUMDACHIARDITE = DACHIARDITE-Na (Na,K,Ca0,5)4-5(Al4-5Si20-19O48).12-13H2O M
URALITE = AMPHIBOLE pseudomorphous after PYROXENE    
THULITE = a pink ZOISITE manganoan variety   O
SERPENTINE = SERPENTINE group A3Si2O5(OH)4 = general formula A = Mg,Fe++,Ni M/O
SCHÖRL = SCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3OH R
SAUSSURITE = Mixture, mainly ZOISITE, SCAPOLITE, etc.    
SWETLOZARITE = SVETLOZARITE (Ca0,5,K,Na)4-5(Al4-5Si20-19O48).12-13H2O O
SVETLOZARITE = DACHIARDITE-Ca (Ca0,5,K,Na)4-5(Al4-5Si20-19O48).12-13H2O O
SORETITE = HORNBLENDE variety 2[NaCa2(Mg,Fe++,Fe+++)5(Si,Al)8O22(OH)2]  
SODIUMDACHIARDITE = DACHIARDITE-Na (Na,K,Ca0,5)4-5(Al4-5Si20-19O48).12-13H2O M
FERRINYBOITE (?) (Na,K)Na2(Mg,Fe++)3(Fe+++,Ti)2(Al0,5Si3,5O11)2(OH)2 M
GARNET = GARNET supergroup    
CLINOPYROXENE = series in PYROXENE group    
CYCLOWOLLASTONITE (?) = Artificial product CaSiO3 A
KAOLINITE-SMECTITE = Clay minerals Al.Si.O.OH.H2O  
KEROLITE = TALC (Mg,Ni)3Si4010(OH)2.H2O M (?)
JOAQUINITE = JOAQUINITE group Ba2NaCe2Fe++(Ti,Nb)2Si8O26(OH,F).H2O M
LEONHARDITE = Partially dehydrated LAUMONTITE    
HIBSCHITE = GROSSULAR hydroxyl variety {Ca3}[Al2](Si3-x[]x)O12-4x(OH)4x C
IIDATEITE (?) Cu5Al5[(Si,S,As)O4]3OH14.4H2O (?) M
ILLITE = a series name (K0,65Al2[]Al0,65Si3,35O10(OH)2 M
IMATRA STONE = a clay concretion    
HYDRO UGRANDITE = HYDROUGRANDITE (discredited) (Ca,Mg,Fe++)3(Fe+++,Al)2(SiO4)3-x(OH)4x C
HYDROMICA = a mixture    
ANTHRACITE = Hard coal variety    
PYROBITUMEN = Hydrocarbon with S, N, also U, etc.   am.
DYSODILE = a resin    
BITUMEN = Mineral pitch    
ELATERITE = Mineral caoutchouc    
ASPHALTUM = Mineral pitch    
FRINGELITE = a mixture of organic fossil pigments    
COPALITE = a resin    
JAIS = JET (Gemstone from hard black lignite)    
JET (Gemstone from hard black lignite)    


[Mineral Search]     [Abbreviations]     [Pictures]     [Athena]


Send comments on page to mail pp

Copyright © 1986, 1994, 2021 ATHENA - Pierre Perroud. All Rights Reserved.