owl  

ATHENA

MINERALOGY


Systematic List of Minerals

List sorted according to Strunz, updated)

mlevy


* ELEMENTS, metals and intermetallic alloys; metalloids and nonmetals; carbides, silicides, nitrides, phosphides
Metals and Intermetallic Alloys
Copper-cupalite family
COPPER Cu C
SILVER Ag C/H
SILVER Ag H
NICKEL Ni C
GOLD Au C
ALUMINIUM Al C
STEINHARDITE Al0,38Ni0,32Fe0,30 C
LEAD Pb C
AURICUPRIDE Cu3Au O
CUPROAURIDE Cu3Au C
TETRAAURICUPRIDE AuCu Q
IODINE I2  
ANYUIITE Au(Pb,Sb)2 Q
KHATYRKITE (Cu,Zn)Al2 Q
NOVODNEPRITE AuPb3 Q
CUPALITE (Cu,Zn)Al O
HUNCHUNITE (Au,Ag)2Pb C
STOLPERITE AlCu C
HOLLISTERITE Al3Fe Q
ICOSAHEDRITE Al63Cu24Fe13 ps C
KRYACHKOITE (Al,Cu)6(Fe,Cu) O
PROXIDECAGONITE Al34Ni9Fe2 O
Zinc-brass family
TITANIUM Ti H
ZINC Zn H
RHENIUM Re H (?)
CADMIUM Cd H
ZINCCOPPERITE Cu7Zn4 (?)  
alfa-BRASS Cu3Zn C
ZHANGHENGITE (Cu,Zn,Fe,Al,Cr) C
DANBAITE CuZn2 C
TONGXINITE Cu2Zn C
MAGNESIUM Mg H
Indium-tin family
INDIUM In Q
TIN Sn Q
YUANJIANGITE AuSn H
eta-BRONZE Cu6Sn5 H
SOROSITE Cu(Sn,Sb) H
RUMOIITE AuSn2 O
Mercury-amalgam family
MERCURY Hg R
BELENDORFFITE Cu7Hg6 R ps C
KOLYMITE Cu7Hg6 C
PARASCHACHNERITE Ag3Hg2 O
SCHACHNERITE Ag1,1Hg0,9 H
LUANHEITE Ag3Hg H
EUGENITE Ag11Hg2 C
MOSCHELLANDSBERGITE Ag2Hg3 C
WEISHANITE (Au,Ag)3Hg2 H
YIYANGITE Au3Hg H
POTARITE PdHg Q
LEADAMALGAM HgPb2 Q
SHOSANBETSUITE Ag3Sn O
AURIHYDRARGYRUMITE Au6Hg5 H
Iron-chromium family
MOLYBDENUM Mo C
KAMACITE = a Ni rich variety o Iron alpha-(Fe,Ni) C
HEXAMOLYBDENUM (Mo,Ru,Fe,Ir,Os) H
TUNGSTEN W C
CHROMIUM Cr C
IRON Fe C
ANTITAENITE = not approved Fe3Ni  
TETRATAENITE FeNi Q
TAENITE (Ni,Fe) C
CHROMFERIDE Fe3Cr1-x (x=0,6) C
FERCHROMIDE Cr3Fe1-x (x=0,6) C
WAIRAUITE CoFe C
AWARUITE Ni2Fe to Ni3Fe H
JEDWABITE Fe7(Ta,Nb)3 H
MANGANESE Mn C
NISNITE Ni3Sn C
VANADIUM V C
Platinum group elements
OSMIUM (Os,Ir) H
RUTHENIRIDOSMINE (Ir,Os,Ru) H
RUTHENIUM (Ru,Ir,Os) H
PALLADIUM (Pd,Pt) C
PLATINUM Pt C
RHODIUM (Rh,Pt) C
IRIDIUM (Ir,Os,Ru) C
PGE-metal alloys
GARUTIITE (Ni,Fe,Ir) H
HEXAFERRUM (Fe,Ru,Os,Ir) H
RUSTENBURGITE (Pt,Pd)3Sn C
ZVYAGINTSEVITE (Pd,Pt,Au)3(Pb,Sn) C
ATOKITE (Pd,Pt)3Sn C
TATYANAITE (Pt,Pd,Cu)9Cu3Sn4 O
TAIMYRITE (Pd,Cu,Pt)3Sn O
PAOLOVITE Pd2Sn O
STANNOPALLADINITE (Pd,Cu)3Sn2 H
PLUMBOPALLADINITE Pd3Pb2 H
CABRIITE Pd2SnCu O
CHENGDEITE Ir3Fe C
ISOFERROPLATINUM (Pt,Pd)3(Fe,Cu) C
TULAMEENITE Pt2CuFe Q
TETRAFERROPLATINUM PtFe Q
FERRONICKELPLATINUM Pt(Ni,Fe) Q
SKAERGAARDITE PdCu C
HONGSHIITE PtCu R
YIXUNITE Pt3In C
DAMIAOITE PtIn2 C
NIGGLIITE PtSn H
BORTNIKOVITE Pd3Cu3Zn Q
NIELSENITE PdCu3 Q
NORILSKITE (Pd,Ag)7Pb4 R
SLUZHENIKINITE Pd15(Sb7-xSnx) (x between 3 and 4) M
SLUZHENIKINITE Pd15(Sb7-xSnx) M
PALLADOTHALLITE Pd3Tl Q
MICHITOSHIITE-(Cu) Rh(Cu1-xGex) C
Miscellaneous Elements, alloys
CERIUM Ce  
TANTALUM Ta C
TOMAMAEITE Cu3Pt C
DECAGONITE Al71Ni24Fe5 Icosaedre
MITROFANOVITE Pt3Te4 R
ORTHOCUPROPLATINUM Pt3Cu O
Metallic Carbides, Silicides, Nitrides, Phosphides and Hydrides
Carbides
COHENITE (Fe,Ni,Co)3C O
ISOVITE (Cr,Fe)23C6 C
HAXONITE (FeNi)23C6 C
TONGBAITE Cr3C2 O
NIOBOCARBIDE (Nb,Ta)C C
KHAMRABAEVITE (Ti,V,Fe)C C
TANTALCARBIDE (Ta,Nb)C C
QUSONGITE WC H
YARLONGITE (Cr,Fe,Ni)9C4 H
EDSCOTTITE Fe5C2 M
Silicides
MAVLYANOVITE (Mn,Fe)5Si3 H
SUESSITE (Fe,Ni)3Si C
PERRYITE (Ni,Fe)16PSi5 H
NAQUITE FeSi C
LINZHIITE FeSi2 Q
LUOBUSAITE Fe3Si7 O
GUPEIITE Fe3Si C
HAPKEITE Fe2Si C
XIFENGITE Fe5Si3 H
PALLADOSILICIDE Pd2Si H
ZHIQINITE TiSi2 O
KANGJINLAITE Ti11Si10 Q
TOLEDOITE TiFeSi O
BROWNLEEITE MnSi C
CARLETONMOOREITE Ni3Si C
ZANGBOITE TiFeSi2 O
Nitrides
ROALDITE Fe4N C
SIDERAZOT Fe3N1,33 H
OSBORNITE TiN C
UAKITITE VN C
CARLSBERGITE CrN C
OREILLYITE Cr2N R
QINGSONGITE BN C
Phosphides
NICKELPHOSPHIDE (Ni,Fe)3P Q
SCHREIBERSITE (Fe,Ni)3P Q
MONIPITE MoNiP H
BARRINGERITE (Fe,Ni)2P H
ALLABOGDANITE (Fe,Ni)2P O
ANDREYIVANOVITE Fe(Cr,Fe)P O
FLORENSKYITE Fe(Ti,Ni)P O
MELLINIITE (Ni,Fe)4P C
NAZAROVITE Ni12P5 Q
POLEKHOVSKYITE MoNiP2 H
TSIKOURASITE Mo3Ni2P1+x (x smaller than 0,25) C
BADENGZHUITE TiP H
TRANSJORDANITE Ni2P H
NICKOLAYITE FeMoP O
NEGEVITE NiP2 C
MURASHKOITE FeP O
HALAMISHITE Ni5P4 H
GRAMMATIKOPOULOSITE NiVP O
ORISHCHINITE Ni2P O
ZUKTAMRURITE FeP2 O
Hydrides    
KISHONITE VH2 C
Metalloids and Nonmetals
Arsenic group elements
ARSENIC As R
BISMUTH Bi R
ANTIMONY Sb R
STIBARSEN SbAs R
ARSENOLAMPRITE As O
PARARSENOLAMPRITE As O
PARADOCRASITE Sb2(Sb,As)2 M
PHOSPHORUS P4 C
Carbon-silicon family
GRAPHITE C H/R
CHAOITE C H
FULLERITE C60 Q
DIAMOND C C
LONSDALEITE C H
SILICON Si C
Sulfur-selenium-iodine
ROSICKYITE S M
SULPHUR S8 O
SELENIUM Se R
TELLURIUM Te R
SULPHUR-Beta S8 M
Nonmetallic Carbides and Nitrides
Nonmetallic carbides
MOISSANITE SiC H/R
Nonmetallic nitrides
NIERITE Si3N4 R
SINOITE Si2N2O O
Unclassified Strunz ELEMENTS, metals and intermetallic alloys; metalloids and nonmetals; carbides, silicides, nitrides, phosphides
Elements, etc. unclassified
WENJIITE Ti10SixPy (x+y between 6 and 7) H
KUFAHRITE PtPb H
JINGSUIITE TiB2 H
PALLADOGERMANIDE Pd2Ge H
KITAGOHAITE Pt7Cu C
MARATHONITE Pd25Ge9 R
* SULFIDES and SULFOSALTS, selenides, tellurides; arsenides, antimonides, bismuthides; sulfarsenites, sulfantimonites, sulfbismuthites, etc.
Alloys
Alloys of metalloids with Cu, Ag, Au
ALGODONITE Cu6As H
DOMEYKITE Cu3As C
KOUTEKITE Cu5As2 H
NOVAKITE (Cu,Ag)21As10 M ps Q
CUPROSTIBITE Cu2(Sb,Tl) Q
KUTINAITE (K,Tl)0,25Cu14Ag6As6,75 Q
ALLARGENTUM Ag1-xSbx H
DYSCRASITE Ag3Sb O
MALDONITE Au2Bi C
STISTAITE SnSb C
ZACCARINIITE RhNiAs Q
DIENERITE Ni3As C
DIENERITE Ni3As C
DOMEYKITE-Beta Cu3-xAs C
Ni-metalloid alloys
ORCELITE Ni5-xAs2 (x about 0,25) H
MAUCHERITE Ni11As8 Q
Alloys of metalloids with PGE
ATHENEITE Pd2(As0,75Hg0,25) H
VINCENTITE (Pd,Pt)3(As,Sb,Te) M
STILLWATERITE Pd8As3 H
MERTIEITE-II Pd8Sb2,5As0,5 R
ARSENOPALLADINITE Pd8(As,Sb)3 A
ISOMERTIEITE Pd11Sb2As2 C
MIESSIITE Pd11Te2Se2 C
MERTIEITE-I Pd11(Sb,As)4 ps H
STIBIOPALLADINITE Pd5Sb2 H
PALARSTANIDE Pd8(Sn,As)3 H
MENSHIKOVITE Pd3Ni2As3 H
PALLADOARSENIDE Pd2As M
RHODARSENIDE (Rh,Pd)2As O
PALLADODYMITE (Pd,Rh)2As O
NALDRETTITE Pd2Sb O
MAJAKITE PdNiAs H
PALLADOBISMUTHARSENIDE Pd2(As,Bi) O
POLKANOVITE (Rh,Ni)12As7 H
GENKINITE (Pt,Pd)4Sb3 Q
UNGAVAITE Pd4Sb3 Q
POLARITE Pd(Bi,Pb) O
FROODITE PdBi2 M
BORISHANSKIITE = POLARITE Pd1+x(As,Pb)2 (x=0-0,2) O
NIPALARSITE Ni8Pd3As4 C
VITEITE Pd5InAs Q
TORNROOSITE Pd11As2Te2 C
Metal Sulfides, M: S > 1: 1 (mainly 2: 1)
With Cu, Ag, Au
CHALCOCITE Cu2S M
ROXBYITE Cu9S5 M
GEERITE Cu8S5 ps C
DJURLEITE Cu31S16 M
ANILITE Cu7S4 O
DIGENITE Cu9S5 C
BORNITE Cu5FeS4 O ps C
BELLIDOITE Cu2Se Q
BERZELIANITE Cu2Se C
UMANGITE Cu3Se2 Q
ATHABASCAITE Cu5Se4 O
WEISSITE Cu2-xTe H ps C
RICKARDITE Cu7Te5 O ps Q
SPRYITE Ag8(As++3+0,5As+++++0,5)S6 O
ACANTHITE Ag2S M
STROMEYERITE AgCuS O
MCKINSTRYITE (Ag,Cu)2S O
HONEAITE Au3TlTe2 O
KURILITE Ag8Te3Se R
JALPAITE Ag3CuS2 Q
SELENOJALPAITE CuAg3Se2 Q
SPIRIDONOVITE (Cu1-xAgx)2Te R
WUYANZHIITE Cu2S Q
EUCAIRITE CuAgSe O
ARGENTITE Ag2S C
AGUILARITE Ag4SeS O
NAUMANNITE Ag2Se O ps C
CERVELLEITE Ag4TeS C
CHENGUODAITE Ag9FeTe2S4 O
HESSITE Ag2Te M
HENRYITE (Cu,Ag)3,4Te2 C
STUTZITE Ag7Te4 H
ARGYRODITE Ag8GeS6 O ps C
CANFIELDITE Ag8SnS6 O ps C
PUTZITE (Cu,Ag)8GeS6 C
UYTENBOGAARDTITE Ag3AuS2 Q
PETZITE Ag3AuTe2 C
PETROVSKAITE AuAg(S,Se) M
PENZHINITE (Ag,Cu)4Au(S,Se)4 H
FISCHESSERITE Ag3AuSe2 C
BILIBINSKITE Au3Cu2PbTe2 ps C
BOGDANOVITE (Au,Te,Pb)3(Cu,Fe) C
BEZSMERTNOVITE Au4Cu(Te,Pb) O
ORILEYITE (?) (Fe,Cu)2As  
MAKOTOITE Ag12(Cu3Au)S8 R
XUWENYUANITE Ag9Fe+++Te2S4 C
ALBURNITE Ag8GeTe2S4 C
DZIERZANOWSKITE CaCu2S2 R
With Ni
VOZHMINITE (Ni,Co)4(As,Sb)S2 H
HEAZLEWOODITE Ni3S2 R
OREGONITE Ni2FeAs2 H
TUCEKITE Ni9Sb2S8 Q
TELLUROHAUCHECORNITE Ni9BiTeS8 Q
HAUCHECORNITE Ni9Bi(Sb,Bi)S8 Q
ARSENOHAUCHECORNITE Ni9BiAsS8 Q
BISMUTOHAUCHECORNITE Ni9Bi2S8 Q
PENTLANDITE (Fe,Ni)9S8 C
FERHODSITE (Fe,Rh,Ni,Ir,Cu,Pt)9S8 T
FERHODSITE (Fe,Rh,Ni,Ir,Cu,Pt)9S8 T
OBERTHURITE Rh3Ni32S32 C
SHADLUNITE (Pb,Cd)(Fe,Cu)8S8 C
MANGANOSHADLUNITE (Mn,Pb,Cd)(Cu,Fe)8S8 C
KHARAELAKHITE (Pt,Cu,Pb,Fe,Ni)9S8 O
GODLEVSKITE (Ni,Fe)7S6 O
GEFFROYITE (Ag,Cu,Fe)9(Se,S)8 C
COBALTPENTLANDITE (Co,Ni,Fe)9S8 C
ARGENTOPENTLANDITE Ag(Fe,Ni)8S8 C
SUGAKIITE Cu(Fe,Ni)8S8 Q
HOROMANITE (Fe,Ni,Co,Cu)9S8 Q
HRABAKITE Ni9PbSbS8 Q
ARSENOTUCEKITE Ni18Sb3AsS16 Q
SAMANIITE Cu2(Fe,Ni)7S8 Q
With Rh, Pd, Pt, etc.
MIASSITE Rh17S15 C
PALLADSEITE Pd17Se15 C
OOSTERBOSCHITE (Pd,Cu)7Se3 O
CHRISSTANLEYITE Ag2Pd3Se4 M
JAGUEITE Cu2Pd3Se4 M
KEITHCONNITE Pd20Te7 R
VASILITE (Pd,Cu)16(S,Te)7 C
TELLUROPALLADINITE Pd9Te4 M
KOJONENITE Pd7-xSnTe2 (x between 0,3 and 0,8) Q
LUBEROITE Pt5Se4 M
KRAVTSOVITE PdAg2S O
LUKKULAISVAARAITE Pd14Ag2Te9 Q
OULANKAITE (Pd,Pt)5(Cu,Fe)4SnTe2S2 Q
MONCHETUNDRAITE Pd2NiTe2 O
THALHAMMERITE Pd9Ag2Bi2S4 Q
TELARGPALITE (Pd,Ag)3(Te,Bi) C
VYMAZALOVAITE Pd3Bi2S2 C
TEMAGAMITE Pd3HgTe3 O
SOPCHEITE Ag4Pd3Te4 O
BOWLESITE PtSnS O
LAFLAMMEITE Pd3Pb2S2 M
TISCHENDORFITE Pd8Hg3Se9 O
PANSKYITE Pd9Ag2Pb2S4 Q
FLEETITE Cu2RhIrSb2 C
COLDWELLITE Pd3Ag2S C
With Hg, Tl
IMITERITE Ag2HgS2 M
GORTDRUMITE Cu24Fe2Hg9S23 A
DANIELSITE (Cu,Ag)14HgS8 O
BALKANITE Cu9Ag5HgS8 O
DONHARRISITE Ni8Hg3S9 M
CARLINITE Tl2S R
MURUNSKITE K2Cu3FeS4 Q
BUKOVITE Tl2Cu3FeSe4 Q
THALCUSITE TlCu3FeS4 Q
ROHAITE Tl2Cu8,5Sb2S4 O
CHALCOTHALLITE (Tl,K)2Cu5,5(Fe,Ag)SbS4 O ps Q
SABATIERITE Cu6TlSe4 O
CROOKESITE Cu7(Tl,Ag)Se4 Q
BRODTKORBITE Cu2HgSe2 M
With Pb (Bi)
BETEKHTINITE Cu10(Fe,Pb)S6 O
FURUTOBEITE (Cu,Ag)6PbS4 M
SHANDITE Pb2Ni3S2 R ps C
RHODPLUMSITE Pb2Rh3S2 R
PARKERITE Ni3(Bi,Pb)2S2 M
SCHLEMAITE (Cu,Ag)6(Pb,Bi)Se4 M
PASAVAITE Pd3Pb2Te2 O
Metal Sulfides, M: S = 1: 1 (and similar)
With Cu
COVELLITE CuS H
KLOCKMANNITE CuSe H
SPIONKOPITE Cu39S28 H
YARROWITE Cu9S8 H
NUKUNDAMITE (Cu,Fe)4S4 H
CALVERTITE Cu5Ge0,5S4 C
ERAZOITE Cu4SnS6 R
GROKHOVSKYITE CuCrS2 R
With Zn, Fe, Cu, Ag, etc.
TIEMANNITE HgSe C
STILLEITE ZnSe C
RUDASHEVSKYITE (Fe,Zn)S C
METACINNABAR HgS C
HAWLEYITE CdS C
COLORADOITE HgTe C
ISHIHARAITE (Cu,Ga,Fe,In,Zn)S C
SPHALERITE (Zn,Fe)S C
SAKURAIITE (Cu,Zn,Fe)3(In,Sn)S4 Q
POLHEMUSITE (Zn,Hg)S Q ps C
SHENZHUANGITE NiFeS2 Q
CHALCOPYRITE CuFeS2 Q
ROQUESITE CuInS2 Q
LENAITE AgFeS2 Q
LAFORETITE AgInS2 Q
GALLITE CuGaS2 Q
ESKEBORNITE CuFeSe2 Q
HAYCOCKITE Cu4Fe5S8 O
PUTORANITE Cu16-18(Fe,Ni)18-19S32 C
TALNAKHITE Cu9(Fe,Ni)8S16 C
MOOIHOEKITE Cu9Fe9S16 Q
OMARINIITE Cu8Fe2ZnGe2S12 O
CERNYITE Cu2CdSnS4 Q
KESTERITE Cu2(Zn,Fe)SnS4 Q
KURAMITE Cu3SnS4 Q
IDAITE Cu5FeS6 H
PIRQUITASITE Ag2ZnSnS4 Q
STANNITE Cu2FeSnS4 Q
FERROKESTERITE Cu2(Fe,Zn)SnS4 Q
VELIKITE Cu2HgSnS4 Q
HOCARTITE Ag2FeSnS4 Q
MOHITE Cu2SnS3 A
STANNOIDITE Cu8(Fe,Zn)3Sn2S12 O
CHATKALITE Cu6Fe++Sn2S8 Q
MAWSONITE Cu+6Fe+++2Sn++++S8 Q
FRIESEITE Ag2Fe5S8 (?)  
ARGYROPYRITE Ag2Fe7S11 (?)  
STIBIOCOLUSITE Cu26V2(Sb,Sn,As)6S32 C
OVAMBOITE Cu10(Fe,Zn,Cu)3W(Ge,As)3S16 C
NEKRASOVITE Cu26V2(Sn,As,Sb)6S32 C
MAIKAINITE Cu10(Fe,Cu)3Mo(Ge,As)3S16 C
GERMANOCOLUSITE Cu26V2(Ge,As)6S32 C
GERMANITE Cu26Fe4Ge4S32 C
COLUSITE Cu26V2(As,Sn,Sb)6S32 C
HEMUSITE Cu+4Cu++Sn++++Mo++++S8 C
VINCIENNITE Cu10Fe4Sn(As,Sb)S16 Q ps C
RENIERITE (Cu,Zn)11(Ge,As)2Fe4S16 Q ps C
POLKOVICITE (Fe,Pb)3(Ge,Fe)1-xS4 C
MOROZEVICZITE (Pb,Fe)3Ge1-xS4 C
KIDDCREEKITE Cu6SnWS8 C
CATAMARCAITE Cu6GeWS8 H
LAUTITE CuAsS O
LINGBAOITE AgTe3 R
CADMOSELITE CdSe H
WURTZITE (Zn,Fe)S H
RAMBERGITE gamma-MnS H
GREENOCKITE CdS H
BUSECKITE (Fe,Zn,Mn)S H
MALETOYVAYAMITE Au3Se4Te6 A
MURCHISITE Cr5S6 R
ZINCSELENIDE ZnSe  
WASSONITE TiS R
DZHEZKAZGANITE ReMoCu2PbS6 (?) R
CUBANITE CuFe2S3 O
ISOCUBANITE CuFe2S3 C
RAGUINITE TlFeS2 O ps H
PICOTPAULITE TlFe2S3 O
STERNBERGITE AgFe2S3 O
ARGENTOPYRITE AgFe2S3 O
SULVANITE Cu3VS4 C
VULCANITE CuTe O
EMPRESSITE AgTe O
MUTHMANNITE (Ag,Au)Te O (?)
GACHINGITE Au(Te1-xSex) (x between 0,2 and 0,5) O
TOLSTYKHITE Au3S4Te6 A
BROWNEITE MnS C
AGMANTINITE Ag2MnSnS4 O
RICHARDSITE Zn2CuGaS4 Q
With Ni, Fe, Co, PGE, etc.
ACHAVALITE FeSe R
KOTULSKITE Pd(Te,Bi)2-x (x about 0,4) H
SEDERHOLMITE beta-NiSe H
ZLATOGORITE CuNiSb2 R
SOBOLEVSKITE Pd(Bi,Te) H/M
JAIPURITE CoS H
FREBOLDITE CoSe H
BREITHAUPTITE NiSb H
STUMPFLITE Pt(Sb,Bi) H
SUDBURYITE (Pd,Ni)Sb H
NICKELINE NiAs H
LANGISITE (Co,Ni)As H
TROILITE FeS H
PYRRHOTITE Fe1-xS (x=0-0,17) M/H
SMYTHITE (Fe,Ni)9S11 or (Fe,Ni)13S16 R
CHEREPANOVITE RhAs O
WESTERVELDITE (Fe,Ni,Co)As O
RUTHENARSENITE (Ru,Ni)As O
MINAKAWAITE RhSb O
MODDERITE (Co,Fe)As O (?)
MAKINENITE gamma-NiSe R
MILLERITE NiS R
MACKINAWITE (Fe,Ni)9S8 Q
VAVRINITE Ni2SbTe2 H
HEXATESTIBIOPANICKELITE (Ni,Pd)(Te,Sb) H
BRAGGITE (Pt,Pd,Ni)S Q
VYSOTSKITE (Pd,Ni)S Q
COOPERITE (Pt,Pd,Ni)S Q
JACUTINGAITE (Pt,Pd)2HgSe3 R
IMGREITE NiTe (?) H
FERROTORRYWEISERITE Rh5Fe10S16 R
TAMURAITE Ir5Fe10S16 R
CROWNINGSHIELDITE (Ni0,9Fe0,10)S H
TORRYWEISERITE Rh5Ni10S16 R
ELIOPOULOSITE V7S8 R
TILKERODEITE Pd2HgSe3 R
KUVAEVITE Ir5Ni10S16 R
With Sn, Pb, Hg, etc.
HERZENBERGITE SnS O
TEALLITE PbSnS2 O
ALABANDITE Mn++S C
OLDHAMITE (Ca,Mg,Fe,Mn)S C
NININGERITE (Mg,Fe++,Mn)S C
KEILITE (Fe,Mg)S C
GALENA PbS C
CLAUSTHALITE PbSe C
ALTAITE PbTe C
CINNABAR HgS R
HYPERCINNABAR HgS H
SVETLANAITE SnSe O
Metal Sulfides, M: S = 3 :4 and 2:3
M:S = 3:4
DAUBREELITE Fe++Cr2S4 C
JOEGOLDSTEINITE MnCr2S4 C
FLETCHERITE Cu(Ni,Co)2S4 C
KALININITE ZnCr2S4 C
FLORENSOVITE (Cu,Zn)(Cr,Sb)2S4 C
GREIGITE Fe++Fe+++2S4 C
LINNAEITE Co++Co+++2S4 C
VIOLARITE Fe++Ni+++2S4 C
CUPRORHODSITE CuRh2S4 C
XINGZHONGITE (Pb,Cu,Fe)(Ir,Pt,Rh)2S4 C
TRUSTEDTITE Ni3Se4 C
POLYDYMITE NiNi2S4 C
SIEGENITE (Ni,Co)3S4 C
TYRRELLITE (Cu,Co,Ni)3Se4 C
MALANITE Cu(Pt,Ir)2S4 C
INDITE Fe++In2S4 C
FERRORHODSITE = CUPRORHODSITE (Fe,Cu)(Rh,Pt,Ir)2S4 C
CUPROKALININITE Cu(Cr+++Cr++++)S4 C
BORNHARDTITE Co++Co+++2Se4 C
CADMOINDITE CdIn2S4 C
CARROLLITE Cu(Co,Ni)2S4 C
CUPROIRIDSITE Cu(Ir+++Ir++++)S4 C
RHODOSTANNITE Cu2FeSn3S8 Q
TOYOHAITE Ag2FeSn3S8 Q
HEIDEITE (Fe,Cr)1+x(Ti,Fe)2S4 M
BREZINAITE Cr3S4 M
KONDERITE PbCu3(Rh,Pt,Ir)8S16 H
INAGLYITE PbCu3(Ir,Pt)8S16 H
KINGSTONITE (Rh,Ir,Pt)3S4 M
ZOLENSKYITE FeCr2S4 M
ZAYKOVITE Rh3Se4 M
NICKELTYRRELLITE CuNi2Se4 C
GRIMMITE NiCo2S4 C
M:S = 2:3
GUANAJUATITE Bi2Se3 O
STIBNITE Sb2S3 O
METASTIBNITE Sb2S3 am.
BISMUTHINITE Bi2S3 O
ANTIMONSELITE Sb2Se3 O
PAAKKONENITE Sb2AsS2 M
OTTEMANNITE Sn2S3 O
SUREDAITE PbSnS3 O
BOWIEITE (Rh,Ir,Pt)1,77S3 O
KASHINITE (Ir,Rh)2S3 O
MONTBRAYITE (Au,Ag,Sb,Bi,Pb)23(TeSb,Bi,Pb)38 A
EDGARITE FeNb3S6 H
TARKIANITE (Cu,Fe)(Re,Mo)4S8 C
CAMERONITE Cu5-x(Cu,Ag)3+xTe10 (x = 0,43) Q
SCHREIBERSITE (of Shepard) Cr2S3 (?)  
STANGERSITE SnGeS3 M
Variable M:S
JOSEITE = IKUNOLITE ? Bi4TeS2 R
LAITAKARITE Bi4(Se,S)3 R
NEVSKITE Bi(Se,S) R
PARAGUANAJUATITE Bi2(Se,S)3 R
PILSENITE Bi4Te3 R
VIHORLATITE Bi24Se17Te4 R
KAWAZULITE Bi2(Te,Se,S)3 R
JOSEITE-A Bi4TeS2 R
HITACHIITE Pb5Bi2Te2S6, R
TELLURANTIMONY Sb2Te3 R
TSUMOITE BiTe R
PROTOJOSEITE Bi3(Te,S)2 H
SZTROKAYITE Bi3TeS2  
SKIPPENITE Bi2Se2Te R
TELLUROBISMUTHITE Bi2Te3 R
TETRADYMITE Bi2Te2S R
SULPHOTSUMOITE Bi3Te2S R
INGODITE Bi(S,Te) H
IKUNOLITE Bi4(S,Se)3 R
HEDLEYITE Bi7Te3 R
BAKSANITE Bi6(Te2S3) R
JOSEITE-B Bi4Te2S R
TELLURONEVSKITE Bi3Te(Se,S)2 R
CASTAINGITE CuMo2S5 H
Metal Sulfides, M: S <= 1:2
M:S = 1:2 - With Cu, Ag, Au
SYLVANITE (Au,Ag)2Te4 M
CALAVERITE AuTe2 M
KOSTOVITE CuAuTe4 O
KRENNERITE Au3AgTe8 O
MERENSKYITE (Pd,Pt)(Te,Bi)2 R
SUDOVIKOVITE PtSe2 R
MONCHEITE (Pt,Pd)(Te,Bi)2 R
MELONITE NiTe2 R
KITKAITE NiTeSe R
BERNDTITE SnS2 R/H
SHUANGFENGITE IrTe2 R
OGNITITE NiBiTe R
VERBEEKITE PdSe2 M
TUNGSTENITE WS2 H/R
MOLYBDENITE-3R MoS2 R
MOLYBDENITE MoS2 H/R
DRYSDALLITE Mo(Se,S)2 H
JORDISITE MoS2 am.
PAMPALOITE AuSbTe M
RADVANICEITE GeS2 M
M:S = 1:2, with Fe, Co, Ni, PGE, etc.
PENROSEITE (Ni,Co,Cu)Se2 C
PYRITE FeS2 C
FUKUCHILITE (Cu,Fe)S2 C
SPERRYLITE PtAs2 C
TROGTALITE CoSe2 C
VAESITE NiS2 C
GAOTAIITE Ir3Te8 C
VILLAMANINITE (Cu,Ni,Co,Fe)S2 C
LAURITE RuS2 C
KRUTAITE CuSe2 C
INSIZWAITE Pt(Bi,Sb)2 C
HAUERITE MnS2 C
ERLICHMANITE OsS2 C
DZHARKENITE FeSe2 C
CATTIERITE CoS2 C
AUROSTIBITE AuSb2 C
GEVERSITE Pt(Sb,Bi)2 C
BAMBOLLAITE Cu(Se,Te)2 Q
PETRICEKITE CuSe2 O
MATTAGAMITE CoTe2 O
MARCASITE FeS2 O
KULLERUDITE NiSe2 O
FROHBERGITE FeTe2 O
FERROSELITE FeSe2 O
ALLOCLASITE (Co,Fe)AsS M
GLAUCODOT (Co,Fe)AsS O ps C
COSTIBITE CoSbS O
PARACOSTIBITE CoSbS O
PARARAMMELSBERGITE NiAs2 O
OENITE CoSbAs O
NISBITE NiSb2 O
SAFFLORITE (Co,Fe++)As2 O
OMEIITE (Os,Ru)As2 O
LOLLINGITE FeAs2 O
CLINOSAFFLORITE (Co,Fe,Ni)As2 M
ANDUOITE (Ru,Os)As2 O
RAMMELSBERGITE NiAs2 O
SEINAJOKITE (Fe,Ni)(Sb,As)2 O
PAXITE Cu2As3 M ps O
GUDMUNDITE FeSbS M
RUARSITE RuAsS M
ARSENOPYRITE FeAsS M ps O
OSARSITE (Os,Ru)AsS M
ORTHOGERSDORFFITE NiAsS O
TOLOVKITE IrSbS C
MICHENERITE (Pd,Pt)BiTe C
KALUNGAITE PdAsSe C
PADMAITE PdBiSe C
TESTIBIOPALLADITE Pd(Sb,Te)Te C
PLATARSITE (Pt,Rh,Ru)AsS C
ULLMANNITE NiSbS A ps C
MAYINGITE IrBiTe C
WILLYAMITE (Co,Ni)SbS M/A
KRUTOVITE NiAs2 C
JOLLIFFEITE (Ni,Co)AsSe C
MILOTAITE PdSbSe C
HOLLINGWORTHITE (Rh,Pt,Pd)AsS C
GERSDORFFITE NiAsS C
COBALTITE CoAsS C
CHANGCHENGITE IrBiS C
MASLOVITE (Pt,Pd)(Bi,Te)2 C
IRARSITE (Ir,Ru,Rh,Pt)AsS C
URVANTSEVITE Pd(Bi,Pb)2 Q
RHENIITE ReS2 A ps H
SELENOLAURITE RuSe2 C
IRIDARSENITE (Ir,Ru)As2 M
M:S = 1:>2
NICKELSKUTTERUDITE (Ni,Co,Fe)As3 C
SKUTTERUDITE (Co,Ni)As3-x C
KIEFTITE CoSb3 C
FERROSKUTTERUDITE (FeCo)As3 C
PATRONITE VS4 M
Sulfides of arsenic, alkalies; sulfides with halide, oxide, hydroxide, H2O
With As, (Sb), S
DURANUSITE As4S O
DIMORPHITE As4S3 O
REALGAR AsS M
PARAREALGAR AsS M
ALACRANITE As8S9 M
UZONITE As4S5 M
LAPHAMITE As2(Se,S)3 M
ORPIMENT As2S3 M
GETCHELLITE AsSbS3 M
KALGOORLIEITE As2Te3 M
WAKABAYASHILITE As4(As,Sb)6S14 M
PARADIMORPHITE As4S3 O
ANORPIMENT As2S3 A
BONAZZIITE As4S4 M
With alkalies (without Cl, etc.)
CRONUSITE Ca0,2(H2O)2CrS2 R
CASWELLSILVERITE NaCrS2 R
SCHOLLHORNITE Na0,3CrS2.H2O R
CHVILEVAITE Na(Cu,Fe,Zn)2S2 H
ORICKITE 2CuFeS2.H2O H
PAUTOVITE CsFe2S3 O
RASVUMITE KFe2S3 O
COLIMAITE K3VS4 O
With Cl, Br, I (halide-sulfides)
DJERFISHERITE K6(Cu,Fe,Ni)24S26Cl C
OWENSITE (Ba,Pb)6(Cu,Fe,Ni)25S27 C
GMALIMITE K6[]Fe++24S27 C
Cu-DJERFISHERITE K6(Cu,Fe)25S26Cl C
ZOHARITE (Ba,K)6(Fe,Cu,Ni)25S27 C
THALFENISITE (Tl,K)6Na(Fe,Ni,Cu)25S26Cl C
BARTONITE K3Fe10S14 Q
CHLORBARTONITE K6Fe24S26(Cl,S) Q
ARZAKITE Hg3S2(Br,Cl)2 M/A
CORDEROITE Hg3S2Cl2 C
LAVRENTIEVITE Hg3S2(Cl,Br)2 M/A
KENHSUITE gamma-Hg3S2Cl2 O
GRECHISHCHEVITE Hg3S2(Br,Cl,I)2 Q
RADTKEITE Hg3S2ClI O
CAPGARONNITE HgSAg(Cl,Br,I) O
ILTISITE HgSAg(Cl,Br) H
PERROUDITE Hg5Ag4S5(I,Br)2Cl2 O
HANAUERITE AgHgSI O
DEMICHELEITE-(Cl) BiS(Cl,Br)5 O ps Q
DEMICHELEITE-(Br) BiS(Br,Cl)5 O ps Q
DEMICHELEITE-(I) BiS(I,Br)5 O ps Q
With O, OH, H2O
KERMESITE Sb2S2O A ps M
VIAENEITE (Fe,Pb)4S8O M
ERDITE NaFeS2.2H2O M
COYOTEITE NaFe3S5.2H2O A
YUSHKINITE VS2(Mg,Al)(OH)2 H
HAAPALAITE 4(Fe,Ni)S.3(Mg,Fe++)(OH)2 H
VALLERIITE 4(Fe,Cu)S.3(Mg,Al)(OH)2 H
EKPLEXITE (Nb,Mo,W)S2.(Mg1-xAlx)(OH)2+x R
FERROTOCHILINITE (FeS)6.5[Fe++(OH)2] M
MANGANOKASKASITE (Mo,Nb)S2.(Mn1-xAlx)(OH)2+x R
KASKASITE (Mo,Nb)S2.(Mg1-xAlx)(OH)2+x R
TOCHILINITE 2(Fe,Ni,Cu)S.1-2(Mg,Fe,Al,Ca)(OH,CO3)1-2 A
WILHELMRAMSAYITE Cu3FeS3.2H2O O
VYALSOVITE FeS.Ca(OH)2.Al(OH)3 O
BAZHENOVITE CaS5.CaS2O3.6Ca(OH)2.20H2O M
FERROVALLERIITE (Fe,Cu)4S4.3[Fe++(OH)2] R
Sulfarsenites, sulfantimonites, sulfbismuthites
Neso-sulfarsenites, etc. without additional S
PROUSTITE Ag3AsS3 R
PYRARGYRITE Ag3SbS3 R
PYROSTILPNITE Ag3SbS3 M
XANTHOCONITE Ag3AsS3 M
SAMSONITE Ag4MnSb2S6 M
BYTIZITE Cu3SbSe3 O
WITTICHENITE Cu3BiS3 O
SKINNERITE Cu3SbS3 M
LAPIEITE CuNiSbS3 O
LISIGUANGITE CuPtBiS3 O
MALYSHEVITE PdCuBiS3 O
MUCKEITE CuNiBiS3 O
ROTERBARITE PdBiCuSe3 O
NOWACKIITE Cu6Zn3As4S12 R
GRUZDEVITE Cu6Hg3Sb4S12 R
AKTASHITE Cu6Hg3As4S12 A
LAFFITTITE AgHgAsS3 M
FERROSTALDERITE Tl(Cu,Ag)(Fe,Zn)2As2S6 M
STALDERITE (Tl,Cu)(Zn,Fe,Hg)2As2S6 Q
ROUTHIERITE TlCu(Hg,Zn)2(As,Sb)2S6 Q
RALPHCANNONITE AgZn2TlAs2S6 Q ps C
ERNIGGLIITE Tl2SnAs2S6 H
CERROMOJONITE CuPbBiSe3 O
SOUCEKITE PbCuBi(S,Se)3 O
SELIGMANNITE PbCuAsS3 O
BOURNONITE PbCuSbS3 O
ELDRAGONITE Cu6BiSe6 O
ECKERITE Ag2CuAsS3 M
ARSICCIOITE AgHg2Tl(As,Sb)2S6 Q
PYRADOKETOSITE Ag3SbS3 M
Neso-sulfarsenites, etc. with additional S
TENNANTITE-(Ni) Cu6(Cu4Ni2)As4S13 C
TENNANTITE-(Cd) Cu6(Cu4Cd2)As4S12S C
TENNANTITE = SUBGROUP name Cu6(Cu4(Fe,Zn,Cu,Hg)++2)As4S12S C
TETRAHEDRITE = SUBGROUP name Cu6(Cu4(Fe,Zn,Cd,Hg)++2)Sb4S12S C
KENOARGENTOTETRAHEDRITE-(Zn) Ag6(Cu4Zn2)Sb4S12[] C
TETRAHEDRITE-(Ni) Cu6(Cu4Ni2)Sb4S13 Cu6(Cu4Ni2)Sb4S13 Cu6(Cu4Ni2)Sb4S13 Cu6(Cu4Ni2)Sb4S13 C
ROZHDESTVENSKAYAITE-(Hg) Ag6(Ag4Hg2)Sb4S13 C
ROZHDESTVENSKAYAITE-(Zn) Ag6(Ag4Zn2)Sb4S13 C
TENNANTITE-(Mn) Cu6(Cu4Mn2)As4S13 C
STIBIOGOLDFIELDITE Cu6Cu6(Sb2Te2)S13 C
TENNANTITE-(Cu) Cu6(Cu4Cu2)As4S13 C
TENNANTITE-(Hg) Cu6(Cu4Hg2)As4S13 C
ROZHDESTVENSKAYAITE-(Fe) Ag6(Ag4Fe2)Sb4S13 C
TETRAHEDRITE-(Cd) Cu6(Cu4Cd2)Sb4S13 C
TETRAHEDRITE-(Cu) Cu6(Cu4Cu2)Sb4S13 C
TETRAHEDRITE-(Hg) Cu6(Cu4Hg2)Sb4S13 C
TETRAHEDRITE-(Mn) Cu6(Cu4Mn2)Sb4S13 C
TETRAHEDRITE-(Zn) Cu6(Cu4Zn2)Sb4S13 C
TENNANTITE-(Fe) Cu6(Cu4Fe2)As4S13 C
KENOARGENTOTETRAHEDRITE-(Fe) Ag6(Cu4Fe2)Sb4S12[] C
POSEPNYITE (Cu+3[]3)(Hg++4Cu+2)Sb4Se12(Se0,5[]0,5) C
ARGENTOTETRAHEDRITE-(Hg) Ag6(Cu4Hg2)Sb4S13 C
TENNANTITE-(Zn) Cu6(Cu4Zn2)As4S13 C
GIRAUDITE-(Zn) Cu6(Cu4Zn2)As4Se13 C
ARGENTOTETRAHEDRITE-(Zn) Ag6(Cu4Zn2)Sb4S12S C
HAKITE-(Cu) Cu6(Cu4Cu2)Sb4Se13 C
ARGENTOTENNANTITE-(Fe) Ag6(Cu4Fe2)As4S13 C
KENOARGENTOTENNANTITE-(Fe) Ag6(Cu4Fe2)As4S12[] C
ARGENTOTENNANTITE-(Zn) Ag6(Cu4Zn2)As4S13 C
GIRAUDITE-(Cu) Cu6(Cu4Cu2)As4Se13 C
ARGENTOTETRAHEDRITE-(Cd) Ag6(Cu4Cd2)Sb4S13 C
FREIBERGITE SUBGROUP ([Ag6]++++((Cu,Ag)4(Fe,Zn,Cd,Hg)++2)Sb4S12(S,Se,[])0-1  
GIRAUDITE-(Hg) Cu6(Cu4Hg2)As4Se13 C
GOLDFIELDITE (Cu4[]2)Cu6Te4S13 C
ARGENTOTETRAHEDRITE-(Fe) Ag6(Cu4Fe2)Sb4S13 C
HAKITE-(Cd) Cu6(Cu4Cd2)Sb4Se13 C
TETRAHEDRITE-(Fe) Cu6(Cu4Fe2)Sb4S13 C
HAKITE-(Fe) Cu6(Cu4Fe2)Sb4Se13 C
HAKITE-(Hg) Cu6(Cu4Hg2)Sb4Se13 C
HAKITE-(Zn) Cu6(Cu4Zn2)Sb4Se13 C
GIRAUDITE-(Fe) Cu6(Cu4Fe2)As4Se13 C
SELENOSTEPHANITE Ag5Sb(Se,S)4 O
STEPHANITE Ag5SbS4 O
POLYBASITE [(Ag8CuS4)][(AgCu)6(Sb,As)2S7] M ps H
SELENOPOLYBASITE Cu(Ag,Cu)6Ag9(Sb,As)2(S,Se)9Se2 R
PEARCEITE [(Ag8CuS4)][(AgCu)6(As,Sb)2S7] M
CUPROPOLYBASITE Ag9Cu7(Sb,As)2S11 R
CUPROPEARCEITE Ag9Cu7(As,Sb)2S11 R
FERROVORONTSOVITE (Fe5Cu)TlAs4S12 C
VORONTSOVITE (Hg5Cu)TlAs4S12 C
GALKHAITE (Cs,Tl)(Hg,Cu,Zn)6(As,Sb)4S12 C
KENOROZHDESTVENSKAYAITE-(Fe) [Ag6]++++(Ag4Fe++2)Sb4S12[] C
STIBIOGOLDFIELDITE Cu6Cu6(Sb2Te2)S13 C
STIBIOUSTALECITE (Cu4Cu2)(Cu4Cu++)(Sb2Te2)Se12Se C
ARGENTOPOLYBASITE Ag16As2S11 R
POLYBASITE-Tac [Cu6Sb2S7][Ag9CuS4] R
ARGENTOPOLYBASITE-T2ac Ag16Sb2S11 R
ARGENTOPEARCEITE Ag16As2S11 A
ZVESTOVITE-(Zn) Ag6(Ag4Zn2)As4S13 C
Poly-sulfarsenites
HATCHITE (Pb,Tl)2AgAs2S5 A
WALLISITE PbTl(Cu,Ag)As2S5 A
SINNERITE Cu6As4S9 A
WATANABEITE Cu4(As,Sb)2S5 O ps C
SIMONITE TlHgAs3S6 M
MANGANOQUADRATITE AgMnAsS3 Q
QUADRATITE Ag(Cd,Pb)(As,Sb)S3 Q
SMITHITE AgAsS2 M
DEBATTISTIITE Ag9Hg0,5As6S12Te2 A
TRECHMANNITE AgAsS2 R
ALEKSITE PbBi2Te2S2 R
KOCHKARITE PbBi4Te7 R
RUCKLIDGEITE (Bi,Pb)3Te4 R
POUBAITE PbBi2(Te,S)2Se2 R
SADDLEBACKITE Pb2Bi2Te2S3 H
BABKINITE Pb2Bi2(S,Se)3 R
TVALCHRELIDZEITE Hg3SbAsS3 A
MUTNOVSKITE Pb2AsS3(I,Cl,Br) O
Sulfosalts of SnS archetype
With Cu, Ag, Fe (without Pb)
GRATIANITE (Mn,Fe)Bi2S4 M
GRUNDMANNITE CuBiSe2 O
HANSBLOCKITE (Cu,Hg)(Bi,Pb)Se2 M
PRIBRAMITE CuSbSe2 O
EMPLECTITE CuBiS2 O
CHALCOSTIBITE CuSbS2 O
MIARGYRITE AgSbS2 M
CLERITE MnSb2S4 O
GARAVELLITE FeSbBiS4 O
BERTHIERITE FeSb2S4 O
BAUMSTARKITE Ag3Sb2SbS6 A
ARAMAYOITE Ag3Sb2BiS6 A
With Cu, Ag, Fe, Sn and Pb
GLADITE CuPbBi5S9 O
SALZBURGITE Cu1,6Pb1,6Bi6,4S12 O
AIKINITE PbCuBiS3 O
EMILITE Cu2,68Pb2,68Bi5,32S12 O
FRIEDRICHITE Pb5Cu5Bi7S18 O
HAMMARITE Pb2Cu2Bi4S9 O
LINDSTROMITE Cu3Pb3Bi7S15 O
PAARITE Cu1,7Pb1,7Bi6,3S12 O
KRUPKAITE PbCuBi3S6 O
PEKOITE PbCuBi11(S,Se)18 O
MENEGHINITE Pb13CuSb7S24 O
JASKOLSKIITE Pb2+xCux(Sb,Bi)2-xS5 (x=0,2) O
KOBELLITE Pb22Cu4(Bi,Sb)30S69 O
TINTINAITE Pb22Cu+4(Sb,Bi)30S69 O
IZOKLAKEITE Pb27(Cu,Fe)2(Sb,Bi)19S57 O
GIESSENITE 2(Cu2Pb26(Bi,Sb)20S57) M
ECLARITE Pb9(Cu,Fe)Bi12S28 O
JAMESONITE Pb4FeSb6S14 M
BENAVIDESITE Pb4(Mn,Fe)Sb6S14 M
NAGYAGITE (Au,Te)3Pb3(Pb,Sb,Bi)3S6 M
JASZCZAKITE [Bi3S3][AuS2] O
BUCKHORNITE AuTe2Pb2BiS3 O
MUSEUMITE AuTe2Pb5SbS12 M
BERRYITE Cu3Ag2Pb3Bi7S16 M
LITOCHLEBITE PbAg2Bi4Se8 M
WATKINSONITE Cu2PbBi4Se8 M
LUXEMBOURGITE AgCuPbBi4Se8 M
MEERSCHAUTITE Pb42(Ag,Cu)6(Sb,As)45S112 M
BARIKAITE Pb10Ag3As11Sb8S40 M
CARDUCCIITE Pb6Ag(As,Sb)9S20 M
With only Pb
TWINNITE Pb(Sb,As)2S4 O
SARTORITE PbAs2S4 M
GUETTARDITE Pb(Sb,As)2S4 M
HYRSLITE Pb8As10Sb6S32 M
BAUMHAUERITE Pb3As4S9 A
ARGENTOBAUMHAUERITE Ag1,5Pb22As33,5S72 A
LIVEINGITE Pb9As13S28 M
ARGENTOLIVEINGITE Ag3+xPb36-2xAs51+xS112 A
VEENITE Pb2(Sb,As)2S5 O
RATHITE (Pb,Tl)3As5S10 M
DUFRENOYSITE Pb2As2S5 M
ARGENTODUFRENOYSITE Ag3Pb26As35S80 A
RATHITE IV (Pb,Tl)3As5S10  
HEPTASARTORITE Tl7Pb22As55S108 M
HENDEKASARTORITE Tl2Pb48As82S172 M
INCOMSARTORITE Tl6Pb144As246S516 M
DEKATRIASARTORITE TlPb58As97S204 M
ECRINSITE AgTl3Pb4As11Sb9S36 A
PHILROTHITE TlAs3S5 M
PIERROTITE Tl2Sb6As4S16 O
PARAPIERROTITE Tl(Sb,As)5S8 M
MARUMOITE Pb8As10S23 M ps O
POLLONEITE AgPb46As26Sb23S120 M
FULOPPITE Pb3Sb8S15 M
PLAGIONITE Pb5Sb8S17 M
HETEROMORPHITE Pb7Sb8S19 M
RAYITE (Ag,Tl)2Pb8Sb8S21 M
SEMSEYITE Pb9Sb8S21 M
BOULANGERITE Pb5Sb4S11 M
FALKMANITE Pb5Sb4S11 M
ROBINSONITE Pb4Sb6S13 A
MOELOITE Pb6Sb6S14(S3) O
DADSONITE Pb23Sb25S60Cl A ps M
ZOUBEKITE AgPb4Sb4S10 O
OWYHEEITE Pb7Ag2(Sb,Bi)8S20 O
PARASTERRYITE Pb20Ag4(Sb,As)24S58 M
LOPATKAITE Pb5Sb3AsS11 M
BERNARLOTTIITE Pb6As5Sb3S18 A
With Tl
DRECHSLERITE Tl4(Sb4-xAsx)S8 A
LORANDITE TlAsS2 M
WEISSBERGITE TlSbS2 A
DALNEGROITE Tl5-xPb2x(As,Sb)21-xS34 A
CHABOURNEITE AgzTl8-x-zPb4+2xSb40-x-yAsyS68 A
CHRISTITE TlHgAsS3 M
RICHARDSOLLYITE TlPbAsS3 M
JANKOVICITE Tl5Sb9(As,Sb)4S22 A
REBULITE Tl5Sb5As8S22 M
IMHOFITE Tl6CuAs16S40 M
EDENHARTERITE TlPbAs3S6 O
JENTSCHITE TlPbAs2SbS6 M
HUTCHINSONITE (Pb,Tl)2As5S9 O
PROTOCHABOURNEITE Tl4-xPb2+2xSb20-x-yAsyS34 A
BERNARDITE Tl(As,Sb)5S8 M
SICHERITE TlAg2(As,Sb)3S6 O
GABRIELITE Tl2AgCu2As3S7 A ps H
TSYGANKOITE Mn8Tl8Hg2(Sb21Pb2Tl)S48 M
DEWITITE AgzTl10-x-zPb2xSb42-x-yAsyS68 A
SHIMENITE Tl5Sb21-yAsyS34 (y between 9 and 10) A
GUNGERITE TlAs5Sb4S13 O
BOSCARDINITE (Tl,Ag)Pb4Sb7As2S18 A
ENNEASARTORITE Tl6Pb32As70S140 M
With alkalies, H2O
GERSTLEYITE Na2(Sb,As)8S13.2H2O M
AMBRINOITE (K,NH4)2(As,Sb)8S13.H2O A
With SnS and PbS archetype structure units
VRBAITE Tl4Hg3Sb2As8S20 O
MERELANIITE Mo4Pb4VSbS15 A (?)
ABRAMOVITE Pb2SnInBiS7 A ps Q
CYLINDRITE Pb4Fe++Sn++++4Sb+++2S16 A
LEVYCLAUDITE Pb8Sn7Cu3(Bi,Sb)3S28 M ps Q/H
COIRAITE (Pb,Sn++)12,5Fe++Sn++++5As3S28 M ps Q/H
FRANCKEITE (Pb,Sn++)6Sn++++2FeSb2S14 A
LENGENBACHITE Pb6(Ag,Cu)2As4S13 A
RAMOSITE Pb25,7Sn8,3Mn3,4Sb6,4S56,2 M
Sulfosalts of PbS archetype
Galena derivatives with little or no Pb
DANTOPAITE (Ag,Cu)5(Bi,Pb)13S22 M
CUPROMAKOPAVONITE Cu8Ag3Pb4Bi19S38 M
CUPROPAVONITE AgPbCu2Bi5S10 M
PAVONITE (Ag,Cu)(Bi,Pb)3S5 M
GRUMIPLUCITE HgBi2S4 M
KUDRIAVITE (Cd,Pb)Bi2S4 M
MAKOVICKYITE (Ag,Cu)1,5(Bi,Pb)5,5S9 M
CUPROMAKOVICKYITE Cu4AgPb2Bi9S18 M
BENJAMINITE (Ag,Cu)3(Bi,Pb)7S12 M
MUMMEITE Cu0,58Ag3,11Pb1,10Bi6,65S13 M
BORODAEVITE Ag5(Bi,Sb)9S16 M
MOZGOVAITE PbBi4(S,Se)7 O
LIVINGSTONITE HgSb4S6(S2) M
CUPROBISMUTITE Cu10Bi12S23 M
KUPCIKITE Cu3,4Fe0,6Bi5S10 M
HODRUSITE Cu8Bi12S22 M
PIZGRISCHITE Cu14(Cu,Fe)PbBi17S35 M
PADERAITE AgPb2Cu6Bi11S22 M
SCHAPBACHITE AgBiS2 C
CUBOARGYRITE AgSbS2 C
MATILDITE AgBiS2 H
BOHDANOWICZITE AgBiSe2 H
VOLYNSKITE AgBiTe2 O
FERDOWSIITE Ag8(Sb5As3)S16 M
LUBORZAKITE Mn2AsSbS5 M
SANGENAROITE Ag8(Sb8-xAsx)S16 (x between = and 2) M
Galena derivatives, with Pb
DIAPHORITE Pb2Ag3Sb3S8 M
COSALITE Pb2Bi2S5 O
MARRITE PbAgAsS3 M
FREIESLEBENITE AgPbSbS3 M
WITTITE Pb3Bi4(S,Se)9 M
CANNIZZARITE Pb4Bi5S11 M
JUNOITE Pb3Cu2Bi8(S,Se)16 M
FELBERTALITE Cu2(Pb,Ag)6Bi8S19 M
NORDSTROMITE Pb3CuBi7(S10Se4) M
PROUDITE (Pb,Cu)8Bi9-10(S,Se)22 M
ANGELAITE Cu2AgPbBiS4 M
NUFFIELDITE Pb2Cu(Pb,Bi)Bi2S7 O
WEIBULLITE (Pb,Ag)6Bi8(S,Se)18 O
CUPRONEYITE Cu7Pb27Bi25S68 M
NEYITE Pb7(Cu,Ag)2Bi6S17 M
ROUXELITE Cu2HgPb22Sb28S64(O,S)2 M
MARCOBALDIITE Pb12Sb3As2BiS21 A
ARSENMARCOBALDIITE Pb12As3,2Sb2,8)S21 A
JORDANITE Pb14(As,Sb)6S23 M
GEOCRONITE Pb14(Sb,As)6S23 M
KIRKIITE Pb10Bi3As3S19 O/M
TSUGARUITE Pb28As15S50Cl O
ZINKENITE Pb9Sb22S42 H
SCAINIITE Pb14Sb30S54O5 M
PILLAITE Pb9Sb10S23ClO0,5 M
PELLOUXITE (Cu,Ag)2Pb21Sb23S55OCl M
CHOVANITE Pb14,6Sb14,4S36O0,2 M
TUBULITE Ag2Pb22Sb20S53 M
MENCHETTIITE Pb5Ag2Mn3As4Sb6S24 M
JASROUXITE Ag16Pb4(Sb24As16)S72 A
XILINGOLITE Pb3Bi2S6 M
STAROCESKEITE Ag0,70Pb1,60(Bi1,35Sb1,35)S6 O
QUATRANDORITE AgPbSb3S6 M
ANDORITE IV = QUATRANDORITE Pb18Ag15Sb47S96 M
FIZELYITE Ag5Pb14Sb21S48 M
GUSTAVITE PbAgBi3S O
LILLIANITE Pb3Bi2S6 O
RAMDOHRITE Pb5,9Fe0,1Mn0,1In0,1Cd0,2Ag2,8Sb10,8S24 M
ROSHCHINITE Ag19Pb10Sb51S96 or Pb(Ag,Cu)2(Sb,As)5S10 O
TREASURITE Ag7Pb6Bi15S32 M
UCHUCCHACUAITE AgPb3MnSb5S12 M ps O
VIKINGITE Ag5Pb8Bi13S30 M
TERRYWALLACEITE AgPb(Sb,Bi)3S6 M
OYONITE Ag3Mn2Pb4Sb7As4S24 M
ESKIMOITE Ag7Pb10Bi15S36 M
HEYROVSKYITE Pb10AgBi5S18 O
ASCHAMALMITE Pb6Bi2S9 M
OURAYITE Ag3Pb4Bi5S13 O
SCHIRMERITE PbAgBi3S6 - Pb3Ag1,5Bi3,5S9 O
USTARASITE Pb(Bi,Sb)6S10 O (?)
GRATONITE Pb9As4S15 R
MARRUCCIITE Pb16Hg3Sb18S46 M ps H
VURROITE Pb10Sn(Bi,As)11S27Cl3 ps O
TAZIEFFITE Pb20Cd2(As,Bi)22S50Cl10 M
DALIRANITE PbHgAs2S5 M
SENANDORITE AgPbSb3S6 O
CHUKOTKAITE AgPb7Sb5S15 M
ERZWIESITE Ag8Pb12Bi16S40 O
ANDORITE VI = SENANDORITE PbAgSb3S6 O
ANDREADINIITE CuAg7HgPb7Sb24S48 M
OSCARKEMPFFITE Ag10Pb4(Sb17Bi9)S48 O
ARSENQUATRANDORITE Ag17,6Pb12,8Sb38,1As11,5S96 M
CLINOOSCARKEMPFFITE Ag15Pb6Sb21Bi18S72 M
Galena derivatives, with Tl
ELLISITE Tl3AsS3 R
GILLULYITE Tl2(As,Sb)8S13 M
GALENOBISMUTITE PbBi2S4 O
Sulfarsenates, Sulfantimonates
Sulfarsenates with (As,Sb)S4 tetrahedra
PETRUKITE (Cu,Fe,Zn)2(Sn,In)S4 O
ENARGITE Cu3AsS4 O
BRIARTITE Cu2(Zn,Fe)GeS4 Q
PERMINGEATITE Cu3SbSe4 Q
LUZONITE Cu3AsS4 Q
KEUTSCHITE Cu2AgAsS4 Q
FAMATINITE Cu3SbS4 Q
BARQUILLITE Cu2(Cd,Fe)GeS4 Q
ZINCOBRIARTITE Cu2(Zn,Fe)(Ge,Ga)S4 Q
FANGITE Tl3AsS4 O
Sulfarsenates with additional S
BILLINGSLEYITE Ag7AsS6 C
Unclassified Sulfosalts
Without essential Pb
DERVILLITE Ag2AsS2 M
DAOMANITE CuPtAsS2 O
VAUGHANITE TlHgSb4S7 A
CRIDDLEITE TlAg2Au3Sb10S10 M ps Q
FETTELITE Ag164HgAs4S15 R ps H
CHAMEANITE (Cu,Fe)4As(Se,S)4 C
ARCUBISITE Ag6CuBiS4 (?)
MGRIITE Cu3AsSe3 C
BENLEONARDITE Ag15Cu(Sb,As)2S7Te4 Q
TSNIGRIITE Ag9SbTe3(S,Se)3 M
BOROVSKITE Pd3SbTe4 C
JONASSONITE Au(Bi,Pb)5S4 M
FERROFETTELITE [Ag6As2S7][Ag10FeAs2S8] M
NUWAITE Ni6GeS2 Q
SPALTIITE Tl2Cu2As2S5 M
THUNDERBAYITE TlAg3Au3Sb7S6 A
RABERITE Tl5Ag4As6SbS15 A
GLADKOVSKYITE MnTlAs3S6 A
BIAGIONIITE Tl2SbS2 M
BUTIANITE Ni6SnS2 Q
AUERBAKHITE MnTl2As2S5 O
With essential Pb
MIHARAITE PbCu4FeBiS6 O
ARDAITE Pb19Sb13S35Cl7 M
SORBYITE Pb19(Sb,As)20S49 M
PLAYFAIRITE Pb16Sb18S43 M
STERRYITE Ag2Pb10(Sb,As)12S29 O
LAUNAYITE Pb22Sb26S61 M
MADOCITE Pb17(Sb,As)16S41 O
LAROSITE (Cu,Ag)21(Pb,Bi)2S13 O
PETROVICITE PbHgCu3BiSe5 O
MAZZETTIITE Ag3HgPbSbTe5 O
CRERARITE (Pt,Pb)Bi3(S,Se)4-x (x=0,7) C
QUIJARROITE Cu6HgPb2Bi4Se12 O
ZNAMENSKYITE Pb4In2Bi4S13 O
CIRIOTTIITE Cu(Cu,Ag)3Pb19(Sb,As)22(As2)S56 M
Oxysulfosalts
Oxysulfosalts of Alkalies and Alkali Earths
CETINEITE (K,Na)3-3,5(Sb2O3)(SbS3)(OH)x.2,5-3H2O (x = less than 0,5) H
OTTENSITE Na3(Sb2O3)3(SbS3).3H2O H
SARABAUITE CaSb10O10S6 M
Sulfides, etc. unclassified
WILKMANITE Ni3Se4 M
IRIDISITE (Ir,Cu,Rh,Ni,Pt)S2 C
DISULFODADSONITE Pb11Sb13S30(S2)0,5 A
ARSENOGOLDFIELDITE Cu6Cu6(As2Te2)S13 C
BAYANKHANITE Cu3-8HgS3-5 H?
POKHODYASHINITE CuTlSb2(Sb1-xTlx)AsS7-x (x between 0,2 and 0,5) A
* HALIDES
Simple halides, without H2O
M:X = 1:1, 2:3, 3:5, etc.
MIERSITE (Ag,Cu)I C
MARSHITE CuI C
NANTOKITE CuCl C
IODARGYRITE AgI H
TOCORNALITE (Ag,Hg)I (?)
CHLORARGYRITE AgCl C
BROMARGYRITE AgBr C
GRICEITE LiF C
VILLIAUMITE NaF C
HALITE NaCl C
CAROBBIITE KF C
SYLVITE KCl C
LAFOSSAITE Tl(Cl,Br) C
SALAMMONIAC NH4Cl C
NATALIYAMALIKITE TlI O
KUZMINITE Hg2(Br,Cl)2 Q
MOSCHELITE Hg+2I2 Q
CALOMEL Hg2Cl2 Q
PARASCANDOLAITE KMgF3 C
NEIGHBORITE NaMgF3 O
JAVORIEITE KFeCl3 O
CHLOROCALCITE KCaCl3 O ps C
KOLARITE PbTeCl2 O
RADHAKRISHNAITE PbTe3(Cl,S)2 Q
CHALLACOLLOITE KPb2Cl5 M
HEPHAISTOSITE (Tl,K)Pb2(Cl,Br)5 M
BRONTESITE (NH4)3PbCl5 O
M:X = 1:2
TOLBACHITE CuCl2 M
COCCINITE HgI2 Q
SELLAITE MgF2 Q
SCACCHITE MnCl2 R
CHLOROMAGNESITE MgCl2 Q
LAWRENCITE (Fe++,Ni)Cl2 R
FRANKDICKSONITE BaF2 C
STRONTIOFLUORITE (Sr,Ca)F2 C
FLUORITE CaF2 C
TVEITITE-(Y) Ca1-xYxF2+x M ps C
POLEZHAEVAITE-(Ce) NaSrCeF6 H
GAGARINITE-(Ce) NaCaCeF6 R
GAGARINITE-(Y) NaCaY(F,Cl)6 H
CALCIOARAVAIPAITE PbCa2AlF6(F,OH)3 A
COTUNNITE PbCl2 O
FLUOROCRONITE PbF2 C
M:X = 1:3
ZHARCHIKHITE AlF(OH)2 M
MOLYSITE Fe+++Cl3 H
FLUOCERITE-(Ce) (Ce,La)F3 H
FLUOCERITE-(La) (La,Ce)F3 H
GANANITE BiF3 C
WAIMIRITE-(Y) YF3 O
OSKARSSONITE AlF3 R
FLINTEITE K2ZnCl4 O
Simple halides, with H2O
M:X = 1:1 and 2:3
HYDROHALITE NaCl.2H2O M
CARNALLITE KMgCl3.6H2O O
NOVOGRABLENOVITE (NH4)MgCl3.6H2O M
CRYOBOSTRYXITE KZnCl3.2H2O M
M:X = 1:2
ERIOCHALCITE CuCl2.2H2O O
ROKUHNITE Fe++Cl2.H2O M
BISCHOFITE MgCl2.6H2O M
NICKELBISCHOFITE NiCl2.6H2O M
SINJARITE CaCl2.2H2O Q
ANTARCTICITE CaCl2.6H2O R
TACHYHYDRITE CaMg2Cl6.12H2O R
ARAVAIPAITE Pb3AlF9.H2O M
GHIARAITE CaCl2.4H2O A
M:X = 1:3
CHLORALUMINITE AlCl3.6H2O R
HYDROMOLYSITE FeCl3.6H2O  
Simple halides with H2O and additional OH
CADWALADERITE Al5(H2O)3(OH)12.n(Cl,H2O) am.
KORSHUNOVSKITE Mg2Cl(OH)3.3,5-4H2O A
NEPSKOEITE Mg4(OH)7Cl.6H2O O
KOENENITE Na4Mg9Al4Cl12(OH)22 R
Complex halides
Borofluorides
FERRUCCITE NaBF4 O
BARBERIITE (NH4)BF4 O
AVOGADRITE (K,Cs)BF4 O
Neso-aluminofluorides
CRYOLITHIONITE {Na3}[Al2](Li3)F12 C
CRYOLITE Na3AlF6 M
ELPASOLITE K2NaAlF6 C
SIMMONSITE Na2LiAlF6 M (?)
COLQUIRIITE CaLiAlF6 R
WEBERITE Na2MgAlF7 O
LEONARDSENITE MgAlF5(H2O)2 M
KARASUGITE SrCaAl(F,OH)7 M
USOVITE Ba2CaMgAl2F14 M
PACHNOLITE NaCaAlF6.H2O M
THOMSENOLITE NaCaAlF6.H2O M
CARLHINTZEITE Ca2AlF7.H2O A ps M
YAROSLAVITE Ca3Al2F10(OH)2.H2O O
SBACCHIITE Ca2AlF7 O
VERNEITE Na2Ca3Al2F14 C
Soro-aluminofluorides
GEARKSUTITE CaAlF4(OH).H2O M
ACUMINITE SrAlF4(OH).H2O M
TIKHONENKOVITE SrAlF4(OH).H2O M
ARTROEITE PbAlF3(OH)2 A
JORGENSENITE Na2(Sr,Ba)14Na2Al12F64(OH,F)4 M
JARLITE Na(Sr,Na)7MgAl6F32(OH,H2O)2 M
CALCJARLITE Na(Ca,Sr)3Al3(F,OH)16 M
Ino-aluminofluorides
ROSENBERGITE AlF3.3H2O Q
TOPSOEITE FeF3(H2O)3 Q
PROSOPITE CaAl2(F,OH)8 M
JAKOBSSONITE CaAlF5 M
Phyllo-aluminofluorides
KHODNEVITE = CHIOLITE ? Na2AlF5 (?)  
CHIOLITE Na5Al3F14 Q
Tekto-aluminofluorides
HYDROKENORALSTONITE Na0,5(Al,Mg)2(F,OH)6.H2O C
BOGVADITE Na2SrBa2Al4F20 O
Aluminofluorides with CO3, SO4, PO4
STENONITE (Sr,Ba,Na)2Al(CO3)F5 M
MENIAYLOVITE Ca4AlSi(SO4)F13.12H2O C
CHUKHROVITE-(Nd) Ca3(Nd,Y)Al2(SO4)F13.12H2O C
CHUKHROVITE-(Y) Ca3(Y,Ce)Al2(SO4)F13.10H2O C
CHUKHROVITE-(Ce) Ca3(Ce,Y)Al2(SO4)F13.10H2O C
CREEDITE Ca3Al2(SO4)(F,OH)10.2H2O M
BOGGILDITE Sr2Na2Al2(PO4)F9 M
THERMESSAITE-(NH4) (NH4)2AlF3(SO4) O
THERMESSAITE-(NH4) (NH4)2AlF3(SO4) O
THERMESSAITE K2Al(SO4)F3 O
KRUIJENITE Ca4Al4(SO4)F2(OH)16.2H2O Q
CHUKHROVITE-(Ca) Ca4,5Al2(SO4)F13.12H2O C
Silicofluorides
MALLADRITE Na2SiF6 R
BARARITE (NH4)2SiF6 H
HIERATITE K2SiF6 C
CRYPTOHALITE (NH4)2SiF6 C
DEMARTINITE K2SiF6 H
KNASIBFITE K3Na4[SiF6]3[BF4] O
HEKLAITE KNaSiF6 O
With MX6 complexes; M = Fe, Mn, Cu
RINNEITE K3NaFe++Cl6 R
SALTONSEAITE K3NaMnCl6 R
CHLORMANGANOKALITE K4MnCl6 R
KREMERSITE (NH4,K)2Fe+++Cl5.H2O O
ERYTHROSIDERITE K2Fe+++Cl5.H2O O
MITSCHERLICHITE K2CuCl4.2H2O Q
DOUGLASITE K2Fe++Cl4.2H2O M
REDIKORTSEVITE (NH4)MgCl3.6H2O O
KALITHALLITE K3Tl+++Cl6.2H2O Q
ZIRKLERITE (Fe++,Mg)9Al4Cl18(OH)12.14H2O (?) R
Halides of Bi, etc.
STEROPESITE Tl3Bi(Cl,Br)6 M
AMMINEITE Cu(NH3)2Cl2 O
Oxyhalides, hydroxyhalides and related double halides
With Cu, etc., without Pb
MELANOTHALLITE Cu2OCl2 O
KEMPITE Mn2Cl(OH)3 O
HIBBINGITE (Fe,Mg)2(OH)3Cl O
ATACAMITE Cu2Cl(OH)3 O
CLINOATACAMITE Cu++2Cl(OH)3 M
BOTALLACKITE Cu2Cl(OH)3 M
BELLOITE Cu(OH)Cl M
IYOITE MnCuCl(OH)3 M
PARATACAMITE-(Ni) Cu3(Ni,Cu)(OH)6Cl2 R
MISAKIITE Cu3Mn(OH)6Cl2 R
LEVERETTITE Cu3(Co,Cu)(OH)6Cl2 R
TONDIITE Cu3MgCl2(OH)6 R
GILLARDITE Cu3NiCl2(OH)6 R
KULIGINITE Fe3Mg(OH)6Cl2 R
HAYDEEITE Cu3MgCl2(OH)6 R
KAPELLASITE Cu3Zn(OH)6Cl2 R
PARATACAMITE Cu3(Cu,Zn)(OH)6Cl2 R
HERBERTSMITHITE Cu3Zn(OH)6Cl2 R
BARLOWITE Cu4BrF(OH)6 H
CLARINGBULLITE Cu++4FCl(OH)6 H
SIMONKOLLEITE Zn5(OH)8Cl2.H2O H
CONNELLITE Cu19Cl4(SO4)(OH)32.2H2O H
BUTTGENBACHITE Cu19Cl4(NO3)2(OH)32.2H2O H
ABHURITE Sn++21Cl16(OH)14O6 R
PONOMAREVITE K4Cu++4OCl10 M
ANTHONYITE Cu(OH,Cl)2.3H2O M
CALUMETITE CaCu4(OH)8Cl2.3,5H2O O
KHAIDARKANITE Cu4Al3(OH)14F3.2H2O M
BOBKINGITE Cu++5Cl2(OH)8.2H2O M
AVDONINITE K2Cu5(OH)4Cl8.H2O M
DRONINOITE Ni6Fe+++2(OH)16Cl2.4H2O R
DIOSKOURIITE CaCu4Cl6(OH)4.4H2O M
CHRYSOTHALLITE K6Cu6Tl+++Cl17(OH)4.H2O Q
FEODOSIYITE Cu11Mg2Cl18(OH)8.16H2O M
ROMANORLOVITE K8Cu6Cl17(OH)3 Q
BOUNAHASITE Cu+Cu++2(OH)3Cl2 M
PARAHIBBINGITE Fe++2(OH)3Cl R
PARATACAMITE-(Mg) Cu3(Mg,Cu)(OH)6Cl2 R
CENTENNIALITE CaCu3Cl2(OH)6.nH2O (n near 0.7) R
MUONIONALUSTAITE Ni3(OH)4Cl2.4H2O M
With Pb, Cu, etc.
DIABOLEITE Pb2CuCl2(OH)4 Q
PSEUDOBOLEITE Pb5Cu4Cl10(OH)8.2H2O Q
BOLEITE KPb26Ag9Cu24Cl62(OH)48 C
CUMENGEITE Pb21Cu20Cl42(OH)40.6H2O Q
BIDEAUXITE Pb++2Ag+Cl3F(OH) C
CHLOROXIPHITE Pb3CuCl2(OH)2O2 M
HEMATOPHANITE Pb4Fe+++3O8(OH,Cl) Q
JANCHEVITE Pb7V+++++(O8,5[]0,5)Cl2 Q
PARKINSONITE (Pb,Mo)O8Cl2 Q
ASISITE Pb9(SiO4)O6Cl2 Q
EDDAVIDITE Pb2Cu12O15Br2 C
MURDOCHITE PbCu++6O8-x(Cl,Br)2x (x smaller or = 0,5) C
YEDLINITE Pb6CrCl6(O,OH)8 R
SIIDRAITE Pb2Cu(OH)2I3 O
RICKTURNERITE Pb7O4[Mg(OH)4](OH)Cl3 O
With Pb (As,Sb,Bi), without Cu
PARALAURIONITE PbCl(OH) M
LAURIONITE PbCl(OH) O
RUSSOITE (NH4)ClAs2O3(H2O)0,5 H
MAURIZIODINIITE (NH4)(As2O3)2I H
FIEDLERITE Pb3Cl4F(OH).H2O M
TELLUROPERITE Pb3(Te++++O4)Cl2 O
PENFIELDITE Pb2Cl3(OH) H
LAURELITE Pb7F12Cl2 H
MATLOCKITE PbFCl Q
ZHANGPEISHANITE BaFCl Q
RORISITE (Ca,Mg)FCl Q
BISMOCLITE BiOCl Q
ZAVARITSKITE BiOF Q
PERITE PbBiO2Cl O
NADORITE PbSbO2Cl O
THORIKOSITE Pb3(Sb+++,As+++)O3(OH)Cl2 Q
MEREHEADITE Pb47(BO3)2(CO3)O24(OH)13Cl25 M
BLIXITE Pb2Cl(O,OH)2 M
RUMSEYITE [Pb2OF]Cl Q ps C
VLADKRIVOVICHEVITE [Pb32O18][Pb4Mn2O]Cl14(BO3)8.2H2O O
PINALITE Pb3WO5Cl2 O
YEOMANITE Pb2O(OH)Cl O
SYMESITE Pb10(SO4)O7Cl4.H2O A ps Q
LORETTOITE Pb7O6Cl2 Q
SARAWAKITE Sb, O, Cl (?)  
ECDEMITE Pb6As+++2O7Cl4 Q
MENDIPITE Pb3Cl2O2 O
DAMARAITE Pb3O2(OH)Cl O
ONORATOITE Sb8O11Cl2 M
PSEUDOCOTUNNITE K2PbCl4 O (?)
BARSTOWITE 3PbCl2.PbCO3.H2O or Pb4Cl6CO3.H2O M
CUATROCAPAITE-(K) K3(NaMg[])(As2O3)6Cl6.16H2O R
CUATROCAPAITE-(NH4) (NH4)3(NaMg[])(As2O3)6Cl6.16H2O R
GAJARDOITE KCa0,5As+++4O6Cl2.5H2O H / A
TORRECILLASITE Na(As,Sb)+++4O6Cl O
LUCABINDIITE (K,NH4)As4O6(Cl,Br) H
With Hg
EGLESTONITE (Hg++2)3OCl3(OH) C
KADYRELITE Hg4(Br,Cl)2O C
POYARKOVITE Hg3ClO M
HANAWALTITE Hg+6Hg++(Cl,OH)2O3 O
TERLINGUAITE Hg+Hg++ClO M
PINCHITE Hg++5O4Cl2 O
MOSESITE Hg2N(Cl,SO4,MoO4,CO3).H2O C
GIANELLAITE Hg4(SO4)N2 C
KLEINITE Hg2N(Cl,SO4).nH2O H
TEDHADLEYITE Hg+10Hg++I2(Cl,Br)2O4 A
VASILYEVITE Hg++2I3Br2Cl(CO3)O6 A
AURIVILLIUSITE Hg+2Hg++2I2O2 O
TERLINGUACREEKITE Hg++3O2Cl2 O
KELYANITE [Hg2]6(SbO)6BrCl2 R
COMANCHEITE Hg++55N---24(NH2,OH)4(Cl,Br)34 O
MIKECOXITE [CHg4]OCl2 M
GAILDUNNINGITE Hg++3[NHg++2]18(Cl,I,OH,Br,S)24 O
With Rare-Earth Elements
HALENIUSITE-(La) (La,Ce)OF C
HALENIUSITE-(Ce) CeOF C
Oxides unclassified    
Halogenides, etc. unclassified
URANOCLITE (UO2)2(OH)2Cl2(H2O)4 M
CABVINITE Th2F7(OH).3H2O Q
MELLIZINKALITE K3Zn2Cl7 A
FLUORNATROCOULSELLITE (Na,Ca)2(Mg,Al)2F6F R ps C
PANICHIITE (NH4)2Sn++++Cl6 C
SANGUITE KCuCl3 M
ERMAKOVITE (NH4)(As2O3)2Br H
* OXIDES, hydroxides, V[5,6] vanadates, arsenites, antimonites, bismuthites, sulfites, selenites, tellurites, iodates
Metal: Oxygen = 2:1 and 1:1
Cation:Anion (M:O) = 2:1 (and 1.8:1)
ICE H2O H
CUPRITE Cu2O C
CUBOICE H2O C
ICE-VII, ICE VII = CUBOICE, CUBO-ICE H2O C
ICE VII = CUBOICE H2O C
PARAMELACONITE Cu+2Cu++2O3 Q
M:O = 1:1 (and up to 1:1.25); with small to medium-sized cations only
CREDNERITE CuMnO2 M
TENORITE CuO M
DELAFOSSITE Cu+Fe+++O2 R
MCCONNELLITE CuCrO2 R
ZINCITE (Zn,Mn)O H
BROMELLITE BeO H
LIME CaO C
WUSTITE Fe++O C
PERICLASE MgO C
MANGANOSITE Mn++O C
BUNSENITE NiO C
MONTEPONITE CdO C
PALLADINITE (Pd,Cu)O Q
HONGQUIITE TiO  
CARBONMONOXIDEICE CO am. ?
M:O = 1:1 (and up to 1:1.25); with large cations (+- smaller ones)
SWEDENBORGITE NaBe4SbO7 H
BROWNMILLERITE Ca2(Al,Fe+++)2O5 O
SREBRODOLSKITE Ca2Fe+++2O5 O
SHULAMITITE Ca3Fe+++AlTi++++O8 O
SHARYGINITE Ca3TiFe2O8 O
MONTROYDITE HgO O
LITHARGE PbO Q
ROMARCHITE SnO Q
MASSICOT PbO O
NATALIAKULIKITE Ca4Ti2(Fe+++,Fe++)(Si,Fe+++,Al)O11 O
Metal: Oxygen = 3:4 and similar
With small and medium-sized cations
CHRYSOBERYL BeAl2O4 O
MARIINSKITE Be(Cr+++,Al)2O4 O
CHIHMINGITE NiAl2O4 C
With only medium-sized cations
ZINCOCHROMITE ZnCr2O4 C
MANGANOCHROMITE (Mn++,Fe++)(Cr+++,V+++)2O4 C
NICHROMITE (Ni,Co,Fe++)(Cr+++,Fe+++,Al)2O4 C
QANDILITE (Mg,Fe++)2(Ti,Fe+++,Al)O4 C
SPINEL MgAl2O4 C
TREVORITE NiFe+++2O4 C
VUORELAINENITE (Mn++,Fe++)(V+++,Cr+++)2O4 C
DELTALUMITE (Al0,67[]0,33)Al2O4 Q
GUITE Co++Co+++2O4 Co++Co+++2O4 C
JACOBSITE (Mn++,Fe++,Mg)(Fe+++,Mn+++)2O4 C
MAGNETITE Fe++Fe+++2O4 C
ULVOSPINEL Fe++2Ti++++O4 C
CUPROSPINEL (Cu++,Mg)Fe+++2O4 C
CHROMITE Fe++Cr2O4 C
MAGNESIOFERRITE MgFe+++2O4 C
MAGNESIOCOULSONITE MgV2O4 C
COCHROMITE (Co,Ni,Fe++)(Cr,Al)2O4 C
COULSONITE Fe++V+++2O4 C
FILIPSTADITE (Mn,Mg)2Sb+++++Fe+++O8 O
FRANKLINITE (Zn,Mn++,Fe++)(Fe+++,Mn+++)2O4 C
GAHNITE ZnAl2O4 C
GALAXITE (Mn++,Fe++,Mg)(Al,Fe+++)2O4 C
HERCYNITE Fe++Al2O4 C
MAGNESIOCHROMITE MgCr2O4 C
WERNERKRAUSEITE Ca(Fe+++,Mn+++)2Mn++++O6 O
HARMUNITE CaFe+++2O4 O
JACOBSITE-Q Mn++(Fe+++,Mn+++)2O4 Q
HETAEROLITE ZnMn+++2O4 Q
MANGANOSTIBITE (Mn++,Fe++)7(SbO4)(AsO4,SiO4)O4 O
HAUSMANNITE Mn++Mn+++2O4 Q
MAGHEMITE (Fe+++0,67[]0,33)Fe+++2O4 C
TITANOMAGHEMITE (Ti0,5[]0,5)Fe+++2O4 C
TEGENGRENITE (Mg,Mn++)2Sb+++++0,5(Mn+++,Si,Ti)0,5O4 R ps C
XIEITE FeCr2O4 O
CARMELTAZITE ZrAl2Ti4O11 O
FEIITE Fe++2(Fe++Ti++++)O5 O
MAOHOKITE MgFe2O4 O
TSCHAUNERITE (Fe++)(Fe++Ti++++)O4 O
GARPENBERGITE Mn6[]As+++++Sb+++++O10(OH)2 O
MAGNELIITE Ti+++2Ti++++2O7 A
ELGORESYITE (Mg5Si2)O9 M
DELLAGIUSTAITE V++Al2O4 C
CHENMINGITE FeCr2O4 O
THERMAEROGENITE CuAl2O4 C
CHUKOCHENITE (Li0,5Al0,5)Al2O4 O
With medium-sized and large cations
MAROKITE CaMn+++2O4 O
DMITRYIVANOVITE CaAl2O4 M
WARKITE Ca2Sc6Al6O20 A
KUDRYAVTSEVAITE Na3MgFe+++Ti4O12 O
TULULITE Ca14(Fe+++,Al)(Al,Zn,Fe+++,Si,P,Mn,Mg)15O36 C
VALLEYITE Ca4Fe6O13 C
KROTITE CaAl2O4 M
IGELSTROMITE Fe+++(SbPb)O4 Q
ELLINAITE CaCr2O4 O
ADDIBISCHOFFITE Ca2Al6Al6O20 A
With only large cations
MINIUM Pb++2Pb++++O4 Q
Metal: Oxygen = 2: 3,3: 5, and similar
With small cations
VERBIERITE BeCr+++2TiO6 O
BYRUDITE (Be,[])(V3+++,Ti++++,Cr)3O6 O
With medium-sized cations
PYROPHANITE MnTiO3 R
MELANOSTIBITE Mn(Sb+++++,Fe+++)O3 R
ECANDREWSITE (Zn,Fe++,Mn++)TiO3 R
TISTARITE Ti2O3 R
ESKOLAITE Cr2O3 R
ILMENITE Fe++TiO3 R
AKIMOTOITE (Mg,Fe++)(SiO3) R
AUROANTIMONATE AuSbO3  
BRIZZIITE NaSb+++++O3 R
HEMATITE alpha-Fe2O3 R
CORUNDUM Al2O3 R
GEIKIELITE MgTiO3 R
KARELIANITE V2O3 R
HEMLEYITE FeSiO3 A
BIXBYITE-(Fe) (Fe+++,Mn+++)2O3 C
BIXBYITE    
AVICENNITE Tl2O3 C
BIXBYITE-(Mn) (Mn+++,Fe+++)2O3 C
FERROPSEUDOBROOKITE Fe++Ti2O5 O
ARMALCOLITE (Mg,Fe++)Ti2O5 O
PSEUDOBROOKITE (Fe+++,Fe++)2(Fe++,Ti)O5 O
MAGNESIOHOGBOMITE-6N12S Mg5Al11TiO23(OH) R
MAGNESIOHOGBOMITE-6N6S Ti(Mg,Fe)2Al8O15(OH) R
ZINCOVELESITE-6N6S Zn3(Fe+++,Mn+++,Al,Ti)8O15(OH) R
FERROHOGBOMITE-2N2S (Fe++,Zn,Mg)3(Al,Fe+++,Ti++++)8O15(OH) H
FERROHOGBOMITE-6N12S [(Fe++,Mg,Zn)5(Al,Ti,Fe+++)12O23(OH)]6 R
MAGNESIOHOGBOMITE-2N3S Ti(Mg,Fe)3Al10O19(OH) R
ZINCOHOGBOMITE-2N2S (Zn,Fe,Ti,Al)22(O,OH)32 H
ZINCOHOGBOMITE-2N6S Ti(Zn,Mg,Fe)6Al16O31(OH) H
MAGNESIOHOGBOMITE-2N4S [(Mg8,43Fe++1,57)Al22Ti++++2O46(OH)2] R
MAGNESIOBELTRANDOITE-2N3S Mg8Al18Fe+++2O38(OH)2 R
MAGNESIOHOGBOMITE-2N2S Ti(Mg,Fe)2Al8O15(OH) H
KLEBERITE Fe+++Ti++++6O11(OH)5 M ps H
PSEUDORUTILE Fe+++2Ti3O9 H
BERDESINSKIITE V+++2TiO5 M
OXYVANITE (V+++,Cr+++)2(V++++,Ti++++)O5 M
KAITIANITE Ti+++2Ti++++O5 M
MACHIITE Al2Ti3O9 M
OLKHONSKITE (Cr+++,V+++)2Ti3O9 M (?)
SCHREYERITE V+++2Ti3O9 M
VESTAITE (Ti++++Fe++)Ti++++3O9 M
RINMANITE (Zn,Mn++)2Sb+++++2Mg2Fe+++4O14(OH)2 H
ISEITE Mn2Mo3O8 H
KAMIOKITE Fe2Mo3O8 H
MAJINDEITE Mg2Mo3O8 H
NOLANITE (V+++,Fe++,Fe+++,Ti)10O14(OH)2 H
CLAUDETITE As2O3 M
STIBIOCLAUDETITE AsSbO3 M
ARSENOLITE As2O3 C
SENARMONTITE Sb2O3 C
VALENTINITE Sb2O3 O
BISMITE Bi2O3 M
SPHAEROBISMOITE Bi2O3 Q
SILLENITE Bi+++12(SiO4)O16 C
KYZYLKUMITE V+++2Ti2O5(OH) M
TIETAIYANGITE Fe+++4Fe++TiO9 H
LIUITE FeTiO3 O
LUOGUFENGITE epsilon-Fe2O3 O
WANGDAODEITE FeTiO3 R
SASSITE Ti+++2Ti++++O5  
GRIFFINITE Al2TiO5 O
With large and medium-sized cations
CHROMBISMITE Bi+++16(CrO4)O23 Q
FLUORMAYENITE Ca12Al14O32F2 C
FLUORKYUYGENITE Ca12Al14O32[(H2O)4F2] C
FREUDENBERGITE Na2(Ti,Fe)8O16 M ps H
GROSSITE CaAl4O7 M
GOLDSCHMIDTITE KNbO3 C
MIANNINGITE ([],Pb,Ce,Na)(U++++,Mn,U++++++)Fe+++2(Ti,Fe+++)18O38 R
PASEROITE PbMn++(Fe+++,[])2(V+++++,Ti,[])18O38 R
CHLORMAYENITE Ca12Al14O32Cl2 C
GORERITE Ca[AlFe+++11]O19 H
KAHLENBERGITE KAl11O17 H
YAFSOANITE {Ca3}[Te++++++2](Zn3)O12 C
NIXONITE Na2Ti6O13 M
LATRAPPITE Ca2NbFe+++O6 O
PEROVSKITE CaTiO3 O ps C
BARIOPEROVSKITE BaTiO3 O
LAKARGIITE Ca(Zr,Ti,Sn)O3 O ps C
MEGAWITE Ca(Sn,Zr)O3 O ps C
NATRONIOBITE NaNbO3 M
LUESHITE NaNbO3 M ps C
MONTENEVEITE Ca3Sb+++++2(Fe+++2Fe++)O12 C
DZHULUITE {Ca3}[Sb+++++Sn++++](Fe+++3)O12 C
USTURITE {Ca3}[Sb+++++Zr](Fe+++3)O12 C
ELBRUSITE {Ca3}[U+++++0,5Zr1,5](Fe+++3)O12 C
PANGUITE (Ti++++,Sc,Al,Mg,Zr,Ca)1,8O3 O
ISOLUESHITE (Na,La,Ca)(Nb,Ti)O3 C
TAUSONITE SrTiO3 C
MACEDONITE PbTiO3 Q
LOPARITE-(Ce) (Na,Ce,Ca)(Ti,Nb)O3 Q/O ps Q
PAULOABIBITE NaNbO3 R
DAVIDITE-(Y) (Y,Ce,La)2Fe+++2(Ti,Fe+++)18O38 (?) R
GRAMACCIOLIITE-(Y) (Pb,Sr)(Y,Mn)(Ti,Fe+++)18Fe+++2O38 R ps H
DAVIDITE-(La) (La,Ce)(Y,U,Fe++)(Ti,Fe+++)20(O,OH)38 R
LOVERINGITE (Ca,Ce)(Ti,Fe+++,Cr,Mg)21O38 R
DESSAUITE-(Y) (Sr,Pb)(Y,U)(Ti,Fe+++)20O38 R ps H
MATHIASITE (K,Ca,Sr)(Ti,Cr,Fe,Mg)21O38 R
SENAITE Pb(Ti,Fe,Mn)21O38 R
LINDSLEYITE (Ba,Sr)(Ti,Cr,Fe,Mg,Zr)21O38 R
CRICHTONITE (Sr,La,Ce,Y)(Ti,Fe+++,Mn)21O38 R
CLEUSONITE (Pb,Sr)(U++++,U++++++)(Fe+++,Zn)2(Ti,Fe++,Fe+++)18(O,OH)38 R
LANDAUITE NaMn++Zn2(Ti,Fe+++)6Ti12O38 M ps R
DAVIDITE-(Ce) (Ce,La)(Y,U,Fe++)(Ti,Fe+++)20(O,OH)38 R
CHIHUAHUAITE Fe++[Al12]O19 H
DIAOYUDAOITE NaAl11O17 H
BATIFERRITE Ba[Ti2Fe+++8Fe++2]O19 H
HAWTHORNEITE Ba[Ti3Cr4Fe+++2Fe++2Mg]O19 H
NEZILOVITE Pb[Mn++++2e7AlZn2]O19 H
HAGGERTYITE Ba[Ti5Fe+++2Fe++4Mg]O19 H
MAGNETOPLUMBITE Pb[Fe12]O19 H
BARIOFERRITE Ba[Fe12]O19 H
KANGITE (Sc,Ti,Al,Zr,Mg,Ca,[])2O3 C
HIBONITE Ca[Al12]O19 H
LINDQVISTITE Pb2(Mn++,Mg)Fe+++16O27 H
PLUMBOFERRITE Pb[Fe10,67Mn++0,33Pb]O18,33 H
YIMENGITE K[Ti3Cr5Fe+++2Mg++2]O19 H
JEPPEITE (K,Ba)2(Ti,Fe+++)6O13 M
ZENZENITE Pb3(Fe+++,Mn+++)4Mn++++3O15 H
MENGXIANMINITE (Ca,Na)2Sn2(Mg,Fe)3Al8[(BO3)(BeO4)O6]2 O
XUITE Ca3Fe2[(AlO3(OH)]3 C
PRISCILLAGREWITE-(Y) (Ca2Y)Zr2(AlO4)3 C
MIZRAITE-(Ce) Ce(Al11Mg)O19 H
SHAGAMITE KFe11O17 H
HEAMANITE-(Ce) (K0,5Ce0,5)TiO3 C
MIRNYITE SrZr++++(Ti++++12Cr+++6)Mg2O38 A
ANZAITE-(Ce) Ce4Fe++Ti6O18(OH)2 M
HAITAITE-(La) LaU++++Fe+++2(Ti13Fe++4Fe+++)O38 R
BITIKLEITE {Ca3}[Sb+++++Sn++++](Al3)O12 C
SARANOVSKITE-(Y) SrCaFe++2(Cr4Ti2)Ti12O38 R
BOTUOBINSKITE SrFe++(Ti++++12Cr+++6)Mg2[O36(OH)2] A
CHLORKYUYGENITE Ca12Al14O32[(H2O)4Cl2] C
YTTRIAITE-(Y) Y2O3 C
ALLENDEITE Sc4Zr3O12 R
DAVEMAOITE CaSiO3 C
Metal: Oxygen = 1:2 and similar
With small cations: Silica family
QUARTZ BLEU = QUARTZ SiO2 R
QUARTZ ENFUME = SMOKY QUARTZ = Brown QUARTZ SiO2 R
QUARTZ HEMATOIDE = FERRUGINOUS QUARTZ SiO2 R
QUARTZ ROSE = QUARTZ SiO2 R
QUARTZ ROUGE = QUARTZ HEMATOIDE = QUARTZ SiO2 R
QUARTZ SiO2 R
TRIDYMITE SiO2 M ps H
OPAL SiO2.nH2O am.
CRISTOBALITE SiO2 Q
MOGANITE SiO2.nH2O M
MELANOPHLOGITE SiO2 C/Q
LECHATELIERITE SiO2 Am.
COESITE SiO2 M
STISHOVITE SiO2 Q
KEATITE SiO2  
SEIFERTITE SiO2 O
QUARTZ-beta SiO2  
CARBONDIOXIDEICE CO2  
CHIBAITE SiO2.0,15(CH4,C2H6,C3H8) C
BOSOITE SiO2.nCxH2x+2 H
With medium-sized cations; chains of edge-sharing octahedra
ARGUTITE GeO2 Q
CASSITERITE SnO2 Q
PLATTNERITE PbO2 Q
PYROLUSITE Mn++++O2 Q
RUTILE TiO2 Q
TRIPUHYITE Fe+++(Sb+++++,Sn,W++++++,Ti++++)O4 Q
TUGARINOVITE MoO2 M
VARLAMOFFITE Sn2Fe+++O5(OH) C
TREDOUXITE NiSb2O6 Q
TAPIOLITE-(Mn) (Mn++,Fe++)(Ta,Nb)2O6 Q
TAPIOLITE-(Fe) (Fe++,Mn++)(Ta,Nb)2O6 Q
ORDONEZITE ZnSb+++++2O6 Q
BYSTROMITE MgSb+++++2O6 Q
RAMSDELLITE MnO2 O
PARAMONTROSEITE VO2 O
AKHTENSKITE epsilon-Mn++++O2 H
NSUTITE (Mn++++,Mn++)(O,OH)2 H
SCRUTINYITE alpha-PbO2 O
IXIOLITE-(M++) (Ta0,66Mn++0,33)O2 M
IXIOLITE-(Fe++) (Ta0,66Fe++0,33)O2 M
YTTROCOLUMBITE-(Y) (Y,U,Fe++)(Nb,Ta)O4 O
ISHIKAWAITE (U,Y,Fe+++,Fe++)(Nb,Ti)O4 O
CALCIOSAMARSKITE (Ca,Fe+++,U,Y)NbO4 M
IXIOLITE = IXIOLITE-(Mn++) or IXIOLITE-(Fe++) (Ta,Nb,Sn,Fe,Mn)4O8 M
SAMARSKITE-(Y) (Y,Ce,U,Fe+++)3(Nb,Ta,Ti)5O16 M
SAMARSKITE-(Yb) (Yb,Y,U,Th,Ca,Fe)(Nb,Ta)O4 M ps O
SRILANKITE TiO2 O
KRASNOSELSKITE CoWO4 M
SANMARTINITE (Zn,Fe++)WO4 M
ROSSOVSKYITE (Fe+++,Ta)(Nb,Ti)O4 M
HUBNERITE Mn++WO4 M
HUANZALAITE (Mg,Fe++)WO4 M
FERBERITE Fe++WO4 M
HEFTETJERNITE (Sc,Sn++++,Mn++)(Ta,Nb)O4 M
COLUMBITE-(Mn) (Mn,Fe++)(Nb,Ta)2O6 O
TANTALITE-(Mg) (Mg,Fe++)(Ta,Nb)2O6 O
COLUMBITE-(Mg) (Mg,Fe++,Mn)(Nb,Ta)2O6 O
TANTALITE-(Mn) Mn++Ta2O6 O
TANTALITE-(Fe) Fe++Ta2O6 O
COLUMBITE-(Fe) Fe++Nb2O6 O
QITIANLINGITE (Fe++,Mn)2(Nb,Ta)2W++++++O10 O
LITHIOWODGINITE (Li,Mn,Fe)(Ta,Nb,Sn)3O8 M
WOLFRAMOWODGINITE Mn(Mn,Sn,Fe,Ta)(W,Ta,Nb)2O8 M
TITANOWODGINITE (Mn++,Fe++)(Ti,Sn,Ta,Sc)(Ta,Nb)2O8 M
LITHIOTANTITE Li(Ta,Nb)3O8 M
FERROWODGINITE (Fe++,Mn++)(Sn,Ti,Fe+++,Ta)(Ta,Nb)2O8 M
FERROTITANOWODGINITE (Fe++,Mn++)(Ti,Sn++++,Ta,Fe+++)(Ta,Nb)2O8 M
TANTALOWODGINITE (Mn++,Li)(Ta,Sn)(Ta,Nb)2O8 M
WODGINITE (Ta,Nb,Sn,Mn,Fe)16O32 M
TIVANITE V+++TiO3(OH) M
CARMICHAELITE (Ti,Cr,Fe)(O,OH)2 M
ALUMOTANTITE AlTaO4 O
BIEHLITE (Sb+++,As+++)2(MoO6) M
NIOBOHEFTETJERNITE ScNbO4 M
SHAKHDARAITE-(Y) ScYNb2O8 M
With medium-sized cations; sheets of edge-sharing octahedra
BAHIANITE Al5Sb+++++3O14(OH)2 M
SIMPSONITE Al4(Ta,Nb)3(O,OH,F)14 R
With medium-sized cations; frameworks of edge-sharing octahedra
ANATASE TiO2 Q
BROOKITE TiO2 O
With medium-sized cations; * With various polyhedra
DOWNEYITE SeO2 Q
KORAGOITE (Mn++,Mn+++,Fe++)3(Nb,Ta,Ti)3(Nb,Mn)2(W,Ta)2O20 M
RUSSELLITE Bi2WO6 Q
KOECHLINITE Bi2MoO6 O
TUNGSTIBITE Sb2O3.WO3 O
TELLURITE TeO2 O
PARATELLURITE TeO2 Q
BISMUTOCOLUMBITE Bi(Nb,Ta)O4 Q
STIBIOTANTALITE SbTaO4 O
STIBIOCOLUMBITE SbNbO4 O
CLINOCERVANTITE beta-Sb+++Sb+++++O4 M
BISMUTOTANTALITE Bi(Ta,Nb)O4 O
CERVANTITE Sb+++Sb+++++O4 O
BADDELEYITE ZrO2 M
BILLWISEITE Sb+++5(Nb,Ta)3WO18 M
KYAWTHUITE Bi+++Sb+++++O4 M
PERTOLDITE GeO2 R
ZIROITE ZrO2 Q
With large (+- medium-sized) cations; dimers and trimers of edgesharing octahedra
AESCHYNITE-(Y) (Y,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 O
AESCHYNITE-(Ce) (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 O
AESCHYNITE-(Nd) (Nd,Ce,Ca)(Ti,Nb)2(O,OH)6 O
NIOBOAESCHYNITE-(Nd) (Nd,Ce)(Nb,Ti)2(O,OH)6 O
RYNERSONITE Ca(Ta,Nb)2O6 O
TANTALAESCHYNITE-(Y) (Y,Ce,Ca)(Ta,Ti,Nb)2O6 O
VIGEZZITE (Ca,Ce)(Nb,Ta,Ti)2O6 O
NIOBOAESCHYNITE-(Ce) (Ce,Ca,Th)(Nb,Ti)2(O,OH)6 O
NIOBOAESCHYNITE-(Y) (Y,Ce,Nd)0,5(Ca,Th)0,5(Nb,Ti)2(O,OH)6 O
CHANGBAIITE PbNb2O6 R
MURATAITE-(Y) (Y,Na)6(Zn,Fe+++)5Ti12O29(O,F)10F4 C
With large (+- medium-sized) cations; chains of edge-sharing octahedra
EUXENITE-(Y) Y(NbTi)O6 O
YTTROCRASITE-(Y) (Y,Th,Ca,U)(Ti,Fe+++)2(O,OH)6 O
URANOPOLYCRASE UTi2O6 O
TANTEUXENITE-(Y) Y(TaTi)O6 O
POLYCRASE-(Y) = EUXENITE-(Y) (Y,Ca,Ce,U,Th)(Ti,Nb,Ta)2O6 O
LORANSKITE-(Y) (Y,Ce,Ca)ZrTaO6 (?) O (?)
FERSMITE CaNb2O6 O
KOBEITE-(Y) (Y,U)(Ti,Nb)2(O,OH)6 (?) am.
CLINOFERGUSONITE-(Ce) (Ce,La,Nd)NbO4 M
CLINOFERGUSONITE-(Y) YNbO4 M
CLINOFERGUSONITE-(Nd) (Nd,Ce)NbO4 M
YTTROTANTALITE-(Y) (Y,U,Fe++)(Ta,Nb)(O,OH)4 O
FOORDITE Sn++(Nb,Ta)2O6 M
THOREAULITE Sn++Ta2O6 M
RASPITE PbWO4 M
With large (+- medium-sized) cations; sheets of edge-sharing octahedra
BRANNERITE (U,Ca,Y,Ce)(Ti,Fe)2O6 M
ORTHOBRANNERITE U++++U++++++Ti4O12(OH)2 O
THORUTITE (Th,U,Ca)Ti2(O,OH)6 M
LUCASITE-(Ce) (Ce,La)Ti2(O,OH)6 M
KASSITE CaTi2O4(OH)2 O
STIBIOMICROLITE = OXYSTIBIOMICROLITE    
HYDROPLUMBOELSMOREITE (Pb[])(W1,33,Fe+++0,67)2O6(H2O) C
BISMUTOMICROLITE   C
STRONTIOPYROCHLORE = FLUORSTRONTIOPYROCHLORE or FLUORKENOPYROCHLORE Sr2Nb2(O,OH)7 (?) C
OXYBISMUTOMICROLITE (Bi1,33[]0,67)S2Ta2O6O C
HYDROKENOPYROCHLORE ([],x)2Nb2O6(H2O,Cs) C
HYDROKENOMICROLITE ([],H2O)2Ta2(O,OH6)(H2O) C
FLUORCALCIOMICROLITE (Ca,Na,[])2Ta2O6F C
HYDROKENOELSMOREITE []2W2O6(H2O) C
FLUORCALCIOPYROCHLORE (Ca,Na)2(Nb,Ti)2O6F C
FLUORHYDROPYROCHLORE ? C
FLUORNATROMICROLITE (Na,Ca,Bi)2Ta2O6F C
FLUORKENOPYROCHLORE ([],Na,Ce,Ca)2(Nb,Ti)2O6F C
HYDROMICROLITE (H2O,[])2Ta2(O,OH)6(H2O) C
HYDROXYCALCIOMICROLITE Ca1,5Ta2O6(OH) C
FLUORSTRONTIOPYROCHLORE (Sr,[])2Nb2(O,OH)6F C
HYDROXYCALCIOPYROCHLORE (Ca,Na,U,[])2(Nb,Ti)2O6(OH) C
FLUORPLUMBOPYROCHLORE (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F C
HYDROXYKENOMICROLITE ([],Na,Sb+++)2Ta2O6(OH) C
HYDROPYROCHLORE (H2O,[])2Nb2(O,OH)6(H2O) C
OXYCALCIOMICROLITE Ca2Ta2O6O C
OXYURANOBETAFITE (U,Ca,[])2(Ti,Nb)2O6O C
OXYSTIBIOMICROLITE (Sb+++,Ca)2Ta2O6O C
OXYPLUMBOPYROCHLORE Pb2Nb2O6O C
OXYNATROPYROCHLORE (Na,Ca,U)2Nb2O6(O,OH) C
OXYNATROMICROLITE (Na,Ca,U)2(Ta,Nb)2O6(O,F) C
OXYYTTROPYROCHLORE-(Y) (Y,[])2Nb2O6O C
OXYCALCIOPYROCHLORE Ca2Nb2O6O C
OXYSTANNOMICROLITE Sn2Ta2O6O C
OXYCALCIOBETAFITE Ca2(Ti,Nb)2O6O C
KENOPLUMBOPYROCHLORE (Pb,[])2Nb2O6([],O) C
KENOPLUMBOMICROLITE (Pb,[])2Ta2O6([],O,OH) C
HYDROXYPLUMBOPYROCHLORE (Pb1,5[]0,5)Nb2O6(OH) C
HYDROXYNATROPYROCHLORE (Na,?a,Ce)2Nb2O6(OH) C
HYDROXYNATROMICROLITE (Na,Bi+++,[])2Ta2O6(OH) C
HYDROXYMANGANOPYROCHLORE (Mn,Th,Na,Ca,REE)2(Nb,Ti)2O6(OH) C
HYDROXYKENOPYROCHLORE ([],Ce,Ba)2(Nb,Ti)2O6(OH,F) C
HYDROXYKENOELSMOREITE ([],Pb)2(W,Fe+++,Al)2(O,OH)6(OH) ([],Pb)2(W,Fe+++,Al)2(O,OH)6(OH) R
MONIMOLITE Pb2Sb+++++2O7 C
OXYCALCIOROMEITE (Ca,Fe++,Sb+++,Na)2Sb+++++2O7 C
STIBICONITE Sb+++Sb+++++2O6(OH) C
STETEFELDTITE Ag2Sb2(O,OH)7 C
FLUORCALCIOROMEITE (Ca,Na)2Sb+++++2(O,OH)6F C
HYDROXYFERROROMEITE Fe++1,5[]0,5)Sb+++++2O6(OH) C
HYDROXYCALCIOROMEITE (Ca,Sb+++)2(Sb+++++,Ti)2O6(OH) C
CUPROROMEITE Cu++2Sb2(O,OH)7 C (?)
ROSIAITE PbSb+++++2O6 R
ZIRCONOLITE-3T CaZrTi2O7 A
ZIRCONOLITE-3O CaZrTi2O7 O
TAZZOLIITE Ba2CaSr0.5Na0.5Ti2Nb3SiO17[PO2(OH)2]0.5 O
NOGGERATHITE-(Ce) (Ce,Ca)2Zr2(Nb,Ti)(Ti,Nb)2Fe++O14 O
STEFANWEISSITE (Ca,REE)2Zr2(Nb,Ti)(Ti,Nb)2Fe++O14 O
LAACHITE (Ca,Mn)2Zr2Nb2TiFeO14 M
ZIRCONOLITE-2M CaZrTi2O7 M
PETSCHECKITE U++++Fe++(Nb,Ta)2O8 H
LIANDRATITE U++++++(Nb,Ta)2O8 H
INGERSONITE Ca3Mn++Sb+++++4O14 H
PITTONGITE Na2(W,Fe+++)9(O,OH)27.4H2O H
OXYYTTROBETAFITE-(Y) Y2Ti2O6O C
ROMEITE    
ROMEITE = FLUORNATROROMEITE or FLUORCALCIOROMEITE or OXYCALCIOROMEITE (Ca,Fe++,Mn++,Na)2(Sb+++++,Ti++++)2O6(O,OH,F) C
BISMUTOROMEITE ? C
CESIOKENOPYROCHLORE []Nb2(O,OH)6Cs1-x (x about 0,20) C
FLUORNATROPYROCHLORE (Na,Pb,Ca,REE,U)2Nb2O6F C
PLUMBOROMEITE ? ?
FLUORNATROROMEITE (Na,Ca)2Sb2(O,OH)6F C
PLUMBOELSMOREITE ? ?
SCHETELIGITE (Ca,Y,Sb,Mn)2(Ti,Ta,Nb,W)2O6(O,OH) O (?)
OXYPLUMBOBETAFITE Pb2(Ti,Nb)2O6O C
YTTROMICROLITE (Ca,Y+++,U,Na)2-x(Ta,Nb,Ti,Fe+++)2O7 C
HYDROXYCALCIOBETAFITE (Ca,Na,U)2(Ti,Nb,Ta)2O6(OH) C
OXYPLUMBOROMEITE (Pb,Ca)2Sb+++++2O7 C
ARGENTOROMEITE Ag2Sb2(O,OH)7 C
STIBIOROMEITE Sb+++Sb+++++2O6(OH) C
OXYKENOMICROLITE   C
With large (+- medium-sized) cations; polyhedral frameworks
NATROTANTITE Na2Ta4O11 M
IRTYSHITE Na2(Ta,Nb)4O11 H
CALCIOTANTITE CaTa4O11 H
With large (+- medium-sized) cations; tunnel structures
AKAGANEITE beta-Fe+++(O,OH,Cl) M ps Q
CORONADITE Pb(Mn++++,Mn++)8O16 M ps Q
CRYPTOMELANE K(Mn++++,Mn++)8O16 M ps Q
HOLLANDITE BaMn++++6Mn++2O16 M
STRONTIOMELANE (Sr,K,Ba)Mn++++6Mn++2O16 M
MANJIROITE (Na,K)(Mn++++,Mn++)8O16.nH2O Q
MANNARDITE BaTi6V+++2O16.H2O Q
REDLEDGEITE BaTi6Cr+++2O16.H2O Q
PRIDERITE (K,Ba)(Ti,Fe+++)8O16 Q
HENRYMEYERITE BaFe++Ti7O16 Q
ROMANECHITE (Ba,H2O)2(Mn++++,Mn+++)5O10 M
TODOROKITE (Mn++,Ca,Mg)Mn++++3O7.H2O M
FERRICORONADITE Pb(Mn++++6Fe+++2)O16 Q
FERRIHOLLANDITE BaMn++++6(Fe+++,Mn+++)2O16 M
THALLIOMELANE TlMn++++7,5Cu++0,5O16 Q
With large (+- medium-sized) cations; fluorite-type structures
THORIANITE ThO2 C
URANINITE UO2 C
CERIANITE-(Ce) (Ce++++,Th)O2 C
ZIRKELITE (Ca,Th,Ce)Zr(Ti,Nb)2O7 C
HIARNEITE Ca2Zr4Mn+++SbTiO16 Q
TAZHERANITE (Zr,Ti,Ca)O2 C
CALZIRTITE CaZr3TiO9 Q
VORLANITE (CaU++++++)O4 C ps H
With large (+- medium-sized) cations; unclassified
SOSEDKOITE (K,Na)5Al2(Ta,Nb)22O60 O
RANKAMAITE (Na,K,Pb,Li)3(Ta,Nb,Al)11(O,OH)30 O
CESPLUMTANTITE (Cs,Na)2(Pb,Sb+++)3Ta8O24 Q
EYSELITE Fe+++Ge++++3O7(OH) O
KURANAKHITE PbMn++++Te++++++O6 O
GELOSAITE Bi(Mo++++++,Mo+++++)2-2,5O7(OH).H2O M
MAMBERTIITE BiMo+++++2,80O8(OH) A
EKEBERGITE ThFeNb2O8 M
RIESITE TiTiO4 M
SARDIGNAITE Bi+++Mo2O7(OH).2H2O M
TEWITE (K1,5[]0,5)(Te1,25W0,25[]0,5)W5O19 O
WUMUITE KAl0,33W2,67O9 H
KINGSGATEITE ZrMo++++++2O7(OH)2.2H2O Q
BAHARIYAITE KMnO4 O
ACHALAITE (Fe++,Mn)(Ti,Fe+++,Ta)(Nb,Ta)2O8 M
Metal: Oxygen = < 1 :2
Oxides with metal : oxygen < 1:2 (M2O5, MO3)
TANTITE Ta2O5 A (?)
MOLYBDITE MoO3 O
Hydroxides (without V or U)
Hydroxides with OH, without H2O; corner-sharing tetrahedra
BEHOITE Be(OH)2 O
CLINOBEHOITE Be(OH)2 M
WULFINGITE Zn(OH)2 O
SWEETITE Zn(OH)2 Q
ASHOVERITE Zn(OH)2 Q
Hydroxides with OH, without H2O; insular octahedra
SHAKHOVITE Hg+4Sb+++++O3(OH)3 M
CUALSTIBITE Cu2AlSb+++++(OH)12 R
ZINCALSTIBITE Zn2AlSb+++++(OH)12 R
OMSITE (Ni,Cu)2Fe+++(OH)6[Sb(OH)6] R
Hydroxides with OH, without H2O; corner-sharing octahedra
SOHNGEITE Ga(OH)3 C
BERNALITE Fe(OH)3 O ps C
DZHALINDITE In(OH)3 C
MUSHISTONITE (Cu++,Zn,Fe++)Sn++++(OH)6 C
NATANITE Fe++Sn++++(OH)6 C
SCHOENFLIESITE MgSn++++(OH)6 C
VISMIRNOVITE ZnSn++++(OH)6 C
WICKMANITE Mn++Sn++++(OH)6 C
BURTITE CaSn(OH)6 C
TETRAWICKMANITE omsitedritsite Q
JEANBANDYITE (Fe+++,[])(Sn++++,[])(OH)6 Q ps C
MOPUNGITE NaSb+++++(OH)6 Q
STOTTITE Fe++Ge(OH)6 Q
MAGNESIONIGERITE-6N6S (Mg,Fe++)18(Al42Sn6)[]48O90(OH)6 R
ZINCONIGERITE-6N6S Zn3Sn2Al16O30(OH)2 R
FERRONIGERITE-2N1S (Fe,Mg)4(Al10Sn2)O22(OH)2 R
FERRONIGERITE-6N6S (Fe,Mg)18(Al42Sn6)O90(OH)6 R
MAGNESIONIGERITE-2N1S (Mg,Fe++)4(Al10Sn2)[]12O22(OH)2 R
ZINCONIGERITE-2N1S ZnSn2Al12O22(OH)2 R
MAGNESIOTAAFFEITE-6N'3S Mg2Al6BeO12 R
FERROTAAFFEITE-6N'3S (Fe++,Zn,Mg)2Al6BeO12 R
MAGNESIOTAAFFEITE-2N'2S Mg3Al8BeO16 H
FERROTAAFFEITE-2N'2S Be(Fe,Mg,Zn)3Al8O16 H
Hydroxides with OH, without H2O; chains of edge-sharing octahedra
SPERTINIITE Cu++(OH)2 O
MONTROSEITE (V+++,Fe+++)O(OH) O
BRACEWELLITE Cr+++O(OH) O
GROUTITE Mn+++O(OH) O
GUYANAITE CrO(OH) O
DIASPORE AlO(OH) O
TSUMGALLITE GaO(OH) O
MANGANITE Mn+++O(OH) M
YTTROTUNGSTITE-(Y) YW2O6(OH)3 M
YTTROTUNGSTITE-(Ce) CeW2O6(OH)3 M
FRANKHAWTHORNEITE Cu2Te++++++O4(OH)2 M
KHINITE-3T Pb++Cu++3Te++++++O6(OH)2 R
KHINITE-4O Pb++Cu++3Te++++++O6(OH)6 O
HOUSLEYITE Pb6CuTe4O18(OH)2 M
GOETHITE alpha-Fe+++O(OH) O
Hydroxides with OH, without H2O; sheets of edge-sharing octahedra
PORTLANDITE Ca(OH)2 H
AMAKINITE (Fe++,Mg)(OH)2 R
PYROCHROITE Mn++(OH)2 R
BRUCITE Mg(OH)2 R
THEOPHRASTITE Ni(OH)2 R
DOYLEITE Al(OH)3 A
BAYERITE Al(OH)3 M
GIBBSITE Al(OH)3 M
NORDSTRANDITE Al(OH)3 A
LEPIDOCROCITE gamma-Fe+++O(OH) O
BOHMITE AlO(OH) O
HETEROGENITE-2H Co+++O(OH) H
HETEROGENITE-3R Co+++O(OH) R
GRIMALDIITE Cr+++O(OH) R
FEITKNECHTITE beta-Mn+++O(OH) H
LITHIOPHORITE Li6Al14Mn++3Mn++++18O42(OH)42 H or M
QUENSELITE PbMn+++O2(OH) M
FERRIHYDRITE 5Fe+++2O3.9H2O H
FEROXYHYTE delta-Fe+++O(OH) H
VERNADITE (MnO2)(Mn++++,Fe+++,Ca,Na)(O,OH)2.nH2O H
QUETZALCOATLITE Zn6Cu3(Cl,Pb,Ag)2(TeO3)2O6(OH)6 H
FUETTERERITE Pb3Cu++6Te++++++O6(OH)7Cl5 R ps H
Hydroxides with OH, without H2O; various polyhedra
HYDROROMARCHITE Sn3O2(OH)2 Q
Hydroxides with OH, without H2O; unclassified
JANGGUNITE Mn++++5-x(Mn++,Fe+++)1+xO8(OH)6 (x=0,2) O
CESAROLITE PbH2Mn++++3O8 (?)
KIMROBINSONITE (Ta,Nb)(OH)5-2x(O,CO3)x C
LANGHOFITE Pb2(OH)[WO4(OH)] A
TASHELGITE CaMgFe+++Al9O16(OH) M ps O
Hydroxides with H2O +- (OH); insular octahedra
BOTTINOITE NiSb+++++2(OH)12.6H2O H
BRANDHOLZITE MgSb+++++2(OH)12.6H2O R
Hydroxides with H2O +- (OH); corner-sharing octahedra
MEYMACITE WO3.2H2O am.
SIDWILLITE MoO3.2H2O M
TUNGSTITE WO3.H2O O
ILSEMANNITE Mo3O8.nH2O am.
HYDROTUNGSTITE H2WO4.H2O M
Hydroxides with H2O +- (OH); chains of edge-sharing octahedra
BAMFORDITE Fe+++Mo2O6(OH)3.H2O A
Hydroxides with H2O +- (OH); sheets of edge-sharing octahedra
CARBOCALUMITE Ca4Al2(OH)12(CO3).6H2O R
DRITSITE Li2Al4(OH)12Cl2.3H2O H
MOSSBAUERITE Fe+++6O4(OH)8[CO3].3H2O R
FOUGERITE Fe++4Fe+++2(OH)12[CO3].3H2O R
IOWAITE Mg6Fe+++2(OH)16Cl2.4H2O H
JAMBORITE Ni++(OH)2.H2O H
MEIXNERITE Mg6Al2(OH)18.4H2O R
MUSKOXITE Mg7Fe+++4(OH)13.10H2O H
WOODALLITE Mg6(Cr,Fe+++)2(OH)16Cl2.4H2O R
HYDROCALUMITE Ca4Al2(OH)12(Cl,CO3,OH)2.4H2O M
KUZELITE Ca4Al2(OH)12(SO4).6H2O R
AURORITE (Mn,Ag,Ca)Mn++++3O7.3H2O A (?)
CHALCOPHANITE (Zn,Fe++,Mn++)Mn++++3O7.3H2O R
ERNIENICKELITE NiMn++++3O7.3H2O R
JIANSHUIITE (Mg,Mn++)Mn++++3O7.3H2O A
WOODRUFFITE Zn++(Mn++++,Mn+++)5O10.3,5H2O M ps Q
CUPROASBOLANE = Cu bearing ASBOLANE    
LAMPADITE = a Cu bearing Asbolane MnO,CuO,H2O  
ASBOLANE (Co,Ni)1-y(Mn++++O2)2-x(OH)2-2y+2x.nH2O H
BUSERITE Na4Mn14O27.21H2O ?
RANCIEITE (Ca,Mn++)Mn++++4O9.3H2O H (?)
TAKANELITE (Mn++,Ca)Mn++++4O8.H2O H
BIRNESSITE Na4Mn14O27.9H2O O
CIANCIULLIITE Mn++++(Mg,Mn++)2Zn+2(OH)10.2-4H2O M
JENSENITE Cu++3Te++++++O6.2H2O M
LEISINGITE (Cu,Mg,Zn)2(Mg,Fe)Te++++++O6.6H2O R
AKDALAITE 4Al2O3.H2O H
CAFETITE CaTi2O5.H2O O
MOURITE U++++Mo++++++5O12(OH)10 M
DELORYITE Cu++4(UO2)(MoO4)2(OH)6 M
LAGALYITE Ca2xMn1-xO2.1,5-2H2O (x = 0,05-0,08) M
TUNNERITE = WOODRUFFITE (?)    
MARIAKRITE [Ca4Al2(OH)12(H2O)4][Fe2S4] A
TREBEURDENITE Fe++2Fe+++4O2(OH)10[CO3].3H2O R
Hydroxides with H2O +- (OH); unclassified
FRANCONITE Na2Nb4O11.9H2O M
HOCHELAGAITE (Ca,Na,Sr)Nb4O11.8H2O M
TERNOVITE (Mg,Ca)Nb4O11.nH2O M
GERASIMOVSKITE (Mn,Ca)(Nb,Ti)5O12.9H2O am.
MANGANBELYANKINITE (Mn,Ca)(Ti,Nb)5O12.9H2O am.
BELYANKINITE Ca1-2(Ti,Zr,Nb)5O12.9H2O (?) am.
SILHYDRITE 3SiO2.H2O O
CUZTICITE Fe+++2Te++++++O6.3H2O H
QATRANAITE CaZn2(OH)6(H2O)2 M
HYDROPLUMBITE 3PbO.H2O  
CHARLESHATCHETTITE CaNb4O10(OH)2.8H2O M
Hydroxides with H2O±(OH); frameworks of corner and/or face-sharing octahedra
MENEZESITE Ba3MgZr4Nb12O42.12H2O C
ASPEDAMITE []12(Fe+++,Fe++)3Nb4[Th(Nb,Fe+++)12O42]{(H2O),(OH)}12 C
Uranyl Hydroxides
Without additional cations
SCHOEPITE [(UO2)8O2(OH)12](H2O)12 O
METASCHOEPITE UO3.nH2O (n smaller than 2) O
PARASCHOEPITE UO3.2H2O O
IANTHINITE (UO2).5(UO3).10H2O O
METASTUDTITE UO4.2H2O O
STUDTITE UO4.4H2O M
PAULSCHERRERITE (UO2)(OH)2 M ps O
HEISENBERGITE (UO2)(OH)2.H2O O
With additional cations (K, Ca, Ba, Pb, etc.); * With mainly UO2(O,OH)5 pentagonal polyhedra
RAMEAUITE K2Ca(UO2)6O6(OH)4,6H2O M
AGRINIERITE K2(Ca,Sr)(UO2)6O6(OH)4.5H2O O
COMPREIGNACITE K2(UO2)6O4(OH)6.7H2O O
PROTASITE Ba(UO2)3O3(OH)2.3H2O M ps H
BECQUERELITE Ca(UO2)6O4(OH)6.8H2O O
BILLIETITE Ba(UO2)6O4(OH)6.8H2O O
RICHETITE PbU++++++4O13.4H2O A
METACALCIOURANOITE (Ca,Na,Ba)U2O7.2H2O (?)
CALCIOURANOITE (Ca,Ba,Pb)U2O7.5H2O am.
BAURANOITE BaU2O7.4-5H2O (?)
FOURMARIERITE Pb(UO2)4O3(OH)4.4H2O O
WOLSENDORFITE (Pb,Ca)U2O7.2H2O O
MASUYITE Pb(UO2)3O3(OH)2.2H2O O
METAVANDENDRIESSCHEITE PbU7O22.nH2O (n smaller than12) O
VANDENDRIESSCHEITE Pb1,5(UO2)10O6(OH)11.11H2O O
VANDENBRANDEITE Cu(UO2)(OH)4 A
SAYRITE Pb2(UO2)5O6(OH)2.4H2O M
CURITE Pb3(UO2)8O8(OH)6.2H2O O
IRIGINITE UO2Mo2O7.3H2O O
URANOSPHAERITE Bi(UO2)O2(OH) M
HOLFERTITE U++++++1,75Ti++++Ca0,25O7,5(H2O)3 or U++++++1,75Ti++++Ca0,25O7,17(OH)0,67(H2O)3 H
CARLOSBARBOSAITE (UO2)2Nb2O6(OH)2.2H2O O
GAUTHIERITE KPb[(UO2)7O5(OH)7].8H2O M
KROUPAITE KPb0,5[(UO2)8O4(OH)10].10H2O O
LEESITE K(H2O)2[(UO2)4O2(OH)5].3H2O O
NOLLMOTZITE Mg[U+++++(U++++++O2)2O4F3].4H2O M
SHINKOLOBWEITE Pb1,25[U+++++(H2O)2(U++++++O2)5O8(OH)2](H2O)5 O
With additional cations; * With mainly UO2(O,OH)6 hexagonal polyhedra
CLARKEITE Na[(UO2)O(OH)](H2O)0-1 H
UMOHOITE (UO2)MoO4.2H2O A
SPRIGGITE Pb2(UO2)6O8(OH)2.3H2O M
BOBFINCHITE Na[(UO2)8O3(OH)11].10H2O O
V[5,6] Vanadates
V[>4] Nesovanadates
Uranyl Sorovanodates
CARNOTITE K2(UO2)2V2O8.3H2O M
MARGARITASITE (Cs,K,H3O)2(UO2)2V2O8.H2O M
SENGIERITE Cu2(UO2)2V2O8.6H2O M
FINCHITE Sr(UO2)2(V2O8).5H2O O
FRITZSCHEITE Mn++(UO2)2[(P,V)O4]2.10H2O (?) Q
FRANCEVILLITE (Ba,Pb)(UO2)2V2O8.5H2O O
CURIENITE Pb(UO2)2V2O8.5H2O O
METAVANURALITE Al(UO2)2V2O8(OH).8H2O A
VANURALITE Al(UO2)2(V+++++O4)2(OH).11H2O M
TYUYAMUNITE Ca(UO2)2V2O8.5-8H2O O
METATYUYAMUNITE Ca(UO2)2V2O8.3H2O O
STRELKINITE Na2(UO2)2V2O8.6H2O O
UVANITE U++++++2V+++++6O21.15H2O (?) O (?)
RAUVITE Ca(UO2)2V+++++10O28.16H2O  
VANDERMEERSCHEITE K2[(UO2)2V2O8].2H2O M
[6]-Sorovanadates
RAKOVANITE (NH4)3Na3[V10O28].12H2O. M
MAGNESIOPASCOITE MgCa2(V10O28).16H2O M ps H
LASALITE Na2Mg2(V10O28).20H2O M
HUGHESITE Na3Al(V10O28).22H2O A
HYDROPASCOITE Ca3(V10O28).24H2O A
PASCOITE Ca2Ca(V10O28).17H2O M
HUMMERITE KMgV+++++5O14.8H2O A
SHERWOODITE Ca9Al2V++++4V+++++24O80.56H2O Q
BLUESTREAKITE K4Mg2(V++++2V+++++8O28).14H2O M
BURROITE Ca2(NH4)2(V10O28).15H2O A
WERNERBAURITE (NH4)4Ca[V+++++10O28].16H2O A
CASEYITE [(V+++++O2)Al7,5(OH)15(H2O)13]2[H2V++++V+++++9O28][V+++++10O28]2.90H2O M
GUNTERITE Na4Ca[V10O28].20H2O M ps H
KOKINOSITE Na2Ca2(V+++++10O28).24H2O A
NASHITE Na3Ca2[(V++++V+++++9)O28].24H2O M
OKIEITE Mg3[V10O28].28H2O A
POSTITE Mg(H2O)6Al2(OH)2(H2O)8(V10O28).13H2O O
SCHINDLERITE (NH4)4Na2[V+++++10O28].10H2O A
PROTOCASEYITE [Al4(OH)6(H2O)12][V10O28].8H2O A
AMMONIOLASALITE (NH4)2Mg2(H2O)20][V10O28] M
BECKETTITE Ca2V6Al6O20 A
Inovanadates
ROSSITE CaV2O6.4H2O A
METAROSSITE CaV2O6.2H2O A
MUNIRITE NaVO3.(2-x)H2O M
METAMUNIRITE Na2[V+++++2O6] or NaVO3 O
DICKTHOMSSENITE Mg(V2O6).7H2O M
ANSERMETITE Mn++(V+++++2O6).4H2O M
PSEUDODICKTHOMSSENITE Mg(VO3)2.8H2O A
Phyllovanadates
MELANOVANADITE Ca(V+++++2V++++2)O10.5H2O A
SHCHERBINAITE V2O5 O
HEWETTITE CaV+++++6O16.9H2O M
METAHEWETTITE CaV+++++6O16.3H2O M
BARIANDITE Al3(V+++++,V++++)40O100.45H2O M
BOKITE (Al,Fe+++)1,3(V+++++,V++++,Fe+++)8O20.7,4H2O M
CORVUSITE (Na,Ca,K)(V+++++,V++++,Fe++)8O20.4H2O M
FERNANDINITE Ca(V+++++,V++++,Fe++)80O20.4H2O M
STRACZEKITE (Ca,K,Ba)(V+++++,V++++)8O20.3H2O M
HAGGITE V2O2(OH)3 M
DOLORESITE H8V++++6O16 M
DUTTONITE V++++O(OH)2 M
CAVOITE CaV++++3O7 O
Tektovanadates
BANNERMANITE (Na,K)xV++++xV+++++6-xO15 (x=0,7) M
Unclassified V oxides
FERVANITE Fe+++4(VO4)4.5H2O M
HUEMULITE Na4MgV+++++10O28.24H2O A
VANALITE NaAl8V10O38.30H2O M
SIMPLOTITE CaV++++4O9.5H2O M
VANOXITE V++++4V+++++2O13.8H2O R (?)
NAVAJOITE (V+++++,Fe+++)10O24.12H2O M
DELRIOITE (Sr,Ca)(VO3)2(H2O)4 M
METADELRIOITE Ca(VO3)2(H2O)4 A
BARNESITE (Na,Ca)2V+++++6O16.3H2O M
HENDERSONITE (Ca,Sr)x(V+++++,V++++)12O32.12H2O (x = about 2,6) O
GRANTSITE (NaCa)x(V+++++,V++++)6O16.4H2O (x = about 2,3) M
LENOBLITE V++++2O4.2H2O O (?)
SATPAEVITE Al12V++++2V+++++6O37.30H2O O (?)
PANDORAITE-Ca CaV++++5V+++++2O16.3H2O M
PANDORAITE-Ba BaV++++5V+++++2O16.3H2O M
TREBISKYITE Na3Mg2[TiV9O28].22H2O M
CALCIODELRIOITE Ca(VO3)2(H2O)4 M
Arsenites, antimonites, bismuthites, sulfites, selenites, tellurites; iodates
Arsenites, antimonites, bismuthites; without additional anions, without H2O
LEITEITE ZnAs+++2O4 M
REINERITE Zn3(As+++O3)2 O
KARIBIBITE Fe+++2As+++4(O,OH)9 O
KUSACHIITE CuBi2O4 Q
SCHAFARZIKITE Fe++Sb+++2O4 Q
TRIPPKEITE CuAs+++2O4 Q
APUANITE Fe++Fe+++4Sb+++4O12S Q
VERSILIAITE Fe2Fe4Sb6O16S O
SCHNEIDERHOHNITE Fe++Fe+++3As+++5O13 A
ZIMBABWEITE (Na,K)2PbAs+++4(Ta,Nb,Ti)4O18 O
LUDLOCKITE Pb++Fe+++4As+++10O22 A
PAULMOOREITE Pb2As+++2O5 M
STIBIVANITE Sb+++2V++++O5 O/M
CHADWICKITE H(UO2)(As+++O3) Q (?)
Arsenites, antimonites, bismuthites; with additional anions, without H2O
FETIASITE (Fe++,Fe+++,Ti++++)3O2(As+++2O5) M
MANGANARSITE Mn++3As+++204(OH)4 R
MAGNUSSONITE Mn++9(As+++O3)6Mn+x(H2O,Clx,[]) C/Q
ARMANGITE Mn++26As+++18O50(OH)4(CO3) R
NANLINGITE NaLiCa5Mg12Fe++(AsO3)8F14 R
ASBECASITE Ca3(Ti,Fe,Sn)(Be,B,Al)2(As+++,Sb+++)3O6(SiO4)2 R
STENHUGGARITE CaFe+++(As+++O2)(As+++Sb+++O5) Q
TRIGONITE Pb3Mn(As+++O3)2(As+++O2OH) M
FINNEMANITE Pb5(As+++O3)3Cl H
GEBHARDITE Pb8(As+++2O5)2OCl6 M
DERBYLITE Fe+++4Ti++++3Sb+++O13(OH) M
GRAESERITE Fe+++4Ti3As+++O13(OH) M
TOMICHITE (V,Fe)4Ti3AsO13(OH) M
HEMLOITE (As,Sb)2(Ti,V,Fe,Al)12O23OH A
FREEDITE Pb8Cu+(As+++O3)2O3Cl5 M
GEORGIADESITE Pb4(AsO3)4Cl4(OH) M
SZKLARYITE []Al6BAs+++3O15 O
EKATITE (Fe+++,Fe++,Zn)12(OH)6(AsO3)6[AsO3,HOSiO3]2 H
LEPAGEITE Mn++3(Fe+++7Fe++4)O3[Sb+++5As+++8O34] A
BIANCHINIITE Ba2(TiV)(As2O5)2OF Q
CUYAITE Ca2Mn+++As+++14O24Cl M
BRATTFORSITE Mn19As12O36Cl2 M
Arsenites, antimonites, bismuthites; without additional anions, with H2O
CAFARSITE (Ca,Na,[])19Ti8Fe+++4Fe++4(AsO3)28F C
LAZARENKOITE (Ca,Fe++)Fe+++As+++3O7.3H2O O
ROUSEITE Pb2Mn++(As+++O3)2.2H2O A
VAJDAKITE [(Mo++++++O2)2(H2O)2As+++2O5)].H2O M
Arsenites, antimonites, bismuthites; with additional anions, with H2O
NEALITE Pb4Fe++(As+++++O3)2Cl4.2H2O A
SEELITE Mg(UO2)(AsO4)0,6(AsO3)1,4.7H2O M
TOOELEITE Fe+++6(As+++O3)4SO4(OH)4.4H2O O
PRACHARITE CaSb+++++2(As+++2O5)2O2.10H2O R
Sulfites
FLEISSTALITE Fe++(SO3).3H2O O
GRAVEGLIAITE Mn++(SO3).3H2O O
HANNEBACHITE Ca2(SO3)2.H2O O
ORSCHALLITE Ca3(SO3)2(SO4).12H2O R
SCOTLANDITE PbSO3 M
KOLLERITE (NH4)2Fe+++(SO3)2(OH).H2O O
ALBERTINIITE (Fe++,Mn++)(SO3).3H2O M
Selenites without additional anions, without H2O
MOLYBDOMENITE PbSeO3 M
Selenites with additional anions, without H2O
GEORGBOKIITE Cu5(SeO3)2O2Cl2 M
PARAGEORGBOKIITE beta-Cu5(SeO3)2O2Cl2 M
CHLOROMENITE Cu9O2(SeO3)4Cl6 M
SOFIITE Zn2(Se++++O3)Cl2 O ps H
ILINSKITE (Na,K)Cu5(SeO3)2O2Cl3 O
FRANCISITE Cu3Bi(SeO3)2O2Cl O
DERRIKSITE Cu4(UO2)(SeO3)2(OH)6 O
BURNSITE KCdCu++7O2(SeO3)2Cl9 H
ALLOCHALCOSELITE Cu+Cu++5PbO2(SeO3)2Cl5 M
NICKSOBOLEVITE Cu7(SeO3)2O2Cl6 M
PLUMBOSELITE Pb3O2(SeO3) O
SARRABUSITE Pb5Cu(SeO3)4Cl4 M
PREWITTITE KPb1,5Cu6Zn(SeO3)2O2Cl10 O
Selenites without additional anions, with H2O
CHALCOMENITE CuSeO3.2H2O O
AHLFELDITE (Ni,Co)SeO3.2H2O M
CLINOCHALCOMENITE CuSeO3.2H2O M
COBALTOMENITE CoSeO3.2H2O M
MANDARINOITE Fe+++2Se++++3O9.6H2O M
ORLANDIITE Pb3SeO3Cl4.H2O A
LARISAITE (H3O)(Na,K)(UO2)3O2(SeO3)2.4H2O M
NESTOLAITE CaSeO3.H2O M
Selenites with additional anions, with H2O
MARTHOZITE Cu++(UO2)3(SeO3)2O2.8H2O O
GUILLEMINITE Ba(UO2)3(SeO3)2O2.3H2O O
PIRETITE Ca(UO2)3(SeO3)2(OH)4.4H2O O
DEMESMAEKERITE Pb2Cu5(UO2)2(SeO3)6(OH)6.2H2O A
HAYNESITE (UO2)3(SeO3)2(OH)2.5H2O O
FAVREAUITE PbBiCu6O4(SeO3)4(OH).H2O Q
PETERMEGAWITE Al6(Se++++O3)3[SiO3(OH)](OH)9.10H2O O
Tellurites without additional anions, without H2O
WALFORDITE (Fe+++,Te++++++)(Te++++3O8) C
WINSTANLEYITE TiTe++++3O8 C
ZINCOSPIROFFITE Zn2(Te3O8) M
SPIROFFITE Mn++2Te3O8 M
BALYAKINITE CuTeO3 O
RAJITE CuTe++++2O5 M
CARLFRIESITE CaTe++++2Te++++++O8 M
DENNINGITE (Ca,Mn)(Mn,Zn)(Te2O5)2 Q
CHEKHOVICHITE (Bi,Pb,Fe)2Te4O11 M
SMIRNITE Bi2Te++++O5 O
CHOLOALITE PbCu++(Te++++O3)2.H2O C
FAIRBANKITE Pb12++(Te++++O3)11(SO4) A
PLUMBOTELLURITE PbTe++++O3 O
MAGNOLITE Hg+2Te++++O3 O
MOCTEZUMITE Pb(UO2)(TeO3)2 M
SCHMITTERITE (UO2)TeO3 O
CLIFFORDITE UTe3O9 C
MATTHIASWEILITE PbTe++++O3 A
Tellurites with additional anions, without H2O
RODALQUILARITE H3Fe+++2(Te++++O3)4Cl A
MACKAYITE Fe+++Te2O5(OH) Q
MROSEITE CaTe++++(CO3)O2 O
PINGGUITE Bi6Te++++++2O15 O
TLAPALLITE H6(Ca,Pb)2(Cu,Zn)3(SO4)(Te++++O3)4(Te++++++O6) M
GIRDITE= OBOYERITE + OTTOITE (?) Pb3H2(Te++++O3)(Te++++++O6) (?) M (?)
BODIEITE Bi2(TeO3)2(SO4) M
TOMIOLLOITE Al12(Te++++O3)5[(SO3)0,5(SO4)0,5](OH)24 H
Tellurites without additional anions, with H2O
ZEMANNITE Mg0,5[Zn++Fe+++(Te++++O3)3].4,5H2O H
KEYSTONEITE Mg0,5[Ni++Fe+++(TeO3)3].4,5H2O H
ILIRNEYITE Mg0,5[ZnMn+++(TeO3)3].4,5H2O H
KINICHILITE Mg0,5[Mn++Fe+++(TeO3)3].4,5H2O H
BLAKEITE Fe+++2(TeO3)3 (?)
EMMONSITE Fe+++2Te++++3O9.2H2O A
GRAEMITE CuTeO3.H2O O
TEINEITE CuTeO3.2H2O O
TELLUROMANDARINOITE Fe+++2Te3O9.6H2O M
MILLSITE Cu++(Te++++O3).2H2O M
RUDOLFHERMANNITE Fe+++2(Te++++O3)3.H2O H
Tellurites with additional anions, with H2O
SONORAITE Fe+++Te++++O3(OH).H2O M
POUGHITE Fe+++2(TeO3)2(SO4).3H2O O
CESBRONITE Cu++3Te++++++O4(OH)4 O
EZTLITE Pb++2Fe+++3(Te++++O3)3(SO4)O2Cl M
JUABITE CaCu10(Te++++O3)4(As+++++O4)4(OH)2.4H2O A
EUREKADUMPITE (Cu,Zn)16(Te++++O3)2(AsO4)3Cl(OH)18.7H2O O ps H
TAMBOITE Fe+++3(OH)(H2O)2(SO4)(Te++++O3)3[Te++++O(OH)2](H2O)3 M
METATAMBOITE Fe+++3(OH)(H2O)2(SO4)(Te++++O3)3(Te++++O(OH)2)(H2O) M
OZERNOVSKIITE Fe++4(Te++++O4)(Te++++O3)4.7H2O M
TOMBSTONEITE (Ca0,5Pb0,5)Pb3Cu++6Te++++++2O6(Te++++O3)6(Se++++O3)2(SO4)2.3H2O R
Iodates: Trigonal [IO3] pyramids (mostly).
Iodates without additional anions, without H2O
LAUTARITE Ca(IO3)2 M
Iodates with additional anions, without H2O
SALESITE Cu(IO3)(OH) O
SCHWARTZEMBERGITE Pb++5I+++O6H2Cl3 Q
SEELIGERITE Pb3I+++++O4Cl3 O
BLUEBELLITE Cu6[I+++++O3(OH)3](OH)7Cl R
Iodates without additional anions, with H2O
BELLINGERITE Cu++3(IO3)6.2H2O A
BRUGGENITE Ca(IO3)2.H2O M
Iodates with additional anions, with H2O
DIETZEITE Ca2H2O(IO3)2(CrO4) M
GEORGEERICKSENITE Na6CaMg(IO3)6(CrO4,SO4)2.12H2O R
Oxides, etc. unclassified
POMITE Ca3[V++++5V+++++10O37(CO3)].37H2O A
PSEUDOPOMITE Ca3,5[V++++6V+++++9O37(CO3)].29H2O A
RAYDEMARKITE MoO3.H2O A
HANAHANITE [Zn8(OH)14(SO4)].3H2O H
TIANHONGQIITE CrTiO3(OH) M
LIGUOWUITE WO3 M
URANMICROLITE (U,Ca,Ce)2(Ta,Nb)2O6(OH,F) (?) C
DAUBREEITE BiO(OH,Cl) Q
YTTROMICROLITE    
WAD = Massive MANGNESE OXIDES    
ALMEIDAITE PbZn2(Mn,Y)(Ti,Fe+++)18O37(OH,O) R
BASSOITE SrV++++3O7 M
VAPNIKITE Ca3UO6 M
PISEKITE-(Y) (Y,As,Ca,Fe,U)(Nb,Ti,Ta)O4  
MAGNESIOHOGBOMITE-6N12S Mg5Al11TiO23(OH) R
MAGNESIOTAAFFEITE-2N'2S2 Mg3Al8BeO16 R
MAPIQUIROITE (Sr,Pb)(U,Y)Fe2(Ti,Fe+++,Cr+++)18O38 R
AKAOGIITE TiO2 M
* CARBONATES, NITRATES
Carbonates without additional anions, without H2O
Alkali carbonates
ZABUYELITE Li2CO3 M
GREGORYITE (Na2,K2,Ca)CO3 H (?)
NATRITE Na2CO3 M
NAHCOLITE NaHCO3 M
KALICINITE KHCO3 M
TESCHEMACHERITE (NH4)HCO3 O
WEGSCHEIDERITE Na5(CO3)(HCO3)3 A
Alkali-earth (and other M2+) carbonates
SPHAEROCOBALTITE CoCO3 R
GASPEITE (Ni,Mg,Fe++)CO3 R
MAGNESITE MgCO3 R
OTAVITE CdCO3 R
RHODOCHROSITE Mn++CO3 R
SIDERITE Fe++CO3 R
SMITHSONITE ZnCO3 R
SPHEROCOBALTITE CoCO3 R
CALCITE CaCO3 R
MINRECORDITE CaZn(CO3)2 R
ANKERITE Ca(Fe++,Mg,Mn)(CO3)2 R
DOLOMITE CaMg(CO3)2 R
KUTNOHORITE Ca(Mn++,Mg,Fe++)(CO3)2 R
WITHERITE BaCO3 O
STRONTIANITE SrCO3 O
ARAGONITE CaCO3 O
CERUSSITE PbCO3 O
VATERITE CaCO3 H
HUNTITE CaMg3(CO3)4 R
NORSETHITE BaMg(CO3)2 R
ALSTONITE BaCa(CO3)2 A ps O
OLEKMINSKITE Sr(Sr,Ca,Ba)(CO3)2 R
PARALSTONITE BaCa(CO3)2 R
BARYTOCALCITE BaCa(CO3)2 M
CARBOCERNAITE (Ca,Na)(Sr,Ce,Ba)(CO3)2 O
BENSTONITE (Ba,Sr)6(Ca,Mn)6Mg(CO3)13 R
JUANGODOYITE Na2Cu++(CO3)2 M
Alkali and alkali-earth carbonates
EITELITE Na2Mg(CO3)2 R
NYEREREITE Na2Ca(CO3)2 O
ZEMKORITE (Na,K)2Ca(CO3)2 H
BUTSCHLIITE K2Ca(CO3)2 R
FAIRCHILDITE K2Ca(CO3)2 H
SHORTITE Na2Ca2(CO3)3 O
SANROMANITE Na2CaPb3(CO3)5 H
BURBANKITE (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 H
CALCIOBURBANKITE Na3(Ca,Ce,La,Sr)3(CO3)5 H
KHANNESHITE (NaCa)3(Ba,Sr,Ce,Ca)3(CO3)5 H
With rare-earth elements (REE)
SAHAMALITE-(Ce) (Mg,Fe++)Ce2(CO3)4 M
PETERSENITE-(Ce) (Na,Ca)4(Ce,La,Nd,Sr,Pr,Sm,Ba)2(CO3)5 M
REMONDITE-(Ce) Na3(Ce,La,Ca,Na,Sr)3(CO3)5 M ps H
REMONDITE-(La) Na3(La,Ce,Ca)3(CO3)5 M ps H
PARATOOITE-(La) (REE,Ca,Na,Sr)6Cu(CO3)8 or REE3(Ca,Sr)2NaCu(CO3)8 O
Carbonates with additional anions, without H2O
With Cu, Co, Ni, Zn, Mg, Mn
AZURITE Cu3(CO3)2(OH)2 M
NULLAGINITE Ni2(CO3)(OH)2 M
ZINCROSASITE (Zn,Cu++)2(CO3)(OH)2 M
CHUKANOVITE Fe++2(CO3)3(OH)2 M
POKROVSKITE Mg2(CO3)(OH)2.0,5H2O M
MCGUINNESSITE (Mg,Cu++)2(CO3)(OH)2 M
MALACHITE Cu2(CO3)(OH)2 M
KOLWEZITE (Cu++,Co)2(CO3)(OH)2 A
GLAUKOSPHAERITE (Cu,Ni)2(CO3)(OH)2 M
GEORGEITE Cu++5(CO3)3(OH)4.6H2O am.
PARADSASVARITE Zn2(CO3)(OH)2 M
ROSASITE (Cu++,Zn)2(CO3)(OH)2 M
AURICHALCITE (Zn,Cu)5(CO3)2(OH)6 M
HYDROZINCITE Zn5(CO3)2(OH)6 M
HOLDAWAYITE Mn++6(CO3)2(OH)7(Cl,OH) M
DEFERNITE Ca6(CO3)2-x(SiO4)x(OH)7(Cl,OH)1-2x (x=0,5) O
LOSEYITE (Mn,Zn)7(CO3)2(OH)10 M
SCLARITE (Zn,Mg,Mn++)4Zn3(CO3)2(OH)10 M
With alkalies, etc.
BARENTSITE Na7AlH2(CO3)4F4 A
DAWSONITE NaAl(CO3)(OH)2 O
TUNISITE NaCa2Al4(CO3)4(OH)8Cl Q
SABINAITE Na4Zr2TiO4(CO3)4 M
With alkali-earth cations
BRENKITE Ca2(CO3)F2 O
ROUVILLEITE Na3Ca2(CO3)3F M
PODLESNOITE BaCa2(CO3)2F2 O
With rare earth elements (REE)
CORDYLITE-(Ce) NaBaCe2(CO3)4F H
CORDYLITE-(La) (Na,Ca)Ba(La,Ce,Sr)2(CO3)4F H
LUKECHANGITE-(Ce) Na3(Ce,La,Nd)2(CO3)4F H
KUKHARENKOITE-(Ce) Ba2Ce(CO3)3F M
ZHONGHUACERITE-(Ce) Ba2Ce(CO3)3F R
KUKHARENKOITE-(La) Ba2(La,Ce,Th)(CO3)3F M
CEBAITE-(Ce) Ba3Ce2(CO3)5F2 M
CEBAITE-(Nd) Ba3(Nd,Ce)2(CO3)5F2 M
ARISITE-(Ce) NaCe2(CO3)2[(CO3)1-xF2x]F H
ARISITE-(La) NaLa2(CO3)2[F2x(CO3)1-x]F H
PARISITE-(La) Ca(La,Nd,Ce)2F2(CO3)3 M ps R ?
BASTNASITE-(La) (La,Ce)(CO3)F H
THORBASTNASITE Th(Ca,Ce)(CO3)2F2.3H2O H
HYDROXYLBASTNASITE-(Nd) (Nd,La)(CO3)(OH,F) H
HYDROXYLBASTNASITE-(La) La(CO3)(OH) H
HYDROXYLBASTNASITE-(Ce) (Ce,La)(CO3)(OH,F) H
BASTNASITE-(Nd) (Nd,La,Ce)(CO3)F H
BASTNASITE-(Ce) (Ce,La)(CO3)F H
BASTNASITE-(Y) (Y,Ce)(CO3)F H
PARISITE-(Ce) CaCe2F2(CO3)3 M
PARISITE-(Nd) Ca(Nd,Ce,La)2(CO3)3F2 R
HYDROXYLSYNCHISITE-(Ce) Ca(Ce,La)(CO3)2(OH) M ?
SYNCHYSITE-(Nd) Ca(Nd,La)(CO3)2F M ps H
SYNCHYSITE-(Y) (Y,Ce)Ca(CO3)2F M ps H
SYNCHYSITE-(Ce) Ca(Ce,La)(CO3)2F M
RONTGENITE-(Ce) Ca2(Ce,La)3(CO3)5F3 R
HORVATHITE-(Y) NaY(CO3)F2 O
QAQARSSUKITE (Ba,Ca,Sr)(Ce,La,Nd)(CO3)2F R
HUANGHOITE-(Ce) BaCe(CO3)2F R
With Pb, Bi
SHANNONITE Pb2OCO3 O
HYDROCERUSSITE Pb3(CO3)2(OH)2 R
PLUMBONACRITE Pb5O(OH)2(CO3)3 H
PHOSGENITE Pb2(CO3)Cl2 Q
BISMUTITE Bi2(CO3)O2 Q
KETTNERITE CaBi(CO3)OF Q
BEYERITE (Ca,Pb)Bi2(CO3)2O2 Q
GROOTFONTEINITE Pb3O(CO3)2 H
SOMERSETITE Pb8O2(OH)2(CO3)5 H
ABELLAITE NaPb2(CO3)2(OH) H
With (Cl), SO4, PO4, TeO3
FERROTYCHITE Na6Fe++2(SO4)(CO3)4 C
MANGANOTYCHITE Na6(Mn++,Fe++,Mg)2(SO4)(CO3)4 C
NORTHUPITE Na3Mg(CO3)2Cl C
TYCHITE Na6Mg2(CO3)4(SO4) C
CRAWFORDITE Na3Sr(PO4)(CO3) M ps O
SIDORENKITE Na3Mn(PO4)(CO3) M ps O
BRADLEYITE Na3Mg(PO4)(CO3) M
BONSHTEDTITE Na3Fe++(PO4)(CO3) M ps O
DAQINGSHANITE-(Ce) (Sr,Ca,Ba)3(Ce,La)(PO4)(CO3)3-x(OH,F)x H
REEDERITE-(Y) (Na,Al,Mn,Ca)15(Y,Ce,Nd,La)2(CO3)9(SO3F)(Cl,F) H
MINEEVITE-(Y) Na25Ba(Y,Gd,Dy)2(HCO3)4(CO3)11(SO4)2ClF2 H
BRIANYOUNGITE Zn3(CO3,SO4)(OH)4 M ps O
PHILOLITHITE Pb12O6Mn(Mg,Mn++)2(Mn,Mg)4(SO4)(CO3)4Cl4(OH)12 Q
SUSANNITE Pb4(SO4)(CO3)2(OH)2 R
LEADHILLITE Pb4(SO4)(CO3)2(OH)2 M ps A
MACPHERSONITE Pb4(SO4)(CO3)2(OH)2 O
PEATITE-(Y) Li4Na12(Y,Na,Ca,HREE)12(PO4)12(CO3)4(F,OH)8 O ps C
RAMIKITE-(Y) Li4Na12(Y,Ca,HREE)6Zr6(PO4)12(CO3)4O4(OH,F)4 A ps C
Carbonates without additional anions, with H2O
With medium-sized cations
NESQUEHONITE Mg(CO3).3H2O M
LANSFORDITE MgCO3.5H2O M
BARRINGTONITE MgCO3.2H2O A
HELLYERITE NiCO3.6H2O A
With large cations (alkali and alkali-earth carbonates)
THERMONATRITE Na2CO3.H2O O
NATRON Na2CO3.10H2O M
TRONA Na3(CO3)(HCO3).2H2O M
MONOHYDROCALCITE CaCO3.H2O H
IKAITE CaCO3.6H2O M
PIRSSONITE Na2Ca(CO3)2.2H2O O
GAYLUSSITE Na2Ca(CO3)2.5H2O M
CHALCONATRONITE Na2Cu(CO3)2.3H2O M
BAYLISSITE K2Mg(CO3)2.4H2O M
TULIOKITE BaNa6Th(CO3)6.6H2O H
With rare earth elements (REE)
WELOGANITE Sr3Na2Zr(CO3)6.3H2O A ps R
DONNAYITE-(Y) Sr3NaCaY(CO3)6.3H2O A ps R
EWALDITE (Ba,Sr)(Ca,Na,Y,Ce)(CO3)2.10-12H2O H
MCKELVEYITE-(Nd) (Ba,Sr)(Nd,Ce,La)(CO3)2. 4-10H2O A
MCKELVEYITE-(Y) NaBa3CaY(CO3)6.3H2O A ps R
TENGERITE-(Y) Y2(CO3)3.nH2O O
LOKKAITE-(Y) CaY4(CO3)7.9H2O O
HIZENITE-(Y) Ca2Y6(CO3)11.14H2O O
KIMURAITE-(Y) CaY2(CO3)4.6H2O O
SHOMIOKITE-(Y) Na3Y(CO3)3.3H2O O
CALKINSITE-(Ce) (Ce,La)2(CO3)3.4H2O O
LANTHANITE-(Ce) (Ce,La)2(CO3)3.8H2O O
LANTHANITE-(La) (La,Ce)2(CO3)3.8H2O O
LANTHANITE-(Nd) (Nd,La)2(CO3)3.8H2O O
ADAMSITE-(Y) NaY(CO3)2.6H2O A
DECRESPIGNYITE-(Y) (Y,Gd,Dy)4Cu(CO3)4Cl(OH)5.2H2O M ps H
GALGENBERGITE-(Ce) Ca(Ce,La,Nd)2(CO3)4.H2O A
LECOQITE-(Y) Na3Y(CO3)3.6H2O H
ALICEWILSONITE-(Yla) Na2Sr2YLa(CO3)6.3H2O A
ALICEWILSONITE-(YCe) Na2Sr2YCe(CO3)6.3H2O A
BAINBRIDGEITE-(YCe) Na2Ba2YCe(CO3)6.3H2O A
Carbonates with additional anions, with H2O
With medium-sized cations
DYPINGITE Mg5(CO3)4(OH)2.5H2O M (?)
GIORGIOSITE Mg5(CO3)4(OH)2.5-6H2O (?)
HYDROMAGNESITE Mg5(CO3)4(OH)2.4H2O M
WIDGIEMOOLTHALITE (Ni,Mg)5(CO3)4(OH)2.4-5H2O M
CHLORARTINITE Mg2(CO3)Cl(OH).3H2O R
INDIGIRITE Mg2Al2(CO3)4(OH)2.15H2O M (?)
ARTINITE Mg2(CO3)(OH)2.3H2O M
ZARATITE Ni3(CO3)(OH)4.4H2O C
OTWAYITE Ni2(CO3)(OH)2.H2O O
KAMBALDAITE NaNi4(CO3)3(OH)3.3H2O H
CALLAGHANITE Cu2Mg2(CO3)(OH)6.2H2O M
CLARAITE (Cu,Zn)15(AsO4)2(CO3)4(SO4)(OH)14.7H2O A
HYDROSCARBROITE Al14(CO3)3(OH)36.nH2O A
SCARBROITE Al5(OH)13(CO3).5H2O H
QUINTINITE [Mg4Al2(OH)12][(CO3)(H2O)3] M
QUINTINITE (Mg,Fe++)4Al2(OH)12(CO3).3H2O H/R
KARCHEVSKYITE [Mg18Al9(OH)54][Sr2(CO3,PO4)9(H2O,H3O)11] R
CARESITE (Fe++,Mg)4Al2(OH)12(CO3).3H2O R
QUINTINITE (Mg,Fe++)4Al2(OH)12(CO3).3H2O H/R
CHARMARITE Mn++4Al2(OH)12(CO3).3H2O H/R
PYROAURITE-2H Mg6Fe+++2(OH)16(CO3).4H2O  
BARBERTONITE = STICHTITE-2H Mg6(Cr,Al)2(CO3)(OH)16 .4H2O  
BRUGNATELLITE Mg6Fe+++(CO3)(OH)13.4H2O H
CHLORMAGALUMINITE (Mg,Fe++)4Al2(OH)12(Cl2,CO3).2H2O H
ZACCAGNAITE Zn4Al2(OH)12(CO3).3H2O H
LIUDONGSHENGITE Zn4Cr2(OH)12(CO3).3H2O R
MANASSEITE = HYDROTALCITE Mg6Al2(CO3)(OH)16.4H2O H
KAZNAKHTITE Ni6Co+++2(CO3)(OH)16.4H2O R
STICHTITE Mg6Cr+++2(CO3)(OH)16.4H2O R
TAKOVITE Ni6Al2(OH)16(CO3,OH).4H2O R
REEVESITE Ni6Fe+++2(CO3)(OH)16.4H2O R
PYROAURITE Mg6Fe+++2(CO3)(OH)16.4H2O R
HYDROTALCITE-3R Mg6Al2(CO3)(OH)16.4H2O R
HYDROTALCITE Mg6Al2(CO3)(OH)16.4H2O R
DESAUTELSITE Mg6Mn+++2(CO3)(OH)16.4H2O R
COMBLAINITE Ni++6Co+++2(CO3)(OH)16.4H2O R
AKOPOVAITE Al4Li2(OH)12(CO3)(H2O)3 M
COALINGITE Mg10Fe+++2(CO3)(OH)24.2H2O R
SLIKITE Zn2Mg(CO3)2(OH)2.4H2O A
MARKLITE Cu5(CO3)2(OH)6.6H2O M
ALEXKHOMYAKOVITE K6(Ca2Na)(CO3)5Cl.6H2O H
With large and medium-sized cations
ALUMOHYDROCALCITE CaAl2(CO3)2(OH)4.3H2O A
NASLEDOVITE PbMn3Al4(CO3)4(SO4)O5.5H2O (?)
PARAALUMOHYDROCALCITE CaAl2(CO3)2(OH)4.6H2O (?)
STRONTIODRESSERITE (Sr,Ca)Al2(CO3)2(OH)4.H2O O
MONTROYALITE Sr4Al8(CO3)3(OH,F)26.10-11H2O A (?)
KOCHSANDORITE CaAl2(CO3)2(OH)4.1,5H2O O
DUNDASITE PbAl2(CO3)2(OH)4.H2O O
DRESSERITE BaAl2(CO3)2(OH)4.H2O O
HYDRODRESSERITE BaAl2(CO3)2(OH)4.3H2O A
SCHUILINGITE-(Nd) PbCu(Nd,Gd,Sm,Y)(CO3)3(OH).1,5H2O O
SERGEEVITE Ca2Mg11(CO3)13-x(HCO3)x(OH)x.10-xH2O (x=4) R
SZYMANSKIITE Hg+16(Ni,Mg)6(CO3)12(OH)12(H3O8).3H2O H
LUSERNAITE-(Y) Y4Al(CO3)2(OH,F)11.6H2O O
PUTNISITE SrCa4Cr+++8(CO3)8SO4(OH)16.25H2O O
GRGURICITE CaCr2(CO3)2(OH)4.4H2O A
With large cations
CALCIOANCYLITE-(La) (LaCa)(CO3)2(OH).H2O O
GYSINITE-(La) PbLa(CO3)2(OH).H2O O
ANCYLITE-(La) Sr(La,Ce)(CO3)2(OH).H2O O
CALCIOANCYLITE-(Nd) Ca(Nd,Ce,Gd,Y)3(CO3)4(OH)3.H2O O
ANCYLITE-(Ce) SrCe(CO3)2(OH).H2O O
KOZOITE-(La) (La,Ce,Nd)(CO3)(OH) O
CALCIOANCYLITE-(Ce) (Ca,Sr)(Ce,REE)(CO3)2(OH).H2O O
GYSINITE-(Nd) Pb(Nd,La)(CO3)2(OH).H2O O
KOZOITE-(Nd) (Nd,La)(CO3)(OH) O
KAMPHAUGITE-(Y) Ca(Y,REE)(CO3)2(OH).H2O Q
SHELDRICKITE NaCa3(CO3)2F3.H2O R
THOMASCLARKITE-(Y) Na(Y,REE)(HCO3)(OH)3.4H2O M ps Q
PETERBAYLISSITE Hg+3(CO3)(OH).2H2O O
CLEARCREEKITE Hg+3(CO3)(OH).2H2O M
NIVEOLANITE NaBeCO3(OH).1-2H2O Q
Uranyl Carbonates
UO2:CO3 > 1:1
URANCALCARITE Ca(UO2)3(CO3)(OH)6.3H2O O
WYARTITE CaU+++++(UO2)2(CO3)O4(OH).7H2O O
OSWALDPEETERSITE (UO2)2CO3(OH)2.4H2O M
ROUBAULTITE Cu2(UO2)3(CO3)2O2(OH)2.4H2O A
KAMOTOITE-(Y) (Y,Nd,Gd)2U++++++4(CO3)3O12.14,5H2O M
SHARPITE Ca(UO2)3(CO3)4.3H2O O
UO2:CO3 = 1:1
RUTHERFORDINE UO2(CO3) O
BLATONITE (UO2)(CO3).H2O H/R (?)
JOLIOTITE (UO2)(CO3).2H2O O
BIJVOETITE-(Y) [(Y,REE)8(H2O)25(UO2)16O8(OH)8(CO3)16](H2O)14 M ps O
UO2:CO3 < 1:1 - 1:2
FONTANITE Ca(UO2)3(CO3)4.3H2O O
ZELLERITE Ca(UO2)(CO3)2.5H2O O
METAZELLERITE Ca(UO2)(CO3)2.3H2O O
EWINGITE Mg8Ca8(UO2)24(CO3)30O4(OH)12(H2O)138 Q
MEYROWITZITE Ca(UO2)(CO3)2.5H2O M
UO2:CO3 = 1:3
BAYLEYITE Mg2(UO2)(CO3)3.18H2O M
SWARTZITE CaMg(UO2)(CO3)3.12H2O M
ALBRECHTSCHRAUFITE Ca4Mg(UO2)2(CO3)6F2.17H2O A
LIEBIGITE Ca2(UO2)(CO3)3.11H2O O
RABBITTITE Ca3Mg3(UO2)2(CO3)6(OH)4.18H2O M
ANDERSONITE Na2Ca(UO2)(CO3)3.6H2O R
GRIMSELITE K3Na(UO2)(CO3)3.H2O H
WIDENMANNITE Pb2(UO2)(CO3)3 O
ZNUCALITE CaZn11(UO2)(CO3)3(OH)20.4H2O A
CEJKAITE Na4(UO2)(CO3)3 A
AGRICOLAITE K4(UO2)(CO3)3 M
BRAUNERITE K2Ca(UO2)(CO3)3.6H2O M
LINEKITE K2Ca3[(UO2)(CO3)3]2.8H2O O
LEOSZILARDITE Na6Mg(UO2)2(CO3)6.6H2O M
MARKEYITE Ca9(UO2)4(CO3)13.28H2O O
NATROMARKEYITE Na2Ca8(UO2)4(CO3)13(H2O)24.3H2O O
PSEUDOMARKEYITE Ca8(UO2)4(CO3)12(H2O)18.3H2O M
PADDLEWHEELITE MgCa5Cu2(UO2)4(CO3)12(H2O)33 M
PARAMARKEYITE Ca2(UO2)(CO3)3.5H2O M
UO2:CO3= 1:4
VOGLITE Ca2Cu++(UO2)(CO3)4.6H2O M
SHABAITE-(Nd) Ca(Nd,Ce,Sm,Gd,Y)2[(UO2)(CO3)3](CO3)2(H2O)10,5 M
UO2:CO3 = 1:5
ASTROCYANITE-(Ce) Cu+2(Ce,Nd,La,Pr,Sm,Ca,Y)2(UO2)(CO3)5(OH)2.3H2O H
With SO4 or SiO4
SCHROCKINGERITE NaCa3(UO2)(CO3)3(SO4)F.10H2O A
LEPERSONNITE-(Nd) Nd4(UO2)24(SiO4)4(CO3)8(OH)28.48H2O O
LEPERSONNITE-(Gd) CaO.(Gd,Dy)2O3.24UO3.8CO2.4SiO2.60H2O O
JEZEKITE Na8[UO2(CO3)3(SO4)2].2H2O H
NITRATES
Without OH or H2O
NITRATINE NaNO3 R
NITER KNO3 O
GWIHABAITE (NH4,K)(NO3) O
NITROBARITE Ba(NO3)2 C
SHILOVITE Cu(NH3)4(NO3)2 O
With OH
GERHARDTITE Cu2(NO3)(OH)3 O
ROUAITE Cu2(NO3)(OH)3 M
NITROPLUMBITE [Pb4(OH)4](NO3)4 M
With H2O
NITROMAGNESITE Mg(NO3)2.6H2O M
NITROCALCITE Ca(NO3)2.4H2O M
With OH (etc.) and H2O
LIKASITE Cu3(NO3)(OH)5.2H2O O
MBOBOMKULITE (Ni,Cu)Al4[(NO3)2,(SO4)](OH)12.3H2O M
HYDROMBOBOMKULITE (Ni,Cu)Al4(NO3,SO4)2(OH)12.14H2O M
SVEITE KAl7(NO3)4Cl2(OH)16.8H2O M
LISLKIRCHNERITE Pb6Al(OH)8Cl2(NO3)5.2H2O M
Carbonates, etc. unclassified
ALDZHANITE = Discredites CaMgB2O4Cl.7H2O O
* BORATES
Monoborates
BO3, without additional anions; 1(D).
SASSOLITE H3BO3 A
NORDENSKIOLDINE CaSnB2O6 R
TUSIONITE Mn++Sn++++(BO3)2 R
JIMBOITE Mn3B2O6 O
KOTOITE Mg3B2O6 O
TAKEDAITE Ca3B2O6 R
BO3, with additional anions; 1(D) + OH, etc.
HAMBERGITE Be2BO3(OH) O
BERBORITE Be2(BO3)(OH,F).H2O R
BERBORITE Be2(BO3)(OH,F).H2O H
JEREMEJEVITE Al6B5O15(F,OH)3 H
YUANFULIITE Mg(Fe+++,Fe++,Al,Ti,Mg)(BO3)O O
WARWICKITE (Mg,Ti,Fe,Cr,Al)2O(BO3) O
KARLITE (Mg,Al)6(BO3)3(OH,Cl)4 O
MARINAITE Cu2Fe+++O2(BO3) M
BONACCORDITE Ni2Fe+++BO5 O
FREDRIKSSONITE Mg2(Mn+++,Fe+++)BO5 O
LUDWIGITE Mg2Fe+++BO5 O
VONSENITE Fe++2Fe+++BO5 O
AZOPROITE (Mg,Fe++)2(Fe+++,Ti,Mg)BO5 O
FOLVIKITE Sb+++++9Mn+++(Mg,Mn++)10O8(BO3)4 M
PINAKIOLITE (Mg,Mn++)2(Mn+++,Sb+++)BO5 M
ORTHOPINAKIOLITE Mn+++7[(Mn++,Mg)xFe+++y[]z](BO3)8O16 (sum x,y,z=17) O
TAKEUCHIITE Mn+++11[(Mn++,Mg)xFe+++y[]z](BO3)12O24 (sum x,y,z=25) O
BLATTERITE Sb+++++3(Mn+++,Fe+++)9(Mn++,Mg)35(BO3)16O32 O
CHESTERMANITE Sb+++++(Mn+++,Fe+++)5[(Mn++,Mg)xFe+++y](BO3)8O16 (sum x,y=18) O
MAGNESIOHULSITE (Mg,Fe++)2(Fe+++,Sn++++,Mg)BO5 M
ALUMINOMAGNESIOHULSITE (Mg,Fe++)2(Al,Mg,Sn)2(BO3)O2 M
HULSITE Fe++2Fe+++O2(BO3) M
FLUOBORITE Mg3(BO3)(F,OH)3 H
HYDROXYLBORITE Mg3(BO3)(OH,F)3 H
WIGHTMANITE Mg5(BO3)O(OH)5.2H2O M
SHABYNITE Mg5(BO3)(Cl,OH)2(OH)5.4H2O M
GAUDEFROYITE Ca4Mn+++3-x(BO3)3(CO3)(O,OH)3 H
SAKHAITE Ca48Mg16(BO3)32(CO3)16.2(H2O,HCl) C
HARKERITE Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16.2(H2O,HCl) C
PERTSEVITE-(F) Mg2(BO3,SiO4)(F,OH)0,5-1 O
PERTSEVITE-(OH) Mg2(BO3,SiO4)(OH,F)0,5-1 O
JACQUESDIETRICHITE Cu2(OH)3BO(OH2) O
RHABDOBORITE-(W) Mg12(W++++++,V+++++)1,5O6{[BO3]6-x[(P,As)O4]xF2-x} (x smaller than 1) H
RHABDOBORITE-(Mo) Mg12Mo++++++1,33O6(BO3)6F2 H
RHABDOBORITE-(V) Mg12(V+++++,Mo++++++,W++++++)1,5O6{[BO3]6-x[(P,As)O4]xF2-x} (x smaller than 1) H
PAINITE CaZrBAl9O18 H
SAVELIEVAITE Mg2Cr+++O2(BO3) O
CHUBAROVITE KZn2(BO3)Cl2 R
B(O,OH)4, without and with additional anions; 1(T), 1(T)+OH, etc
SINHALITE MgAlBO4 O
PSEUDOSINHALITE (Mg,Fe++)2Al3B2O9(OH) M
BEHIERITE (Ta,Nb)BO4 Q
SCHIAVINATOITE (Nb,Ta)BO4 Q
FROLOVITE CaB2(OH)8 A
HEXAHYDROBORITE Ca[B(OH)4]2.2H2O M
HENMILITE Ca2Cu[B(OH)4]2(OH)4 A
BANDYLITE CuB(OH)4Cl Q
TEEPLEITE Na2B(OH)4Cl Q
MOYDITE-(Y) YB(OH)4(CO3) O
CARBOBORITE Ca2Mg(CO3)2B2(OH)8.4H2O M
SULFOBORITE Mg3B2(SO4)(OH)8(OH,F)2 O
LUNEBURGITE Mg3B2(PO4)2(OH)6.5H2O M
SEAMANITE Mn3(PO4)B(OH)6 O
CAHNITE Ca2B(AsO4)(OH)4 Q
Diborates
Neso-diborates with double triangles B2(O,OH)5; 2(2D); 2(2D) + OH, etc.
SUANITE Mg2B2O5 M
CLINOKURCHATOVITE Ca(Mg,Fe++,Mn)B2O5 M
KURCHATOVITE Ca(Mg,Mn,Fe++)B2O5 O
SUSSEXITE MnBO2(OH) M
SZAIBELYITE MgBO2(OH) M
WISERITE (Mn++,Mg)14B8(Si,Mg)O22(OH)10Cl Q
Neso-diborates with double tetrahedra B2O(OH)6; 2(2T)
PINNOITE MgB2O4.3H2O Q
PENTAHYDROBORITE CaB2O(OH)6.2H2O A
Ino-diborates with triangles and/or tetrahedra
CALCIBORITE CaB2O4 O
VIMSITE CaB2O2(OH)4 M
PARASIBIRSKITE Ca2B2O5.H2O M
SIBIRSKITE Ca2B2O4(OH)2 M
SHIMAZAKIITE-4M Ca2B2-xO5-3x(OH)3x (x=0-0,06) M
Tektodiborates with tetrahedra
SANTAROSAITE Cu(B2O4) Q
KRASNOSHTEINITE Al8[B2O4(OH)2](OH)16Cl4.7H2O M
Triborates
Neso-triborates
AMEGHINITE NaB3O3(OH)4 M
INDERITE MgB3O3(OH)5.5H2O M
KURNAKOVITE MgB3O3(OH)5.5H2O A
INDERBORITE CaMg[B3O3(OH)5]2.6H2O M
MEYERHOFFERITE Ca2B6O6(OH)10.2H2O A
INYOITE Ca2B6O6(OH)10.8H2O M
SOLONGOITE Ca2B3O4(OH)4Cl M
PEPROSSIITE-(Ce) (Ce,La)Al2(B4O10)O0,5 H
NIFONTOVITE Ca3B6O6(OH)12(H2O)2 M
OLSHANSKYITE Ca2[B3O3(OH)6](OH)(H2O)3 A
COLEMANITE CaB3O4(OH)3.H2O M
HYDROBORACITE CaMgB6O8(OH)6.3H2O M
HOWLITE Ca2B5SiO9(OH)5 M
JARANDOLITE CaB3O4(OH)3 M
Phyllo-triborates
JOHACHIDOLITE CaAlB3O7 O
Tetraborates
Neso-tetraborates
BORAX Na2B4O5(OH)4.8H2O M
TINCALCONITE Na6[B4O5(OH)4]3.8H2O R
HUNGCHAOITE MgB4O5(OH)4.7H2O A ps H
ROWEITE Ca2Mn++2B4O7(OH)6 O
FEDOROVSKITE Ca2(Mg,Mn)2B4O7(OH)6 O
HYDROCHLORBORITE Ca2B4O4(OH)7Cl.7H2O M
URALBORITE CaB2O2(OH)4 M
BORCARITE Ca4MgB4O6(OH)6(CO3)2 M
NUMANOITE Ca4CuB4O6(CO3)2(OH)6 M
FONTARNAUITE (Na,K)2(Sr,Ca)(SO4)[B5O8(OH)](H2O)2 M
Ino-tetraborates
KERNITE Na2B4O6(OH)2.3H2O M
Phyllo-tetraborates
Tekto-tetraborates
Pentaborates
Neso-pentaborates
LEUCOSTAURITE Pb2[B5O9]Cl.0,5H2O O
SBORGITE NaB5O6(OH)4.3H2O M
RAMANITE-(Cs) CsB5O6(OH)4.4H2O M
RAMANITE-(Rb) RbB5O6(OH)4.4H2O O
SANTITE KB5O6(OH)4.2H2O O
AMMONIOBORITE (NH4)2B10O16.5H2O M
ULEXITE NaCaB5O6(OH)6.5H2O A
Ino-pentaborates
YARZHEMSKIITE K[B5O7(OH)2].H2O M
LARDERELLITE (NH4)B5O6(OH)4 M
EZCURRITE Na4B10O17.7H2O A
PROBERTITE NaCaB5O7(OH)4.3H2O M
TERTSCHITE Ca4B10O19.20H2O M (?)
PRICEITE Ca2B5O7(OH)5.H2O A
Phyllo-pentaborates
BIRINGUCCITE Na2B5O8(OH).H2O M
NASINITE Na2B5O8(OH).2H2O O
GOWERITE CaB6O10.5H2O M
VEATCHITE-A Sr2B11O16(OH)5.H2O A
VEATCHITE Sr2B11O16(OH)5.H2O M
VEATCHITE Sr2B11O16(OH)5.H2O M
VOLKOVSKITE KCa4[B5O8(OH)4][B(OH)3]Cl.4H2O A
TUZLAITE NaCaB5O8(OH)2.3H2O M
HEIDORNITE Na2Ca3B5O8(SO4)2Cl(OH)2 M
BRIANROULSTONITE Ca3B5O6(OH)Cl2.8H2O M
CALCIOVEATCHITE SrCaB11O16(OH)5.H2O M
POPUGAEVAITE Ca3[B5O6(OH)6]FCl2.8H2O M
Tekto-pentaborates
KURGANTAITE CaSrB5O9Cl.H2O A
TYRETSKITE Ca2B5O9(OH).H2O A
HILGARDITE Ca2B5O9Cl.H2O A
Hexaborates
Neso-hexaborates
AKSAITE MgB6O7(OH)6.2H2O O
MCALLISTERITE Mg2B12O14(OH)12.9H2O R
ADMONTITE MgB6O10.7H2O M
RIVADAVITE Na6Mg[B6O7(OH)6]4.10H2O M
TERUGGITE Ca4MgAs2B12O22(OH)12.12H2O M
Ino-hexaborates
ARISTARAINITE Na2MgB12O20.10H2O M
KALIBORITE KHMg2B12O16(OH)10.4H2O M
Phyllo-hexaborates
NOBLEITE CaB6O9(OH)2.3H2O M
TUNELLITE SrB6O9(OH)2.3H2O M
STRONTIOBORITE SrB8O11(OH)4 M
GINORITE Ca2B14O23.8H2O M
STRONTIOGINORITE SrCaB14O20(OH)6.5H2O M
FABIANITE CaB3O5(OH) M
Heptaborates and other megaborates
Tekto-heptaborates
BORACITE Mg3B7O13Cl O ps C
CHAMBERSITE Mn3B7O13Cl O
ERICAITE (Fe++,Mg,Mn)3B7O13Cl O
CONGOLITE (Fe++,Mg,Mn)3B7O13Cl R
TREMBATHITE (Mg,Fe++,Mn)3B7O13Cl R
KORZHINSKITE CaB2O4.H2O M
Phyllo-nonborates, etc.
STUDENITSITE NaCa2B9O14(OH)4.2H2O M
PENOBSQUISITE Ca2(Fe++,Mg)[B9O13(OH)6]Cl.4H2O M
PREOBRAZHENSKITE Mg3B11O15(OH)9 O
WALKERITE Ca16(Mg,Li)2Cl6B52O68(OH)56.28H2O O
Tekto-dodecaborates
LONDONITE (Cs,K,Rb)Al4Be4(B,Be)12O28 C
RHODIZITE (K,Cs)Al4Be4(B,Be)12O28 C
Mega-tektoborates
PRINGLEITE Ca9B26O34(OH)24Cl4.13H2O A
RUITENBERGITE Ca9B26O34(OH)24Cl4.13H2O M
METABORITE HBO2 C
Unclassified borates
VITIMITE Ca6SO4B14O19(OH)14.5H2O M
CLINOMETABORITE HBO2 M
ALFREDSTELZNERITE Ca4(H2O)4[B4O4(OH)6]4(H2O)15 O
QILIANSHANITE NaH4(CO3)(BO3).2H2O M
CANAVESITE Mg2(CO3)(HBO3).5H2O M
EKATERINITE Ca2B4O7(Cl,OH)2.2H2O H
HALURGITE Mg4[B8O13(OH)2]2.7H2O M
WARDSMITHITE Ca5MgB24O42.30H2O H
IQUIQUEITE K3Na4Mg(Cr++++++O4)B24O39(OH).12H2O H
SATIMOLITE KNa2(Al5Mg2)[B12O18(OH)12](OH)6Cl4.4H2O R
CHELKARITE CaMgB2O4(Cl,OH)2.5H2O (?) O
BRAITSCHITE-(Ce) (Ca,Na)7(Ce,La,Nd)2[B6O7(OH)3(O,OH)3]4.(H2O) H
* SULFATES, selenates, tellurates, chromates, molybdates, wolframates
Sulfates (selenates, etc.) without additional anions, without H2O
With small cations
With medium-sized cations
KORYAKITE NaKMg2Al2(SO4)6 R
MILLOSEVICHITE (Al,Fe+++)2(SO4)3 R
MIKASAITE (Fe+++,Al)2(SO4)3 R
ZINKOSITE ZnSO4 O
CHALCOCYANITE CuSO4 O
HERMANNJAHNITE CuZn(SO4)2 M
OTTOITE Pb2Te++++++O5 M
MCALPINEITE Cu++3Te++++++O6.H2O C
ANDYMCDONALDITE Fe2TeO6 Q
DRAVERTITE CuMg(SO4)2 M
DAGENAISITE Zn3Te++++++O6 M
With medium-sized and large cations
VANTHOFFITE Na6Mg(SO4)4 M
PYRACMONITE (NH4)3Fe+++(SO4)3 R ps H
LANGBEINITE K2Mg2(SO4)3 C
MANGANOLANGBEINITE K2Mn2(SO4)3 C
EFREMOVITE (NH4)2Mg2(SO4)3 C
FERROEFREMOVITE (NH4)2Fe++2(SO4)3 C
YAVAPAIITE KFe+++(SO4)2 M
ELDFELLITE NaFe+++(SO4)2 M
SABIEITE (NH4)Fe+++(SO4)2 R
STEKLITE KAl(SO4)2 R
GODOVIKOVITE (NH4)(Al,Fe+++)(SO4)2 H
APHTHITALITE (K,Na)3Na(SO4)2 R
MOHNITE (NH4)K2Na(SO4)2 R
NATROAPHTHITALITE KNa3(SO4)2 R
BELOMARINAITE KNa(SO4) R
ITELMENITE Na4Mg3Cu3(SO4)8 O
SARANCHINAITE Na2Cu(SO4)2 M
MAJZLANITE K2Na(ZnNa)Ca(SO4)4 M
PHILOXENITE (K,Na,Pb)4(Na,Ca)2(Mg,Cu)3(Fe+++0,5Al0,5)(SO4)8 A
PETROVITE Na12Cu2(SO4)8 M
AMGAITE Tl+++2Te++++++O6 R
ALUMINOPYRACMONITE (NH4)3Al(SO4)3 R
With only large cations
ARCANITE K2SO4 0
ARCANITE 'TAYLORITE' K2SO4 O
MASCAGNITE (NH4)2SO4 O
MERCALLITE KHSO4 O
MISENITE K8H6(SO4)7 M
LETOVICITE (NH4)3H(SO4)2 A
THENARDITE Na2SO4 O
GLAUBERITE Na2Ca(SO4)2 M
ANHYDRITE CaSO4 O
METATHENARDITE Na2SO4 H
ANGLESITE PbSO4 O
BARYTE BaSO4 O
CELESTINE SrSO4 O
OLSACHERITE Pb2(SeO4)(SO4) O
PALMIERITE (K,Na)2Pb(SO4)2 R
KALISTRONTITE K2Sr(SO4)2 R
IVSITE Na3H(SO4)2 M
MARKHININITE TlBi(SO4)2 A
CALCIOLANGBEINITE-O K2Ca2(SO4)3 O
MURPHYITE Pb(Te++++++O4) O
BUBNOVAITE K2Na8Ca(SO4)6 R
CALCIOLANGBEINITE K2Ca2(SO4)3 C
DOBROVOLSKYITE Na4Ca(SO4)3 R
Sulfates (selenates, etc.) with additional anions, without H2O
With small cations
With medium-sized cations
BRUMADOITE Cu3Te++++++O4(OH)4.5H2O M
HAUCKITE Fe+++3(Mg,Mn++)24Zn18(SO4)4(CO3)2(OH)81 H
ANTLERITE Cu3(SO4)(OH)4 O
DOLEROPHANITE Cu2(SO4)O M
BROCHANTITE Cu4(SO4)(OH)6 M
RAMACCIONIITE Cu4[SeO4](OH)6 M
CUPROMOLYBDITE Cu3(MoO4)O O
VERGASOVAITE Cu3O[(Mo,S)O4](SO4) O
TAVAGNASCOITE Bi4O4(SO4)(OH)2 O
KLEBELSBERGITE Sb+++4O4(OH)2(SO4) O
SCHUETTEITE Hg3(SO4)O2 H
PARAOTWAYITE Ni(OH)2-x(SO4,CO3)0,5x M
XOCOMECATLITE Cu3Te++++++O4(OH)4 O
PAUFLERITE V++++O(SO4) O
GRANDVIEWITE Cu3Al2(SO4)(OH)10.H2O: M
TIMROSEITE Pb2Cu++5(Te++++++O6)2(OH)2 O
GLIKINITE Zn3O(SO4)2 M
MOJAVEITE Cu6[Te++++++O4(OH)2](OH)7Cl R
PARATIMROSEITE Pb2Cu++4(Te++++++O6)2(H2O)2 O
ISKANDAROVITE Sb6O7(SO4)2 O
WILDCATITE CaFe+++Te++++++O5(OH) R
With medium-sized and large cations
DANSITE-Fe Na21Fe++(SO4)10Cl3 C
DANSITE Na21Mg(SO4)10Cl3 C
DANSITE-Mn Na21Mn++(SO4)10Cl3 C
APATELITE Fe3(SO4)2(OH)5.0,5H2O  
NATROJAROSITE Na2Fe+++6(SO4)4(OH)12 R
WALTHIERITE BaAl6(SO4)4(OH)12 R
SCHLOSSMACHERITE (H3O,Ca)Al3(AsO4,SO4)2(OH)6 R
OSARIZAWAITE Pb2Cu++Al4(SO4)4(OH)12 R
NATROALUNITE-2c (Na,Ca,K)2Al6(SO4)4(OH)12 R
NATROALUNITE Na2Al6(SO4)4(OH)12 R
JAROSITE K2Fe+++6(SO4)4(OH)12 R
AMMONIOJAROSITE (NH4)2Fe+++6(SO4)4(OH)12 R
ARGENTOJAROSITE Ag+2Fe+++6(SO4)4(OH)12 R
BEAVERITE-Cu Pb(Cu++,Fe+++,Al)6(SO4)4(OH)12 R
BEAVERITE-Zn Pb(Fe2Zn)(SO4)2(OH) R
ALUNITE K2Al6(SO4)4(OH)12 R
DORALLCHARITE (Tl,K)2Fe+++6(SO4)4(OH)12 O
HUANGITE CaAl6(SO4)4(OH)12 R
HYDRONIUMJAROSITE (H3O+)2Fe+++6(SO4)4(OH)12 R
AMMONIOALUNITE (NH4)2Al6(SO4)4(OH)12 R
PLUMBOJAROSITE PbFe+++6(SO4)4(OH)12 R
YEELIMITE Ca4Al6O12(SO4) C
PUNINITE Na2Cu3O(SO4)3 M
NABOKOITE Cu++7Te++++O4(SO4)5.KCl Q
ATLASOVITE Cu6Fe+++Bi+++O4(SO4)5.KCl Q
CHLOROTHIONITE K2Cu(SO4)Cl2 O
FEDOTOVITE K2Cu++3O(SO4)3 M
EUCHLORINE KNaCu++3(SO4)3O M
KAMCHATKITE KCu++3OCl(SO4)2 O
PIYPITE K2Cu2(SO4)2O Q
ALUMOKLYUCHEVSKITE K3Cu3(Al,Fe+++)O2(SO4)4 M
KLYUCHEVSKITE K3Cu3(Fe+++,Al)O2(SO4)4 M
BELOUSOVITE KZn(SO4)Cl M
MULLERITE Pb2Fe+++(Te++++++O6)Cl R
ELASMOCHLOITE Na3Cu6BiO4(SO4)5 M
CALEDONITE Pb5Cu2(CO3)(SO4)3(OH)6 O
ELEOMELANITE (K2Pb)Cu4O2(SO4)4 M
WHERRYITE Pb7Cu2(SO4)4(SiO4)2(OH)2 M
FALGARITE K4(VO)3(SO4)5 M
KRASHENINNIKOVITE KNa2CaMg(SO4)3F H
WULFFITE K3NaCu4O2(SO4)4 O
MAMMOTHITE Pb6Cu4AlSb+++++O2(SO4)2Cl4(OH)16 M
PARAWULFFITE K5Na3Cu8O4(SO4)8 M
SHUVALOVITE K2(Ca2Na)(SO4)3F O
MUNAKATAITE Pb2Cu(Se++++O3)(SO4)(OH)4 M
SCHMIEDERITE Pb2Cu++2(Se++++O3)(Se++++++O4)(OH)4 M
THERASIAITE (NH4)3KNa2Fe++Fe+++(SO4)3Cl5 M
SACCOITE Ca2Mn+++2F(OH)8.0,5(SO4) Q
LINARITE PbCu(SO4)(OH)2 M
CHENITE Pb4Cu(SO4)2(OH)6 A
KRIVOVICHEVITE Pb3Al(SO4)(OH)7 R
ANHYDROKAINITE KMg(SO4)Cl  
ZINCOCHENITE Pb4Zn(OH)6(SO4)2 A
FRANKSOUSAITE PbCu(Se++++++O4)(OH)2 M
HAGSTROMITE Pb8Cu++(Te++++++O6)2(CO3)Cl4 O
AGAITE Pb3Cu++Te++++++O5(OH)2(CO3) O
ADRANOSITE (NH4)4NaAl2(SO4)4(OH)2Cl Q
ADRANOSITE-(Fe) (NH4)4NaFe+++2(SO4)4Cl(OH)2 Q
ACMONIDESITE (NH4,K,Pb)8NaFe++4(SO4)5Cl8 O
BACKITE Pb2AlTe++++++O6Cl R
With only large cations
SULPHOHALITE Na6(SO4)2FCl C
SCHAIRERITE Na21(SO4)7F6Cl R
GALEITE Na15(SO4)5F4Cl R
KOGARKOITE Na3(SO4)F M
CESANITE Na3Ca2(SO4)3(OH) H
CARACOLITE Na2(Pb2Na)(SO4)3Cl M ps H
AIOLOSITE Na4Bi+++(SO4)3Cl H
BURKEITE Na6(CO3)(SO4)2 O
HANKSITE KNa22(SO4)9(CO3)2Cl H
CANNONITE Bi2O(OH)2SO4 M
LANARKITE Pb2(SO4)O M
GRANDREEFITE Pb2SO4F2 M
ITOITE Pb3Ge(SO4)2O2(OH)2 O
CHILUITE Bi6Te++++++2Mo++++++2O21 H
HECTORFLORESITE Na9(IO3)(SO4)4 M
PSEUDOGRANDREEFITE Pb6SO4F1O O ps Q
SUNDIUSITE Pb10(SO4)O8Cl2 M
KENNYGAYITE [Pb4O2(OH)2](SO4) A
EVANICHITE Pb6Cr+++(Cr++++++O4)2(SO4)(OH)7FCl R
EVANICHITE Pb6Cr+++(Cr++++++O4)2(SO4)(OH)7FCl  
ADANITE Pb2(Te++++O3)(SO4) M
HASANOVITE KNa(MoO2)(SO4)2 M
Sulfates (selenates, etc.) without additional anions, with H2O
With small cations
PILIPENKOITE KCu(AsO4).H2O M
ALFREDOPETROVITE Al2(Se++++O3)3.6H2O H
With only medium-sized cations
VOUDOURISITE CdSO4.H2O M
COBALTKIESERITE Co(SO4).H2O M
KIESERITE MgSO4.H2O M
GUNNINGITE (Zn,Mn++)SO4.H2O M
POITEVINITE (Cu++,Fe++,Zn)SO4.H2O A
DWORNIKITE (Ni,Fe++)SO4.H2O M
SZMIKITE Mn++SO4.H2O M
SZOMOLNOKITE Fe++SO4.H2O M
SANDERITE MgSO4.2H2O (?)
BONATTITE CuSO4.3H2O M
BELOGUBITE CuZn(SO4)2.10H2O A
STARKEYITE MgSO4.4H2O M
ROZENITE Fe++SO4.4H2O M
BOYLEITE (Zn,Mg)SO4.4H2O M
CRANSWICKITE MgSO4.4H2O M
ILESITE (Mn++,Zn,Fe++)SO4.4H2O M
DROBECITE Cd(SO4).4H2O  
APLOWITE (Co,Mn++,Ni)SO4.4H2O M
JOKOKUITE Mn++SO4.5H2O A
PENTAHYDRITE MgSO4.5H2O A
SIDEROTIL (Fe++,Cu)SO4.5H2O A
CHALCANTHITE Cu++SO4.5H2O A
BIANCHITE (Zn,Fe++)(SO4).6H2O M
CHVALETICEITE (Mn++,Mg)SO4.6H2O M
FERROHEXAHYDRITE Fe++SO4.6H2O M
HEXAHYDRITE MgSO4.6H2O M
MOORHOUSEITE (Co,Ni,Mn++)SO4.6H2O M
NICKELHEXAHYDRITE (Ni,Mg,Fe++)(SO4).6H2O M
RETGERSITE NiSO4.6H2O Q
MALLARDITE Mn++SO4.7H2O M
ZINCMELANTERITE (Zn,Cu++,Fe++)SO4.7H2O M
BOOTHITE CuSO4.7H2O M
BIEBERITE CoSO4.7H2O M
ALPERSITE (Mg,Cu)SO4.7H2O M
MELANTERITE Fe++SO4.7H2O M
MORENOSITE NiSO4.7H2O O
EPSOMITE MgSO4.7H2O O
GOSLARITE ZnSO4.7H2O O
ALUNOGEN Al2(SO4)3.17H2O A
METAALUNOGEN Al4(SO4)6.27H2O M
LAZARIDISITE 3CdSO4.8H2O M
ALUMINOCOQUIMBITE Al2Fe+++2(SO4)6(H2O)12.6H2O R
PARARAISAITE CuMg[Te++++++O4(OH)2].6H2O M
RAISAITE Cu++Mg[Te++++++O4(OH)2].6H2O M
RHOMBOCLASE (H5O2)+Fe+++(SO4)2.2H2O O
PARACOQUIMBITE Fe+++2(SO4)3.9H2O R
COQUIMBITE AlFe+++3(SO4)6(H2O)12.6H2O R
KORNELITE Fe+++2(SO4)3.7H2O M
QUENSTEDTITE Fe+++2(SO4)3.10H2O A
LAUSENITE Fe+++2(SO4)3.6H2O M
ROMERITE Fe++Fe+++2(SO4)4.14H2O A
LISHIZHENITE ZnFe+++2(SO4)4.14H2O A
RANSOMITE CuFe+++2(SO4)4.6H2O M
WUPATKIITE (Co,Mg,Ni)Al2(SO4)4.22H2O M
REDINGTONITE (Fe++,Mg,Ni)(Cr,Al)2(SO4)4.22H2O M
PICKERINGITE MgAl2(SO4)4.22H2O M
HALOTRICHITE Fe++Al2(SO4)4.22H2O M
DIETRICHITE (Zn,Fe++,Mn++)Al2(SO4)4.22H2O M
BILINITE Fe++Fe+++2(SO4)4.22H2O M
APJOHNITE Mn++Al2(SO4)4.22H2O M
MERIDIANIITE MgSO4.11H2O A
With medium-sized and large cations
KRAUSITE KFe+++(SO4)2.H2O M
TAMARUGITE NaAl(SO4)2.6H2O M
KALINITE KAl(SO4)2.11H2O M (?)
MENDOZITE NaAl(SO4)2.11H2O M
TSCHERMIGITE (NH4)Al(SO4)2.12H2O C
ALUM-(K) KAl(SO4)2.12H2O C
ALUM-(Na) NaAl(SO4)2.12H2O C
LANMUCHANGITE TlAl(SO4)2.12H2O C
LONECREEKITE (NH4)(Fe+++,Al)(SO4)2.12H2O C
AMMONIOVOLTAITE (NH4)2Fe++5Fe+++3Al(SO4)12(H2O)18 C
PERTLIKITE K2(Fe++,Mg,Mn++)2(Mg,Fe+++)4Fe+++2Al(SO4)12.18H2O Q ps C
MAGNESIOVOLTAITE K2Mg5Fe+++3Al(SO4)12.18H2O C
AMMONIOMAGNESIOVOLTAITE (NH4)2Mg5Fe+++3Al(SO4)12.18H2O C
ZINCOVOLTAITE K2Zn5Fe+++3Al(SO4)12.18H2O C
VOLTAITE K2Fe++5Fe+++4(SO4)12.18H2O C
KROHNKITE Na2Cu(SO4)2.2H2O M
FERRINATRITE Na3Fe+++(SO4)3.3H2O R
GOLDICHITE KFe+++(SO4)2.4H2O M
LOWEITE Na12Mg7(SO4)13.15H2O R
CHANGOITE Na2Zn(SO4)2.4H2O M
NICKELBLODITE Na2(Ni,Mg)(SO4)2.4H2O M
COBALTOBLODITE Na2(Co,Mg)(SO4)2.4H2O M
BLODITE Na2Mg(SO4)2.4H2O M
MEREITERITE K2Fe++(SO4)2.4H2O M
LEONITE K2Mg(SO4)2.4H2O M
NICKELPICROMERITE K2Ni(SO4)2.6H2O M
NICKELBOUSSINGAULTITE (NH4)2(Ni,Mg)(SO4)2.6H2O M
KATERINOPOULOSITE (NH4)2Zn(SO4)2.6H2O M
BOUSSINGAULTITE (NH4)2Mg(SO4)2.6H2O M
CYANOCHROITE K2Cu++(SO4).6H2O M
MOHRITE (NH4)2Fe++(SO4)2.6H2O M
PICROMERITE K2Mg(SO4)2.6H2O M
POLYHALITE K2Ca2Mg(SO4)4.2H2O A
LEIGHTONITE K2Ca2Cu(SO4)4.2H2O A ps O
AMARILLITE NaFe++(SO4)2.6H2O M
KONYAITE Na2Mg(SO4)2.5H2O M
XOCOLATLITE Ca2Mn++++2Te++++++2O12.H2O M
WATTEVILLEITE Na2Ca(SO4)2.4H2O (?) O (?)
ECKHARDITE (Ca,Pb)Cu++Te++++++O5(H2O) M
ANDYCHRISTYITE PbCu++Te++++++O5(H2O) A
With only large cations
MATTEUCCITE NaHSO4.H2O M
MIRABILITE Na2SO4.10H2O M
LECONTITE (NH4,K)Na(SO4).2H2O O
HYDROGLAUBERITE Na4Ca(SO4)3.2H2O M
EUGSTERITE Na4Ca(SO4)3.2H2O M (?)
GORGEYITE K2Ca5(SO4)6.H2O M
ANTOFAGASTAITE Na2Ca(SO4)2.1,5H2O M
KOKTAITE (NH4)2Ca(SO4)2.H2O M
SYNGENITE K2Ca(SO4)2.H2O M
GYPSUM CaSO4.2H2O M
CHINLEITE-(Y) NaY(SO4)2.H2O R
BASSANITE 2CaSO4.H2O M ps H
ZIRCOSULFATE Zr(SO4)2.4H2O O
SCHIEFFELINITE Pb10Te6O20(OH)14(SO4).5H2O O
MONTANITE Bi+++2Te++++++O6.nH2O M (?)
OMONGWAITE (Na,K)2Ca5(SO4)6.3H2O M ps H
CAMPOSTRINIITE (Bi,Na)3(Na,K)4(SO4)6.H2O M
ARGESITE (NH)4Bi3Cl16 R ps H
Sulfates (selenates, etc.) with additional anions, with H2O
With small cations
With only medium-sized cations; insular octahedra and finite units
SVYAZHINITE (Mg,Mn)(Al,Fe+++)(SO4)2F.14H2O A
MAGNESIOAUBERTITE (Mg,Cu)Al(SO4)2Cl.14H2O A
AUBERTITE CuAl(SO4)2Cl.14H2O A
ROSTITE Al(SO4)(OH).5H2O O
KHADEMITE Al(SO4)F(H2O5) O
JURBANITE Al(SO4)(OH).5H2O M
ORTHOMINASRAGRITE V++++O(SO4).5H2O O
MINASRAGRITE V++++O(SO4).5H2O M
ANORTHOMINASRAGRITE V++++O(SO4).5H2O A
BOBJONESITE V++++O(SO4).3H2O M
KARPOVITE Tl2VO(SO4)2(H2O) M
AMARANTITE Fe+++2(SO4)2O.7H2O A
METAHOHMANNITE Fe+++2(SO4)2O.4H2O (?)
HOHMANNITE Fe+++2(SO4)2O.8H2O A
CALCIOCOPIAPITE CaFe+++4(SO4)6(OH)2.19H2O A
ALUMINOCOPIAPITE (Al,Mg)Fe+++4(SO4)6(OH)2.20H2O A
CUPROCOPIAPITE Cu++Fe+++4(SO4)6(OH)2.20H2O A
ZINCOCOPIAPITE ZnFe+++4(SO4)6(OH)2.18H2O A
MAGNESIOCOPIAPITE MgFe+++4(SO4)6(OH)2.20H2O A
FERRICOPIAPITE (Fe+++,Al,Mg)Fe+++5(SO4)6(OH)2.20H2O A
COPIAPITE Fe++Fe+++4(SO4)6(OH)2.20H2O A
With only medium-sized cations; chains of edge-sharing octahedra
METAALUMINITE Al2(SO4)(OH)4.5H2O M
ALUMINITE Al2(SO4)(OH)4.7H2O M ps O
PARABUTLERITE Fe+++(SO4)(OH).2H2O O
BUTLERITE Fe+++(SO4)(OH).2H2O M
FIBROFERRITE Fe+++(SO4)(OH).5H2O M
XITIESHANITE Fe+++(SO4)(OH).7H2O M
ZINCOBOTRYOGEN (Zn,Mg,Mn)Fe+++(SO4)2(OH).7H2O M
BOTRYOGEN MgFe+++(SO4)2(OH).7H2O M
GUILDITE CuFe+++(SO4)2(OH).4H2O M
CHAIDAMUITE CuFe(SO4)2(OH).4H2O A ps M
PAULADAMSITE Cu4(SeO3)(SO4)(OH)4.2H2O A
RIOTINTOITE Al(SO4)(OH).3H2O A
THORNEITE Pb6(Te++++++2O10)(CO3)Cl2(H2O) M
VENDIDAITE Al2(SO4)Cl(OH)3.6H2O M
With only medium-sized cations; sheets of edge-sharing octahedra
FELSOBANYAITE Al4(SO4)(OH)10.4H2O H
LLANTENESITE Cu6Al[SeO4](OH)12Cl.3H2O R
LANGITE Cu4(SO4)(OH)6.2H2O M
WROEWOLFEITE Cu4(SO4)(OH)6.2H2O M
POSNJAKITE Cu4(SO4)(OH)6.H2O M
GOBELINITE CoCu4(SO4)2(OH)6.6H2O M
FEHRITE MgCu4(SO4)2(OH)6.6H2O M
KOBYASHEVITE Cu5(SO4)2(OH)6.4H2O A
SPANGOLITE Cu6Al(SO4)(OH)12Cl.3H2O R
KTENASITE (Cu,Zn)5(SO4)2(OH)6.6H2O M
CHRISTELITE Zn3Cu2(SO4)2(OH)6.4H2O A
ORTHOSERPIERITE Ca(Cu,Zn)4(SO4)2(OH)6.3H2O O
NIEDERMAYRITE Cu4Cd(SO4)2(OH)6.4H2O M
EDWARDSITE Cd2(Cu,Zn)3(SO4)2(OH)3.4H2O M
DEVILLINE CaCu4(SO4)2(OH)6.3H2O M
CAMPIGLIAITE Cu++4Mn++(SO4)2(OH)6.4H2O M
SERPIERITE Ca(Cu,Zn)4(SO4)2(OH)6.3H2O M
MOTUKOREAITE NaMg6Al3(SO4)2(OH)18.12H2O H
CARRBOYDITE (Ni,Cu)14Al9(SO4,CO3)6(OH)43.7H2O (?) H
GLAUCOCERINITE (Zn,Cu)10Al6(SO4)3(OH)32.18H2O H
HONESSITE Ni6Fe+++2(SO4)(OH)16.4H2O R
HYDROHONESSITE Ni6Fe+++2(SO4)(OH)16.7H2O H
ZINCALUMINITE Zn6Al6(SO4)2(OH)26.5H2O H (?)
ZINCOWOODWARDITE (Zn,Cu)5,5-4Al2,5-4(SO4)1,5-2(OH)16.5-8H2O R ps H
HYDROWOODWARDITE [Cu1-xAlx(OH)2][(SO4)0,5x(H2O)n] (x lower than 0,67; n = about 1,5x) R
WOODWARDITE Cu6Al2[(OH)16(SO)4].2,5-3H2O R
WERMLANDITE Mg7Al2(OH)18[Ca(H2O)6][SO4]2.6H2O R
SHIGAITE NaMn++6Al3(SO4)2(OH)18.12H2O R
NIKISCHERITE NaFe++6Al3(SO4)2(OH)18.12H2O R
NATROGLOCOCERINITE Zn6Al3(OH)18[Na(H2O)6](SO4)2.6H2O H
NATROGLAUCOCERINITE Zn6Al3(OH)18[Na(H2O)6](SO4)2.6H2O  
MOUNTKEITHITE (Mg,Ni)11(Fe+++,Cr,Al)3(OH)24(SO4,CO3)3,5.11H2O H
ISSELITE Cu6(SO4)(OH)10(H2O4).H2O O
TORREYITE (Mg,Mn)9Zn4(SO4)2(OH)22.8H2O M
LAWSONBAUERITE (Mn,Mg)9Zn4(SO4)2(OH)22.8H2O M
HODGESMITHITE (Cu,Zn)6Zn(SO4)2(OH)10.3H2O R
MOOREITE (Mg,Zn,Mn)15(SO4)2(OH)26.8H2O M
LAHNSTEINITE Zn4(SO4)(OH)6.3H2O A ps H
MINOHLITE (Cu,Zn)7(SO4)2(OH)10.8H2O R ps H
NAMUWITE (Zn,Cu)4(SO4)(OH)6.4H2O H
LAURANIITE Cu6Cd2(SO4)2(OH)12.5H2O M
BECHERERITE Zn7Cu(OH)13[SiO(OH)3](SO4) R
RAMSBECKITE (Cu,Zn)15(SO4)4(OH)22.6H2O M
VONBEZINGITE Ca6Cu++3(SO4)3(OH)12.2H2O M
REDGILLITE Cu6(SO4)(OH)10.H2O M
NICKELALUMITE NiAl4(SO4)(OH)12(H2O)3 M
KYRGYZSTANITE (Zn,Ni)Al4(SO4)(OH)12.3H2O M
CHALCOALUMITE CuAl4(SO4)(OH)12(H2O)3 M
THERESEMAGNANITE NaCo4(SO4)(OH)6Cl.6H2O R
SCHULENBERGITE (Cu,Zn)7(SO4,CO3)2(OH)10.3H2O R
GUARINOITE (Zn,Co,Ni)6(SO4)(OH,Cl)10.5H2O H
MONTETRISAITE Cu6(SO4)(OH)10.H2O O
With only medium-sized cations; unclassified
MANGAZEITE Al2(SO4)(OH)4.3H2O A
CYANOTRICHITE Cu4Al2(SO4)(OH)12.2H2O O
CARBONATECYANOTRICHITE Cu++4Al2(CO3,SO4)(OH)12.2H2O O
SCHWERTMANNITE Fe+++16O16(OH)12(SO4)2 Q
TLALOCITE (Cu,Zn)16(Te++++O3)(Te++++++O4)2Cl(OH)25.27H2O M (?)
UTAHITE MgCu++4Zn2Te++++++3O14(OH)4.6H2O A
COQUANDITE Sb6+xO8+x(SO4)(OH)x.(H2O)1-x (x = 0,3) A
OSAKAITE Zn4(SO4)(OH)6.5H2O A
ALTERITE Zn2Fe+++4(SO4)4(C2O4)2(OH)4.17H2O M
BARROTITE Cu9Al(HSiO4)2[(SO4)(HAsO4)0,5](OH)12.8H2O R
WILCOXITE MgAl(SO4)2F.18H2O A
TIBERIOBARDIITE {Cu9Al[SiO3(OH)]2(OH)12(H2O)6}(SO4)1,5.10H2O R
BOUSKAITE MoO2)2O(SO3OH)2(H2O)2.2H2O A
STANLEYITE V++++O(SO4).6H2O O
KHANGALASITE Fe(SO4)(OH).2H2O A
HYDROBASALUMINITE Al4(SO4)(OH)10.12-36H2O M
VOLASCHIOITE Fe+++4(SO4)O2(OH)6.2H2O M
ZAHERITE Al12(SO4)5(OH)26.20H2O A
CAMEROLAITE Cu6Al3(OH)18(H2O)2[Sb(OH)6](SO4) M
MAGNESIOALTERITE Mg2Fe+++4(SO4)4(C2O4)2(OH)4.17H2O M
COSSAITE (Mg0,5,[])Al6(SO4)6(HSO4)F6.36H2O R ps H
With large and medium-sized cations
UKLONSKOVITE NaMg(SO4)F·2H2O M
KALIOCHALCITE KCu2(SO4)2[(OH)(H2O)] M
KAINITE KMgSO4Cl.2,75H2O M
NATROCHALCITE NaCu2(SO4)2(OH,H2O)2 M
GENPLESITE Ca3Sn(SO4)2(OH)6.3H2O H
METASIDERONATRITE Na2Fe+++(SO4)2(OH).H2O O
SIDERONATRITE Na2Fe+++(SO4)2(OH).3H2O O
SCHAURTEITE Ca3Ge++++(SO4)2(OH)6.3H2O H
MALLESTIGITE Pb3Sb+++++(SO4)(AsO4)(OH)6.3H2O H
DESPUJOLSITE Ca3Mn++++(SO4)2(OH)6.3H2O H
FLEISCHERITE Pb3Ge(SO4)2(OH)6.3H2O H
SLAVIKITE (H3O+)3Mg6Fe15(SO4)21(OH)18.98H2O R
METAVOLTINE K2Na6Fe++Fe+++6(SO4)12O2.18H2O H
LANNONITE HCa4Mg2Al4(SO4)8F9.32H2O Q
VLODAVETSITE AlCa2(SO4)2F2Cl.4H2O Q
PERETAITE CaSb+++4O4(OH)2(SO4)2.2H2O M
CALAMAITE Na2TiO(SO4)2.2H2O O
GORDAITE NaZn4Cl(OH)6(SO4).6H2O R
HUIZINGITE-(Al) (NH4)9Al3(SO4)8(OH)2.4H2O A
SCORDARIITE K8(Fe+++0,67[]0,33)[Fe+++3O(SO4)6]2.14H2O R
CLAIRITE (NH4)2(Fe+++,Mn+++)3(SO4)4(OH)3.3H2O A
GIACOVAZZOITE K5Fe+++3O(SO4)6.10H2O M
MAGNANELLIITE K3Fe+++2(SO4)4(OH)(H2O)2 M
ARZRUNITE Cu4Pb2(SO4)(OH)4Cl6.2H2O (?) O
EVDOKIMOVITE Tl4(VO)3(SO4)5(H2O)5 M
BRIDGESITE-(Ce) CaCe2Cu6(SO4)4(OH)12.H2O M
ELYITE Pb4Cu(SO4)O2(OH)4.H2O M
LAUTENTHALITE PbCu++4(OH)6(SO4)2.3H2O M
YECORAITE Bi5Fe+++3(Te++++O3)(Te++++++O4)2O9.9H2O Q or H
RIOMARINAITE Bi(OH)SO4.H2O M
DUKEITE Bi+++24Cr++++++8O57(OH)6.3H2O R
ERSSONITE CaMg7Fe+++2(OH)18(SO4)2.12H2O R
HAYWOODITE [Pb(H2O)10][Zn12(OH)20(H2O)(SO4)3]  
CHEROKEEITE [Pb2Zn(OH)4](SO4).H2O M
POELLMANNITE Ca6Al3(OH)18[Na(H2O)6](SO4)2.6H2O R
FLAGGITE Pb4Cu++4Te++++++2(SO4)2O11(OH)2(H2O) A
AMMONIOMATHESIUSITE (NH4)5(UO2)4(SO4)4(VO5).4H2O Q
ALDRIDGEITE (Cd,Ca)(Cu,Zn)4(SO4)2(OH)6.3H2O M
CHROMSCHIEFFELINITE Pb10Te++++++6O20(OH)14(CrO4).5H2O O
CARLSONITE (NH4)5Fe+++3O(SO4)6.7H2O A
BAIRDITE Pb2Cu++4Te++++++2O10(OH)2(SO4)(H2O) M
ALCAPARROSSAITE K3Ti++++Fe+++(SO4)4O(H2O)2 M
With large and medium-sized cations; * With NO3, CO3, B(OH)4, SiO4 or IO3
DARAPSKITE Na3(SO4)(NO3).H2O M
HUMBERSTONITE K3Na7Mg2(SO4)6(NO3)2.6H2O R
UNGEMACHITE K3Na8Fe+++(SO4)6(NO3)2.6H2O R
CLINOUNGEMACHITE K2Na3Fe(SO4)6(OH)3.9H2O M ps R
CARRARAITE Ca3Ge++++(OH)6(SO4)(CO3).12H2O H
IMAYOSHIITE Ca3Al(CO3)[B(OH)4](OH)6.12H2O H
CHIYOKOITE Ca3Si(CO3)[B(OH)4]O(OH)5.12H2O H
JOURAVSKITE Ca6Mn++++2(SO4,CO3)4(OH)12.26H2O H
ETTRINGITE Ca6Al2(SO4)3(OH)12.26H2O H
THAUMASITE Ca6Si2(CO3)2(SO4)2(OH)12.24H2O H
TATARINOVITE ??3Al(SO4)[B(OH)4](OH)6.12H2O H
STURMANITE Ca6(Fe+++,Al,Mn++)2(SO4)2[B(OH)4](OH)12.25H2O H
KOTTENHEIMITE Ca3Si(OH)6(SO4)2.12H2O H
HIELSCHERITE Ca3Si(OH)6(SO4)(SO3).11H2O H
CHARLESITE Ca6(Al,Si)2(SO4)2B(OH)4(OH,O)12.26H2O H
BURYATITE Ca3(Si,Fe+++,Al)(SO4)[B(OH)4](O,OH)5O.12H2O R ps H
BENTORITE Ca6(Cr,Al)2(SO4)3(OH)12.26H2O H
SIWAQAITE Ca6Al2(CrO4)3(OH)12.26H2O R
KORKINOITE Ca4(SO4)2(CO3)2.9(H2O)  
RAPIDCREEKITE Ca2(SO4)(CO3).4H2O O
TATARSKITE Ca6Mg2(SO4)2(CO3)2Cl4(OH)4.7H2O O
NAKAURIITE Cu8(SO4)4(CO3)(OH)6.48H2O O
CHESSEXITE Na4Ca2(Mg,Zn)3Al8(SiO4)2(SO4)10(OH)10.40H2O O
CARLOSRUIZITE K6(Na,K)4Na6Mg10(Se++++++O4)12(IO3)12.12H2O R
FUENZALIDAITE K6(Na,K)4Na6Mg10(SO4)12(IO3)12.12H2O R
CHELYABINSKITE (Ca,Mg)3Si(OH)6(SO4,CO3)2.9H2O O
RAMAZZOITE [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0,33SO4)3(H2O)36] C
ZINCOMENITE ZnSeO3 O
MATHESIUSITE K5(UO2)4(SO4)4(VO5)(H2O)4 Q
BIRUNITE Ca18(SiO3)8,5(CO3)8,5(SO4).15H2O ?
Uranyl sulfates
Without cations
URANOPILITE (UO2)6(SO4)(OH)6O2.14H2O A
METAURANOPILITE (UO2)6(SO4)(OH)10.5H2O M
JACHYMOVITE (UO2)8(SO4)(OH)14.13H2O M (?)
SHUMWAYITE (UO2)2(SO4)2.5H2O M
SCENICITE [(UO2)(H2O)2(SO4)]2.3H2O O
With medium-sized cations
MEITNERITE (NH4)(UO2)(SO4)(OH).2H2O A
JOHANNITE Cu(UO2)2(SO4)2(OH)2.8H2O A
DELIENSITE Fe++(UO2)2(SO4)2(OH)2.3H2O O
RIETVELDITE Fe(UO2)(SO4)2(H2O)5 O
LEYDETITE Fe(UO2)(SO4)2(H2O)11 M
MAGNESIOLEYDETITE Mg(UO2)(SO4)2.11H2O M
STRASSMANNITE Al(UO2)(SO4)2F.16H2O M
GREENLIZARDITE (NH4)Na(UO2)2(SO4)2(OH)2.4H2O A
MARKCOOPERITE Pb(UO2)Te++++++O6 M ps Q
SHINARUMPITE [Co(H2O)6][(UO2)(SO4)2(H2O)].4H2O M
GURZHIITE Al(UO2)(SO4)2F.10H2O A
BOBCOOKITE NaAl(UO2)2(SO4)4.18H2O A
ALWILKINSITE-(Y) Y(UO2)3(SO4)2O(OH)3(H2O)7.7H2O O
With medium-sized and large cations
AMMONIOZIPPEITE (NH4)2[(UO2)2(SO4)O2].H2O O
PLAVNOITE K0,8Mn0,6[(UO2)2O2(SO4)].3,5H2O M
COBALTZIPPEITE Co(UO2)2(SO4)O2.3,5H2O M
MAGNESIOZIPPEITE Mg(UO2)2(SO4)O2.3,5H2O M
NATROZIPPEITE Na5(UO2)8(SO4)4O5(OH)3.12H2O M
NICKELZIPPEITE Ni(UO2)2(SO4)O2.3,5H2O M
ZINCZIPPEITE Zn(UO2)2(SO4)O2.3,5H2O M
ZIPPEITE K1,85H+0,15[(UO2)4O2(SO4)2(OH)2](H2O)4 M
REDCANYONITE (NH4)2Mn[(UO2)4O4(SO4)2](H2O)4 M
SVORNOSTITE K2Mg[(UO2)(SO4)2]2.8H2O O
RABEJACITE Ca2[(UO2)4O4(SO4)2](H2O)8 A
MARECOTTITE Mg3(H2O)18[(UO2)4O3(OH)(SO4)2]2.10H2O A
SEJKORAITE-(Y) (Y1,98Dy0,24)H+0,34[(UO2)8O88O7OH(SO4)4](OH)(H2O)26 A
PSEUDOJOHANNITE Cu3(OH)2[(UO2)4O4(SO4)2](H2O)12 A
BLUELIZARDITE Na7(UO2)(SO4)4Cl(H2O)2 M
MEISSERITE Na5(UO2)(SO4)3(SO3OH)(H2O) A
OPPENHEIMERITE Na2(UO2)(SO4)2.3H2O A
FERMIITE Na4(UO2)(SO4)3.3H2O O
FEYNMANITE Na(UO2)(SO4)(OH).3,5H2O M
PLASILITE Na(UO2)(SO4)(OH).2H2O M
GESCHIEBERITE K2(UO2)(SO4)2.2H2O O
OTTOHAHNITE Na6(UO2)2(SO4)5(H2O)7.1,H2O A
PELIGOTITE Na6(UO2)(SO4)4(H2O)4 A
KLAPROTHITE Na6(UO2)(SO4)4.4H2O M
LUSSIERITE Na10[(UO2)(SO4)4](SO4)2(H2O)3 M
NAVROTSKYITE K2Na10(UO2)3(SO4)9.2H2O O
PSEUDOMEISSERITE-(NH4) (NH4)2Na4[(UO2)2(SO4)5].4H2O M
WETHERILLITE Na2Mg(UO2)2(SO4)4.18H2O Na2Mg(UO2)2(SO4)4.18H2O M
OLDSITE K2Fe++[(UO2)(SO4)2]2(H2O)8 O
NITSCHEITE (NH4)2[(UO2)2(SO4)3(H2O)2].3H2O M
SEABORGITE LiK2Na6(UO2)(SO4)5(SO3OH)(H2O) A
BESHTAUITE (NH4)2(UO2)(SO4)2.2H2O M
ADOLFPATERAITE K(UO2)(SO4)(OH).H2O M
Chromates
Without additional anions
TARAPACAITE K2CrO4 O
CHROMATITE CaCrO4 Q
HASHEMITE Ba(Cr,S)O4 O
CROCOITE PbCrO4 M
With additional O,V, S, Cl
GEORGEROBINSONITE Pb4(CrO4)2(OH)2FCl O
PHOENICOCHROITE Pb2(CrO4)O M
SANTANAITE Pb11CrO16 H
WATTERSITE Hg+4Hg++Cr++++++O6 M
DEANESMITHITE Hg+2Hg++3Cr++++++O5S2 A
EDOYLERITE Hg++3Cr++++++O4S2 M
REYNOLDSITE Pb2Mn++++2O5(CrO4) A
With PO4, AsO4, SiO4
VAUQUELINITE Pb2Cu++(CrO4)(PO4)(OH) M
FORNACITE (Pb,Cu++)3[(Cr,As)O4]2(OH) M
MOLYBDOFORNACITE Pb2Cu[(As,P)O4][(Mo,Cr)O4](OH) M
IRANITE Pb10Cu(CrO4)6(SiO4)2(F,OH)2 A
RAYGRANTITE Pb10Zn(SO4)6(SiO4)2(OH)2 A
HEMIHEDRITE Pb10Zn(CrO4)6(SiO4)2(OH)2 A
EMBREYITE Pb5(CrO4)2(PO4)2.H2O M
CASSEDANNEITE Pb5(VO4)2(CrO4)2.H2O M
Dichromates
LOPEZITE K2Cr++++++2O7 A
Molybdates, Wolframates and Niobates
Without additional anions or H2O
WULFENITE PbMoO4 Q
FERGUSONITE-(Ce) (Ce,Nd,La)NbO4.0,3H2O M
FERGUSONITE-(Nd) (Nd,Ce)(Nb,Ti)O4 M
FERGUSONITE-(Y) YNbO4 Q
POWELLITE CaMoO4 Q
SCHEELITE CaWO4 Q
STOLZITE PbWO4 Q
SUSEINARGIUITE Na0,5Bi0,5(MoO4) Q
IWASHIROITE-(Y) Y(Ta,Nb)O4 M
FORMANITE-(Y) YTaO4 Q
PARANIITE-(Y) Ca2Y(AsO4)(WO4)2 Q
TAKANAWAITE-(Y) Y(Ta,Nb)O4 M
With additional anions and/or H2O
LINDGRENITE Cu3(MoO4)2(OH)2 M
SZENICSITE Cu3MoO4(OH)4 O
CUPROTUNGSTITE Cu++3(WO4)2(OH)2 Q
HUENITE Cu4(MoO4)3(OH)2 R
PHYLLOTUNGSTITE CaFe+++3H(WO4)6.10H2O O
RANKACHITE CaFe++V+++++4W++++++8O36.12H2O O
FERRIMOLYBDITE Fe2(MoO4)3.nH2O O (?)
MPOROROITE W++++++AlO3(OH)3.2H2O A (?)
ANTHOINITE AlWO3(OH)3 A
ObRADOVICITE-KCu H4(K,Na)Cu++Fe+++2(AsO4)(MoO4)5.12H2O O
OBRADOVICITE-NaNa [Na2(H2O)16Na(H2O)6][Mo8As2Fe+++3O33(OH)4] O
PARAMENDOZAVILITE NaAl4Fe+++7(PO4)5(P+++++Mo++++++12O40)(OH)16.56H2O M/A
MENDOZAVILITE-NaFe (Na,K)(Ca,Mg)2Fe+++3(PO4)2(Mo++++++8O28)(OH).9H2O M
OBRADOVICITE-NaCu Na2(H2O)17Cu(H2O)6][Mo8As2Fe+++3O34(OH)3] O
MENDOZAVILITE-KCa [K2(H2O)15Ca(H2O)6][Mo8P2Fe+++3O34(OH)3] M
TANCAITE-(Ce) Fe+++(Ce,La,Nd)(MoO4)3.3H2O R ps C
MENDOZAVILITE-NaCu [Na2(H2O)15Cu(H2O)6][Mo8P2Fe+++3O34(OH)3] M
HANSESMARKITE Ca2Mn2Nb6O19.20H2O A
PETERANDRESENITE Mn4Nb6O19.14H2O M
MELCHERITE Ba2Na2Mg[Nb6O19].6H2O R
ICHNUSAITE Th(MoO4)2.3H2O M
MARKASCHERITE Cu3(MoO4)(OH)4 M
NURAGHEITE Th(MoO4)2.H2O M
OPHIRITE Ca2Mg4[Zn2Mn+++2(H2O)2(Fe+++W9O34)2].46H2O A
Uranium and uranyl molybdates and wolframates
With U4+
SEDOVITE U(MoO4)2 O
COUSINITE MgU2Mo2O11.6H2O (?)
MOLURANITE H4U++++(UO2)3(MoO4)7.18H2O am.
With U6+
CALCURMOLITE ((Ca1-xNax)2(UO2)3(MoO4)2(OH)6-x.nH2O M
TENGCHONGITE CaU++++++6Mo++++++2O25.12H2O O
URANOTUNGSTITE (Fe++,Ba,Pb)(UO2)2WO4(OH)4.12H2O O
Thiosulfates
Thiosulfates of Pb
SIDPIETERSITE Pb4(S2O3)O2(OH)2 A
STEVERUSTITE Pb++5Cu+(S++++++O3S--)3(OH)5.2H2O M
FASSINAITE Pb++2(S2O3)(CO3) O
NORTHSTARITE Pb6(Te++++O3)5(S++++++O3S--) H
CUBOTHIOPLUMBITE [Pb4(OH)4]Pb(S2O3)3 C
SULFATOREDMONDITE [Pb8O2Zn(OH)6](SO4)4.6H2O M
BOOJUMITE Pb8O4(OH)2(S2O3)3 O
HYDROREDMONDITE [Pb8O2Zn(OH)6](S2O3)4.2H2O M
REDMONDITE [Pb8O2Zn(OH)6](S2O3)4 M
FINESCREEKITE [Pb4(OH)4](S2O3)2 O
HEXATHIOPLUMBITE [Pb4OH4]Pb(S2O3)3 H
HAYELASDIITE [Pb4O1,5(OH)2,5]2[Cu+5(S2O3)4(S2O2OH)2(H2O)].4H2O A
Sulfates, etc. unclassified
CRYPTOCHALCITE K2Cu5O(SO4)5 A
KONONOVITE NaMg(SO4)F M
CESIODYMITE CsKCu5O(SO4)5 A
BEHOUNEKITE U++++(SO4)2.4H2O O
BELAKOVSKIITE Na7(UO2)(SO4)4(SO3OH)(H2O)3 A
CAMINITE Mg7(SO4)5(OH)4.H2O Q
BALICZUNICITE Bi2O(SO4)2 A
BAUMOITE Ba0,5[(UO2)3O8Mo2(OH)3](H2O)3 M
WITZKEITE K4Na4Ca(SO4)4(NO3)2.2H2O M
LEGUERNITE Bi38O42(SO4)15 M
MANGANOBLODITE Na2(Mn++,Mg)(SO4)2.4H2O M
* PHOSPHATES, ARSENATES, VANADATES
Phosphates, etc. without additional anions, without H2O
With small cations (some also With larger ones)
BERLINITE AlPO4 R
ALARSITE AlAsO4 R
BERYLLONITE NaBePO4 M
HURLBUTITE CaBe2(PO4)2 M
LITHIOPHOSPHATE Li3PO4 O
NALIPOITE NaLi2PO4 O
OLYMPITE LiNa5(PO4)2 O
With medium-sized cations
MICHALSKIITE Cu++Mg3Fe+++3,33(VO4)6 Fe+++1,33Cu++2(MgFe+++)2(VO4)6 O
FARRINGTONITE Mg3(PO4)2 M
SIMFERITE Li0,5(Mg,Mn+++)5(PO4)3 O
HETEROSITE Fe+++PO4 O
KARENWEBBERITE Na(Fe++,Mn++)PO4 O
LITHIOPHILITE LiMnPO4 O
NATROPHILITE NaMnPO4 O
FERRISICKLERITE Li(Fe+++,Mn++)PO4 O
SICKLERITE Li(Mn++,Fe+++)PO4 O
TRIPHYLITE LiFe++PO4 O
PURPURITE Mn+++PO4 O
ZAVALIAITE (Mn++,Fe++,Mg)3(PO4)2 M
CHOPINITE (Mg,Fe++)3(PO4)2 M
SARCOPSIDE (Fe++,Mn,Mg)3(PO4)2 M
BEUSITE Mn++Mn++2(PO4)2 M
GRAFTONITE Fe++Fe++2(PO4)2 M
GRAFTONITE-(Ca) CaFe++2(PO4)2 M
GRAFTONITE-(Mn) MnFe++2(PO4)2 M
XANTHIOSITE Ni3(AsO4)2 M
PARALAMMERITE Fe+++1,33Cu2++2(MgFe+++)2(VO4)6  
LAMMERITE-Beta = PARALAMMERITE Cu3(AsO4)2 M
LAMMERITE Cu3[(As,P)O4]2 M
MCBIRNEYITE Cu3(VO4)2 A
PSEUDOLYONSITE (Cu,Zn)3(VO4)2 M
STRANSKIITE Zn2Cu++(AsO4)2 A
LYONSITE Cu++3Fe+++4(VO4)6 O
NIASITE Ni++4,5(AsO4)3 Q
BORISENKOITE Cu3[(V,As)O4]2 M
BEUSITE-(Ca) CaMn++2(PO4)2 M
JOHANNGEORGENSTADTITE Ni++4,5(AsO4)3 M
RODOLICOITE Fe+++(PO4) R
With medium-sized and large cations
KOKSHAROVITE CaMg2Fe+++4(VO4)6 A
GRIGORIEVITE Cu3Fe+++2Al2(VO4)6 A
ZIMINAITE Fe+++6(VO4)6 A
MAGNESIOHATERTITE (Na,Ca)2Ca(Mg,Fe+++)2(AsO4)3 M
FERROALLUAUDITE-Na_Na Na4Na4Fe++4Fe+++8(PO4)12 M
ALLUAUDITE-Na[] []4Na4Mn++4Fe+++8(PO4)12 M
ODANIELITE Na[]ZnZn2(AsO4)[AsO3(OH)]2 M
CALCIOJOHILLERITE NaCaMg3(AsO4)3 M
ALLUAUDITE-Ca[] []4Ca4Mn++4Fe+++8(PO4)12 M
KHRENOVITE Na3Fe+++2(AsO4)3 M
ERIKAPOHLITE ([]0,5Cu0,5)CuCaZn2(AsO4)3.H2O M
HATERTITE NaNaCa(Cu++Fe+++)(AsO4)3 M
HAGENDORFITE-NaNa Fe++Mn++(PO4)-(Na)(Na) M
HOWARDEVANSITE NaCu++Fe+++2(VO4)3 A
MAGNESIOCANUTITE Na[]MnMg2[AsO4]2[AsO2(OH)2] M
FERROBOBFERGUSONITE []Na2Fe++5Fe+++Al(PO4)6 M
NICKENICHITE Na(Ca0,5Cu0,5)MgMg2(AsO4)3 M
CARYINITE NaCaCaMn2(AsO4)3 M
VARULITE Na2Mn(MnFe+++)(PO4)3 M
MAGHAGENDORFITE Na2MgFe++Fe+++(PO4)3 M
JOHILLERITE NaCuMgMg2(AsO4)3 M
HAGENDORFITE Na2MnFe++Fe+++(PO4)3 M
GROATITE []NaCaMn2(PO4)(HPO4)2 M
FERROHAGENDORFITE NaCaFe++Fe++2(PO4)3 M
FERROALLUAUDITE (Na,Ca)Fe++(Fe+++,Mn++,Fe++)2(PO4)3 M
ARSENIOPLEITE NaCaMn++(Mn++,Mg)2(AsO4)3 M
ALLUAUDITE []NaMnFe+++2(PO4)3 M
BRADACZEKITE NaCuCuCu2(AsO4)3 M
FERROWYLLIEITE NaNaFe++(Fe++Al)(PO4)3 M
WYLLIEITE NaNaMn(Fe++Al)(PO4)3 M
ROSEMARYITE []NaMn(Fe3+Al)(PO4)3 M
QINGHEIITE NaNaMn(MgAl)(PO4)3 M
FERROROSEMARYITE []NaFe++(Fe+++Al)(PO4)3 M
BOBFERGUSONITE []Na2Mn5Fe+++Al(PO4)6 M
FERROQINGHEIITE NaNaFe2+(MgAl)(PO4)3 M
CZOCHRALSKIITE Na4Ca3Mg(PO4)4 O
MANITOBAITE (Na,Ca)3(Mn++,Fe++)5(Al,Fe+++)1,5(PO4)6 M
MARICITE NaFe++PO4 O
MATYHITE Ca9(Ca0,5[]0,5)Fe++(PO4)7 R
HEDEGAARDITE (Ca,Na)9(Ca,Na)Mg(PO4)6(PO3OH) R
BERZELIITE {Ca2Na}[Mg2](As+++++3)O12 C
MANGANBERZELIITE {Ca2Na}[Mn++2](As+++++3)O12 C
PALENZONAITE {Ca2Na}[Mn++2](V+++++3)O12 C
PARABERZELIITE NaCaCaMg2(AsO4)3 M
SCHAFERITE {Ca2Na}[Mg2](V+++++3)O12 C
BRIANITE Na2CaMg(PO4)2 M
VITUSITE-(Ce) Na3(Ce,La,Nd)(PO4)2 O
OLGITE Na(Na,Sr)2(Ba,Sr)(PO4)2 H
BARIOOLGITE (Ba,Sr)(Na,Sr,REE)2Na(PO4)2 R
TUITE gamma-(Ca,Mg,Na)3(PO4)2 R
MERRILLITE Ca9Na(Mg,Fe)(PO4)7 R
FERROMERRILLITE Ca9NaFe++(PO4)7 R
STRONTIOWHITLOCKITE Sr7(Mg,Ca)3(PO4)6[PO3(OH)] R
WHITLOCKITE Ca9(Mg,Fe++)(PO4)6(PO3OH) R
ANATOLYITE Na6(Ca,Na)(Mg,Fe+++)3Al(AsO4)6 R
OZEROVAITE Na2KAl3(AsO4)4 O
PANSNERITE K3Na3(Fe+++,Al)6(AsO4)8 O
IWATEITE Na2BaMn++(PO4)2 R
YURMARINITE Na7(Fe+++,Mg,Cu)4(AsO4)6 R
UDINAITE NaMg4(VO4)3 Q
ARSENUDINAITE NaMg4(AsO4)3 Q
XENOPHYLLITE Na4Fe++7(PO4)6 A
STORNESITE-(Y) = a Chladinite variety (Y,Ca)[]2Na6(Ca,Na)8(Mg,Fe)43(PO4)36 R
CHLADNIITE Na12Ca5(Mg,Fe++)43(PO4)36 R
FILLOWITE Na12Ca4(Mn++,Fe++)44(PO4)36 M
GALILEIITE (Na,K)12(Fe++,Mn++,Cr)48(PO4)36 R
JOHNSOMERVILLEITE Na8Ca7(Fe++,Mg,Mn++)43(PO4)36 R
LASNIERITE (Ca,Sr)(Mg,Fe++)2Al(P[O,F]4)3 O
PHARMAZINCITE KZnAsO4 H
ZUBKOVAITE Ca3Cu3(AsO4)4 M
KOSNARITE KZr++++2(PO4)3 R ps C
PANETHITE (Na,Ca,K)2(Mg,Fe++,Mn)2(PO4)2 M
STANFIELDITE Ca4(Mg,Fe++,Mn)5(PO4)6 M
RONNEBURGITE K2Mn++V4O12 M
TILLMANNSITE (Ag3Hg)+++(VO4,AsO4) Q
FILATOVITE K(Al,Zn)2(As+++++,Si)2O8 M
CROCOBELONITE CaFe+++2O(PO4)2 O
BEERSHEVAITE CaFe+++3(PO4)3O M
CALCIOHATERTITE NaNaCa(CaFe+++)(AsO4)3 M
KABALOVITE Fe++3Fe++4(PO4)6 A
NAZARCHUKITE Ca2NiFe+++2(PO4)4 O
ANGARFITE NaFe+++5(PO4)4(OH)4.4H2O O
ZHANGHUIFENITE Na3Mn++4Mg2Al(PO4)6 M
DYRNAESITE-(La) Na8Ce++++(La,REE)2(PO4)6 O
EDTOLLITE K2NaCu5Fe+++O2(AsO4)4 A
CAMANCHACAITE Na[]CaMg2(AsO4)2[AsO2(OH)2] M
WOPMAYITE Ca6Na3[]Mn(PO4)3(PO3OH)4 R
MANGANOBADALOVITE NaNaMn(MgFe+++)(AsO4)3 M
ALUMOEDTOLLITE K2NaCu5AlO2(AsO4)4 A
ZINCOBRADACZEKITE NaCuCuZn2(AsO4)3 M
CANUTITE Na[]MnMn2(AsO4)[AsO3(OH)]2 M
With only large cations
NAHPOITE Na2HPO4 M
SVENEKITE Ca(H2AsO4)2 A
MONETITE CaHPO4 A
WEILITE CaHAsO4 A
ARCHERITE (K,NH4,)H2PO4 Q
BIPHOSPHAMMITE (NH4,K)H2PO4 Q
PHOSPHAMMITE (NH4)2HPO4 M (?)
BUCHWALDITE NaCaPO4 O
SCHULTENITE PbHAsO4 M
CHERNOVITE-(Ce) (Ce,Y)(AsO4) Q
WAKEFIELDITE-(Y) YVO4 Q
XENOTIME-(Y) YPO4 Q
XENOTIME-(Yb) (Yb,Y,Er)PO4 Q
WAKEFIELDITE-(Nd) (Nd,La,Ce)VO4 Q
CHERNOVITE-(Y) YAsO4 Q
PRETULITE Sc(PO4) Q
WAKEFIELDITE-(Ce) (Ce,La,Nd,Y,Pr,Sm)(V,As)O4 Q
WAKEFIELDITE-(La) (La,Nd,Pr)VO4 Q
DREYERITE BiVO4 Q
PUCHERITE BiVO4 O
XIMENGITE BiPO4 H
MONAZITE-(Ce) (Ce,La,Nd,Th)PO4 M
CHERALITE CaTh(PO4)2 M
GASPARITE-(La) LaAsO4 M
MONAZITE-(La) (La,Ce,Nd)PO4 M
MONAZITE-(Nd) (Nd,Ce,Sm)(PO4) M
MONAZITE-(Sm) (Sm,Gd,Ce,Th,Ca)(PO4) M
ROOSEVELTITE BiAsO4 M
GASPARITE-(Ce) (Ce,La,Nd)AsO4 M
TETRAROOSEVELTITE BiAsO4 Q
CHURSINITE Hg+Hg++(AsO4) M
CLINOBISVANITE BiVO4 M
GURIMITE Ba3(VO4)2 R
PICAITE NaCa[AsO3OH][AsO2(OH)2] M
MAZORITE Ba3(PO4)2 R
DEYNEKOITE Ca9Fe+++(PO4)7 R
KEPLERITE Ca9(Ca0,5[]0,5)Mg(PO4)7 R
BADALOVITE NaNaMg(MgFe+++)(AsO4)3 M
Phosphates, etc., with additional anions, without H2O
With small and medium-sized cations
VAYRYNENITE MnBe(PO4)(OH,F) M
HERDERITE CaBe(PO4)F M
BERGSLAGITE CaBe(AsO4)(OH) M
HYDROXYLHERDERITE CaBe(PO4)(OH) M
BABEFPHITE BaBe(PO4)(F,O) Q
AXELITE Na14Cu7(AsO4)8F2Cl2 Q
With only medium-sized cations, (OH, etc.):RO4 about 1:1
ARSENOWAGNERITE Mg2(AsO4)F M
TAVORITE LiFe+++(PO4)(OH) A
MONTEBRASITE LiAl(PO4)(OH,F) A
AMBLYGONITE (Li,Na)Al(PO4)(F,OH) A
TRIPLITE (Mn,Fe++,Mg,Ca)2(PO4)(F,OH) M
ZWIESELITE Fe++,Mn)2(PO4)F M
WOLFEITE (Fe++,Mn++)2(PO4)(OH) M
HYDROXYLWAGNERITE Mg2(PO4)(OH) M
JOOSTEITE Mn++(Mn+++,Fe+++)(PO4)O M
SARKINITE Mn++2(AsO4)(OH) M
STANEKITE Fe+++(Mn++,Fe++,Mg)(PO4)O M
TRIPLOIDITE (Mn,Fe++)2(PO4)(OH) M
WAGNERITE (Mg,Fe++)2(PO4)F M
HOLTEDAHLITE Mg12(PO3OH,CO3)(PO4)5(OH,O)6 H
SATTERLYITE (Fe++,Mg,Fe+++)2(PO4)(OH) H
ALTHAUSITE Mg2(PO4)(OH,F,O) O
ZINCOLIVENITE Cu(Zn,Cu)AsO4(OH) O
ZINCOLIBETHENITE CuZn(PO4)(OH) O
OLIVENITE Cu2AsO4(OH) M
LIBETHENITE Cu2(PO4)(OH) M
EVEITE Mn2(AsO4)(OH) O
AURIACUSITE Fe+++Cu++(AsO4,Sb+++++O4)(O,OH) O
ADAMITE Zn2(AsO4)(OH) O/M
TARBUTTITE Zn2(PO4)(OH) A
PARADAMITE Zn2(AsO4)(OH) A
BARBOSALITE Fe++Fe+++2(PO4)2(OH)2 M
WILHELMKLEINITE ZnFe+++2(AsO4)2(OH)2 M
SCORZALITE (Fe++,Mg)Al2(PO4)2(OH)2 M
HENTSCHELITE Cu++Fe+++2(PO4)2(OH)2 M
LAZULITE (Mg,Fe)Al2(PO4)2(OH)2 M
YAROSHEVSKITE Cu9O2(VO4)4Cl2 A
DOKUCHAEVITE Cu8O2(VO4)3Cl3 A
TROLLEITE Al4(PO4)3(OH)3 M
ALEUTITE [Cu5O2](AsO4)(VO4).(Cu,K,Pb,Rb,Cs,)Cl M
NAMIBITE Cu++(BiO)2V+++++O4OH M
ERICLAXMANITE Cu4O(AsO4)2 A
KOZYREVSKITE Cu4O(AsO4)2 O
POPOVITE Cu5O2(AsO4)2 R
PHOSPHOELLENBERGERITE Mg14(PO4,AsO4)6(PO3OH,CO3)2(OH)6 H
URUSOVITE CuAl(AsO4)O M
THEOPARACELSITE Cu++3(OH)2As2O7 O
TURANITE Cu5(VO4)2(OH)4 O
STOIBERITE Cu5V+++++2O10 M
FINGERITE Cu11(VO4)6O2 A
AVERIEVITE Cu++5O2(VO4)2.n(CuCl) or Cu++5O2(VO4)2.n(CuCl2) or Cu++5O2(VO4)2.n(K,Rb,Cs)Cl M
ZINCLIPSCOMBITE ZnFe+++2(PO4)2(OH)2 Q
RICHELLITE CaFe+++2(PO4)2(OH,F)2 am.
LIPSCOMBITE (Fe++,Mn++)Fe+++2(PO4)2(OH)2 Q
KARLDITMARITE Cu9O4(PO4)2(SO4)2 A
PAULGROTHITE Cu9Fe+++O4(PO4)4Cl O
MOABITE NiFe+++(PO4)O O
MILKOVOITE Cu4O(PO4)(AsO4) O
With only medium-sized cations, (OH, etc.):RO4 > 1:1 and < 2:1
ANGELELLITE Fe+++4(AsO4)2O3 A
ROCKBRIDGEITE (Fe++,Mn)Fe+++4(PO4)3(OH)5 O
FRONDELITE Mn++Fe+++4(PO4)3(OH)5 O
PLIMERITE ZnFe+++4(PO4)3(OH)5 O
AERUGITE Ni17As6O32 R
FERROROCKBRIDGEITE (Fe++,Mn++)2(Fe+++)3(PO4)3(OH)4(H2O) O
FERRIROCKBRIDGEITE (Fe+++0,67[]0,33)2(Fe+++)3(PO4)3(OH)4(H2O) O
With only medium-sized cations, (OH, etc.):RO4= 2:1
CORNWALLITE Cu5(AsO4)2(OH)4 M
PSEUDOMALACHITE Cu5(PO4)2(OH)4 M
REICHENBACHITE Cu++5(PO4)2(OH)4 M
GATEHOUSEITE Mn++5(PO4)2(OH)4 O
ARSENOCLASITE Mn5(AsO4)2(OH)4 O
PARWELITE (Mn,Mg)5Sb(As,Si)2O12 M
REPPIAITE Mn5(VO4)2(OH)4 M
LUDJIBAITE Cu5(PO4)2(OH)4 A
CORNUBITE Cu5(AsO4)2(OH)4 A
GUTSEVICHITE (Al,Fe+++)3(PO4,VO4)2(OH)3.8H2O (?) C
With only medium-sized cations, (OH, etc.):RO4 > 2:1
AUGELITE Al2(PO4)(OH)3 M
GRATTAROLAITE Fe+++3(PO4)O3 R
CORNETITE Cu3(PO4)(OH)3 O
CLINOCLASE Cu3(AsO4)(OH)3 M
ARHBARITE Cu2Mg(AsO4)(OH)3 A
GILMARITE Cu3(AsO4)(OH)3 A
FLINKITE Mn++2Mn+++(AsO4)(OH)4 O
RAADEITE Mg7(PO4)2(OH)8 M
ALLACTITE Mn7(AsO4)2(OH)8 M
ARGANDITE Mn++7(VO4,AsO4)2(OH)8 M
MAGNESIOCHLOROPHOENICITE (Mg,Mn)3Zn2(AsO4)(OH,O)6 M
CHLOROPHOENICITE (Mn,Mg)3Zn2(AsO4)(OH,O)6 M
GERDTREMMELITE (Zn,Fe++)(Al,Fe+++)2(AsO4)(OH)5 A
HEMATOLITE (Mn,Mg,Al)15(AsO3)(AsO4)2(OH)23 R
TURTMANNITE (Mn,Mg)22,5Mg3-3x[(V,As)O4]3[SiO4]3[AsO3]xO5-5x(OH)20+x R ps H
KRAISSLITE (Mn++,Mg)24Zn3Fe+++(As+++O3)2(As+++++O4)3(SiO4)6(OH)18 H
DIXENITE Cu+Mn++14Fe+++(As+++O3)5(SiO4)2(As+++++O4)(OH)6 R
CARLFRANCISITE Mn++3(Mn++,Mg,Fe+++,Al)42[As+++O3]2(As+++++O4)4[(Si,As+++++)O4]6[(As+++++,Si)O4]2(OH)42 R
ARAKIITE (Zn,Mn++)(Mn++,Mg)12(Fe+++,Al)2(As+++O3)(As+++++O4)2(OH)23 M
MCGOVERNITE (Mn,Mg,Zn)22(AsO3)(AsO4)3(SiO4)3(OH)20 R
SYNADELPHITE Mn++9(As+++++O4)2(As+++O3)(OH)9.2H2O A ps O
HOLDENITE (Mn,Mg)6Zn3(AsO4)2(SiO4)(OH)8 O
KOLICITE Mn7Zn4(AsO4)2(SiO4)2(OH)8 O
SABELLIITE (Cu,Zn)2Zn[(As,Sb)O4](OH)3 R
JAROSEWICHITE Mn++3Mn+++(AsO4)(OH)6 O
THEISITE Cu5Zn5(As+++++,Sb+++++)2O8(OH)14 O
COPARSITE Cu4O2[(As,V)O4]Cl O
WATERHOUSEITE Mn++7(PO4)2(OH)4 M ps O
VASILSEVERGINITE Cu9O4(AsO4)2(SO4)2 M
With medium-sized and large cations, (OH, etc.):RO4< 0.5:1
ARROJADITE-(KFeNa) {KNa}{Fe++[]}{Ca}{Na3}{Fe++13}{Al}(PO4)11(HPO4)(OH)2 M
FLUORARROJADITE-(BaFe) Na2BaCaFe++14Al(PO4)11(PO3OH)F2 M
DICKINSONITE-(KMnNa) KNa4CaMn++14Al(PO4)12(OH)2 M
ARROJADITE-(SrFe) Na2SrCaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(PbFe) Na2PbCaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(KNa) KNa5CaFe++13Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(KFe) KNa3CaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(BaNa) BaNa3(NaCa)Fe++13Al(PO4)11(PO3OH)(OH) M
FLUORARROJADITE-(BaNa) BaNa4CaFe13Al(PO4)11(PO3OH)F2 M
FERRIARROJADITE-(BaNa) {Ba[]}{Na2}{Ca}{Na2[]}{Fe++13}{Fe+++}(PO4)11(HPO4)(OH)2 M
FLUORARROJADITE-(NaFe) {Na2}{Fe++[]}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)F2 M
FLUORCARMOITE-(BaNa) (Ba[])(NaNa)Ca(Na2[])Mg13Al(PO4)11(PO3OH)F2 M
ARROJADITE-(NaFe) {Na2}{Fe++[]}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)(OH)2 M
FLUORARROJADITE-(KNa) {KNa}{Na2}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)F2 M
SAMUELSONITE (Ca,Ba)Ca8(Fe++,Mn++)4Al2(PO4)10(OH)2 M
GRIPHITE Na4Ca6(Mn,Fe++,Mg)19Li2Al8(PO4)24(F,OH)8 C
NABIASITE BaMn9[(V,As)O4]6(OH)2 C
STAROVAITE KCu5O(VO4)3 A
ACHYROPHANITE (K,Na)3(Fe+++,Ti,Al,Mg)5O2(AsO4)5 O
SIGISMUNDITE BaFe++(CaNa2)Fe++13Al(PO4)11(PO3OH)(OH)2 M
MANGANOARROJADITE-(KNa) KNa5MnFe13Al(PO4)11(PO3OH)(OH)2 M
With medium-sized and large cations, (OH, etc.):RO4 = 0.5:1
FERRIBUSHMAKINITE Pb2Fe+++(PO4)(VO4)(OH) M
LOMBARDOITE Ba2Mn+++(AsO4)2(OH) M
FEINGLOSITE Pb2(Zn,Fe++)[(As,S)O4]2.H2O M
ARSENTSUMEBITE Pb2Cu(AsO4)(SO4)(OH) M
BEARTHITE Ca2Al(PO4)2(OH) M
BRACKEBUSCHITE Pb2(Mn+++,Fe+++)(VO4)2(OH) M
BUSHMAKINITE Pb2(Al,Cu++)PO4(V+++++,Cr++++++)O4(OH) M
GAMAGARITE Ba2(Fe+++,Mn+++)(VO4)2(OH) M
TOKYOITE Ba2Mn+++(VO4)2(OH) M
TSUMEBITE Pb2Cu(PO4)(SO4)(OH) M
ARSENBRACKEBUSCHITE Pb2(Fe++,Zn)(AsO4)2(OH,H2O) M
CALDERONITE Pb2Fe+++(VO4)2(OH) M
GOEDKENITE (Sr,Ca)2Al(PO4)2(OH) M
MELONJOSEPHITE CaFe++Fe+++(PO4)2(OH) O
TANCOITE LiNa2Al(PO4)(PO3OH)(OH) O
DMISOKOLOVITE K3Cu5AlO2(AsO4)4 M
SHCHUROVSKYITE K2CaCu6O2(AsO4)4 M
WRIGHTITE K2Al2O(AsO4)2 O
POLYARSITE Na7CaMgCu2(AsO4)4F2Cl M
DONGCHUANITE Pb4ZnZn2(PO4)4(OH)2 A
ALDOMARINOITE Sr2Mn+++(AsO4)2(OH) M
CUPRODONGCHUANITE Pb4CuZn2(PO4)4(OH)2 A
CANOSIOITE Ba2Fe+++(AsO4)2(OH) M
With medium-sized and large cations, (OH,etc.):RO4 = 1:1
THADEUITE (Ca,Mn++)(Mg,Fe++,Mn+++)3(PO4)2(OH,F)2 O
ARSENATROTITANITE NaTi(AsO4)O M
DURANGITE NaAl(AsO4)F M
ISOKITE CaMg(PO4)F M
LACROIXITE NaAl(PO4)F M
MAXWELLITE (Na,Ca)(Fe+++,Al,Mg)(AsO4)(F,O) M
PANASQUEIRAITE CaMg(PO4)(OH,F) M
TILASITE CaMg(AsO4)F M
DRUGMANITE Pb2(Fe+++,Al)H(PO4)2(OH)2 M
JOHNTOMAITE Ba(Fe++,Ca,Mn++)2Fe3+++2(PO4)3(OH)3 M
CIRROLITE Ca3Al2(PO4)3(OH)3 (?)  
KULANITE Ba(Fe++,Mn,Mg)2Al2(PO4)3(OH)3 A
PENIKISITE Ba(Mg,Fe++)2Al2(PO4)3(OH)3 A
PERLOFFITE Ba(Mn,Fe++)2Fe+++2(PO4)3(OH)3 M
STRONTIOPERLOFFITE SrMn2+2Fe3+2(PO4)3(OH)3 M
BJAREBYITE (Ba,Sr)(Mn++,Fe++,Mg)2Al2(PO4)3(OH)3 M
BERTOSSAITE (Li,Na)2CaAl4(PO4)4(OH,F)4 O
PALERMOITE (Sr,Ca)(Li,Na)2Al4(PO4)4(OH)4 O
NATROPALERMOITE Na2SrAl4(PO4)4(OH)4 O
CARMINITE PbFe+++2(AsO4)2(OH)2 O
SEWARDITE Ca2Fe+++2(AsO4)2(OH)2 O
DUFTITE-alpha PbCu(AsO4)(OH)  
ADELITE CaMg(AsO4)(OH) O
TANGEITE CaCu(VO4)(OH) O
NICKELAUSTINITE Ca(Ni,Zn)(AsO4)(OH) O
HERMANNROSEITE CaCu(PO4,AsO4)(OH) O
GOTTLOBITE CaMg(VO4,AsO4)(OH).0,5H2O O
GABRIELSONITE PbFe+++(As+++O3)O O
DUFTITE PbCu(AsO4)(OH) O
CONICHALCITE CaCu++(AsO4)(OH) O
COBALTAUSTINITE Ca(Co,Cu++)(AsO4)(OH) O
AUSTINITE CaZn(AsO4)(OH) O
ARSENDESCLOIZITE PbZn(AsO4)(OH) O
CECHITE Pb(Fe++,Mn)(VO4)(OH) O
PYROBELONITE PbMn++(VO4)(OH) O
DESCLOIZITE PbZn(VO4)(OH) O
MOTTRAMITE PbCu++(VO4)(OH) O
KHORIXASITE (Bi0,67[]0,33)Cu(VO4)(OH) M
VESIGNIEITE Cu3Ba(VO4)2(OH)2 M
BAYLDONITE (Cu,Zn)3Pb(AsO4)2(OH)2 M
PAGANOITE (Ni,Co)Bi+++As+++++O5 A
JAGOWERITE BaAl2(PO4)2(OH)2 A
HARRISONITE Ca(Fe++,Mg)6(PO4)2(SiO4)2 R
ATTAKOLITE (Ca,Sr)Mn++(Al,Fe+++)4[(Si,P)O4]H(PO4)3(OH)4 M
LENINGRADITE PbCu++3(VO4)Cl2 O
KATIARSITE KTiO(AsO4) O
YURGENSONITE K2SnTiO2(AsO4)2 O
MELANARSITE K3Cu7Fe+++O4(AsO4)4 M
MORASKOITE Na2Mg(PO4)F O
EVSEEVITE Na2Mg(AsO4)F O
PICCOLIITE NaCaMn+++2(AsO4)2O(OH) O
REZNITSKYITE CaMg(VO4)F M
CUPROZHESHENGITE Pb4CuZn2(AsO4)2(PO4)2(OH)2 A
ZHESHENGITE Pb4ZnZn2(AsO4)2(PO4)2(OH)2 A
PLUMBOPERLOFFITE PbMn++2Fe+++2(PO4)3(OH)3 M
CRIMSONITE PbFe+++2(PO4)2(OH)2 O
With medium-sized and large cations, (OH, etc.):RO4= 1:5:1
With medium-sized and large cations, (OH, etc.):RO4 = 2:1, 2.5:1
BRAZILIANITE NaAl3(PO4)2(OH)4 M
MEDENBACHITE Bi2Fe+++(Cu,Fe++)O2(OH)2(AsO4)2 A
NEUSTADTELITE Bi2Fe+++(Fe+++,Co++)O2(OH)2(AsO4)2 A
COBALTNEUSTADTELITE Bi2Fe+++(Co++,Fe+++)O(OH)3(AsO4)2 A
CURETONITE Ba(Al,Ti++++)(PO4)4(O,OH)F M
HEYITE Pb5Fe++2(VO4)2O4 M
JAMESITE Pb2ZnFe+++2(Fe+++2,8Zn1,2)(AsO4)4(OH)8[(OH)1,2O0,8] A
LULZACITE Sr2Fe++(Fe++,Mg)2Al4(PO4)4(OH)10 A
NISHANBAEVITE KAl2O(AsO4)(SO4) O
LEHMANNITE Na18Cu12TiO8(AsO4)8FCl5 M
With medium-sized and large cations, (OH, etc.):RO4 = 3:1
SVANBERGITE SrAl3(PO4)(SO4)(OH)6 R
BEUDANTITE PbFe+++3(AsO4)(SO4)(OH)6 R
CORKITE PbFe+++3(PO4)(SO4)(OH)6 R
GALLOBEUDANTITE PbGa3[(AsO4),(SO4)]2(OH)6 R
HIDALGOITE PbAl3(AsO4)(SO4)(OH)6 R
WEILERITE BaAl3(AsO4)(SO4)(OH)6 R
HINSDALITE (Pb,Sr)Al3(PO4,SO4)(OH,H2O)6 R
KEMMLITZITE (Sr,Ce)Al3(AsO4)(SO4)(OH)6 R
WOODHOUSEITE CaAl3(PO4)(SO4)(OH)6 R
VISEITE Ca10Al24(SiO4)6(PO4)7O22F3.72H2O (?) C
GORCEIXITE BaAl3[(PO3(O,OH)]2(OH)6 R
SEGNITITE PbFe+++3H(AsO4)2(OH)6 R
KINTOREITE PbFe+++3(PO4)2(OH,H2O)6 R
PHILIPSBORNITE PbAl3(AsO4)2(OH)5.H2O R
GOYAZITE SrAl3(PO3OH)(PO4)(OH)6 R
ARSENOGORCEIXITE HBaAl3(AsO4)2(OH)6 R
BENAUITE (Sr,Ba)(Fe+++,Al)3(PO4)2(SO4)2(OH,H2O)6 R
CRANDALLITE CaAl3(PO3OH)(PO4)(OH)6 R
ARSENOGOYAZITE (Sr,Ca,Ba)Al3(AsO4,PO4)2(OH,F)5.H2O R
DUSSERTITE BaFe+++3(AsO4)2(OH)5 R
EYLETTERSITE (Th,Pb)1-xAl3(PO4,SiO4)2(OH)6 R
SPRINGCREEKITE Ba(V+++,Fe+++)2(PO4)2(OH,H2O)6 R
ARSENOCRANDALLITE (Ca,Sr)Al3[(As,P)O4]2(OH)5.H2O R
PLUMBOGUMMITE PbAl3(PO4)2(OH)5.H2O R
GRAULICHITE-(La) LaFe+++3(AsO4)2(OH)6 R
ARSENOFLORENCITE-(Nd) NdAl3(AsO4)2(OH)6 R
FLORENCITE-(Nd) (Nd,Ce)Al3(PO4)2(OH)6 A
FLORENCITE-(La) (La,Ce)Al3(PO4)2(OH)6 R
FLORENCITE-(Ce) CeAl3(PO4)2(OH)6 R
ARSENOFLORENCITE-(La) (La,Ce,Nd)Al3(AsO4)2(OH)6 R
ARSENOFLORENCITE-(Ce) (Ce,La)Al3(AsO4,PO4)2(OH)6 R
GRAULICHITE-(Ce) (Ce,Ba)(Fe+++,Al)3(AsO4)2(OH,H2O)6 A
WAYLANDITE (Bi,Ca)Al3(PO4,SiO4)2(OH)6 R
ZAIRITE Bi(Fe+++,Al)3(PO4)2(OH)6 R
FLORENCITE-(Sm) (Sm,Nd)Al3(PO4)2(OH)6 R
VIITANIEMIITE Na(Ca,Mn++)Al(PO4)(F,OH)3 M
PATTERSONITE PbFe+++3(PO4)2(OH,H2O)6 A
KIRYUITE NaMnAl(PO4)F3 M
OBERWOLFACHITE SrFe+++3(AsO4)(SO4)(OH)6 R
GALLOPLUMBOGUMMITE Pb(Ga,Al)3-xGexH1-x(PO4)2(OH)6 (x between 0 and 1) R
With medium-sized and large cations, (OH, etc.):RO4 = 4:1
RETZIAN-(Ce) Mn2Ce(AsO4)(OH)4 O
RETZIAN-(La) (Mn,Mg)2(La,Ce,Nd)(AsO4)(OH)4 O
RETZIAN-(Nd) Mn2(Nd,Ce,La)(AsO4)(OH)4 O
KOLITSCHITE Pb[Zn0,5[]0,5]Fe3(AsO4)2(OH)6 M ps R
PAULKELLERITE Bi2Fe+++(PO4)O2(OH)2 M
BRENDELITE (Bi+++,Pb++)2(Fe+++,Fe++)O2(OH)(PO4) M
BETPAKDALITE-NaNa [Na2(H2O)16Na(H2O)6][Mo8As2Fe+++3O33(OH)4] M
With only large cations, (OH, etc.):RO4 = 0.33:1
PARAFINIUKITE Ca2Mn3(PO4)3Cl H
PLINIUSITE Ca5(VO4)3F H
PIECZKAITE Mn5(PO4)3Cl H
OXYPYROMORPHITE Pb10(PO4)6O  
JOHNBAUMITE-M (Ca,Sr)5(AsO4,PO4)3(OH) M
CHLORAPATITE-M Ca5(PO4)3Cl M
HYDROXYLAPATITE-M Ca5(PO4)3(OH) M
CHLORAPATITE Ca5(PO4)3Cl H
DELONEITE (Na,Ca,Ce)2Sr3(Ca,Ce)5(PO4)6(OH)F R
FLUORAPATITE Ca5(PO4)3F H
FLUORCAPHITE Ca(Sr,NaCa)(Ca,Sr,Ce)3(PO4)3F H
FLUORPHOSPHOHEDYPHANE Ca2Pb3(PO4)3F H
FLUORSTROPHITE Sr4Ca(PO4)3F H
SVABITE Ca5(AsO4)3F H
HYDROXYLAPATITE Ca5(PO4)3(OH) H
BELOVITE-(Ce) Sr3Na(Ce,La)(PO4)3(F,OH) R
JOHNBAUMITE Ca5(AsO4)3(OH) H
KUANNERSUITE-(Ce) NaBa3(Ce,Nd,La)(PO4)3(F,Cl) R ps H
MIMETITE Pb5(AsO4)3Cl H
MIMETITE-M Pb5(AsO4)3Cl M ps H
MIYAHISAITE (Sr,Ca)2Ba3(PO4)3F H
MORELANDITE (Ba,Pb)3(Ca,Pb)2(AsO4,PO4)3Cl H
PHOSPHOHEDYPHANE Ca2Pb3(PO4)3Cl H
PYROMORPHITE Pb5(PO4)3Cl H
HEDYPHANE Pb3Ca2(AsO4)3Cl H
STRONADELPHITE Sr5(PO4)3(F,OH) H
TURNEAUREITE Ca5(AsO4)3Cl H
ALFORSITE Ba5(PO4)3Cl H
VANADINITE Pb5(VO4)3Cl H
BELOVITE-(La) Sr3Na(La,Ce)(PO4)3(F,OH) R
VANACKERITE Pb4Cd(AsO4)3(Cl,OH) R ps H
CARLGIESECKEITE-(Nd) NaNdCa3(PO4)3F R ps H
ARCTITE Na2Ca4(PO4)3F R
GORYAINOVITE Ca2(PO4)Cl O
FLUORSIGAIITE Ca2Sr3(PO4)3F H
FLUORSIGALITE Ca2Sr3(PO4)3F H
FLUORPYROMORPHITE Pb5(PO4)3F H
MAGGANASITE CuFe+++3O(AsO4)3 A
ARADITE BaCa6[(SiO4)(VO4)](VO4)2F R
HYDROXYLHEDYPHANE Ca2Pb3(AsO4)3(OH) R
HYDROXYLPYROMORPHITE Pb5(PO4)3(OH) H
ZADOVITE BaCa6[(SiO4)(PO4)](PO4)2F R
With only large cations, (OH, etc.):RO4 about 1:1
NACAPHITE Na2Ca(PO4)F O
SCHUMACHERITE Bi3[(V,As,P)O4]2O(OH) A
PETITJEANITE Bi+++3(PO4)2O(OH) A
PREISINGERITE Bi3(AsO4)2O(OH) A
ATELESTITE Bi2O(OH)(AsO4) M
SMRKOVECITE Bi2O(OH)(PO4) M
HECHTSBERGITE Bi2O(OH)(VO4) M
SAHLINITE Pb14(AsO4)2O9Cl4 M
KOMBATITE Pb14(VO4)2O9Cl4 M
HENEUITE CaMg5(PO4)3(CO3)(OH) A
NEFEDOVITE Na5Ca4(PO4)4F A
KUZNETSOVITE Hg3Cl(AsO4) C
ARTSMITHITE Hg+4Al(PO4)2-x(OH)1+3x (x = 0,26) M
SCHLEGELITE Bi7(MoO4)2(AsO4)3O4 O
ERIKJONSSONITE (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 M
HEREROITE [Pb32(O,[])21](AsO4)2[(Si,As,V,Mo]O4)2Cl10 M
RUDABANYAITE (Ag2Hg2)(AsO4)Cl C
SEGERSTROMITE Ca3(As+++++O4)2[As+++(OH)3]2 C
WIKLUNDITE Pb2(Mn++,Zn)3(Fe+++,Mn++)2(Mn++,Mg)19(As+++O3)2(Si,As+++++O4)6(OH)18Cl6 R
ARAVAITE Ba2Ca18(SiO4)6(PO4)3(CO3)F3O R
ARIEGILATITE BaCa12(SiO4)4(PO4)2F2O R
Phosphates without additional anions, with H2O
With small and large/medium cations
PARAFRANSOLETITE Ca3Be2(PO4)2(PO3OH)2.4H2O A
FRANSOLETITE H2Ca3Be2(PO4)4.4H2O M
EHRLEITE Ca2ZnBe(PO4)2(PO3OH).4H2O A
FAHEYITE (Mn,Mg)Fe+++2Be2(PO4)4.6H2O H
GAINESITE Na(Na,K)(Be,Li)(Zr,Zn)2(PO4)4.1-2H2O Q
MCCRILLISITE NaCs(Be,Li)Zr2(PO4)4.1-2H2O Q
SELWYNITE NaK(Be,Al)Zr2(PO4)4.2H2O Q
PAHASAPAITE (Ca5,5Li3,6K1,2Na0,2[]13,5)Li8[Be24P24O96].38H2O C
HOPEITE Zn3(PO4)2.4H2O O
ARSENOHOPEITE Zn3(AsO4)2.4H2O O
NIZAMOFFITE Mn++Zn2(PO4)2.4H2O O
WARIKAHNITE Zn3(AsO4)2.2H2O A
PHOSPHOPHYLLITE Zn2(Fe++,Mn)(PO4)2.4H2O M
STEINMETZITE Zn2Fe+++(PO4)2(OH).3H2O A
SCHOLZITE CaZn2(PO4)2.2H2O O
PARASCHOLZITE CaZn2(PO4)2.2H2O M
KEYITE ([]0,5Cu0,5)CuCdZn2(AsO4)3.H2O M
PUSHCHAROVSKITE K0,6Cu18(AsO4)(HAsO4)10(H2AsO4)4(OH)9,6.18,6H2O A
PROSPERITE CaZn2(AsO4)2.H2O M
GENGENBACHITE KFe+++3[(H2PO4)2|(HPO4)4].6H2O H
REAPHOOKHILLITE MgZn2(PO4)2.4H2O A
PARAHOPEITE Zn3(PO4)2.4H2O A
STERGIOUITE CaZn2(AsO4)2.4H2O M
LIMOUSINITE BaCa[Be4P4O16].6H2O M
MINJIANGITE Ba[Be2PeO8] H
WILANCOOKITE (Ba5Li2[])Ba6Be24P24O96.26H2O C
APEXITE NaMg(PO4).9H2O A
BRANDAOITE [BeAl2(PO4)2(OH)2(H2O)4](H2O) A
DAVIDLLOYDITE Zn3(AsO4)2.4H2O A
With only medium-sized cations, RO4:H2O = 1:1
SERRABRANCAITE Mn+++(PO4).H2O M
GIFTGRUBEITE CaMn2Ca2(AsO4)2(AsO3OH)2.4H2O M
HUREAULITE Mn5(PO4)2[PO3(OH)]2.4H2O M
VILLYAELLENITE (Mn,Ca)Mn2Ca2(H2O)4(AsO3OH)2(AsO4)2 M
NYHOLMITE Cd3Zn2(AsO3OH)2(AsO4)2.4H2O M
MIGUELROMEROITE Mn5(H2O)4(AsO3OH)2(AsO4)2 M
KRAUTITE MnAs+++++O3(OH).H2O M
MAGNESIOKORITNIGITE Mg(AsO3OH).H2O A
KORITNIGITE Zn(As+++++O3)(OH).H2O A
COBALTKORITNIGITE (Co,Zn)(As+++++O3)(OH).H2O A
YVONITE Cu(AsO3.OH).2H2O A
GEMINITE Cu++(AsO3OH).H2O A
SCHUBNELITE Fe+++2-x(V+++++,V++++)2O4(OH)4 A
RADOVANITE Cu2Fe+++(As+++O2)(As+++++O4)(OH)2.H2O O
KAZAKHSTANITE Fe+++5V++++3V+++++12O39(OH)9.9H2O M
KOLOVRATITE Hydrous vanadate of Ni and Zn (?)
HONZAITE Ni2(AsO3OH)2.5H2O M
BURGESSITE Co2(H2O)4[AsO3(OH)]2(H2O) M
CARDITE Zn5,5(AsO4)2(AsO3OH)(OH)3.3H2O O
ERMELOITE Al(PO4).H2O M
KRUPICKAITE Cu6[AsO3(OH)]6.8H2O M
With only medium-sized cations, RO4:H2O = 1:1.5
LANDESITE Fe+++Mn++2(PO4)2(OH).2H2O O
KRYZHANOVSKITE MnFe+++2(PO4)2(OH)2.H2O O
PHOSPHOFERRITE (Fe++,Mn)3(PO4)2.3H2O O
REDDINGITE Mn++3(PO4)2.3H2O O
GARYANSELLITE (Mg,Fe+++)3(PO4)2(OH,O).1,5H2O O
KAATIALAITE Fe+++As+++++3O9.6-8H2O M
LEOGANGITE Cu10(AsO4)4(SO4)(OH)6.8H2O M
CORREIANEVESITE Fe++Mn++2(PO4)2.3H2O O
With only medium-sized cations, RO4:H2O = 1:2
PHOSPHOSIDERITE Fe+++PO4.2H2O M
BONACINAITE Sc(AsO4).2H2O M
METAVARISCITE AlPO4.2H2O M
KOLBECKITE ScPO4.2H2O M
MANSFIELDITE AlAsO4.2H2O O
SCORODITE Fe+++AsO4.2H2O O
STRENGITE Fe+++PO4.2H2O O
VARISCITE AlPO4.2H2O O
YANOMAMITE InAsO4.2H2O O
REDONDITE = A variety of Variscite Al(PO4).2H2O  
PARASCORODITE Fe+++AsO4.2H2O R
LUDLAMITE (Fe++,Mg,Mn)3(PO4)2.4H2O M
STERLINGHILLITE Mn++3(AsO4)2.3H2O (?)
ROLLANDITE Cu3(AsO4)2.4H2O O
LIVERSIDGEITE Zn6(PO4)4.7H2O A
THORASPHITE Th2H(AsO4)2(PO4).6H2O O
SERGEYSMIRNOVITE MgZn2(PO4)2.4H2O O
CASTELLAROITE Mn++3(AsO4)2.4,5H2O M
With only medium-sized cations, RO4:H2O about 1:2.5
CHUDOBAITE (Mg,Zn)5H2(AsO4)4.10H2O A
GEIGERITE Mn5(H2O)8(AsO3OH)2(AsO4)2.2H2O A
NEWBERYITE MgHPO4.3H2O O
BRASSITE MgHAsO4.4H2O O
PHOSPHORROSSLERITE MgHPO4.7H2O M
ROSSLERITE MgHAsO4.7H2O M
SWITZERITE (Mn++,Fe++)3(PO4)2.7H2O M
METASWITZERITE Mn3(PO4)2.4H2O M
LINDACKERITE (Cu,Co)5(AsO4)2(AsO3OH)2.10H2O A
KLAJITE MnCu4(AsO4)2(AsO3OH)2.9-10H2O A
ONDRUSITE CaCu4(AsO4)2(AsO3OH)2.10H2O A
PRADETITE CoCu4(AsO4)2(AsO3OH)2.9H2O A
VESELOVSKYITE (Zn,Cu,Co)Cu4[AsO3(OH)AsO4]2.9H2O A
HLOUSEKITE (Ni,Co)Cu4(AsO4)2(AsO3OH)2.9H2O A
BOBIERRITE Mg3(PO4)2.8H2O M
ANNABERGITE Ni3(AsO4)2.8H2O M
ARUPITE (Ni,Fe++)3(PO4)2.8H2O M
BARICITE (Mg,Fe++,Fe+++)3(PO4)2.8(H2O,OH) M
ERYTHRITE Co3(AsO4)2.8H2O M
HORNESITE Mg3(AsO4)2.8H2O M
FERRISYMPLESITE Fe+++3(AsO4)2(OH)3.5H2O am.
KOTTIGITE Zn3(AsO4)2.8H2O M
MANGANOHORNESITE (Mn++,Mg)3(AsO4)2.8H2O M
PAKHOMOVSKYITE (Co,Mg)3(PO4)2.8H2O M
PARASYMPLESITE Fe++3(AsO4)2.8H2O M
VIVIANITE Fe++3(PO4)2.8H2O M
SYMPLESITE Fe++3(AsO4)2.8H2O A
CATTIITE Mg3(PO4)2.22H2O A
KONINCKITE Fe+++PO4.3H2O Q
HILARIONITE Fe+++2(SO4)(AsO4)(OH).6H2O M
KANKITE Fe+++AsO4.3,5H2O M
STEIGERITE AlVO4.3H2O M
METASCHODERITE Al2(PO4)(VO4).6H2O M
SCHODERITE Al2(PO4)(VO4).8H2O M
MALHMOODITE Fe+++Zr(PO4)2.4H2O M
ZIGRASITE MgZr(PO4)2.4H2O A
SANTABARBARAITE Fe+++3(PO4)2(OH)3.5H2O am.
METAKOTTIGITE (Zn,Fe+++,Fe++)3(AsO4)2.8(H2O,OH) A
SLAVKOVITE Cu13(AsO4)6(AsO3OH)4.23H2O A
MONTENEROITE Cu++Mn++2(AsO4)2.8H2O M
BABANEKITE (Cu,Zn,Co,Ni)3(AsO4)2.8H2O M
With large and medium-sized cations, RO4:H2O > 1:1
GRISCHUNITE NaCa2Mn++5Fe+++(AsO4)6.2H2O O
MANECKIITE (Na[])Ca2Fe++2(Fe+++Mg)Mn2(PO4)6.2H2O O
TASSIEITE (Na,[])Ca2(Mg,Fe++,Fe+++)2(Fe+++,Mg)2(Fe++,Mg)2(PO4)6.2H2O O
WICKSITE NaCa2(Fe++,Mn++)4MgFe+++(PO4)6.2H2O O
BEDERITE []Ca2Mn++2Fe+++2Mn++2(PO4)6.2H2O O
HAIGERACHITE KFe+++3(H2PO4)6(HPO4)2.4H2O M
YAZGANITE []NaMgFe+++2(AsO4)3.H2O M
CURRIERITE Na4Ca3MgAl4(AsO3OH)12.9H2O H
RIOSECOITE Ca2Mg(AsO3OH)3(H2O)2 A
ESPADAITE Na4Ca3Mg2[AsO3(OH)]2[AsO2(OH)2]10.7H2O O
LIRAITE NaCa2Mn++2[Fe+++Fe++]Mn++2(PO4)6(H2O)2 O
FALSTERITE Ca2MgMn++2(Fe++0,5Fe+++0,5)4Zn4(PO4)8(OH)4(H2O)14 M
FERRAIOLOITE MgMn++4(Fe++0,5Al+++0,5)4Zn4(PO4)8(OH)4(H2O)20 M
NAFEASITE Na3Fe+++3(AsO3OH)6.3H2O M
With large and medium-sized cations, RO4:H2O = 1:1
HILLITE Ca2(Zn,Mg)(PO4)2.2H2O A
CASSIDYITE Ca2(Ni,Mg)(PO4)2.2H2O A
COLLINSITE Ca2(Mg,Fe++)(PO4)2.2H2O A
TALMESSITE Ca2Mg(AsO4)2.2H2O A
GAITITE Ca2Zn(AsO4)2.2H2O A
MESSELITE Ca2(Fe++,Mn)(PO4)2.2H2O A
PARABRANDTITE Ca2Mn++(AsO4).2H2O A
ROSELITEBETA Ca2Co(AsO4)2.2H2O A
FAIRFIELDITE Ca2(Mn,Fe++)(PO4)2.2H2O A
ANORTHOROSELITE Ca2Co(AsO4)2.2H2O A
BRANDTITE Ca2(Mn++,Mg)(AsO4)2.2H2O M
ROSELITE Ca2(Co++,Mg)(AsO4)2.2H2O M
RRUFFITE Ca2Cu(AsO4)2.2H2O M
ZINCROSELITE Ca2Zn(AsO4)2.2H2O M
WENDWILSONITE Ca2(Mg,Co)(AsO4)2.2H2O M
MOUNANAITE PbFe+++2(VO4)2(OH,H2O)2 M
CABALZARITE Ca(Mg,Al,Fe+++)2(AsO4)2(H2O,OH)2 M
COBALTLOTHARMEYERITE Ca(Co,Fe+++,Ni)2(AsO4)2(OH,H2O)2 M
COBALTTSUMCORITE Pb(Co,Fe+++,Ni)2(AsO4)2(H2O,OH)2 M
FERRILOTHARMEYERITE Ca(Fe+++,Zn)2(AsO4)2(OH,H2O)2 M
KRETTNICHITE PbMn+++2(VO4)2(OH)2 M
LOTHARMEYERITE Ca(Mn+++,Zn)2(AsO4)2(OH,H2O)2 M
TSUMCORITE Pb(Zn,Fe+++)2(AsO4)2(OH,H2O)2 M
MAWBYITE Pb(Fe+++,Zn)2(AsO4)2(OH,H2O)2 M
YANCOWINNAITE PbCuAl(AsO4)2OH.H2O A
NICKELLOTHARMEYERITE (Ca,Bi+++)(Ni,Fe+++,Co)2(AsO4)2(H2O,OH)2 M
NICKELSCHNEEBERGITE (Bi+++,Ca)(Ni,Co,Fe+++)2(AsO4)2[(H2O)(OH)] M
SCHNEEBERGITE (Bi+++,Ca)(Co,Ni,Fe+++)2(AsO4)2[(H2O)(OH)] M
THOMETZEKITE Pb(Cu,Zn)2(AsO4)2(OH,H2O)2 M/A (?)
NICKELTSUMCORITE Pb(Ni,Fe+++)2(AsO4)2(H2O,OH)2 M
MANGANLOTHARMEYERITE Ca(Mn+++,[],Mg)2{AsO4,[AsO2(OH)2]}2(OH,H2O)2 M
MAGNESIOFLUCKITE CaMg(AsO3OH)2(H2O)2 A
LUKRAHNITE Ca(Cu,Zn)(Fe+++,Zn)(AsO4)2.2(H2O,OH) A
ZINCGARTRELLITE Pb(Zn,Fe+++,Cu)2(AsO4)2(H2O,OH)2 A
PHOSPHOGARTRELLITE PbCuFe+++(PO4)2(OH,H2O)2 A
HELMUTWINKLERITE Pb(Zn,Cu)2(AsO4)2(OH,H2O)2 A
GARTRELLITE PbCu(Fe,Cu)(AsO4)2(OH,H2O)2 A
RAPPOLDITE Pb(Co,Ni,Zn)2(AsO4)2.2H2O A ps M
POTTSITE (Pb3Bi)Bi(VO4)4.H2O. Q
NICKELTALMESSITE Ca2(Ni,Mg)(AsO4)2.2H2O A
ARMELLINOITE-(Ce) Ca4Ce++++(AsO4)4.H2O Q
IRHTEMITE Ca4MgH2(AsO4)4.4H2O M
Ca-HUREAULITE CaMn5(PO4)4.4H2O  
DONDOELLITE Ca2Fe(PO4)2.2H2O A
NEOMESSELITE = MESSELITE   A
FLUCKITE CaMn++H2(AsO4)2.2H2O A
With large and medium-sized cations, RO4:H2O < 1:1
WALENTAITE Fe+++3(P0,84As0,16O4)2(O,OH)6As+++2,56Ca0,42Na0,28Mn++0,35Fe++0,30O6,1(OH)0,9(H2O)5,2 O
NATROWALENTAITE [Fe+++0,5Na0,5(H2O)6][NaAs+++2(Fe+++2,33W++++++0,67)(PO4)2O7] O
HALILSARPITE [Mg(H2O)6][CaAs+++2(Fe+++2,67Mo++++++0,33)(AsO4)2O7] O
ANAPAITE Ca2Fe++(PO4)2.4H2O A
PICROPHARMACOLITE H2Ca4Mg(AsO4)4.11H2O A
DITTMARITE (NH4)Mg(PO4).H2O O
NIAHITE (NH4)(Mn++,Mg,Ca)PO4.H2O O
FRANCOANELLITE H6(K,Na)3(Al,Fe+++)5(PO4)8.13H2O R
TARANAKITE K3Al5[PO3(OH)]6(PO4)2.18H2O R
SCHERTELITE (NH4)2MgH2(PO4)2.4H2O O
HANNAYITE (NH4)2Mg3H4(PO4)4.8H2O A
STRUVITE-(K) KMgPO4.6H2O O
HAZENITE KNaMg2(PO4)2.14H2O O
STRUVITE (NH4)MgPO4.6H2O O
RIMKOROLGITE (Mg,Mn)5(Ba,Sr,Ca)(PO4)4.8H2O M ps H
BAKHCHISARAITSEVITE Na2Mg5(PO4)4.7H2O M
FAHLEITE Zn5CaFe+++2(AsO4)6.14H2O O
SMOLYANINOVITE (Co,Ni,Mg,Ca)3(Fe+++,Al)2(AsO4)4.11H2O O
BARAHONAITE-(Al) (Ca,Cu,Na,Al)6Al(AsO4)4.6-6,5(H2O,OH) M
BARAHONAITE-(Fe) (Ca,Cu,Na,Fe+++,Al)6Fe+++(AsO4)4.6(H2O,OH,Cl) M
EPIFANOVITE NaCaCu5(PO4)4[AsO2(OH)2].7H2O M
ESDANAITE-(Ce) NaMnCe(PO4)2.4H2O O
With only large cations
STERCORITE H(NH4)Na(PO4).4H2O A
SWAKNOITE (NH4)2Ca(HPO4)2.H2O O
MUNDRABILLAITE (NH4)2Ca(HPO4)2.H2O M
NASTROPHITE Na(Sr,Ba)(PO4).9H2O C
NABAPHITE NaBaPO4.9H2O C
HAIDINGERITE CaHAsO4.H2O O
VLADIMIRITE Ca4(AsO4)2(AsO3OH).4H2O M
RHABDOPHANE-(Y) (Y,La,Nd)PO4.H2O H
CHURCHITE-(Dy) (Dy,Sm,Gd,Nd)(PO4).2H2O M
FERRARISITE Ca5H2(AsO4)4.9H2O A
MACHATSCHKIITE (Ca,Na)6(As+++++O4)(As+++++O3OH)3(PO4,SO4).15H2O R
FULBRIGHTITE Ca(VO)2(AsO4)2.4H2O A
PHAUNOUXITE Ca3(AsO4).11H2O A
RAUENTHALITE Ca3(AsO4)2.10H2O M/A
SMIRNOVSKITE (Th,Ca)(PO4).nH2O H
TRISTRAMITE (Ca,U++++,Fe+++)(PO4,SO4).2H2O H
STEPITE U++++(AsO3OH)2.4H2O Q
RHABDOPHANE-(Nd) (Nd,Ce,La)PO4.H2O H
RHABDOPHANE-(Ce) (Ce,La)PO4.H2O H
GRAYITE (Th,Pb,Ca)PO4.H2O ps H
BROCKITE (Ca,Th,Ce)(PO4).H2O H
RHABDOPHANE-(La) (La,Ce)PO4.H2O H
VYSOKYITE U++++[As+++++O2(OH)2]4.4H2O A
BRUSHITE CaHPO4.2H2O M
CHURCHITE-(Y) YPO4.2H2O M
PHARMACOLITE CaHAsO4.2H2O M
ARDEALITE Ca2(SO4)(HPO4).4H2O M
CHURCHITE-(Nd) = Nd rich CHURCHITE-(Y) (Y,Nd)(PO4).2H2O M
MCNEARITE NaCa5H4(AsO4)5.4H2O A
DORFMANITE Na2HPO4.2H2O O
SINCOSITE CaV++++2(PO4)2(OH)4.3H2O Q
BARIOSINCOSITE (Ba,Sr)(V++++OPO4)2.4H2O Q
CATALANOITE Na2PO3(OH).8H2O O
GUERINITE Ca5H2(AsO4)4.9H2O M
NINGYOITE (U,Ca,Ce)2(PO4)2.1-2H2O O ps H
AIRDITE Sr(V++++O)2(PO4)2.4H2O M
CAESIUMPHARMACOSIDERITE CsFe4[(AsO4)3(OH)4].4H2O C
JEANKEMPITE Ca5(AsO4)2(AsO3OH)2(H2O)7 A
DOBSINAITE Ca2Ca(AsO4)2.2H2O M
SAINFELDITE Ca5(H2O)4(AsO3OH)2(AsO4)2 M
Phosphates, etc. with additional anions, with H2O
With small (and occasionally larger) cations
BEARSITE Be2(AsO4)(OH).4H2O M
MORAESITE Be2(PO4)(OH).4H2O M
ZANAZZIITE Ca2Be4(Mg,Fe++)5(PO4)6(OH)4.6(H2O) M
ATENCIOITE Ca2Mg2Fe++2-3Be4(PO4)6(OH)4.6H2O A
FOOTEMINEITE Ca2Be4(Mn++,Fe++)5(PO4)6(OH)4.6H2O A
GREIFENSTEINITE Ca2Be4(Fe++,Mn)5(PO4)6(OH)4.6(H2O) M
GUIMARAESITE Ca2(Zn,Mg,Fe++)5Be4(PO4)6(OH)4.6H2O M
ROSCHERITE Ca2Be4(Mn,Fe++)5(PO4)6(OH)4.6H2O M/A
RUIFRANCOITE Ca2([],Mn)2(Fe+++,Mn,Mg)4Be4(PO4)6(OH)6.4H2O M
OKRUSCHITE Ca2Mn++5Be4(AsO4)6(OH)4.6H2O M
URALOLITE Ca2Be4(PO4)3(OH)3.5H2O M
WEINEBENEITE Ca[Be3(PO4)2(OH)2].4H2O M
TIPTOPITE [(Li,Na,Ca,[])6](OH)2(H2O)(K2)(Be6P6O24) H
PHILIPSBURGITE Cu5Zn(AsO4)(PO4)(OH)6.H2O M
SPENCERITE Zn4(PO4)2(OH)2.3H2O M
GLUCINE CaBe4(PO4)2(OH)4.0,5H2O (?)
With only medium-sized cations, (OH, etc.):RO4< 1:1
PITTICITE Hydrous ferric arsenate sulfate am.
DESTINEZITE Fe+++2(PO4)(SO4)(OH).6H2O A
DIADOCHITE Fe+++2(PO4)(SO4)(OH).5H2O A
WILDENAUERITE Zn(Fe+++,Mn++)2MnFe+++(PO4)3(OH)3(H2O)6.2H2O O
WILHELMGUMBELITE [ZnFe++Fe+++3(PO4)3(OH)4(H2O)5].2H2O O
SCHMIDITE [Zn2(Fe+++,Mn++)2Fe+++(PO4)3(OH)3(H2O)6].2H2O  
VASHEGYITE Al11(PO4)9(OH)6.38H2O or Al6(PO4)5(OH)3.23H2O O
SCHOONERITE [ZnMnFe++2Fe+++(PO4)3(OH)2(H2O)7].2H2O O
SINKANKASITE H2MnAl(PO4)2(OH).6H2O A
MITRYAEVAITE Al11(PO4,SO3OH)10F3.30H2O A
SANJUANITE Al2(PO4)(SO4)(OH).9H2O M (?)
SARMIENTITE Fe+++2(AsO4)(SO4)(OH).5H2O M
FLURLITE Zn4Fe+++(PO4)3(OH)2(H2O)7.2H2O M
MANGANFLURLITE ZnMn++3Fe+++(PO4)3(OH)2(H2O)7.2H2O ZnMn++3Fe+++(PO4)3(OH)2(H2O)7.2H2O M
BUKOVSKYITE Fe+++2(AsO4)(SO4)(OH).7H2O M
BOHUSLAVITE Fe+++4(PO4)3(SO4)(OH).nH2O (n between 15 and 24) A
ZYKAITE Fe+++4(AsO4)3(SO4)(OH).15H2O O
LAPEYREITE Cu3O[AsO3(OH)]2.0,75H2O O
ROSSIANTONITE Al3(PO4)(SO4)2(OH)2(H2O)10.4H2O A
GINIITE Fe++Fe+++4(PO4)4(OH)2.2H2O M
ARCTOWSKITE Al9(PO4)8(OH)3.27H2O  
SASAITE (Al,Fe+++)6[(PO4),(SO4)]5(OH)3.35-36H2O O
MCAUSLANITE HFe++3Al2(PO4)4F.18H2O A
GOLDQUARRYITE CuCd2Al3(PO4)4F2.12H2O A
BIRCHITE CdCu2(SO4)(PO4)2.5H2O O
BRAITHWAITEITE NaCu++5(Sb+++++Ti4++++)O2(AsO4)4(AsO3OH)2(H2O)8 A
CAMARONESITE Fe+++2(PO3OH)2(SO4)(H2O)4.1-2H2O R
ARANGASITE Al2(PO4)(SO4)F.7,5?2O M
HOSLITE Fe+++3(VO4)2(SO4)(OH)(H2O)4.3H2O M
With only medium-sized cations, (OH, etc.):RO4 = 1:1 and < 2:1
NISSONITE Cu2Mg2(PO4)2(OH)2.5H2O M
EUCHROITE Cu2(AsO4)(OH).3H2O O
LEGRANDITE Zn2(AsO4)(OH).H2O M
STRASHIMIRITE Cu8(AsO4)4(OH)4.5H2O M
ARTHURITE Cu++Fe+++2(AsO4,PO4,SO4)2(O,OH)2.4H2O M
OJUELAITE ZnFe+++2(AsO4)2(OH)2.4H2O M
KUNATITE CuFe+++2(PO4)2(OH)2.4H2O M
EARLSHANNONITE (Mn++,Fe++)Fe+++2(PO4)2(OH)2.4H2O M
BENDADAITE Fe++Fe+++2(AsO4)2(OH)2.4H2O M
WHITMOREITE Fe++Fe+++2(PO4)2(OH)2.4H2O M
COBALTARTHURITE (Co++,Mg)Fe+++2(AsO4)2(OH)2.4H2O M
KLEEMANITE ZnAl2(PO4)2(OH)2.3H2O M
CORALLOITE Mn++Mn+++2(AsO4)2(OH)2.4H2O M
MAGNESIOBERMANITE MgMn+++2(PO4)2(OH)2.4H2O M
BERMANITE Mn++Mn+++2(PO4)2(OH)2.4H2O M
KOVDORSKITE Mg2(PO4)(OH).3H2O M
METAVIVIANITE Fe++Fe+++2(PO4)2(OH)2.6H2O A
STRUNZITE Mn++Fe+++2(PO4)2(OH)2.6H2O A ps M
ZINCOSTRUNZITE ZnFe+++2(PO4)2(OH)2.6,5H2O A
METAVAUXITE Fe++Al2(PO4)2(OH)2.8H2O M
FERROSTRUNZITE Fe++Fe+++2(PO4)2(OH)2.6H2O A
FERRISTRUNZITE Fe+++Fe+++2(PO4)2(OH)3.5H2O A
TVRDYITE Fe++Fe+++2Al3(PO4)4(OH)5(H2O)4.2H2O M
BERAUNITE Fe+++6(PO4)4O(OH)4.6H2O M
ZINCOBERAUNITE ZnFe+++5(PO4)4(OH)5.6H2O O
KAYROBERTSONITE [MnAl2(PO4)2(OH)2(H2O)4].2H2O A
KASTNINGITE (Mn++,Fe++,Mg)Al2(PO4)2(OH)2.8H2O A
MANGANGORDONITE (Mn++,Fe++)Al2(PO4)2(OH)2.8H2O A
USHKOVITE MgFe+++2(PO4)2(OH)2.8H2O A
STEWARTITE Mn++Fe+++2(PO4)2(OH)2.8H2O A
SIGLOITE Fe+++Al2(PO4)2(OH)3.7H2O A
PSEUDOLAUEITE Mn++Fe+++2(PO4)2(OH)2.7-8H2O M
NORDGAUITE Mn++Al2(PO4)2(F,OH)2.5H2O A
MAGHREBITE MgAl2(AsO4)2(OH)2.8H2O A
LAUEITE Mn++Fe+++2(PO4)2(OH)2.8H2O A
GORDONITE MgAl2(PO4)2(OH)2.8H2O A
FERROLAUEITE Fe++Fe+++2(PO4)2(OH)2.8H2O A
KUMMERITE Mn++Fe+++Al(PO4)2(OH)2.8H2O A
PARAVAUXITE Fe++Al2(PO4)2(OH)2.8H2O A
KAMARIZAITE Fe+++3(AsO4)2(OH)3.3H2O O
TINTICITE Fe+++11(PO4,VO4)8(OH)8.13H2O A
VAUXITE Fe++Al2(PO4)2(OH)2.6H2O A
VANTASSELITE Al4(PO4)3(OH)3.9H2O O
CACOXENITE (Fe+++,Al)25(PO4)17O6(OH)12.75H2O H
GORMANITE Fe++3Al4(PO4)4(OH)6.2H2O A
SOUZALITE (Mg,Fe++)3(Al,Fe+++)4(PO4)4(OH)6.2H2O M
KINGITE Al3(PO4)2(OH,F)3.9H2O A
FLUORWAVELLITE Al3(PO4)2(F,OH)3.5H2O O
ALLANPRINGITE Fe+++3(PO4)2(OH).5H2O M
WAVELLITE Al3(PO4)2(OH,F)3.5H2O O
KRIBERGITE Al5(PO4)3(SO4)(OH)4.4H2O A
MAPIMITE Zn2Fe+++3(AsO4)3(OH)4.10H2O M
OGDENSBURGITE Ca2(Zn,Mn)Fe+++4(AsO4)4(OH)6.6H2O O ps H
CLONCURRYITE Cu0,5Al2(VO)0,5(PO4)2(F,OH)2.5H2O M
NEVADAITE (Cu++,Al,V+++)2-3Al4(PO4)4(OH)F4.11H2O M
KENNGOTTITE Mn++3Fe+++4(PO4)4(OH)6(H2O)2 M
MOLINELLOITE Cu(H2O)(OH)V++++O(V+++++O4) A
WHITECAPSITE H16Fe2++5Fe+++14Sb+++6(AsO4)18O16.120H2O H
CESARFERREIRAITE Fe++Fe+++2(AsO4)2(OH)2.8H2O A
FERRIVAUXITE Fe+++Al2(PO4)2(OH)3.5H2O A
IANBRUCEITE [Zn2(OH)(H2O)(AsO4)](H2O)2 M
HEIMITE PbCu2(AsO4)(OH)3.2H2O M
With only medium-sized cations, (OH, etc.):RO4= 2:1
CHENEVIXITE Cu2Fe+++2(AsO4)2(OH)4 M
LUETHEITE Cu2Al2(AsO4)2(OH)4 M
AKROCHORDITE Mn++4Mg(AsO4)2(OH)4.4H2O M
GUANACOITE Cu2(Mg,Cu)Mg2(AsO4)2(OH)4.4H2O M
TURQUOISE Cu++(Al,Fe+++)6(PO4)4(OH)8.4H2O A
AFMITE Al3(OH)4(H2O)3(PO4)(PO3OH)·H2O A
AHEYLITE (Fe++,Zn)Al6(PO4)4(OH)8.4H2O A
CHALCOSIDERITE Cu++(Fe+++,Al)6(PO4)4(OH)8.4H2O A
FAUSTITE (Zn,Cu++)Al6(PO4)4(OH)8.4H2O A
PLANERITE Al6(PO4)2(PO3OH)2(OH)8.4H2O A
COERULEOLACTITE    
LEFONTITE Fe2Al2Be(PO4)2(OH)6 O
ERNSTITE (Mn++1-xFe+++x)Al(PO4)(OH)2-xOx M
EOSPHORITE MnAl(PO4)(OH)2.H2O M
CHILDRENITE Fe++Al(PO4)(OH)2.H2O M
KOBOKOBOITE Al6(PO4)4(OH)6.11H2O A
SMAMITE Ca2Sb(OH)4[H(AsO4)2].6H2O A
BETTERTONITE Al6(AsO4)3(OH)9.16H2O M
GALEACLOLUSITE Al6(AsO4)3(OH)9(H2O)4.8H2O O
PENBERTHYCROFTITE [Al6(AsO4)3(OH)9(H2O)5].8H2O M
VARGITE Cu2Mn3(AsO4)2(OH)4(H2O)4 M
With only medium-sized cations, (OH, etc.):RO4 = 3:1
SENEGALITE Al2(PO4)(OH)3.H2O O
CLINOHOLMQUISTITE = root name [](Li2Mg3Al2)Si8O22(OH)2 (?) M
FLUELLITE Al2(PO4)F2(OH).7H2O O
BULACHITE Al6(AsO4)3(OH)9(H2O)4.2H2O O
ZAPATALITE Cu3Al4(PO4)3(OH)9.4H2O Q
CERULEITE CuAl4[AsO4]2(OH)8(H2O)4 M
VESZELYITE (Cu,Zn)3(PO4)(OH)3.2H2O M
JUANITAITE (Cu,Ca,Fe++)10Bi(AsO4)4(OH)11.H2O Q
IANGREYITE Ca2Al7(PO4)2(PO3OH)2(OH,F)15.8H2O R
KIPUSHITE (Cu,Zn)5Zn(PO4)2(OH)6.H2O M
GOLDHILLITE Cu5Zn(AsO4)2(OH)6.H2O M
ARSENOVESZELYITE Cu2Zn(AsO4)(OH)3.2H2O M
With only medium-sized cations, (OH,etc.):RO4 > 3:1
HOTSONITE Al5(PO4)(SO4)(OH)10.8H2O A
BOLIVARITE Al2(PO4)(OH)3·4H2O amorphous
EVANSITE Al3(PO4)(OH)6.6H2O am.
LISKEARDITE [(Al,Fe)32(AsO4)18(OH)42(H2O)22].52H2O O (?)
ROSIERESITE [Pb,Cu,Al,(PO4),H2O] (?) am.
RUSAKOVITE (Fe+++,Al)5(VO4,PO4)2(OH)9.3H2O (?)
LIROCONITE Cu2Al(AsO4)(OH)4.4H2O M
SIELECKIITE Cu3Al4(PO4)2(OH)12.2H2O A
CHALCOPHYLLITE Cu++18Al2(AsO4)3(SO4)3(OH)27.33H2O R
PARNAUITE Cu9(AsO4)2(SO4)(OH)10.7H2O O
GLADIUSITE (Fe++,Mg)4Fe+++2(PO4)(OH)11.H2O M ps O
FORETITE Cu2Al2(AsO4)(OH,O,H2O)6 A
KERNOWITE Cu2Fe+++(AsO4)(OH)4.4H2O M
With large and medium-sized cations, (OH, etc.):RO4< 0.5:1
LAVENDULAN NaCaCu5(AsO4)4Cl.5H2O O
LEMANSKIITE NaCaCu5(AsO4)4Cl.5H2O Q
SAMPLEITE NaCaCu5(PO4)4Cl.5H2O O
SHUBNIKOVITE Ca2Cu++8(AsO4)6Cl(OH).7H2O O (?)
ZDENEKITE Na(Pb,Ca)Cu++5(AsO4)4Cl.5H2O Q
JASONSMITHITE Mn++4ZnAl(PO4)4(OH)(H2O)7.3,5H2O M
RELIANCEITE-(K) K4Mg(V++++O)2(C2O4)(PO3OH)4(H2O)10 M
DAVIDBROWNITE-(NH4) (NH4,K)5(V++++O)2(C2O4)[PO2,75(OH)1,25]4.3H2O M
With large and medium-sized cations, (OH, etc.):RO4 < 1:1
KAPUNDAITE (Na,Ca)2Fe+++4(PO4)4(OH)3.5H2O A
MINYULITE KAl2(PO4)2F.4H2O O
LEUCOPHOSPHITE KFe+++2(PO4)2(OH).2H2O M
SPHENISCIDITE (NH4,K)(Fe+++,Al)2(PO4)2(OH).2H2O M
TINSLEYITE KAl2(PO4)2(OH).2H2O M
KECKITE CaMn(Fe+++,Mn)2Fe+++2(PO4)4(OH)3.7H2O M
JAHNSITE-(CaMnMn) CaMn++Mn++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnMn) (Mn++,Ca)Mn++(Mn++,Fe++)2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(NaMnMn) NaMn++Mn++Fe+++Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(NaFeMg) NaMg2Fe+++3(PO4)4(OH)2.8H2O M
JAHNSITE-(NaMnMg) {(Na,Ca)}{(Mn++,Fe+++)}{(Mg,Fe+++)2}{Fe+++2}(PO4)4(OH)2.8H2O M
JAHNSITE-(CaFeMg) CaFe++Mg2Fe+++2(PO4)4(OH)2.8H2O M
RITTMANNITE (Mn++,Ca)Mn++(Fe++,Mn++)2(Al,Fe+++)2(PO4)4(OH)2.8H2O M
WHITEITE-(CaFeMg) Ca(Fe++,Mn++)Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(CaMnMg) CaMn++Mg2Al2(PO4)4(OH)2.8H2O M
KALUGINITE (Mn++,Ca)MgFe+++(PO4)2(OH).4H2O O
JAHNSITE-(CaFeFe) {Ca}{Fe++}{Fe++2}{Fe+++2}(PO4)4(OH)2.8H2O M
WHITEITE-(MnFeMg) (Mn++,Ca)(Fe++,Mn++)Mg2Al2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnZn) CaMn++Zn2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnFe) CaMn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnMg) CaMn++(Mg,Fe++)2Fe+++2(PO4)4(OH)2.8H2O M
WHITEITE-(MnMnMg) Mn++Mn++Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(CaMnMn) CaMnMn2Al2[PO4]4(OH)2.8H2O M
JAHNSITE-(MnMnFe) Mn++Mn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnZn) Mn++Mn++Zn2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnMg) Mn++Mn++Mg2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnFe++) MnMn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
WHITEITE-(CaMgMg) CaMg3Al2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMgMg) {Ca}{Mg}{Mg2}{Fe+++2}(PO4)4(OH)2.8H2O M
WHITEITE-(MnMnMn) Mn++Mn++Mn++2Al2(PO4)4(OH)2.8H2O M
WILHELMVIERLINGITE CaMn++Fe+++(PO4)2(OH).2H2O O
OVERITE CaMgAl(PO4)2(OH).4H2O O
JUONNIITE CaMgSc(PO4)2(OH).4H2O O
LUNOKITE (Mn++,Ca)(Mg,Fe++,Mn++)Al(PO4)2(OH).4H2O O
SEGELERITE CaMgFe+++(PO4)2(OH).4H2O O
MANGANOSEGELERITE (Mn++,Ca)(Mn++,Fe++,Mg)Fe+++(PO4)2(OH).4H2O O
ZODACITE Ca4Mn++Fe+++4(PO4)6(OH)4.12H2O M
MONTGOMERYITE Ca4MgAl4(PO4)6(OH)4.12H2O M
KINGSMOUNTITE Ca3MnFeAl4(PO4)6(OH)4.12H2O M
CALCIOFERRITE Ca4Fe++(Fe+++,Al)4(PO4)6(OH)4.13H2O M
FANFANIITE Ca4MnAl4(PO4)6(OH)4.12H2O M
PARAROBERTSITE Ca2Mn+++3(PO4)3O2.3H2O M
SAILAUFITE NaCaMn+++3O2(AsO4)2(CO3).3H2O M
ARSENIOSIDERITE Ca2Fe+++3(AsO4)3O2.3H2O M
MITRIDATITE Ca2Fe+++3(PO4)3O2.3H2O M
ROBERTSITE Ca6Mn+++9(PO4)9O6(H2O)6.3H2O M
KOLFANITE Ca2Fe+++3O2(AsO4)3.2H2O M
MANTIENNEITE (H2O,K)2(Mg,Fe++)2(Al,Fe+++)2Ti(PO4)4(O,F)2.14H2O O
BENYACARITE (H2O,K)2(Mn++,Fe++)2(Fe+++,Ti)2Ti(PO4)4(O,F)2.14H2O O
PAULKERRITE (H2O,K)2(Mg,Mn++)2(Fe+++,Al)2Ti(PO4)4(O,F)2.14H2O O
XANTHOXENITE Ca4Fe+++2(PO4)4(OH)2.3H2O A
MAHNERTITE (Na,Ca,K)Cu++3(AsO4)2Cl.5H2O Q
CALCIOANDYROBERTSITE KCaCu5(AsO4)4[As(OH)2O2].2(H2O) M
ANDYROBERTSITE KCdCu5(AsO4)4[As(OH)2O2].2(H2O) M
ENGLISHITE K3Na2Ca10Al15(PO4)21(OH)7.26H2O O
BOUAZZERITE Mg5,5Bi3Fe+++7(AsO4)9O6(OH)2.43H2O M
GALLISKIITE Ca4Al2(PO4)2F8.5H2O A
JOTEITE Ca2CuAl[AsO4][AsO3(OH)]2(OH)2.5H2O A
KAMPELITE Ba6Mg3Sc8(PO4)12(OH)6.7H2O O
VANINIITE Ca2Mn++3Mn+++2O2(AsO4)4.2H2O M
AMMONIOTINSLEYITE (NH4)Al2(PO4)2(OH),2H2O M
THEBAITE-(NH4) (NH4)3Al(C2O4)(PO3OH)2(H2O) M
FERROBERAUNITE Fe++Fe+++5(PO4)4(OH)5.6H2O M
DENDORAITE-(NH4) (NH4)2NaAl(C2O4)(PO3OH)2(H2O)2 M
ROWLEYITE [Na(NH4,K)9Cl4][V2(P,As)O8]6.n[H2O,Na,NH4,K,Cl] C
With large and medium-sized cations, (OH, etc.):RO4 = 1:1
OLMSTEADITE KFe++2(Nb,Ta)(PO4)2O2.2H2O O
JOHNWALKITE K(Mn++,Fe+++,Fe++)2(Nb,Ta)(PO4)2O2(H2O,OH)2 O
GATUMBAITE CaAl2(PO4)2(OH)2.H2O M
CAMGASITE CaMg(AsO4)(OH).5H2O M
MEURIGITE-K KFe+++8(PO4)6(OH)7.6,5H2O M
MEURIGITE-Na Na(Fe+++,Al)8(PO4)6(OH)7.6,5H2O M
PHOSPHOFIBRITE [K0,5(H2O)3][(Fe+++,Cu)8(PO4)6(OH)7(H2O)4] M
JUNGITE Ca2Zn4Fe+++8(PO4)9(OH)9.16H2O O
WYCHEPROOFITE NaAlZr(PO4)2(OH)2.H2O A
ERCITITE Na(Mn+++,Fe+++)(PO4)(OH).2H2O M
MRAZEKITE Bi+++2Cu++3(PO4)2O2(OH)2.2H2O M
ATTIKAITE Ca3Cu2Al(AsO4)2(OH)2.2H2O O
MENGEITE Ba(Mg,Mn++)Mn+++4(PO4)4(OH)4.4H2O A
With large and medium-sized cations, (OH, etc.):RO4 > 1:1 and < 2:1
PLUMBOPHARMACOSIDERITE Pb0,5Fe+++4(AsO4)3(OH)4.5H2O C
PHARMACOSIDERITE KFe+++4(AsO4)3(OH)4.6-7H2O C/Q
THALLIUMPHARMACOSIDERITE TlFe4[(AsO4)3(OH)4].4H2O  
STRONTIOPHARMACOSIDERITE Sr0,5Fe4[(AsO4)3(OH)4].4H2O C
BARIUMZINCALUMOPHARMACOSIDERITE (Ba,K)0,5(Zn,Cu)0,5(Al,Fe)4(AsO4)3(OH)5.5H2O Q
HYDRONIUMPHARMACOSIDERITE (H3O,K)(Fe+++,Al)4(AsO4)3(OH)4.4H2O C
NATROPHARMACOSIDERITE (Na,K)2Fe+++4(AsO4)3(OH)5.7H2O Q ps C
BARIOPHARMACOSIDERITE BaFe+++4(AsO4)3(OH)5.5H2O Q ps C
BARIOPHARMACOALUMITE Ba0,5Al4(AsO4)3(OH)4.4H2O C
NATROPHARMACOALUMITE (Na,K,H3O)Al4(AsO4)3(OH)4.4H2O C
PHARMACOALUMITE KAl4(AsO4)3(OH)4.6,5H2O C
HYDRONIUMPHARMACOALUMITE (H3O)Al4(AsO4)3(OH)4.4,5H2O C
NATRODUFRENITE Na(Fe+++,Fe++)(Fe+++,Al)5(PO4)4(OH)6.2H2O M
MATIOLIITE Na(Mg,Fe++)Al5(PO4)4(OH)6.2H2O M
GAYITE NaMn++Fe+++5(PO4)4(OH)6.2H2O M
DUFRENITE Fe++Fe+++4(PO4)3(OH)5.2H2O M
BURANGAITE (Na,Ca)2(Fe++,Mg)2Al10(PO4)8(OH,O)12.4H2O M
KIDWELLITE NaFe+++9(PO4)6(OH)10.5H2O M
BLEASDALEITE (Ca,Fe+++)2Cu5(Bi+++,Cu++)(PO4)4(H2O,OH,Cl)13 M ps Q
MATULAITE Fe+++Al7(PO4)4(PO3OH)2(OH)8(H2O)8.8H2O M
KRASNOVITE Ba(Al,Mg)(PO4,CO3)(OH)2.H2O O
BIMBOWRIEITE NaMgFe+++5(PO4)4(OH)6.2H2O M
PUTTAPAITE Pb2Mn++2ZnCr+++4O2(AsO4)4(OH)6.12H2O M
RICHELSDORFITE Ca2Cu5Sb(AsO4)4Cl(OH)6.6H2O M
With large and medium-sized cations, (OH, etc.):RO4 = 2:1
FOGGITE CaAl(PO4)(OH)2.H2O O
FLUOROWARDITE NaAl3(PO4)2F2(OH)2.2H2O Q
CYRILOVITE NaFe+++3(PO4)2(OH)4.2H2O Q
MILLISITE (Na,K)CaAl6(PO4)4(OH)9.3H2O Q
WARDITE NaAl3(PO4)2(OH)4.2H2O Q
PETERSITE-(Ce) Cu6Ce(PO4)3(OH)6.3H2O H
ZALESIITE CaCu++6(AsO4)2(AsO3OH)(OH)6.3H2O H
PLUMBOAGARDITE (Pb,REE,Ca)Cu6(AsO4)3(OH)6.3H2O H
MIXITE BiCu++6(AsO4)3(OH)6.3H2O H
GOUDEYITE (Al,Y)Cu6(AsO4)3(OH)6.3H2O H
PETERSITE-(La) Cu6La(PO4)3(OH)6.3H2O H
CALCIOPETERSITE CaCu6[(PO4)2(PO3OH)](OH)6.3H2O H
AGARDITE-(Y) (Y,Ca)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(Nd) (Nd,La,Y)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(La) LaCu++6(AsO4)3(OH)6.3H2O H
AGARDITE-(Ce) (Ce,Ca,La)Cu6(AsO4)3(OH)6.3H2O H
PETERSITE-(Y) (Y,Ce,Nd,Ca)Cu++6(PO4)3(OH)6.3H2O H
AGARDITE-(Dy) (Dy,La,Ca)Cu6(AsO4)3(OH)6.3H2O (?) H
PETERSITE-(Nd)    
WALLKILLDELLITE-Fe (Ca,Cu)4Fe6[(As,Si)O4]4(OH)8.18H2O H
CHEREMNYKHITE Zn3Pb3Te++++O6(VO4,AsO4)2 O
DUGGANITE Pb3Zn3Te(As,V,Si)2(O,OH)14 H
KUKSITE (Pb,Ca)3Zn3Te++++++O6(PO4,VO4)2 O
WALLKILLDELLITE Ca4Mn++6As+++++4O16(OH)8.18H2O H
ANGASTONITE CaMgAl2(PO4)2(OH)4.7H2O am
LANGBANSHYTTANITE Pb2Mn2Mg(AsO4)2(OH)4.6H2O A
With large and medium-sized cations, (OH, etc.):RO4 > 2:1
ESPERANZAITE NaCa2Al2(As+++++O4)2F4(OH).H2O M
MORINITE NaCa2Al2(PO4)2(F,OH)5.2H2O M
TANGDANITE Ca2Cu9(AsO4)4(SO4)0.5(OH)9.9H2O M
TYROLITE CaCu5(AsO4)2(CO3)(OH)4.6H2O O
MELKOVITE CaFe+++H6(MoO4)4(PO4).6H2O M
BETPAKDALITE-CaCa MgCa2Fe+++3(Mo++++++8O28)(AsO4)2(OH).23H2O M
BETPAKDALITE-NaCa (Na,Ca)3Fe+++2(As2O4)(MoO4)6.15H2O M
PHOSPHOVANADYLITE-Ca Ca[V++++4P2O10(OH)6].12H2O C
PHOSPHOVANADYLITE-Ba (Ba,Ca,K,Na)0,66[P2(V++++,Al)4(O,OH)16].12H2O C
YUKONITE Ca3Fe+++(AsO4)2(OH)3.5H2O am.
UDUMINELITE Ca3Al8(PO4)2O12.2H2O  
DELVAUXITE CaFe+++4(PO4,SO4)2(OH)8.4-6H2O (?) am.
ALDERMANITE [Mg(H2O)6][Na(H2O)2Al3(PO4)2(OH,F)6].H2O O
AZOVSKITE = DELVAUXITE ?    
SANTAFEITE (Na,Ca,Sr)3(Mn++,Fe+++)2Mn++++2(VO4)4(OH,O)5.2H2O O
TAPIAITE Ca5Al2(AsO4)4(OH)4.12H2O M
ALCANTARILLAITE [Fe+++0,5(H2O)4][CaAs+++2(Fe+++2,5W++++++0,5)(AsO4)2O7] O
BETPAKDALITE-CaMg [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe+++3O36(OH)] M
BETPAKDALITE-FeFe [Fe+++2(H2O)15(OH)2Fe+++(H2O)6][Mo8As2Fe+++3O37] M
PENRICEITE NaMgAl3(PO4)2F6(H2O)9 M
SARROCHITE [Ca4(H2O)38][Mo8P2Fe+++3O37(OH)]  
ELLIOTTITE NaMgAl3(PO4)2F6.9H2O M
TOMSQUARRYITE NaMgAl3(PO4)2(OH)6.8H2O R
With only large cations
NATROPHOSPHATE Na7(PO4)2F.19H2O C
ISOCLASITE Ca2(PO4)(OH).2H2O M
LERMONTOVITE U++++(PO4)(OH).H2O O
URPHOITE U++++6(PO4)7(OH)3.4H2O M
VYACHESLAVITE U++++(PO4)(OH).2.5H2O O
LOOMISITE Ba[Be2P2O8].H2O M
With CO3, SO4, SiO4
GIRVASITE NaCa2Mg3(PO4)3(CO3)(H2O)6 M
VOGGITE Na2Zr(PO4)(CO3)(OH).2H2O M
PEISLEYITE Na3Al16(SO4)2(PO4)10(OH)17.20H2O M
KRASNOITE Ca3Al7,7Si3P4O23,5(OH)12,1F2.8H2O R ps H
PERHAMITE (Ca,Sr)3Al7,7Si3P4O23,5(OH)14,1.8H2O R ps H
SARYARKITE-(Y) Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7.6H2O H
MICHEELSENITE (Ca,Y)3Al(PO3OH,CO3)(CO3)(OH)6.12H2O H
MICHEELSENITE (Ca2Y)Al(PO3OH)(CO3)(OH)6.12H2O H
PARWANITE (Na,K)(Mg,Ca)4Al8(CO3)(PO4)8(OH)7.30H2O M ps H
SKORPIONITE Ca3Zn2(CO3)(PO4)2(OH)2.H2O M
JORGKELLERITE Na3Mn+++3(PO4)2(CO3)O2.5H2O R
JUANSILVAITE Na5Al3[AsO3(OH)]4[AsO2(OH)2]2(SO4)2.4H2O M
VANDERHEYDENITE Zn6(PO4)2(SO4)(OH)4.7H2O M
WHITEROCKITE CaMgMn+++3O2(PO4)2(CO3)F.5H2O M
Uranyl phosphates and arsenates
UO2:RO4 = 1:2
ORTHOWALPURGITE (UO2)Bi4O4(AsO4)2.2H2O O
PHOSPHOWALPURGITE Bi4(UO2)(PO4,AsO4)2O4.2H2O A
WALPURGITE Bi4(UO2)(AsO4)2O4.2H2O A
PARSONSITE Pb2(UO2)(PO4)2.2H2O A
HALLIMONDITE Pb2(UO2)(AsO4)2 A
ULRICHITE CaCu++(UO2)(PO4)2.4H2O M
LAKEBOGAITE NaCa(Fe+++,Al)2H(UO2)2(PO4)4(OH)2.8H2O M
UO2:RO4 = 1:1
URANOSPINITE Ca[(UO2)(AsO4)]2(H2O)11 O
ZEUNERITE Cu++(UO2)2(AsO4)2.10-16H2O Q
XIANGJIANGITE (Fe+++,Al)(UO2)4(PO4)2(SO4)2(OH).22H2O Q
NOVACEKITE I = HYDRONOVACEKITE Mg(UO2)2(AsO4)2.10-12H2O Q
METARAUCHITE (Ni,Co)(UO2)2(AsO4)2.8H2O A
TORBERNITE Cu++(UO2)2(PO4)2.8-12H2O Q
RAUCHITE (Ni,Mg)(UO2)2(AsO4)2.10H2O A
NOVACEKITE II = NOVACEKITE Mg(UO2)2(AsO4)2.10H2O M
AUTUNITE Ca(UO2)2(PO4)2.10-12H2O Q
HEINRICHITE Ba[(UO2)(AsO4)]2(H2O)10 M
URANOCIRCITE Ba[(UO2)(PO4)]2(H2O)10 O
KAHLERITE Fe++(UO2)2(AsO4)2.10-12H2O Q
SALEEITE Mg(UO2)2(PO4)2.10H2O M ps Q
NOVACEKITE Mg(UO2)2(AsO4)2.10-12H2O M
HYDRONOVACEKITE Mg(UO2)2(AsO4)2.12H2O A
METANATROAUTUNITE Na2(UO2)2(PO4)2.6-8H2O Q
PRZHEVALSKITE Pb(UO2)2(PO4)2.4H2O O
METAZEUNERITE Cu++(UO2)2(AsO4)2.8H2O Q
METAURANOSPINITE Ca(UO2)2(AsO4)2.8H2O Q
METAURANOCIRCITE II = METAURANOCIRCITE Ba[(UO2)(PO4)]2(H2O)7 M
METAURANOCIRCITE I Ba(UO2)2(PO4)2.6-8H2O M
METASALEEITE Mg(UO2)2(PO4)2.8H2O Q
METANOVACEKITE Mg(UO2)2(AsO4)2.4-8H2O Q
METAKIRCHHEIMERITE Co(UO2)2(AsO4)2.8H2O A
METAKAHLERITE Fe++(UO2)2(AsO4)2.8H2O Q
METAHEINRICHITE Ba[(UO2)(AsO4)]2(H2O)7 M
METAAUTUNITE Ca(UO2)2(PO4)2.2-6H2O Q
LEHNERITE Mn++U++++++(PO4)2O.8H2O M
BASSETITE Fe++(UO2)2(PO4)2.8H2O M
METATORBERNITE Cu++(UO2)2(PO4)2.8H2O Q
METAURANOCIRCITE Ba[(UO2)(PO4)]2(H2O)7 M
PSEUDOAUTUNITE (H3O)4Ca2(UO2)2(PO4)4.5H2O (?) Q
URAMPHITE (NH4)(UO2)(PO4).3H2O O (?)
ABERNATHYITE K2(UO2)2(AsO4)2.8H2O Q
CHERNIKOVITE (H3O)2(UO2)2(PO4)2.6H2O Q
METAANKOLEITE K2(UO2)2(PO4)2.6H2O Q
URAMARSITE (NH4,H3O)2(UO2)(AsO4,PO4)2.6H2O Q
NATROURANOSPINITE (Na2,Ca)(UO2)2(AsO4)2.5H2O Q
TROGERITE (H3O)(UO2)(AsO4).3H2O Q
THREADGOLDITE Al(UO2)2(PO4)2(OH).8H2O M
CHISTYAKOVAITE Al(UO2)2(AsO4)2(F,OH).6,5H2O M
URANOSPATHITE Al0,5-1(UO2)2(PO4)2F.20-21H2O O ps Q
ARSENURANOSPATHITE HAl(UO2)4(AsO4)4.40H2O Q
VOCHTENITE (Fe++,Mg)Fe+++[(UO2)(PO4)]4(OH).12-13H2O M
COCONINOITE Fe+++2Al2(UO2)2(PO4)4(SO4)(OH)2.20H2O M (?)
RANUNCULITE HAl(UO2)PO4(OH)3.4H2O M ps O
TRIANGULITE Al3(UO2)4(PO4)4(OH)5.5H2O A
FURONGITE Al4[(UO2)4(PO4)6](OH)2(H2O)19,5H2O A
SABUGALITE H0,5Al0,5(UO2)2(PO4)2.8H2O M ps Q
HORAKITE (Bi7O7OH)[(UO2)4(PO4)2(AsO4)2(OH)2] M
UO2:RO4 = 3:2
UPALITE Al(UO2)3(PO4)2O(OH).7H2O M
FRANCOISITE-(Ce) (Ce,Nd,Ca)(UO2)3(PO4)2O(OH).6H2O M
FRANCOISITE-(Nd) (Nd,Y,Sm,Ce)(UO2)3(PO4)2O(OH).6H2O M
PHURALUMITE Al2[(UO2)3(PO4)2O(OH)](OH)3(H2O)9 M
ARSENURANYLITE Ca(UO2)4(AsO4)2(OH)4.6H2O O
DEWINDTITE Pb3[H(UO2)3O2(PO4)2]2.12H2O O
RENARDITE Pb(UO2)4(PO4)2(OH)4.7H2O O
PHOSPHURANYLITE KCa(H3O)3(UO2)7(PO4)4O4.8H2O O
YINGJIANGITE (K2,Ca)(UO2)7(PO4)4(OH)6.6H2O O
KIVUITE (Th,Ca,Pb)H2(UO2)4(PO4)2(OH)8.7H2O (?) O (?)
DUMONTITE Pb2(UO2)3O2(PO4)2.5H2O M
HUGELITE Pb2(UO2)3(AsO4)2O2.5H2O M
ARSENOVANMEERSSCHEITE U++++++(UO2)3(AsO4,PO4)2(OH)2.4H2O O
METAVANMEERSSCHEITE U++++++(UO2)3(PO4)2(OH)6.2H2O O
VANMEERSSCHEITE U++++++(UO2)3(PO4)2(OH)6.4H2O O
ALTHUPITE ThAl(UO2)7(PO4)4(OH)5.15H2O A
MUNDITE Al(UO2)3(PO4)2(OH)3,5.5H2O O
PHURCALITE Ca2(UO2)3O2(PO4)2.7H2O O
BERGENITE Ba4Ca2(UO2)6(PO4)6O6.16H2O M
Unclassified
MOREAUITE Al3(UO2)(PO4)3(OH)2.13H2O M
SREINITE (BiO)3Pb(UO2)4(OH)7(PO4,AsO4)2.4H2O C
ASSELBORNITE (BiO)3(Pb,Ba)(UO2)4(OH)7(AsO4)2.4H2O C
METALODEVITE Zn(UO2)2(AsO4)2.10H2O Q
KAMITUGAITE PbAl(UO2)5[(P,As)O4]2(OH)9.9.5H2O A
NIELSBOHRITE K(UO2)3(AsO4)(OH)4.H2O O
Polyphosphates, Polyarsenates, [4]-Polyvanadates
Polyphosphates, etc., without OH and H2O; dimers of corner-sharing RO4 tetrahedra
BLOSSITE Cu2V+++++2O7 O
ZIESITE Cu2V+++++2O7 M
CHERVETITE Pb2V2O7 M
PYROPHOSPHITE K2Ca(P2O7) M
PYROCOPROITE (K,Na)2Mg(P2O7) M
PETEWILLIAMSITE (Ni,Co)2(As2O7) M
ANASTASENKOITE CaFe++(P2O7) A
PHOSPHOCYCLITE-(Fe) Fe++2(P4O12) M
PHOSPHOCYCLITE-(Ni) Ni2(P4O12) M
SAMRAITE Ni2P2O7 M
NABATEAITE Fe2P2O7 A
LISANITE CaNiP2O7 A
SHASUITE CaNi3(P2O7)2 M
Polyphosphates, etc., with OH only
ENGELHAUPTITE KCu3(V2O7)(OH)2Cl H
Polyphosphates, etc., with H2O only
FIANELITE Mn++2V+++++(V+++++,As+++++)O7.2H2O M
RUDLINGERITE Mn++2V+++++As+++++O7.2H2O M
CANAPHITE CaNa2P2O7.4H2O M
PINTADOITE Ca2(V2O7).9H2O (?)
ARNHEMITE (K,Na)4Mg2(P2O7)2.5H2O H
WOOLDRIDGEITE Na2CaCu++2(P2O7)2.10H2O O
KANONEROVITE Mn++Na3P3O10.12H2O M
MESAITE CaMn++5(V2O7)3.12H2O M
HYLBROWNITE Na3MgP3O10.12H2O M ps O
DONOWENSITE a(H2O)3Fe+++2(V2O7)2 A
Polyphosphates, etc., with OH and H2O
MARTYITE (Zn,Co)3(V2O7)(OH)2.2H2O R ps H
KARPENKOITE Co3(V2O7)(OH)2.2H2O R ps H
VOLBORTHITE Cu++3V+++++2O7(OH)2.2H2O M
MORRISONITE Ca11(As3+V4+2V5+10As5+6O51)2.78H2O M
BICAPITE [KNa2Mg2(H2O)25][H2PV+++++12O40(V+++++O)2] Q
GATEWAYITE Ca6(As+++V++++3V+++++9As+++++6O51).31H2O M
VANARSITE NaCa12(As+++V+++++8,5V4++++3,5As+++++6O51)2.78H2O M
KEGGINITE Pb3Ca3[AsV12O40(VO)].20H2O R
LUMSDENITE NaCa3Mg2(As+++V++++2V+++++10As+++++6O51).45H2O A
PACKRATITE Ca11(As+++V+++++10V++++2As+++++6O51)2.83H2O A
CHINCHORROITE Na2Mg5(As2O7)2(AsO3OH)2(H2O)10 A
Ino-[4]-vanadates
ANKINOVICHITE (Ni,Zn)Al4(VO3)2(OH)12.2H2O M
ALVANITE ZnAl4(VO3)2(OH)12(H2O)2 M
Phosphates, etc. unclassified
GRANDAITE Sr2Al(AsO4)2(OH) M
KAINOTROPITE Cu4Fe+++O2(V2O7)(VO4) O
DYMKOVITE (Ni,Mg)(UO2)2(As+++O3).7H2O M
STRONTIOHURLBUTITE SrBe2(PO4)2 M
MEJILLONESITE NaMg2(PO3OH)(PO4)(OH).H5O2 O
YAKUBOVICHITE CaNi2Fe+++(PO4)3 O
METAURAMPHITE (NH4)2(UO2)2(PO4)2.6H2O  
MEDVEDEVITE KMn++2V2O6Cl.2H2O M
MIKEHOWARDITE Fe+++4(V+++++O4)4(H2O)2.H2O A
CHANGESITE-(Y) (Ca8Y)[]Fe++(PO4)7 R
URANOCIRCITE-II Ba(UO2)2(PO4)2.10H2O  
ABUITE CaAl2(PO4)2F2 O
CHONGITE Ca3Mg2(AsO4)2(AsO3OH)2.4H2O M
DOMEROCKITE Cu4(AsO4)2(AsO3OH)(OH)3.H2O A
JOELBRUGGERITE Pb3Zn3(Sb+++++,Te++++++)As2O13(OH,O) H
BATAGAYITE CaZn2(Zn,Cu)6(PO4)4[PO3(OH)]3.12H2O M
ARSMIRANDITE Na18Cu12Fe+++O8(AsO4)8Cl5 M
* SILICATES, Germanates
Nesosilicates
Nesosilicates without additional anions; cations in tetrahedral [4] coordination
WILLEMITE Zn2SiO4 R
EUCRYPTITE LiAlSiO4 R
PHENAKITE Be2SiO4 R
LIBERITE Li2BeSiO4 M
Nesosilicates without additional anions; cations in [4] and greater coordination
TRIMERITE Ca,Mn2Be3(SiO4)3 M
LARSENITE PbZnSiO4 O
ESPERITE PbCa2Zn3(SiO4)3 M
RONDORFITE Ca8Mg(SiO4)4Cl2 C
Nesosilicates without additional anions; cations in octahedral [6] coordination
LIEBENBERGITE (Ni,Mg)2SiO4 O
GLAUCOCHROITE CaMnSiO4 O
TEPHROITE Mn++2SiO4 O
LAIHUNITE Fe++Fe+++2(SiO4)2 M
FORSTERITE Mg2SiO4 O
FAYALITE Fe++2SiO4 O
KIRSCHSTEINITE CaFe++SiO4 O
MONTICELLITE CaMgSiO4 O
BRUNOGEIERITE Fe++2Ge++++O4 C
RINGWOODITE (Mg,Fe++)2SiO4 C
CHESNOKOVITE Na2SiO2(OH)2.8H2O O
AHRENSITE Fe2SiO4 C
POIRIERITE Mg2SiO4 O
Nesosilicates without additional anions; cations in [6] and/or greater coordination
LARNITE Ca2SiO4 M
CALCIOOLIVINE Ca2SiO4 O
MERWINITE Ca3Mg(SiO4)2 M
BREDIGITE Ca7Mg(SiO4)4 O ps H
GROSSULAR {Ca3}[Al2](Si3)O12 C
MAJORITE {Mg3}[SiMg](Si3)O12 C
MENZERITE-(Y) {Y2Ca}[Mg2](Si3)O12 C
KHOHARITE Mg3Fe+++2(SiO4)3 C
IRINARASSITE {Ca3}[Sn++++2](SiAl2)O12 C
WADALITE Ca12Al010Si4O32Cl6 C
UVAROVITE {Ca3}[Cr+++2](Si3)O12 C
TOTURITE {Ca3}[Sn++++2](SiFe+++2)O12 C
SPESSARTINE {Mn++3}[Al2](Si3)O12 C
SCHORLOMITE {Ca3}[Ti2](SiFe+++2)O12 C
PYROPE {Mg3}[Al2](Si3)O12 C
MORIMOTOITE {Ca3}[TiFe++](Si3)O12 C
MOMOIITE {Mn++3}[V+++2](Si3)O12 C
NIKMELNIKOVITE Ca12Fe++Fe+++3Al3(SiO4)6(OH)20 R
ANDRADITE {Ca3}[Fe+++2](Si3)O12 C
HOLTSTAMITE Ca3(Al,Mn+++)2(SiO4)2(OH)4 Q
ALMANDINE {Fe++3}[Al2](Si3)O12 C
KNORRINGITE {Mg3}[Cr+++2](Si3)O12 C
CALDERITE {Mn++3}[Fe+++2](Si3)O12 C
ELTYUBYUITE Ca12Fe+++10Si4O32Cl6 C
ERINGAITE {Ca3}[Sc2](Si3)O12 C
GOLDMANITE {Ca3}[V+++2](Si3)O12 C
HENRITERMIERITE {Ca3}[Mn+++2](Si2)([])O8(OH)4 Q
KIMZEYITE {Ca3}[Zr2](SiAl2)O12 C
KERIMASITE {Ca3}[Zr2](SiFe+++2)O12 C
KATOITE Ca3Al2(SiO4)3-x(OH)4x (x = 1,5-3) C
HUTCHEONITE Ca3Ti2(SiAl2)O12 C
SKIAGITE Fe++3Fe+++2[SiO4]3  
RUBINITE Ca3Ti+++2Si3O12 C
BLYTHITE Mn++3Mn+++2[SiO4]3  
HYDROUGRANDITE (Ca,Mg,Fe++)3(Fe+++,Al)2(SiO4)3-x(OH)4x (?) C
YAMATOITE = MOMOIITE (Mn++,Ca)3(V+++,Al)2(SiO4)3 (?) C
COFFINITE U(SiO4)1-x(OH)4x Q
HAFNON HfSiO4 Q
STETINDITE-(Ce) Ce++++SiO4 Q
THORITE (Th,U)SiO4 Q
ZIRCON (Zr,Hf)SiO4 Q
AUERLITE Th(Si,P)O4 (?)  
HUTTONITE ThSiO4 M
TOMBARTHITE-(Y) Y4(Si,H4)4O12-x(OH)4+2x M
EULYTINE Bi4(SiO4)3 C
REIDITE ZrSiO4 Q
JEFFBENITE Mg3Al2Si3O12 Q
ADRIANITE Ca12(Al4Mg3Si7)O32Cl6 C
JINGWENITE-(Y) YAlV++++(SiO4)O2(OH)2 M
Nesosilicates with additional anions (O,OH,F,H2O); cations in tetrahedral [4] coordination
BERYLLITE Be3SiO4(OH)2.H2O O (?)
EUCLASE BeAlSiO4(OH) M
SVERIGEITE NaMnMgSn++++Be2Si3O12(OH) O
HODGKINSONITE MnZn2SiO4(OH)2 M
GERSTMANNITE (Mg,Mn)2ZnSiO4(OH)2 O
CLINOHEDRITE CaZnSiO4.H2O M
STRINGHAMITE CaCuSiO4.2H2O M
KATOPTRITE (Mn,Mg)13(Al,Fe+++)4Sb+++++2Si2O28 M
YEATMANITE Mn++9Zn6Sb+++++2Si4O28 A
SPHAEROBERTRANDITE Be3SiO4(OH)2 M ps O
Nesosilicates with additional anions; cations in [4], [5] and/or only [6] coordination
SILLIMANITE Al2SiO5 O
XENOLITE = a Sillimanite ? Al10Si8O31  
ANDALUSITE Al2SiO5 O
KANONAITE (Mn+++,Al)AlSiO5 O
KYANITE Al2SiO5 A
KRIESELITE (Al,Ga)2(Ge,Al)O4(F,OH)2 O
MULLITE Al4+2xSi2-2xO10-x (x about 0,4) O
BOROMULLITE Al8BO4AlO4(SiO4)2O3 O
YODERITE (Mg,Al,Fe+++)8Si4(O,OH)20 M
MAGNESIOSTAUROLITE []4Mg4Al16(Al2[]2)Si8O40[(OH)2O6] M
STAUROLITE (Fe++,Mg,Zn)2Al9(Si,Al)4O22(OH)2 M ps O
ZINCOSTAUROLITE (Zn,Li,Fe,Mg)2Al9(Si,Al)4O22(OH)2 M
TOPAZ Al2SiO4(F,OH)2 O
NORBERGITE Mg3(SiO4)(F,OH)2 O
REINHARDBRAUNSITE Ca5(SiO4)2(OH,F)2 M
ALLEGHANYITE Mn++5(SiO4)2(OH)2 M
CHONDRODITE (Mg,Fe++)5(SiO4)2(F,OH)2 M
HYDROXYLCHONDRODITE Mg5(SiO4)2(OH)2 M
KUMTYUBEITE Ca5(SiO4)2F2 M
HUMITE (Mg,Fe++)7(SiO4)3(F,OH)2 O
FLUORCHEGEMITE Ca7(SiO4)3F2 O
MANGANHUMITE (Mn++,Mg)7(SiO4)3(OH)2 O
CLINOHUMITE (Mg,Fe++)9(SiO4)4(F,OH)2 M
HYDROXYLCLINOHUMITE Mg9(SiO4)4(OH,F)2 M
SONOLITE Mn++9(SiO4)4(OH,F)2 M
LEUCOPHOENICITE Mn++7(SiO4)3(OH)2 M
RIBBEITE (Mn++,Mg)5(SiO4)2(OH)2 O
JERRYGIBBSITE Mn++9(SiO4)4(OH)2 O
SCORTICOITE Mn6(Sb,[])2(SiO4)2O3(OH)3 R
FRANCISCANITE Mn++3V+++++(SiO4)(O,OH)7 H
OREBROITE Mn++3(Sb+++++,Fe+++)Si(O,OH)7 H
WELINITE Mn++3(W++++++,Mg)0,7SiO4(O,OH)3 H
ELLENBERGERITE Mg6TiAl6Si8O28(OH)10 H
CHLORITOID (Fe++,Mg,Mn)2Al4Si2O10(OH)4 M/A
MAGNESIOCHLORITOID MgAl2SiO5(OH)2 A
OTTRELITE (Mn,Fe++,Mg)2Al4Si2O10(OH)4 M/A
OLMIITE CaMn++SiO3(OH)2 O
POLDERVAARTITE CaCaSiO3(OH)2 O
PILAWITE-(Y) Ca2Y2Al4(SiO4)4O2(OH)2 M
BARWOODITE Mn++6(Nb+++++,[])2(SiO4)2(O,OH)6 H
CHEGEMITE Ca7(SiO4)3(OH)2 O
Nesosilicates with additional anions; cations in > [6] +- [6] coordination
GATEDALITE ZrMn++2Mn+++4SiO12 Q
ABSWURMBACHITE Cu++Mn+++6SiO12 Q
BRAUNITE Mn++Mn+++6SiO12 Q
BRAUNITE-II Ca(Mn+++,Fe+++)14SiO24 Q
NELTNERITE CaMn+++6SiO12 Q
LANGBANITE (Mn++,Ca)4(Mn+++,Fe+++)9Sb+++++Si2O24 R
TAIPINGITE-(Ce) Ce+++7Ca2Mg(SiO4)3[SiO3(OH)]4F3 R
VANADOMALAYAITE CaVOSiO4 M
TITANITE CaTiSiO5 M
MALAYAITE CaSnSiO5 M
NATROTITANITE (Na,Ca,Y,REE)TiSiO4(O,F) M
ZABINSKIITE Ca[Al0,5(Ta,Nb)0,5)](SiO4)O A
ALUMINOCERITE-(Ce) (Ce,Ca,La,Nd)9(Al,Fe+++)(SiO4)3[SiO3(OH)]4(OH)3 R
CERITE-(Ce) Ce+++9Fe+++(SiO4)6[(SiO3)(OH)](OH)3 R
FERRICERITE-(La) (La,Ce,Ca)9Fe+++(SiO4)3(SiO3OH)4(OH)3 R ps H
MIEITE-(Y) Y4Ti(SiO4)2O[F,(OH)]6 O
TRIMOUNSITE-(Y) (Y,Dy,Er,Yb,Gd,Ho,Tb,Sm)2Ti2SiO9 M
YFTISITE-(Y) (Y,Dy,Er)4(Ti,Sn++++)O(SiO4)2(F,OH)6 O
SITINAKITE Na2K(Ti,Nb)4O4(SiO4)2(O,OH).4H2O Q
KITTATINNYITE Ca4Mn++2Mn+++4Si4O16(OH)8.18H2O H
NATISITE Na2(TiO)SiO4 Q
PARANATISITE Na2(TiO)SiO4 O
TORNEBOHMITE-(Ce) (Ce,La)2Al(SiO4)2(OH) M
TORNEBOHMITE-(La) (La,Ce)2Al(SiO4)2(OH) M
HYDROXYLEDGREWITE Ca9(SiO4)4(OH)2 M
KULIOKITE-(Y) (Y,Yb,Er,Dy,Lu,Gd,Tm,Ho)4Al(SiO4)2(OH)2F5 A
IVANYUKITE-Na Na3[Ti4(OH)O3(SiO4)3].7H2O R
IVANYUKITE-Cu Cu[Ti4(OH)2O2(SiO4)3].7H2O C
IVANYUKITE-K K2[Ti4(OH)2O2(SiO4)3].9H2O C
ULFANDERSSONITE-(Ce) (Ce15Ca)Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 M
CHANTALITE CaAl2SiO4(OH)4 Q
MOZARTITE CaMn+++SiO4(OH) O
VUAGNATITE CaAlSiO4(OH) O
HATRURITE Ca3SiO5 R
JASMUNDITE Ca11(SiO4)4O2S Q
AFWILLITE Ca3[SiO3(OH)]2.2H2O M
BULTFONTEINITE Ca2SiO2(OH,F)4 A
ZOLTAIITE BaV+++12(Ti,V++++)2(Si2O8)O19 R
TRANQUILLITYITE Fe++8(Zr,Y)2Ti3Si3O24 H
EDGREWITE Ca9(SiO4)4F2 M
IVANYUKITE-Na-C Na2[Ti4O2(OH)2(SiO4)3].6H2O C
IVANYUKITE-Na-T Na2[Ti4O2(OH)2(SiO4)3].6H2O R
Nesosilicates with CO3, SO4, PO4, etc.
IIMORIITE-(Y) Y2(SiO4)(CO3) A
TUNDRITE-(Ce) Na2(Ce,La,Nd)2(Ti,Nb)(O,OH)2(SiO4)(CO3)2 A
TUNDRITE-(Nd) Na3(Nd,La)4(Ti,Nb)2(SiO4)2(CO3)3O4(OH).2H2O A
SPURRITE Ca5(SiO4)2(CO3) M
GALUSKINITE Ca7(SiO4)3(CO3) M
TERNESITE Ca5(SiO4)2SO4 O
SILICOCARNOTITE Ca5[(SiO4)(PO4)](PO4) O
HYDROXYLELLESTADITE Ca5(SiO4)1,5(SO4)1,5OH M ps H
TRITOMITE-(Y) Y5(SiO4,BO4)3(O,OH,Cl) R (?)
TRITOMITE-(Ce) Ce5(SiO4,BO4)3(OH,O) R
MATTHEDDLEITE Pb5(SiO4)1,5(PO4)1,5Cl H
CHLORELLESTADITE Ca5(SiO4)1,5(SO4)1,5Cl O
FLUORCALCIOBRITHOLITE (Ca,Ce,La,Nd)5(SiO4,PO4)3(F,O) H
FLUORBRITHOLITE-(Ce) (Ce,Ca)5(SiO4)3F H
BRITHOLITE-(Y) (Y,Ca)5(SiO4,PO4)3(OH,F) H
BRITHOLITE-(Ce) (Ce,Ca)5(SiO4,PO4)3(OH,F) H
FLUORELLESTADITE Ca5(SiO4)1,5(SO4)1,5F H
FLUORBRITHOLITE-(Y) (Y,Ca,Ce,Nd)5(SiO4)3(F,O) H
CALCIOBRITHOLITE (Ca,Y)5(SiO4,PO4)3(OH)  
DARGAITE BaCa12(SiO4)4(SO4)2O3 R
NABIMUSAITE KCa12(SiO4)4(SO4)2O2F R
GAZEEVITE BaCa6(SiO4)2(SO4)2O R
STRACHERITE BaCa6(SiO4)2[(PO4)(CO3)]2F R
FLAMITE (Ca,Na,K)2(Si,P)O4 H
BYZANTIEVITE Ba5(Ca,REE,Y)22(Ti,Nb)18(SiO4)4[(PO4),(SiO4)]4(BO3)9O22[(OH),F]43(H2O)1,5 R
GREENWOODITE Ba2-x(V+++OH)xV9(Fe+++,Fe++)2Si2O22 R
KIHLMANITE-(Ce) Ce2TiO2[SiO4](HCO3)2(H2O) A
TSANGPOITE Ca5(PO4)2(SiO4) H
ENALITE (Th,REE,Al) [(PO4),(SiO4),(OH)] Q
Nesosilicates with BO3 triangles and/or B[4], Be[4] tetrahedra, cornersharing with SiO4
GRANDIDIERITE (Mg,Fe++)Al3(BO4)(SiO4)O O
OMINELITE (Fe++,Mg)Al3BSiO9 O
DUMORTIERITE Al7(BO3)(SiO4)3O3 O
TITANOHOLTITE (Ti0,75[]0,25)Al6BSi3O18 O
NIOBOHOLTITE (Nb0,6[]0,4)Al6BSi3O18 O
HOLTITE Al6(Al,Ta)(Si,Sb)3BO15(O,OH)2 O
MAGNESIODUMORTIERITE (Mg,Ti,-)(Al,Mg)2Al4Si3O18-y(OH)yB (y=2-3) O
GARRELSITE Ba3NaSi2B7O16(OH)4 M
HINGGANITE-(Yb) (Yb,Y)BeSiO4(OH) M
HINGGANITE-(Nd) Nd2[]Be2Si2O8(OH)2 M
GADOLINITE-(Nd) Nd2Fe++Be2O2(SiO4)2 M
MINASGERAISITE-(Y) CaY2Be2Si2O10 M
HOMILITE Ca2(Fe++,Mg)B2Si2O10 M
HINGGANITE-(Ce) BeCeSiO4(OH) M
GADOLINITE-(Y) Y2Fe++Be2Si2O10 M
GADOLINITE-(Ce) (Ce,La,Nd,Y)2Fe++Be2Si2O10 M
DATOLITE Ca2B2Si2O8(OH)2 M
CALCYBEBOROSILITE-(Y) (Y,Ca)2([],Fe++)(B,Be)2[SiO4]2(OH,O)2 M
HINGGANITE-(Y) BeYSiO4(OH) M
MUROMONTITE Be2FeY2Si3O12 (?)  
MELANOCERITE-(Ce) (Ce,Ca)5(OH,F)[(Si,B)O4]3.nH2O (?) H
STILLWELLITE-(Ce) (Ce,La,Ca)BSiO5 R
CAPPELENITE-(Y) Ba(Y,Ce)6Si3B6O24F2 R
LAPTEVITE-(Ce) Ca6(Fe++,Mn++)Y3REE7(SiO4)3(PO4)(B3Si3O18)(BO3)F11 H
HUNDHOLMENITE-(Y) (Y,REE,Ca,Na)15(Al,Fe+++)(CaxAs+++1-x)(Si,As+++++)Si6B3(O,F)48 (x = 0,78) R
OKANOGANITE-(Y) Na(Y,Ce,Nd,Ca,Na)15Fe+++(Si3B3O18)(SiO4)4F10(OH)4 R
PROSHCHENKOITE-(Y) (Y,REE,Ca,Na,Mn)15(Fe++,Mn)Ca(P,Si)Si6B3O34F14 R
VICANITE-(Ce) (Ca,REE,Th)15Fe+++(SiO4)3(Si3B3O18)(BO3)(As+++++O4)(As+++O3)x(NaF3)1-xF7.0,2H2O (x=0.4) R
JADARITE NaLiB3SiO7(OH) M
ARRHENIUSITE-(Ce) CaMg[(Ce7Y3)Ca5](SiO4)3(Si3B3O18)(AsO4)(BO3)F11 R
Uranyl neso- and polysilicates
SODDYITE (UO2)2(SiO4)(H2O)2 O
CUPROSKLODOWSKITE (H3O)2Cu(UO2)2(SiO4)2.2H2O A
OURSINITE (Co,Mg)(UO2)2Si6(OH)2.6H2O O
SKLODOWSKITE (H3O)2Mg(UO2)2(SiO4)2.2H2O M
BOLTWOODITE (K,Na)(UO2)SiO3(OH).1,5H2O M
KASOLITE Pb(UO2)SiO4.H2O M
NATROBOLTWOODITE (Na,K)(UO2)SiO3(OH).1,5H2O O
URANOPHANE Ca(UO2)2(SiO3OH)2.5H2O M
URANOPHANE-Beta = PARAURANOPHANE Ca(UO2)2SiO3(OH)2.5H2O M
PARAURANOPHANE Ca(UO2)2SiO3(OH)2.5H2O M
SWAMBOITE-(Nd) Nd0.33[(UO2)(SiO3OH)].2,5(H2O) M
HAIWEEITE Ca(UO2)2Si5O12(OH)2.4,5H2O O
METAHAIWEEITE Ca(UO2)2Si6O15.nH2O M (?)
COUTINHOITE (Th,Ba)0,5(UO2)2Si5O13.1-3,5H2O O
WEEKSITE K2(UO2)2(Si5O13).4H2O M
MAGNIOURSILITE Mg4(UO2)4(Si2O5)5(OH)6.20H2O  
CALCIOURSILITE Ca4(UO2)4(Si2O5)5(OH)6.15H2O  
URANOSILITE U++++++Si7O17 O
ORLITE Pb3(UO2)3(Si2O7)2.6H2O  
Sorosilicates
Si2O7 groups, without non-tetrahedral anions; cations in tetrahedral [4] coordination
Si2O7 groups, without non-tetrahedral anions; cations in tetrahedral [4] and greater coordination
JEFFREYITE (Ca,Na)2(Be,Al)Si2(O,OH)7 O ps Q
HYDROXYLGUGIAITE (Ca,[])2(Be,Si)[(Si,Be)2O5(OH)2] Q
OKAYAMALITE Ca2B2SiO7 Q
HARDYSTONITE Ca2ZnSi2O7 Q
GEHLENITE Ca2Al(AlSi)O7 Q
CEBOLLITE Ca2(Mg,Fe++,Al)Si2(O,OH)7 O
ALUMOAKERMANITE NaCa(Al,Fe+++)Si2O7 Q
AKERMANITE Ca2MgSi2O7 Q
GUGIAITE Ca2BeSi2O7 Q
FERRIGEHLENITE Ca2Fe+++[AlSiO7]  
BARYLITE BaBe2Si2O7 O ps H
BARYLITE-1O BaBe2Si2O7  
ANDREMEYERITE BaFe++2Si2O7 M
MELILITE = Melilite group (Ca,Na)2(Al,Mg)(Si,Al)2O7 Q
BENNESHERITE Ba2Fe++Si2O7 Q
Si2O7 groups, without non-tetrahedral anions; cations in octahedral [6] and greater coordination
KEIVIITE-(Y) (Y,Yb)2Si2O7 M
KEIVIITE-(Yb) (Yb,Y)2Si2O7 M
THORTVEITITE (Sc,Y)2Si2O7 M
YTTRIALITE-(Y) (Y,Th)2Si2O7 H (?)
GITTINSITE CaZrSi2O7 M
PARAKELDYSHITE Na2ZrSi2O7 A
KELDYSHITE Na2-xHxZrSi2O7.nH2O A
KHIBINSKITE K2ZrSi2O7 M ps R
RANKINITE Ca3Si2O7 M
BARYSILITE Pb8Mn(Si2O7)3 R
EDGARBAILEYITE Hg+6Si2O7 M
KRISTIANSENITE Ca2ScSn(Si2O7)(Si2O6OH) A
SILESIAITE Ca2Fe+++Sn(Si2O7)(Si2O6OH) A
PERCLEVEITE-(Ce) (Ce,La,Nd)2(Si2O7) Q
PERCLEVEITE-(La) La2Si2O7 Q
SCOTTYITE BaCu2Si2O7 O
KOZLOWSKIITE Ca4Fe2Sn3(Si2O7)2[Si2O6(OH)]2 A
Si2O7 groups, with additional anions; cations in tetrahedral [4] and greater coordination
BERTRANDITE Be4Si2O7(OH)2 O
HEMIMORPHITE Zn4Si2O7(OH)2.H2O O
JUNITOITE CaZn2Si2O7.H2O O
AXINITE-(Fe) Ca2Fe++Al2BO3Si4O12(OH) A
TINZENITE Ca2Mn++4Al4[B2Si8O30](OH)2 A
AXINITE-(Mg) Ca2MgAl2BO3Si4O12(OH) A
AXINITE-(Mn) Ca2Mn++Al2BO3Si4O12(OH) A
VISTEPITE (Mn++,Ca)4Sn++++B2(SiO7)(Si3O9)(OH)2 A
BORALSILITE Al16(BO4)6(SiO4)2O5 M
WERDINGITE (Mg,Fe)2Al12(Al,Fe)2Si4B2(B,Al)2O37 A
VRANAITE Al16B4Si4O38 M
Si2O7 groups, with additional anions; cations in octahedral [6] and greater coordination
WADSLEYITE (Mg,Fe++)2SiO4 O
LAWSONITE CaAl2Si2O7(OH)2.H2O O
ITOIGAWAITE SrAl2Si2O7(OH)2.H2O O
HENNOMARTINITE SrMn+++2Si2O7(OH)2.H2O O
NOELBENSONITE BaMn+++2(Si2O7)(OH)2.H2O O
AMAMOORITE CaMn++2Mn+++(Si2O7)O(OH) M
ILVAITE CaFe++2Fe+++Si2O7O(OH) O
MANGANILVAITE CaFe++Fe+++(Mn,Fe++)(Si2O7)O(OH) M
SUOLUNITE Ca2Si2O5(OH)2.H2O O
JAFFEITE Ca4(Si3O7)(OH)6 H
FRESNOITE Ba2TiSi2O8 Q
HIORTDAHLITE Na2Ca4(Ca0,5Zr0,5)Zr(Si2O7)2OF3 A
WOHLERITE Na2Ca4ZrNb(Si2O7)2O3F M
NORMANDITE Na2Ca2Mn2Ti2(Si2O7)2O2F2 M
NIOCALITE Ca7Nb(Si2O7)2O3F M
JANHAUGITE Na3Mn3Ti2(Si2O7)2(OH)2OF M
CUSPIDINE Ca8(Si2O7)2F4 M
BURPALITE Na4Ca2Zr2(Si2O7)2F4 M
LAVENITE (Na,Ca)8(Mn++,Fe++)4(Zr,Ti)4(Si2O7)4(O,OH,F)8 M
BAGHDADITE Ca6Zr2(Si2O7)2O4 M
HIORTDAHLITE-II (Na,Ca)4Ca8Zr2(Y,Zr,REE,Na)2(Si2O7)4(O3F5) A
MOSANDRITE-(Ce) (Ca3REE)[(H2O)2Ca0,5[]0,5]Ti(Si2O7)2(OH)2(H2O)2 M
NACARENIOBSITE-(Ce) Na3Ca3(Ce,La,Pr,Nd)(Nb,Ti)(Si2O7)2OF3 M
ROUMANITE (Ca,Na,REE,[])7(Nb,Ti)[Si2O7]2OF3 M
RINKITE-(Ce) (Ca3Ce)Na(NaCa)Ti(Si2O7)2(OF)F2 M
HAINITE-(Y) Na2Ca4(Y,REE)Ti(Si2O7)2OF3 A
ROSENBUSCHITE (Ca,Na)12(Zr,Ti)4(Si2O7)4(O4F4) A
GOTZENITE Na(Na,Ca)4Ca2Ti(Si2O7)2(O,F)2 A
KOCHITE Na2(Na,Ca)4Ca4(Mn,Ca)2Zr2(Si2O7)4(O,F)4F4 A
FOGOITE-(Y) Na3Ca2Y2Ti(Si2O7)2OF3 A
DOVYRENITE Ca6Zr[Si2O7]2(OH)4 O
DOVYRENITE Ca6Zr(Si2O7)2(OH)4 O
SEIDOZERITE Na4MnZr2Ti(Si2O7)2O2F2 M
SCHULLERITE (Na,Ca,Mn)2Ba2(Mg,Fe++)2(Ti,Fe+++)2(Si2O7)2O2F2 A
NABALAMPROPHYLLITE Na3(Ba,Na)2Ti3Si8O16(OH,F)2 M
LILEYITE Ba2(Na,Fe,Ca)3MgTi2(Si2O7)2O2F2 M
FLUORLAMPROPHYLLITE Na3(SrNa)Ti3(Si2O7)2O2F2 M
LAMPROPHYLLITE Na2(Sr,Ba)2Ti3(SiO4)4(OH,F)2 M
SAAMITE Ba[]Na3Ti2Nb(Si2O7)2O2(OH)F(H2O)2 A
KAZANSKYITE Ba[]TiNbNa3Ti(Si2O7)2O2(OH)2(H2O)4 A
GRENMARITE (Na,Ca)4(Mn,Na)(Zr,Mn)2(Zr,Ti)(Si2O7)2(O,F)2 M
FERROERICSSONITE BaFe++2Fe+++(Si2O7)O(OH) M
ERICSSONITE BaMn2Fe+++OSi2O7(OH) M
BARYTOLAMPROPHYLLITE (Na,K)2(Ba,Ca,Sr)2(Ti,Fe)3(SiO4)4(O,OH)2 M
EMMERICHITE Ba2Na(Na,Fe++)2(Fe+++,Mg)Ti2(Si2O7)2O2F2 M
FLUORBARYTOLAMPROPHYLLITE (Ba,Sr)2[(Na,Fe++)3(Ti,Mg)F2][Ti2(Si2O7)2O2] M
ERICSSONITE-2O BaMn++2Fe+++(Si2O7)O(OH) O
ERICSSONITE (-2M) BaMn2Fe+++OSi2O7(OH) M
SELIVANOVAITE (Na,Ca)3(Ti,Fe)5[Si4O18(OH)3].7H2O A
KOLSKYITE CaNa2Ti4(Si2O7)O4(H2O)7 A
MURMANITE Na2Ti2Na2Ti2(Si2O7)2O4(H2O)4 A
VIGRISHINITE NaZnTi4(Si2O7)2O3(OH)(H2O)4 A
EPISTOLITE Na4Ti++++4(Si2O7)2O2(OH,F)2.4H2O A
LOMONOSOVITE Na8Mn++Ti++++3Si4O12(PO4)2O4 A
VUONNEMITE Na11Ti++++Nb2(Si2O7)2(PO4)2O3(F,OH) A
SOBOLEVITE Na12Ca(NaCaMn)Ti2(TiMn)[Si2O7]2(PO4)4O3F3 M
INNELITE (Ba,K)4(Na,Ca)3Ti3(Si2O7)(SO4)O4 A
PHOSPHOINNELITE Na3Ba4Ti3(Si2O7)2(PO4,SO4)2(O,F)3 A
YOSHIMURAITE (Ba,Sr)2(Mn++,Fe++)2(Ti++++,Fe+++)(PO4,SO4,SiO4)(Si2O7)(O,OH) A
QUADRUPHITE Na14Ca(Mg,Mn)(Ti,Mn,Zr,Nb)4Si4O12(PO4)4O6F2 A
POLYPHITE Na5(Na4Ca2)Ti2[Si2O7](PO4)3O2F2 A
BORNEMANITE (Na,Ba)4(Na,Ti,Mn++)4(Ti,Nb)2(PO4)(Si2O7)2O2(OH,F,O)2 M
SHKATULKALITE Na2Nb2Na3Ti(Si2O7)2O2(FO)(H2O)4(H2O)3 M
BAFERTISITE Ba(Fe++,Mn)2TiSi2O7(O,OH)2 M
BYKOVAITE (Ba,Na,K)2{(Na,Ti,Mn)4[(Ti,Nb)2O2Si4O14](H2O,F,OH)2}.3,5H2O M
HEJTMANITE Ba(Mn,Fe++)2TiO(Si2O7)(OH,F)2 M
NECHELYUSTOVITE (Ba,Sr,K)2{(Na,Ti,Mn)4[(Ti,Nb)2O2Si4O14](O,H2O,F)2}.4,5H2O M
DELINDEITE (Na,K)3Ba2(Ti,Fe+++)3(Si2O7)2(O,OH,H2O)6 A
ORTHOCHEVKINITE (Ce,La,Ca,Na,Th)4(Fe++,Mg)2(Ti,Fe+++)3Si4O22 O
PERRIERITE-(Nd) Nd4MgFe+++2Ti2(Si2O7)2O8 (?) M
CHEVKINITE-(Nd) (Nd,REE)4(Fe++,Mg)(Fe++,Ti,Fe+++)2(Ti,Fe+++)2(Si2O7)2O8 (?) M ?
BUSSENITE Na2(Ba,Sr)2(Fe++,Mn++)TiSi2O7(CO3)(OH)3F A
PERRAULTITE (Na,Ca)(Ba,K)(Mn++,Fe++)4(Ti,Zr)2(Si2O7)2O2(OH,F,O)3 M
JINSHAJIANGITE NaBaFe++4Ti2(Si2O7)2O2(OH)2F M
PERRIERITE-(Ce) (Ce,La,Ca,Sr)4(Fe++,Mg,Mn++)(Ti,Fe+++)4Si4O22 M
STRONTIOCHEVKINITE (Sr,La,Ce,Ca)4Zr(Ti++++,Fe++,Fe+++)2Ti2O4(Si2O7)2 M
RENGEITE (Sr,Ce)4Zr(Ti++++,Al)4Si4O22 M
CHEVKINITE-(Ce) (Ca,Ce,La)4(Fe++,Mg)2(Ti,Fe+++)3O8(Si2O7)2 M
POLYAKOVITE-(Ce) (Ce,La,Nd,Ca)4(Mg,Fe++)(Cr+++,Fe+++)2(Ti,Nb)2Si4O22 M
PERRIERITE-(La) (La,Ce,Ca)4(Fe++,Mn++,Mg)(Ti,Fe)4Si4O22 M
MAONIUPINGITE-(Ce) (Ca,Ce)4(Fe+++,Ti,Fe++,[])(Ti,Fe+++,Fe++,Nb)4Si4O22 M
KARNASURTITE-(Ce) (Ce,La,Th)(Ti,Nb)(Al,Fe+++)(Si,P)2O7(OH)4.3H2O H (?)
DINGDAOHENGITE-(Ce) Ce4Fe++(Ti,Fe++,Mg,Fe+++)2Ti2Si4O22 M
MATSUBARAITE Sr4Ti5Si4O22 M
HEZUOLINITE (Sr,REE)4Zr(Ti,Fe+++,Fe++)2Ti2O8(Si2O7)2 M
FERSMANITE (Ca,Na)8(Ti,Nb)4(Si4O12)O10(F,OH)4 M
BELKOVITE Ba3(Nb,Ti)6(Si2O7)2O12 H
NASONITE Pb6Ca4Si6O21Cl2 H
KENTROLITE Pb2Mn+++2Si2O9 O
MELANOTEKITE Pb2Fe+++2Si2O9 O
ALEXKUZNETSOVITE-(La) La2Mn(CO3)(Si2O7) M
TILLEYITE Ca5Si2O7(CO3)2 M
ALEXKUZNETSOVITE-(Ce) Ce2Mn(CO3)(Si2O7) M
KILLALAITE Ca6,4[H0,6Si2O7]2(OH)2 M
STAVELOTITE-(La) La3Mn++3Cu++(Mn+++,Fe+++,Mn++++)26[Si2O7]6O30 R
BIRAITE-(La) La2Fe++(CO3)(Si2O7) M
BIRAITE-(Ce) Ce2Fe++(CO3)(Si2O7) M
MAGNESIOROWLANDITE-(Y) Y4(Mg,Fe++)Si4O14F2 A
CERVANDONITE-(Ce) (Ce,Nd,La)(Fe+++,Fe++,Ti++++,Al)3O2(Si2O7)1-x+y(AsO3)1+x-y(OH)3x-3y (x=0,47 y=0,31) M
CHIRVINSKYITE (Na,Ca)13(Fe,Mn,[])2(Ti,Nb)2(Zr,Ti)3(Si2O7)4(OH,O,F)12 A
BATISIVITE Ba(V+++,Cr+++)8Ti++++6(Si2O7)O22 A
RUSINOVITE Ca10(Si2O7)3Cl2 O
SCHLUTERITE-(Y) (Y,REE)2Al(Si2O7)(OH)2F M
ASIMOWITE Fe2SiO4 O
ZINKGRUVANITE Ba4Mn++4Fe+++2(Si2O7)2(SO4)2O2(OH)2 A
ROUMAITE (Ca,Na,Ce,La)6-7(Nb,Ti++++)(Si2O7)(OH)F3 M
ZVYAGINITE NaZnNb2Ti[Si2O7]2O(OH,F)3(H2O)4+x (x less than 1) A
RINKITE-(Y) Na2Ca4YTi(Si2O7)2OF3 M
BETALOMONOSOVITE = PAALOMONOSOVITE Na6[]4Ti4(Si2O7)2[PO3(OH)][PO2(OH)2]O2(OF) A
CORTESOGNOITE CaV2Si2O7(OH)2.H2O O
CALCIOMURMANITE (Na,[])2Ca(Ti,Mg,Nb)4[Si2O7]2O2(OH,O)2(H2O)4 A
BOBSHANNONITE Na2KBa(Mn++,Na)8(Nb,Ti)4(Si2O7)4O4(OH)4(O,F)2 A
CAMARAITE Ba3NaTi4(Fe++,Mn)8(Si2O7)4O4(OH,F)7 A
CHRISTOFSCHAFERITE-(Ce) (Ce,La,Ca)4Mn(Ti,Fe)3(Fe,Ti)(Si2O7)2O8 M
DELHUYARITE-(Ce) Ce4Mg(Fe+++2W)[](Si2O7)2O6(OH)2 M
MOXUANXUEITE NaCa6Zr(Si2O7)2OF3 A
BATIEVAITE-(Y) Y2Ca2Ti(Si2O7)2(OH)2(H2O)4 A
MADEIRAITE Na2Ca2Fe2Zr2(Si2O7)2O2F2 M
BORTOLANITE Ca2(Ca1,5Zr0,5)Na(NaCa)Ti(Si2O7)2(OF)F2 M
PARALOMONOSOVITE Na6[]4Ti4(Si2O7)2[PO3OH][PO2(OH)2]O2(OF) A
Sorosilicates with mixed SiO4 and Si2O7 groups; cations in tetrahedral [4] and greater coordination
HARSTIGITE Ca6MnBe4(SiO4)2(Si2O7)2(OH)2 O
SAMFOWLERITE Ca14Mn++3Zn2Be2Be6Si14O52(OH)6 M
DAVREUXITE MnAl6Si4O17(OH)2 M
QUEITITE Pb4Zn2(SiO4)(Si2O7)(SO4) M
Sorosilicates with mixed SiO4 and Si2O7 groups; cations in octahedral [6] and greater coordination
PIEMONTITE-(Pb) CaPbAl2Mn+++[Si2O7][SiO4]O(OH) M
VANADOANDROSITE-(Ce) (Mn++,Ca)(Ce,La)Mn++(V+++,Mg,Al)Al(SiO4)(Si2O7)(O,F)(OH) M
UEDAITE-(Ce) (Mn++,Ca,Fe++)(Ce,Nd)Fe++(Al,Fe+++)2(Si2O7)(SiO4)OOH M
TWEDDILLITE CaSr(Mn+++,Fe+++)2Al(SiO4)(Si2O7)O(OH) M
PIEMONTITE-(Sr) CaSr(Al,Mn+++,Fe+++)3Si3O11O(OH) M
NIIGATAITE CaSrAl3[Si2O7][SiO4]O(OH) M
KHRISTOVITE-(Ce) (Ca,REE)REE(Mg,Fe++)AlMn++Si3O11(OH)(F,O) M
DOLLASEITE-(Ce) CaCeMg2AlSi3O11(OH,F)2 M
DISSAKISITE-(La) Ca(La,Ce,Th)(Mg,Fe++)(Al,Fe+++,Cr)2(SiO4)(Si2O7)O(OH) M
PIEMONTITE Ca2(Al,Mn+++,Fe+++)3Si3O11O(OH) M
MUKHINITE Ca2(Al2V+++)[Si2O7][SiO4]O(OH) M
CLINOZOISITE Ca2Al3[Si2O7][SiO4]O(OH) M
EPIDOTE Ca2Al2Fe+++[Si2O7][SiO4]O(OH) M
EPIDOTE-(Sr) CaSr(Al,Fe+++,Mn+++)3(Si2O7)(SiO4](OH) M
HANCOCKITE CaPbAl2Fe+++[Si2O7][SiO4]O(OH) M
FERRIALLANITE-(La) Ca(La,Ce,Th)(Fe+++,Al)(Al,Fe+++)(Fe++,Mn,Ti,Mg)(SiO4)(Si2O7)O(OH) M
ALLANITE-(Y) Ca(Y,Ce,La)(Al,Fe++,Fe+++)3(SiO4)3(OH) M
ASKAGENITE-(Nd) Mn++NdAl2Fe+++(Si2O7)(SiO4)O2 M
FERRIALLANITE-(Ce) CaCeFe+++AlFe++[Si2O7][SiO4]O(OH) M
MANGANIAKASAKITE-(La) CaLa(Mn+++AlMn++)[Si2O7][SiO4]O(OH) M
MANGANIANDROSITE-(La) (Mn++,Ca)(La,Ce,Ca,Nd)AlMn+++Mn++(SiO4)(Si2O7)O(OH) M
DISSAKISITE-(Ce) Ca(Ce,La)(Mg,Fe++)(Al,Fe+++)2(SiO4)3(OH) M
ALLANITE-(Nd) CaNdAl2Fe++(SiO4)(Si2O7)O(OH) M
ALLANITE-(Ce) (Ce,Ca,Y)2(Al,Fe++,Fe+++)3(SiO4)3(OH) M
VANADOALLANITE-(La) CaLaV+++AlFe++(SiO4)(Si2O7)O(OH) M
FERRIAKASAKAITE-(Ce) CaCeFe+++AlMn++(Si2O7)(SiO4)O(OH) M
FERRIAKASAKAITE-(La) CaLaFe+++AlMn++(Si2O7)(SiO4)O(OH) M
FERRIANDROSITE-(La) MnLaFe+++AlMn++(Si2O7)(SiO4)O(OH) M
MANGANIANDROSITE-(Ce) (Mn++,Ca)(Ce,La)Mn++(Mn+++,Fe+++)Al(SiO4)(Si2O7)O(OH) M
ALLANITE-(La) Ca(La,REE,Ca)Al2(Fe2+,Fe3+)(SiO4)(Si2O7)O(OH) M
ZOISITE Ca2Al3[Si2O7][SiO4]O(OH) O
SURSASSITE Mn++2Al3(SiO4)(Si2O7)(OH)3 M
MACFALLITE Ca2Mn+++3(SiO4)(Si2O7)(OH)3 M
JULGOLDITE-(Mg) Ca2(Mg,Fe++)(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
JULGOLDITE-(Fe+++) Ca2Fe+++(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
OKHOTSKITE Ca2Mn++Mn+++2(Si2O7)(SiO4)(OH)2.H2O M
POPPIITE Ca2(V+++,Fe+++,Mg)(V+++,Al)2(SiO4)(Si2O7)(O,OH)3 M
PUMPELLYITE-(Al) Ca2(Al,Fe++,Mg)Al2(SiO4)(Si2O7)(O,OH)2.H2O M
PUMPELLYITE-(Fe++) Ca2Fe++Al2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Fe+++) Ca2(Fe+++,Mg,Fe++)(Al,Fe+++)2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Mg) Ca2MgAl2(SiO4)(Si2O7)(OH)2.H2O M
PUMPELLYITE-(Mn++) Ca2(Mn++,Mg)(Al,Mn+++,Fe)2(SiO4)(Si2O7)(OH)2.H2O M
SHUISKITE-(Mg) Ca2(Mg,Al)(Cr,Al)2(SiO4)(Si2O7)(OH)2.H2O M
JULGOLDITE-(Fe++) Ca2Fe++(Fe+++,Al)2(SiO4)(Si2O7)(OH)2.H2O M
GANOMALITE Pb9Ca5Mn++Si9O33 H
WAYNEBURNHAMITE Pb9Ca6(Si2O7)3(SiO4) H
RUSTUMITE Ca10(Si2O7)2(SiO4)Cl2(OH)2 M
MAGNESIOVESUVIANITE Ca19Mg(Al10Mg2)(Si2O7)4(SiO4)10(OH)10 Q
ALUMOVESUVIANITE Ca19Al(Al10Mg2)Si18O69(OH)9 Q
MILANRIEDERITE (Ca18[REE])Fe+++Al4(Mg4Al4)([]4)[][Si2O7]4[(SiO4)10](OH)(OH)9 Q
WILUITE Ca19(Al,Mg,Fe,Ti)13(B,Al,[])5Si18O68(O,OH)10 Q
MANGANVESUVIANITE Ca19Mn+++(Al,Mn+++,Fe+++)10(Mg,Mn++)2Si18O69(OH)9 Q
VESUVIANITE Ca10Mg2Al4(SiO4)5(Si2O7)2(OH)4 Q
FLUORVESUVIANITE Ca19(Al,Mg,Fe++)13(SiO4)10(Si2O7)4(F,OH,O)10 Q
CYPRINE Ca19Cu++(Al10Mg2)Si18O68(OH)10 Q
HONGHEITE Ca19Fe++Al4(Fe+++,Mg)8([]4)B[Si2O7]4[(SiO4)10]O(OH,O)9 Q
FLUORVESUVIANITE Ca19Fe+++Al4(Al6Mg2)([]4)[][Si2O7]4[(SiO4)10]O(F,OH)9 Q
VYUNTSPAKHKITE-(Y) Y4Al2AlSi5O18(OH)5 M
DELLAITE Ca6Si3O11(OH)2 M (?)
PERBOEITE-(La) (CaLa3)(Al3Fe++)[Si2O7][SiO4]3O(OH)2 M
PERBOEITE-(Ce) Ca(Ce,Nd,La)3Al3Fe++Si2O7[SiO4]3O(OH)2 M
FERRIPERBOEITE-(La) (CaLa3)(Fe+++Al2Fe++)[Si2O7][SiO4]3O(OH)2 M
FERRIPERBOEITE-(Ce) (CaCe3)(Fe+++Al2Fe++)(Si2O7)(SiO4)3O(OH)2 M
GATELITE-(Ce) Ca(Ce,Nd,La,Pr)3(Mg,Fe++,Al)(Al,Mg)3(SiO4)3(Si2O7)(O,F)(OH,O)2 M
VASTMANLANDITE-(Ce) (Ce,La)3CaAl2Mg2[Si2O7][SiO4]3F(OH)2 M
RADEKSKODAITE-(La) (CaLa5)(Al4Fe++)[Si2O7][SiO4]5O(OH)3 M
RADEKSKODAITE-(Ce) (CaCe5)(Al4Fe++)[Si2O7][SiO4]5O(OH)3 M
ALNAPERBOEITE-(Ce) Na0,5Ca(Ce,Nd,La)2,5Al4Si2O7[SiO4]3O(OH)2 M
SHUISKITE-(Cr) Ca2CrCr2[SiO4][Si2O6(OH)](OH)2O M
MANAEVITE-(Ce) Ca11(Ce,H2O,Ca)8Mg(Al,Fe)4(Mg,Ti,Fe+++)8[Si2O7]4[(SiO4)8(H4O4)2](OH)9 Q
ZOISITE-(Pb) CaPbAl3[Si2O7][SiO4]O(OH) O
Sorosilicates with Si3O10, Si4O11, etc. anions; cations in tetrahedral [4] and greater coordination
AMINOFFITE Ca2(Be,Al)Si2O7(OH).H2O Q
KINOITE Ca2Cu2Si3O8(OH)4 M
AKATOREITE (Mn++,Fe++)9Al2Si8O24(OH)8 A
FENCOOPERITE Ba6Fe+++3Si8O23(CO3)2Cl3.H2O R
BUNNOITE Mn++6AlSi6O18(OH)3 A
Sorosilicates with Si3O10, Si4O11, etc. anions; cations in octahedral [6] and greater coordination
ORIENTITE Ca2Mn++Mn+++2Si3O10(OH)4 O
ROSENHAHNITE Ca3Si3O8(OH)2 or HCa3[Si3O9(OH)] A
TRABZONITE Ca4[Si3O9(OH)]OH M
THALENITE-(Y) Y3Si3O10(OH) M
TIRAGALLOITE Mn++4As+++++Si3O12(OH) M
ARSENMEDAITE Mn++As+++++Si5O18(OH) M
MEDAITE (Mn,Ca)6(V+++++,As)Si5O18(OH) M
TANIAJACOITE SrCaMn+++2Si4O11(OH)4.2H2O A
RUIZITE CaMn+++Si2O6(OH).2H2O M
STRONTIORUIZITE Sr2Mn+++2Si4O11(OH)4.2H2O M
ALPEITE Ca4Mn+++2Al2(Mn+++Mg)(SiO4)2(Si3O10)(VO4)(OH)6 O
KANNANITE Ca4Al4(MgAl)(VO4)(SiO4)2(Si3O10)(OH)6 Ca4Al4(MgAl)(VO4)(SiO4)2(Si3O10)(OH)6 O
ARDENNITE-(V) Mn4[Al4(AlMg)][Si5V]O22(OH)6 O
ARDENNITE-(As) Mn4[Al4(AlMg)][Si5As]O22(OH)6 O
KILCHOANITE Ca6(SiO4)(Si3O10) O
KORNERUPINE Mg4(Al,Fe+++)6(Si,B)4O21(OH) O
PRISMATINE (Mg,Al,Fe++)5-6Al4((Si,Al)O4)4(BO3)(O,OH,F)3 O
ZUNYITE Al13Si5O20(OH,F)18Cl C
HUBEITE Ca2Mn++Fe+++Si4O12(OH).2H2O A
CASSAGNAITE (Ca,Mn++)4(Fe+++,Mn+++,Al)4(V+++,Mg,Al)2(SiO4)2(Si3O10)(OH,O)8 O
PAVLOVSKYITE Ca3(SiO4)2(Si3O10) O
ARDENNITE-(Si) Mn++4Al4(AlMg)(SiO4,AsO4)(SiO4)2(Si3O10)(OH)6 (?) O
Unclassified sorosilicates
KHURAYYIMITE Ca7Zn4(Si2O7)2(OH)10.4H2O M
Cyclosilicates
[Si3O9]6- 3-membered single rings (dreier-Einfachringe), without insular complex anions
BAZIRITE BaZrSi3O9 H
BENITOITE BaTiSi3O9 H
PABSTITE Ba(Sn,Ti)Si3O9 H
WADEITE (K,Na)2ZrSi3O9 H
CALCIOCATAPLEIITE CaZrSi3O9.2H2O H
CATAPLEIITE Na2ZrSi3O9.2H2O H
PSEUDOWOLLASTONITE CaSiO3 M
MARGAROSANITE Pb(Ca,Mn++)2Si3O9 A
WALSTROMITE BaCa2Si3O9 A
BREYITE Ca3Si3O9 A
BOBTRAILLITE (Na,Ca)13Sr11(Zr,Y,Nb)14Si42B6O132(OH)12.12H2O R
ROGERMITCHELLITE Na6Sr12Ba2Zr13Si39B6O123(OH)14.10H2O R ps H
[Si3O9]6- 3-membered single rings, with insular complex anions
ROEBLINGITE Pb2Ca6Mn++(Si6O18)2(SO4)2(OH)2.4H2O M
DIVERSILITE-(Ce) Na2(Ba,K)6CeFe++2Ti3[Si3O9]3[SiO3OH]3.9(OH,H2O) R
ILIMAUSSITE-(Ce) (Na,K)7-8(Ba,K)10Ce5(Nb,Ti)6(Si12O36)(Si9O18)(O,OH)24O6 R ps H
[Si3O9]6- - branched 3-membered single rings
[Si3O9]6- 3-membered double rings
MOSKVINITE-(Y) Na2K(Y,Dy)Si6O15 O
[Si4O12]8- 4-membered single rings (vierer-Einfachringe), without insular complex anions
PAPAGOITE CaCu++AlSi2O6(OH)3 M
VERPLANCKITE Ba2(Mn,Fe++,Ti)Si2O6(O,OH,Cl,F)2.3H2O H
BAOTITE Ba4(Ti,Nb)8Si4O28Cl Q
NAGASHIMALITE Ba4(V+++,Ti)4Si8B2O27Cl(O,OH)2 O
TARAMELLITE Ba4(Fe+++,Ti,Fe++,Mg)4(B2Si8O27)O2Clx O
TITANTARAMELLITE Ba4(Ti,Fe+++,Fe++,Mg)4(B2Si8O27)O2Clx O
JOAQUINITE-(Ce) Ba2NaCe2Fe++(Ti,Nb)2Si8O26(OH,F).H2O M
STRONTIOORTHOJOAQUINITE Sr2Ba2(Na,Fe++)2Ti2Si8O24(O,OH)2.H2O O
STRONTIOJOAQUINITE Sr2Ba2(Na,Fe++)2Ti2Si8O24(O,OH)2.H2O M
ORTHOJOAQUINITE-(Ce) Ba2NaCe2Fe++Ti2Si8O26(O,OH).H2O O
BYELORUSSITE-(Ce) NaMn++Ba2(Ce,La)2Ti2Si8O26(F,OH).H2O O
BARIOORTHOJOAQUINITE (Ba,Sr)4Fe++2Ti2Si8O26.H2O O
ORTHOJOAQUINITE-(La) Ba2Na(La,Ce)2Fe++(Ti,Nb)2Si8O26(O,OH,F).H2O O
KOROBITSYNITE Na8-xTi4(Si4O12)2(O,OH)4.8H2O O
NENADKEVICHITE Na8-xNb4(Si4O12)2(O,OH)4.8H2O O
TSEPINITE-K (K,Ba,Na)4(Ti,Nb)4(Si4O12)2(OH,O)4.6H2O M
TSEPINITE-Na Na(Na,H3O,K,Sr,Ba)12-xTi8(Si4O12)4(OH,O)8.nH2O (x=0-6, n=12-16) M
VUORIYARVITE-K (K,Na)12-xNb8(Si4O12)4(O)8.nH2O (x=0-6, n=12-16) M
TSEPINITE-Sr (Sr,Ba,K)2-x(Ti,Nb)4(Si4O12)(OH,O)2.5-6H2O M
PARATSEPINITE-Na Na(NaSrKCa)7(TiNb)8(Si4O12)4(O,OH)8.H2O M
PARATSEPINITE-Ba (Ba,Na,K)2-x(Ti,Nb)2(Si4O12)(OH,O)2.4H2O M
TSEPINITE-Ca (Ca,K,Na)4(Ti,Nb)4(Si4O12)2(OH,O)4.8H2O M
GJERDINGENITE-Fe K2(Fe++,Mn++)(Nb,Ti)4(Si4O12)2(O,OH)4.7-8H2O M ps O
LEPKHENELMITE-Zn (Ba,K)2Zn(Ti,Nb)4Si8O24(O,OH)4.7H2O M
KUZMENKOITE-Zn K2Zn(Ti,Nb)4(Si4O12)2(OH,O)4.6-8H2O M
KUZMENKOITE-Mn K4Mn2Ti8(Si4O12)4(OH)8.nH2O (n=10-12) M
KARUPMOLLERITE-Ca (Na,Ca,K)2Ca2(Nb,Ti)4(Si4O12)2(O,OH)4.7H2O M
GJERDINGENITE-Mn (K,Na)2(Mn++,Fe++)(Nb,Ti)4(Si4O12)2(O,OH)4.6H2O M ps O
GJERDINGENITE-Ca (K,Na,Sr)2Ca(Nb,Ti)4(Si4O12)2(O,OH)2.6H2O M
BUROVAITE-Ca (K,Na)4Ca2(Ti,Nb)8[Si4O12]4(OH,O)8.12H2O M
GJERDINGENITE-Na (K,Na,Sr)2Na(Nb,Ti)4(Si4O12)2(O,OH)2.5H2O M
LEMMLEINITE-Ba Na4K4Ba2+xTi8(Si4O12)4(O,OH)8.8H2O M
LEMMLEINITE-K Na4K4K4Ti8(Si4O12)4(O,OH)8.8H2O M ps O
LABUNTSOVITE-Mg Na4K4Mg2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
LABUNTSOVITE-Mn Na4K4Mn2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
LABUNTSOVITE-Fe Na4K4Fe2Ti8(Si4O12)4(O,OH)8.nH2O (n =10-12) M
PARALABUNTSOVITE-Mg Na8K8Mg4Ti16(Si4O12)8(O,OH)8.nH2O (n=20-24) M
ORGANOVAITE-Mn K8Mn4Nb16(Si4O12)8O16.nH2O (n=20-28) M
ORGANOVAITE-Zn K8Zn4Nb16(Si4O12)8O16.nH2O (n=20-28) M
PARAKUZMENKOITE-Fe (K,Ba)8Fe4Ti16(Si4O12)8(OH,O)16.nH2O (n=20-28) M
NESKEVAARAITE-Fe K3Na2Fe++(Ti,Nb)4(Si4O12)2(O,OH)4.5-6H2O M
ALSAKHAROVITE-Zn (Na,Ca)Sr(K,Ba)Zn(Ti,Nb)4(Si4O12)2(O,OH)4.7H2O M
GUTKOVAITE-Mn CaK2Mn(Ti,Nb)4(Si4O12)2(O,OH)4.5H2O M
KOMAROVITE (Ca,Sr,Na)2(Nb,Ti)6(Si4O12)(O,OH)14(F,OH)2.6-7H2O O
NATROKOMAROVITE Na6Ca(Nb,Ti)6(Si4O12)(O,OH)14(F,OH)2.3-4H2O O
DUTKEVICHITE-(Ce) NaZnBa2Ce2Ti2Si8O26F.H2O O
[Si4O12]8- 4-membered single rings, with insular complex anions
ASHBURTONITE Pb4Cu++4Si4HO12(HCO3)4(OH)4Cl Q
KAINOSITE-(Y) Ca2(Y,Ce)2Si4O12(CO3).H2O O
CLINOPHOSINAITE Na12(Ca,Sr)4(PO4)4(Si4O12) M
PHOSINAITE-(Ce) Na13Ca2(Ce,La,Th,Nd,Pr)(Si4O12)(PO4)4 O
STRAKHOVITE NaBa3(Mn++,Mn+++)4Si6O19(OH)3 M
CERCHIARAITE-(Al) Ba4(Al,Fe+++)4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl Q
CERCHIARAITE-(Fe) Ba4(Fe+++,Al)4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl Q
CERCHIARAITE-(Mn) Ba4(Mn+++,Fe+++,Al)4(Si6O18)(OH)7Cl Q
BOBMEYERITE Pb4(Al3Cu)(Si4O12)(S0,5Si0,5O4)(OH)7Cl(H2O)3 O
[Si4O12]8- branched 4-membered single rings
EAKERITE Ca2SnAl2Si6O18(OH)2.2H2O M
[Si4O12]8- 4-membered double rings
KAPITSAITE-(Y) (Ba,K,Pb++)4(Y,Ca,Na)2Si8(B,Si)4O28F A ps Q
HYALOTEKITE (Ba,Pb,Ca,K)6(B,Si,Al)2(Si,Be)10O28(F,Cl) A ps M
KHVOROVITE (Pb,Ba,K)4Ca2[Si8B2(Si,B)2O28]F A
ITSIITE Ba2Ca(BSi2O7)2 Q
TURKESTANITE Th(Ca,Na)2(K1-x[]x)Si8O20.nH2O Q
STEACYITE Th(Ca,Na)2K1-xSi8O20 Q
ARAPOVITE (U,Th)(Ca,Na)2(K1-x[]x)Si8O20.H2O (x=0,5) Q
IRAQITE-(La) K(La,Ce,Th)2(Ca,Na)4(Si,Al)16O40 Q
[Si6O18]12- 6-membered single rings (sechser-Einfachringe), without insular complex anions
INDIALITE Mg2Al4Si5O18 H
JOHNKOIVULAITE Cs[Be2B]Mg2Si6O18 H
STOPPANIITE (Fe,Al,Mg)4(Be6Si12O36)(H2O)2(Na,[]) H
BERYL Be3Al2Si6O18 H
FERROINDIALITE Mg2Al4Si5O18 H
BAZZITE Be3(Sc,Al)2Si6O18 H
VOROBYEVITE = a Beryl Be3Al2(Si6O18)  
CORDIERITE Mg2Al4Si5O18 O
SEKANINAITE (Fe++,Mg)2Al4Si5O18 O
COMBEITE Na2Ca2Si3O9 R
KAPUSTINITE Na5(Na,Mn++)Zr(Si6O16)(OH)2 M
KAZAKOVITE Na6Mn++TiSi6O18 R
LITVINSKITE Na3ZrSi6O13(OH)5 M
LOVOZERITE Na2CaZrSi6O18(OH,O)6.H2O R (?)
TISINALITE Na3H3(Mn++,Ca,Fe)TiSi6(O,OH)18.2H2O R
ZIRSINALITE Na6(Ca,Mn,Fe++)ZrSi6O18 R
TOWNENDITE Na8ZrSi6O18 R ps H
IMANDRITE Na12Ca3Fe+++2Si12O36 O
KOASHVITE Na6(Ca,Mn)(Ti,Fe)Si6O18.H2O O
BARATOVITE KCa7(Ti,Zr)2Li3Si12O36F2 M ps H
KATAYAMALITE KLi3Ca7Ti2(SiO3)12(OH)2 M
ALEKSANDROVITE KCa7Sn2Li3Si12O36F2 M
DIOPTASE CuSiO2(OH)2 R
KOSTYLEVITE K2ZrSi3O9.H2O M
PETARASITE Na5Zr2Si6O18(Cl,OH).2H2O M
GERENITE-(Y) (Ca,Na)2(Y,REE)3(Si6O18).2H2O A
ODINTSOVITE K2(Na,Li)4Ca3Ti2Be4Si12O38 O
MATHEWROGERSITE Pb7(Fe,Cu)Al3GeSi12O36.(OH,H2O)6 R
PEZZOTTAITE CsLiBe2Al2Si6O18 R
NAKKAALAAQiTE K2[Na3Ca]LiCa2Ti2Be4Si12O38 O
AVDEEVITE (Na,Cs)(Be2Li)Al2(Si6O18) H
ZOLOTAREVITE Na5Zr[Si6O15(??)3].3H2O R
[Si6O18]12- 6-membered single rings, with insular complex anions
ROSSMANITE [](LiAl2)Al6(Si6O18)(BO3)3(OH)3OH R
OXYDRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3FNa(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O R
OXYROSSMANITE [](LiAl2)Al6(Si6O18)(BO3)3(OH)3O R
OXYSCHORL Na(Fe++Al)3Al6(Si6O18)(BO3)3(OH)3O R
OXYVANADIUMDRAVITE NaMg2V7(Si6O18)(BO3)3(OH)3O R
OXYFOITITE [](Fe++Al2)Al6(Si6O18)(BO3)3(OH)3O R
OXYCHROMIUMDRAVITE NaMg2Cr7(Si6O18)(BO3)3(OH)3O R
SCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3OH R
TSILAISITE NaMn++3Al6(Si6O18)(BO3)3(OH)3(OH) R ps H
VANADIOOXYCHROMIUMDRAVITE NaMg2V3Cr4(Si6O18)(BO3)3(OH)3O R
VANADIOOXYDRAVITE NaMg2V3Al4(Si6O18)(BO3)3(OH)3O R
LUCCHESIITE CaFe++3Al6(Si6O18)(BO3)3(OH)3O R
MARUYAMAITE K(MgAl2)(Al5Mg)(BO3)3(Si6O18)(OH)3O R ps H
OLENITE NaAl3Al6(Si6O18)(BO3)3(O3)OH R
OXYUVITE CaMg3Al6(Si6O18)(BO3)3(OH)3O R
MAGNESIOLUCCHESIITE CaMg3Al6(Si6O18)(BO3)3(OH)3O R
FLUORBUERGERITE NaFe+++3Al6(Si6O18)(BO3)3O3F R
CHROMOALUMINOPOVONDRAITE NaCr3(Al4Mg2)(Si6O18)(BO3)3(OH)3O R
CHROMIUMDRAVITE NaMg3Cr6(Si6O18)(BO3)3(OH)3OH R
MAGNESIOFOITITE [](Mg2Al)Al6(Si6O18)(BO3)3(OH)3OH R ps H
DRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3OH R
FERUVITE CaFe++3(Al5Mg)(Si6O18)(BO3)3(OH)3OH R
FLUORDRAVITE NaMg3Al6(Si6O18)(BO3)3(OH)3F R
FLUORELBAITE Na(Li1,5Al1,5)Al6(Si6O18)(BO3)3(OH)3F R
FLUORFERUVITE Ca(Fe++)3MgAl5(Si6O18)(BO3)3(OH)3F R
POVONDRAITE NaFe+++3(Fe+++4Mg2)(Si6O18)(BO3)3(OH)3O R
FLUORLIDDICOATITE Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F R
FLUORTSILAISITE NaMn3Al6(Si6O18)(BO3)3(OH)3F R
FLUORUVITE CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F R
FOITITE [](Fe++2Al)Al6(Si6O18)(BO3)3(OH)3OH R
LUINAITE-(OH) = a SCHORL polymoph (Na,[](Fe++,Mg)3Al6(BO3)3Si6O18(OH)4 R
ELBAITE Na(Li1,5Al1,5)Al6(Si6O18)(BO3)3(OH)3OH R
LIDDICOATITE Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) R
ABENAKIITE-(Ce) Na26(Ce,Nd,La,Pr,Th,Sm)6(SiO3)6(PO4)6(CO3)6(S++++O2)O R
SCAWTITE Ca7Si6O18(CO3).2H2O M
STEENSTRUPINE-(Ce) Na14Mn++2(Fe+++,Mn+++)2Ce6(Zr,Th)(Si6O18)2(PO4)6(HPO4)(OH)2.2H2O R
THOROSTEENSTRUPINE CaMnThSi4O11(OH)F.6H2O am. (?)
CELLERIITE [](?Mn++2Al)Al6(Si6O18)(BO3)3(OH)3(OH) R
UVITE CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3OH R
PRINCIVALLEITE Na(Mn2Al)Al6(Si6O18)(BO3)3(OH)3O R
DARRELLHENRYITE Na(LiAl2)Al6(Si6O18)(BO3)3(OH)3OH R
BOSIITE NaFe+++3(Al4Mg2)(Si6O18)(BO3)3(OH)3O R
ALUMINOOXYROSSMANITE Al3Al6(Si5AlO18)(BO3)3(OH)3O R
ADACHIITE CaFe++3Al6(Si5AlO18)(BO3)3(OH)3(OH) R
FLUORSCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3F R
DUTROWITE Na(Fe++2,5Ti0,5)Al6(Si6O18)(BO3)3(OH)3O R
[Si6O18]12- branched 6-membered single rings
TIENSHANITE KNa3(Na,K,[])6(Ca,Y,REE)2Ba6(Mn++,Fe++,Zn,Ti)6(Ti,Nb)6Si36B12O114[O5,5(OH,F)3,5]F2 H
[Si6O18]12- branched 6-membered double rings
FRIEDRICHBECKEITE K([]0,5Na0,5)2(Mg0,8Mn0,1Fe0,1)2(Be0,6Mg0,4)3[Si12O30] H
OSUMILITE-(Mg) KMg2Al3(Al2Si10)O30 H
POUDRETTEITE KNa2B3Si12O30 H
ROEDDERITE (Na,K)2(Mg,Fe++)5Si12O30 H
SHIBKOVITE K(Ca,Mn,Na)2(K2-x[]x)2Zn3Si12O30 H
LAURENTTHOMASITE Mg2K(Be2Al)Si12O30 H
SOGDIANITE (Zr,Ti++++,Fe+++,Al)2([],Na)2K[Li3Si12O30] H
SUGILITE KNa2(Fe++,Mn++,Al)2Li3Si12O30 H
YAGIITE (Na,K)1,5Mg2(Al,Mg)3(Si,Al)12O30 H
OSUMILITE (K,Na)(Fe++,Mg)2(Al,Fe+++)3(Si,Al)12O30 H
KLOCHITE ([]1Na1)KFe2Zn3(Si12O30) H
BRANNOCKITE (K,Na)Li3Sn2Si12O30 H
TRATTNERITE (Mg,Fe++)3Fe+++2(Si12O30) H
MILARITE KCa2AlBe2Si12O30.0,5H2O H
MERRIHUEITE (K,Na)2(Fe++,Mg)5Si12O30 H
EIFELITE KNa3Mg4Si12O30 H
DUSMATOVITE K(K,Na,[])(Mn++,Y,Zr)2(Zn,Li)3Si12O30 H
CHAYESITE K(Mg,Fe++)4Fe+++Si12O30 H
BEREZANSKITE Ti2[]KLi3(Si12O30) H
ARMENITE BaCa2Al6Si9O30.2H2O O
ALMARUDITE (K,Na)(Mn++,Fe++,Mg)2(Be,Al)3(Si12O30) H
DARAPIOSITE NaxK(Li,Zn,Fe++)2(Mn,Zr,Y)2(Si12O30) (x = less than 2) H
OFTEDALITE (Sc,Ca,Mn++)2K(Be,Al)3Si12O30 H
FAIZIEVITE K2Li6Na(Ca6Na)Ti4[Si6O18]2[Si12O30]F2 A
ALUMINOSUGILITE KNa2Al2Li3Si12O30 H
AGAKHANOVITE-(Y) (YCa)[]2KBe3Si12O30 H
[Si8O24]16- 8-membered rings
MUIRITE Ba10Ca2MnTiSi10O30(OH,Cl,F)10 Q
[Si9O27]18- 9-membered rings
VORONKOVITE Na15(Na,Ca,Ce)3(Mn,Ca)3Fe3Zr3Si26O72(OH,O)4Cl.H2O R
MANGANOEUDIALYTE Na14Ca6Mn3Zr3[Si26O72(OH)2](H2O,Cl,O,OH)6 R
MANGANOKHOMYAKOVITE Na12Sr3Ca6Mn++3Zr3W(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
MOGOVIDITE Na9(Ca,Na)5Ca6Zr3Fe2(Si,Nb)[(OH,H2O)3|Cl0,3|CO3|(Si3O9)2(Si9O27)2] R
ONEILLITE Na15Ca3Mn3Fe3Zr3Nb(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
RASLAKITE Na15Ca3Fe3(Na,Zr)3Zr3Nb0,5(Si3O9)2(Si9O27)2(SiO)(Cl,OH).3(OH,H2O) R
TASEQITE Na12Sr3Ca6Fe3Zr3NbSi25O73(O,OH,H2O)3Cl2 R
AQUALITE (H3O)8(Na,K,Sr)5Ca6Zr3Si26O66(OH)9Cl R
ZIRSILITE-(Ce) Na11-12Ca6(Ce,Na)3Mn3Zr3Nb(CO3)2(Si3O9)4(Si9O27)2(SiO)(OH)6.H2O R
FENGCHENGITE Na12[]3(Ca,Sr)6Fe+++3Zr3Si(Si25O73)(H2O,OH)3(OH,Cl)2 R
ILYUKHINITE (H3O,Na)14Ca6Mn2Zr3Si26O72(OH)2.3H2O R
SERGEVANITE Na15(Ca3Mn3)(Na2Fe)Zr3Si26O72(OH)3.H2O R
SIUDAITE Na8(Mn++2Na)Ca6(Fe+++,Mn++)3Zr3NbSi24(Si,[],Ti)O74(OH)2Cl.5H2O R
LABYRINTHITE (Na,K,Sr)35Ca12Fe3Zr6TiSi51O144(O,OH,H2O)9Cl3 R
RASTSVETAEVITE Na27K8Ca12Fe3Zr6Si4[Si3O9]4[Si9O27]4(O,OH,H2O)6Cl2 R
FERROKENTBROOKSITE Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3(Cl,F,OH)2 R
ANDRIANOVITE Na12(K,Sr,Ce)3Ca6Mn3Zr3Nb(Si25O73)(O,H2O,OH)5 R
DUALITE Na30(Ca,Na,Ce,Sr)12(Na,Mn,Fe,Ti)6Zr3Ti3MnSi51O144(OH,H2O,Cl)9 R
CARBOKENTBROOKSITE (Na,[])12(Na,Ce)3Ca6Mn3Zr3Nb(Si25O73)(OH)3(CO3).H2O R
KHOMYAKOVITE Na12Sr3Ca6Fe++3Zr3W(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
FEKLICHEVITE Na11Ca9(Fe+++,Fe++)2Zr3Nb[Si25O73](OH,H2O,Cl,O)5 R
ALLUAIVITE Na19(Ca,Mn++)6(Ti,Nb)3(Si3O9)2(Si10O28)2Cl.2H2O R
GEORGBARSANOVITE Na12(Mn,Sr,REE)3Ca6Fe++3Zr3NbSi25O76Cl2.H2O R
GOLYSHEVITE [Na10Ca3]Ca6Zr3Fe2SiNb[(OH)3|CO3|(Si3O9)2|(Si9O27)2].H2O R
HYDRORASTSVETAEVITE (Na11(H3O)11K6(H2O)1,5Sr)Ca12Fe3Na2MnZr6Si52O144(OH)4,5Cl3,5 R
IKRANITE (Na,H3O)15(Ca,Mn,REE)6Fe+++2Zr3([],Zr)([],Si)Si24O66(O,OH)6Cl.nH2O R
JOHNSENITE-(Ce) Na12(Ce,La,Sr,Ca,M)3Ca6Mn3Zr3W(Si25O73)(CO3)(OH,Cl)2 R
KENTBROOKSITE (Na,REE)15(Ca,REE)6(Mn++,Fe++)3Zr3Nb(Si25O73)(O,OH,H2O)3(F,Cl)2 R
EUDIALYTE Na15Ca6(Fe++,Mn)3Zr3(Si25O73)(O,OH,H2O)3(OH,Cl)2 R
DAVINCIITE Na12K3Ca6Fe++3Zr3(Si26O73OH)Cl2 R
SELSURTITE (H3O)12Na3(Ca3Mn3)(Na2Fe)Zr3[]{Si(Si3O9)2(Si9O27)Si9O24(OH)3}(OH)Cl(H2O) R
ODIKHINCHAITE Na9Sr3[(H2O)2Na]Ca6Mn3Zr3NbSi(Si24O72)O(OH)3(CO3).H2O R
12-membered and larger rings
TRASKITE Ba9Fe++2Ti2(SiO3)12(OH,Cl,F)6.6H2O H
MEGACYCLITE K2Na16Si18O36(OH)18.32H2O M
LAURENTIANITE [NbO(H2O)]3(Si2O7)2[Na(H2O)2]3 R
Inosilicates
Inosilicates with 2-periodic single chains, Si2O6; pyroxene family
PROTOENSTATITE Mg2Si2O6 O
ENSTATITE Mg2Si2O6 O
FERROSILITE (Fe++,Mg)2Si2O6 O
DONPEACORITE (Mn++,Mg)MgSi2O6 O
PIGEONITE (Mg,Fe++,Ca)(Mg,Fe++)Si2O6 M
CLINOFERROSILITE (Fe++,Mg)2Si2O6 M
KANOITE (Mn++,Mg)2Si2O6 M
CLINOENSTATITE Mg2Si2O6 M
GROSSMANITE CaTi+++(AlSiO6) M
PETEDUNNITE Ca(Zn,Mn++,Fe++,Mg)Si2O6 M
KUSHIROITE CaAl(AlSiO6) M
JOHANNSENITE CaMnSi2O6 M
HEDENBERGITE CaFe++Si2O6 M
DIOPSIDE CaMgSi2O6 M
DAVISITE Ca(Sc,Ti,Mg)(AlSiO6) M
AUGITE (Ca,Na)(Mg,Fe,Al,Ti)(Si,Al)2O6 M
ESSENEITE CaFe+++AlSiO6 M
JEFFERSONITE = Mn Zn AEGIRINE or AUGITE    
OMPHACITE (Ca,Na)(Mg,Fe++,Fe+++,Al)Si2O6 M
AEGIRINEAUGITE (Ca,Na)(Fe3+,Mg,Fe2+)Si2O6 M
TISSINTITE (Ca,Na,[])AlSi2O6 M
AEGIRINE NaFe+++Si2O6 M
JADEITE Na(Al,Fe+++)Si2O6 M
JERVISITE (Na,Ca,Fe++)(Sc,Mg,Fe++)Si2O6 M
KOSMOCHLOR NaCr+++Si2O6 M
NAMANSILITE NaMn+++(Si2O6) M
NATALYITE Na(V+++,Cr+++)Si2O6 M
SPODUMENE LiAlSi2O6 M
HIROSEITE FeSiO3 O
RYABCHIKOVITE CuMgSi2O6 M
COLOMERAITE NaTi+++Si2O6 M
Inosilicates with 2-periodic single chains, Si2O6; Pyroxene-related minerals
BALIPHOLITE BaMg2LiAl3Si4O12(OH,F)8 O
CARPHOLITE MnAl2Si2O6(OH)4 O
FERROCARPHOLITE (Fe++,Mg)Al2Si2O6(OH)4 O
MAGNESIOCARPHOLITE MgAl2Si2O6(OH)4 O
POTASSICCARPHOLITE K0,5-1(Li,Mn++)2Al4(Si2O6)2(OH;F)8 O
VANADIOCARPHOLITE Mn++V+++Al(Si2O6)(OH)4 O
LORENZENITE Na2Ti2Si2O9 O
LINTISITE Na3LiTi2Si4O14.2H2O M
PUNKARUAIVITE LiTi2[Si4O11(OH)](OH)2.H2O M
ELISEEVITE Na1,5Li[Ti2Si4O12,5(OH)1,5].2H2O M
KUKISVUMITE Na6ZnTi4Si8O28.4H2O O
MANGANOKUKISVUMITE Na6Mn++Ti4Si8O28.4H2O O
PARAVINOGRADOVITE Na2Ti3Fe+++(Si2O6)2(Si3AlO10)(OH)4.H2O A
VINOGRADOVITE Na8Ti8O8(Si2O6)4[(Si3Al)O10]2[(H2O),(Na,K)2] M
NCHWANINGITE Mn++SiO3OH2.H2O O
PLANCHEITE Cu8Si8O22(OH)4.H2O O
SHATTUCKITE Cu5(SiO3)4(OH)2 O
AERINITE (Ca5,1Na0,5)(Fe+++AlFe++1,7Mg0,3)(Al5,1Mg0,7)[Si12O36(OH)12H].[(CO3)1,2(H2O)12] H
CAPRANICAITE (K,[])(Ca,Na)Al4B4Si2O18 M
Inosilicates with branched 2-periodic single chains; Si2O6 + 2SiO3 Si4O12
LOBANOVITE K2Na2(Fe++,Fe+++,Mn)4Mg2Ti2Si8O26(OH)4 M
NIOBOPHYLLITE K2Na(Mn,Fe++)7(Nb,Ti)2Si8O26(OH)4(F,O) A
TARBAGATAITE (K,[])2(Ca,Na)(Fe++,Mn)7Ti2(Si4O12)2O2(OH)4(OH,F) A
LAVEROVITE K2NaMn7Zr2(Si4O12)2O2(OH)4F A
DEVITOITE [Ba6(PO4)2(CO3)][Fe++7(OH)4Fe+++2O2(SiO3)8] A
ZIRCOPHYLLITE K2(Na,Ca)(Fe++,Mn)7(Zr,Nb)2Si8O26(OH)4F A
SVEINBERGITE Ca(Fe++6Fe+++)Ti2(Si4O12)2O2(OH)5(H2O)4 A
NIOBOKUPLETSKITE K2Na(Mn++,Zn,Fe++)7(Nb,Zr,Ti)2Si8O26(OH)4(O,F) A
KUPLETSKITE-(Cs) (Cs,K)2Na(Mn,Fe,Li)7(Ti,Nb)2Si8O26(OH)4F A
KUPLETSKITE K2Na(Mn,Fe++)7(Ti,Nb)2Si8O26(OH)4F A
HYDROASTROPHYLLITE (H3O,K)2Ca(Fe++,Mn)5-6Ti2Si8O26(OH)4F A
ASTROPHYLLITE K2Na(Fe++,Mn)7Ti2Si8O26(OH)4F A
NALIVKINITE Li2Na(Fe++,Mn++)7Ti2Si8O26(OH)4F A
HEYERDAHLITE Na3Mn7Ti2(Si4O12)2O2(OH)4F(H2O)2 A
BULGAKITE Li2(Ca,Na)Fe++7Ti2(Si4O12)2O2(OH)4(F,O)(H2O)2 A
Inosilicates with 2-periodic double chains, Si4O11; Orthoamphiboles
FERROFERRIHOLMQUISTITE []{Li2}{Fe++3Fe+++2}(Si8O22)(OH)2 O
PROTOANTHOPHYLLITE (Mg,Fe++)2Mg5Si8O22(OH)2.H2O O
FERROPAPIKEITE NaFe++2(Fe++3Al2)(Si5Al3)O22(OH)2 O
SODICFERROANTHOPHYLLITE NaFe++7Si8O22(OH)2 O
SODICANTHOPHYLLITE NaMg7Si8O22(OH)2 O
PROTOFERROSUENOITE (Mn++,Fe++)2(Fe++,Mg)5(Si4O11)2(OH)2 O
SUENOITE []Mn2Mg5Si8O22(OH)2 O
PROTOFERROANTHOPHYLLITE (Fe++,Mn++)2(Fe++,Mg)5(Si4O11)2(OH)2 O
PAPIKEITE NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 O
GEDRITE [](Mg,Fe++)5Al2Si6Al2O22(OH)2 O
FERROHOLMQUISTITE []{Li2}{Fe++3Al2}(Si8O22)(OH)2 O
FERROGEDRITE [](Fe++,Mg)5Al2Si6Al2O22(OH)2 O
FERROHOLMQUISTITE [](Li2Fe++3Al2)Si8O22(OH)2 O
FERROANTHOPHYLLITE []Fe++7Si8O22(OH)2 O
FERRIHOLMQUISTITE []{Li2}{Mg3Fe+++2}(Si8O22)(OH)2 O
ANTHOPHYLLITE []Mg7Si8O22(OH)2 O
HOLMQUISTITE [](Li2Mg3Al2)Si8O22(OH)2 O
LAVINSKYITE-1M K(LiCu)Cu6(Si4O11)2(OH)4 M
Inosilicates with 2-periodic double chains, Si4O11; Clinoamphiboles
GRUNERITE []Fe++7Si8O22(OH)2 M
CUMMINGTONITE []Mg7Si8O22(OH)2 M
PERMANGANOGRUNERITE []Mn4Fe++3Si8O22(OH)2 M
FERRIFLUOROLEAKEITE NaNa2(Mg2Fe+++2Li)Si8O22F2 M
TSCHERMAKITE []Ca2(Mg3AlFe+++)Si6Al2O22(OH)2 M
FLUORHORNBLENDE ([]/Na,K)Ca2({Fe++/Mg}4{Fe+++/Mg})(AlSi7O22)F2 M
FERROTSCHERMAKITE []Ca2(Fe++3AlFe+++)Si6Al2O22(OH)2 M
FLUOROCANNILLOITE CaCa2(Mg4Al)Si5Al3O22F2 M
FERROHORNBLENDE []Ca2[Fe++4(Al,Fe+++)]Si7AlO22(OH)2 M
FLUOROTSCHERMAKITE []{Ca2}{Mg3Al2}(Al2Si6O22)F2 M
MAGNESIOFERRIFLUOROHORNBLENDE []Ca2(Mg4Fe+++)(Si7Al)O22F2 M
MAGNESIOFERRIHORNBLENDE []Ca2(Mg4Fe+++)[(Si7Al)O22](OH)2 Ca2(Mg4Fe+++)[(Si7Al)O22](OH)2 M
MAGNESIOFLUOROHORNBLENDE (Na,K)1-xCa2Mg5(Si7Al)O22F2 M
MAGNESIOHORNBLENDE []Ca2[Mg4(Al,Fe+++)]Si7AlO22(OH)2 M
TREMOLITE []Ca2Mg5Si8O22(OH)2 M
FLUOROTREMOLITE []Ca2Mg5Si8O22F2 M
MANGANOACTINOLITE []Ca2(Mg,Mn,Fe)5(Si8O22)(OH)2 M
CANNILLOITE CaCa2(Mg4Al)Si5Al3O22(OH)2 M
FERROFLUOROTSCHERMAKITE []{Ca2}{Fe++3Al2}(Al2Si6O22)F2 M
CLINOFERROSUENOITE []{Mn++2}{Fe++5}(Si8O22)(OH)2 M
ACTINOLITE []Ca2(Mg,Fe++)5Si8O22(OH)2 M
FERRIFLUOROTSCHERMAKITE []{Ca2}{Mg3Fe+++2}(Al2Si6O22)F2 M
FERRITSCHERMAKITE []Ca2(Mg3Fe+++2)Si6Al2O22(OH)2 M
FERROACTINOLITE []Ca2Fe++5Si8O22(OH)2 M
FERROFLUOROHORNBLENDE []Ca2(Fe++4Al)(AlSi7O22)F2 M
FERROFERRICANNILLOITE CaCa2(Fe++4Fe+++)(Si5Al3O22)OH2 M
FERROFERRIFLUOROHORNBLENDE []Ca2(Fe++4Fe+++)(AlSi7O22)F2 M
FERROFERRIFLUOROTSCHERMAKITE []{Ca2}{Fe++3Fe+++2}(Al2Si6O22)F2 M
FERROFERRIHORNBLENDE []Ca2(Fe++4Fe+++)(Si7Al)O22(OH)2 M
FERROFERRITSCHERMAKITE []{Ca2}{Fe++3Fe+++2}(Al2Si6O22)(OH)2 M
FERROCANNILLOITE CaCa2(Fe++4Al)(Si5Al3O22)OH2 M
JOESMITHITE PbCa2(Mg,Fe++,Fe+++)5Si6Be2O22(OH)2 M
FERROFLUOROACTINOLITE = an intermediate member []{Ca2}{Fe5}(Si8O22)F2 M
PARVOMANGANOTREMOLITE []{CaMn++}{Mg5}(Si8O22)(OH)2 M
POTASSICFERROFERRISADANAGAITE KCa2(Fe++3Fe+++2)(Si5Al3)O22(OH)2 M
POTASSICFERROCHLOROSADANAGAITE {K}{Ca2}{Fe++3Al2}(Al3Si5O22)Cl2 M
POTASSICFERROCHLOROEDENITE KCa2Fe++5(AlSi7O22)Cl2 M
POTASSICFERRISADANAGAITE (K,Na)Ca2[Fe++3)(Fe+++,Al)2]Si5Al3O22(OH,F)2 M
POTASSICCHLOROSADANAGAITE {K}{Ca2}{Mg3Al2}(Al3Si5O22)Cl2 M
POTASSICCHLOROPARGASITE (K,Na)Ca2(Fe++,Mg)4(Al,Fe+++)(Si6Al2O22(Cl,OH)2 M
MAGNESIOHASTINGSITE NaCa2(Mg4Fe+++)Si6Al2O22(OH)2 M
POTASSICFERROPARGASITE KCa2(Fe++4Al)Si6Al2O22(OH)2 M
SADANAGAITE {Na}{Ca2}{Mg3Al2}(Si5Al3O22)(OH)2 M
PARGASITE NaCa2(Mg4Al)Si6Al2O22(OH)2 M
POTASSICFERROSADANAGAITE {K}{Ca2}{Fe++3Al2}(Al3Si5O22)(OH)2 M
POTASSICFLUOROHASTINGSITE KCa2(Fe++4Fe+++)Si6Al2O22F2 M
POTASSICFLUOROPARGASITE KCa2(Mg4Al)(Si6Al2)O22F2 M
POTASSICHASTINGSITE KCa2(Fe++4Fe+++)(Si6Al2)O22(OH)2 M
POTASSICMAGNESIOHASTINGSITE KCa2(Mg4Fe+++)Si6Al2O22(OH)2 M
POTASSICPARGASITE (K,Na)Ca2(Mg,Fe++,Al,Fe+++)5(Si,Al)8O22(OH,F)2 M
MAGNESIOFLUOROHASTINGSITE NaCa2(Mg4Fe+++)Si6Al2O22F2 M
SADANAGAITE NaCa2Mg3(Al,Fe++,Ti)2(Al,Si)4(Si2O11)2(OH)2 M
MANGANIPARGASITE NaCa2(Mg4Mn+++)(Si6Al2)O22(OH)2 M
VANADIOPARGASITE NaCa2(Mg4V+++)Si6Al2O22(OH)2 M
POTASSICSADANAGAITE (K,Na)Ca2[Fe++3(Al,Fe+++)2]Si5Al3O22(OH)2 M
FERRIKAERSUTITE NaCa2(Mg3Fe+++Ti)(Al2Si6O22)O2 M
OXOMAGNESIOHASTINGSITE NaCa2(Mg2Fe+++3)(Al2Si6)O22O2 M
CHROMIOPARGASITE NaCa2(Mg4Cr)(Si6Al2)O22(OH)2 M
POTASSICCHLOROHASTINGSITE KCa2(Fe++4Fe+++)Si6Al2O22(Cl,OH)2 M
FERRIFLUOROSADANAGAITE {Na}{Ca2}{Mg3Fe+++2}(Al3Si5O22)F2 M
KAERSUTITE NaCa2(Mg4Ti)Si6Al2O23(OH) M
FERRISADANAGAITE {Na}{Ca2}{Mg3Fe+++2}(Al3Si5O22)(OH)2 M
FERROCHLOROPARGASITE NaCa2(Fe++4Al)Si6Al2O22Cl2 M
FERROCHLOROSADANAGAITE {K}{Ca2}{Mg3Al2}(Al3Si5O22)Cl2 M
FERROEDENITE NaCa2Fe++5Si7AlO22(OH)2 M
FERROFERRIFLUOROSADANAGAITE {Na}{Ca2}{Fe++3Fe+++2}(Al3Si5O22)F2 M
FERROFERRISADANAGAITE {Na}{Ca2}{Fe++3Fe+++2}(Al3Si5O22)(OH)2 M
FLUOROPARGASITE NaCa2(Mg,Fe++)4AlSi6Al2O22(F,OH)2 M
FERROFLUOROEDENITE NaCa2Fe++5(Si7AlO22)F2 M
FERROFLUROPARGASITE NaCa2(Fe++4Al)Si6Al2O22F2 M
FERROKAERSUTITE NaCa2(Fe++4Ti)Si6Al2O22(OH)2 M
HASTINGSITE NaCa2(Fe++4Fe+++)Si6Al2O22(OH)2 M
FERROPARGASITE NaCa2(Fe++4Al)Si6Al2O22(OH)2 M
FLUOROEDENITE NaCa2(Mg,Fe++)5(Si7Al)O22F2 M
FLUOROHASTINGSITE NaCa2(Fe++4Fe+++)(Al2Si6O22)F2 M
FLUOROSADANAGAITE {Na}{Ca2}{Mg3Al2}(Al3Si5O22)F2 M
EDENITE NaCa2(Mg,Fe++)5(Si7Al)O22(OH)2 M
FERROSADANAGAITE {Na}{Ca2}{Fe3Al2}(Al3Si5O22)(OH)2  
FERROFLUOROSADANAGAITE {Na}{Ca2}{Fe++3Al2}(Al3Si5O22)F2  
POTASSICFERRITARAMITE K(CaNa)(Mg3Fe+++2)(Al2Si6O22)(OH) M
POTASSICFERRIKATOPHORITE K(CaNa)(Mg4Fe+++)(AlSi7O22)(OH)2 M
KATOPHORITE Na(NaCa)(Mg4Al)(Si7Al)O22(OH)2 M
KATOPHORITE Na(CaNa)Fe++4(Al,Fe+++)Si7AlO22(OH)2 M
GHOSEITE [][Mn++Na][Mg4Al]Si8O22(OH)2 m
FLUOROWINCHITE []{CaNa}{Mg4Al}(Si8O22)F2 M
POTASSICFERROFERRIKATOPHORITE {K}{CaNa}{Fe++4Fe+++}[(AlSi7)O22](OH)2 M
FLUORORICHTERITE Na(CaNa)Mg5Si8O22F2 M
FLUOROKATOPHORITE Na(CaNa)(Mg4Al)(AlSi7O22)F2 M
FERROWINCHITE [](CaNa)Fe++4(Al,Fe+++)Si8O22(OH)2 M
FLUOROTARAMITE {Na}{CaNa}{Mg3Al2}(Al2Si6O22)F2 M
POTASSICFERROFERRITARAMITE K(NaCa)(Fe++3Fe+++2)(Si6Al2)O22(OH)2 M
POTASSICFERRORICHTERITE {K}{CaNa}{Fe++5}Si8O22(OH)2 M
POTASSICFLUOROKATOPHORITE K(CaNa)(Mg4Al)(AlSi7O22)F2 M
TARAMITE Na(CaNa)Fe++3AlFe+++Si6Al2O22(OH)2 M
POTASSICFLUORORICHTERITE (K,Na)(CaNa)Mg5Si8O22F2 M
POTASSICRICHTERITE K(NaCa)Mg5Si8O22(OH)2 M
RICHTERITE Na(CaNa)Mg5Si8O22(OH)2 M
FERRIGHOSEITE [][Mn++Na][Mg4Fe+++]Si8O22(OH)2 M
FERROTARAMITE Na2Ca(Fe++,Mg)3Al2(AlSi3O11)2(OH)2 M
FERROFERRIFLUOROBARROISITE []{CaNa}{Fe++3Fe+++2}(AlSi7O22)F2 M
WINCHITE [](CaNa)Mg4(Al,Fe+++)Si8O22(OH)2 M
POTASSICFERROTARAMITE K(NaCa)(Fe++3Al2)(Si6Al2)O22(OH)2 M
FERRIBARROISITE [](CaNa)Mg3Fe+++2Si7AlO22(OH)2 M
FERRITARAMITE Na(NaCa)(Mg3Fe+++2)(Si6Al2)O22(OH)2 M
FERRORICHTERITE Na(CaNa)Fe++5Si8O22(OH)2 M
HJALMARITE Na(NaMn)Mg5Si8O22(OH)2 M
FLUOROBARROISITE []{CaNa}{Mg3Al2}(AlSi7O22)F2 M
BARROISITE [](CaNa)Mg3AlFe+++Si7AlO22(OH)2 M
FERRIFLUOROKATOPHORITE Na(NaCa)(Mg4Fe+++)(Si7Al)O22F2 M
FERRIFLUOROTARAMITE Na(CaNa)(Mg3Fe+++2)(Al2Si6O22)F2 M
FERRIKATOPHORITE Na2Ca(Fe++,Mg)4Fe+++(Si7Al)O22(OH)2 M
FERRIWINCHITE []NaCa(Mg,Fe++)4Fe+++Si8O22(OH)2 M
FERROBARROISITE [](CaNa)Fe++3AlFe+++Si7AlO22(OH)2 M
FERROFLUOROKATOPHORITE Na(CaNa)(Fe++4Al)(AlSi7O22)F2 M
FERROKATOPHORITE Na(NaCa)(Fe++4Al)(Si7Al)O22(OH)2 M
FERROFERRIFLUOROKATOPHORITE Na(CaNa)(Fe++4Fe+++)(AlSi7O22)F2 M
FERROFLUOROTARAMITE Na(CaNa)(Fe++3Al2)(Al2Si6O22)F2 M
FERROFLUORORICHTERITE {Na}{CaNa}{Fe++5}(Si8O22)F2 M
FERROFLUOROWINCHITE []{CaNa}{Fe++4Al}(Si8O22)F2 M
FERROFERRIWINCHITE [][CaNa][Fe++4(Fe+++,Al)]Si8O22(OH)2 M
FERROFERRITARAMITE Na(CaNa)(Fe++3Fe+++2)(Al2Si6O22)(OH)2 M
FERROFERRIKATOPHORITE Na(NaCa)(Fe++4Fe+++)(Si7Al)O22(OH)2 M
FERROFERRIFLUOROTARAMITE Na(CaNa)(Fe++3Fe+++2)(Al2Si6O22)F2 M
FERROFLUOROBARROISITE []{CaNa}{Fe++3Al2}(AlSi7O22)F2 M
CLINOFERROHOLMQUISTITE [](Li2Fe++3Al2)Si8O22(OH)2 M
FLUOROPOTASSICRICHTERITE = POTASSICFLUORORICHTERITE KNaCaMg5Si8O22F2 M
MAGNESIOTARAMITE Na(CaNa)Mg3AlFe+++Si6Al2O22(OH)2 M
MANGANIOBERTIITE Na(Na2)(Mg3Mn+++Ti)(Si8O22)O2 M
MAGNESIOARFVEDSONITE NaNa2(Mg4Fe+++)Si8O22(OH)2 M
MAGNESIORIEBECKITE []Na2(Mg3Fe+++2)Si8O22(OH)2 M
MAGNESIOFLUORORIEBECKITE []{Na2}{Mg3Fe+++2}(Si8O22)F2 M
MAGNESIOFLUOROARFVEDSONITE (Na,K)Na2(Mg,Fe++)4Fe+++Si8O22(F,OH)2 M
MANGANIDELLAVENTURAITE NaNa2(MgMn+++2Ti++++Li)Si8O22O2 M
GLAUCOPHANE []Na2(Mg3Al2)Si8O22(OH)2 M
FLUORORIEBECKITE []Na2(Fe++3Fe+++2)Si8O22F2 M
FLUOROPEDRIZITE NaLi2(Mg2Al2Li)Si8O22F2 M
FLUOROGLAUCOPHANE [][Na2][Mg3Al2]Si8O22F2 M
FLUOROLEAKEITE NaNa2(Mg2Fe+++Li)Si8O22F2 M
MANGANOFERRIECKERMANNITE NaNa2(Mn++4Fe+++)Si8O22(OH)2 M
FLUOROECKERMANNITE NaNa2(Mg4Al}Si8O22F2 M
FLUORONYBOITE Na(Na,Ca)2(Mg,Fe++)3(Al,Mg,Fe+++)2Si7AlO22(F,OH)2 M
MANGANOMANGANIUNGARETTIITE NaNa2(Mg3Fe+++Ti)Si8O22O2 M
NYBOITE NaNa2(Mg3Al2)Si7AlO22(OH)2 M
OXOPARGASITE NaCa2(Mg3(Al2-x,Tix))5(Si6Al2O22)O2 M
PEDRIZITE Li2(Li,MgFe++Al)5(Si,Al)8O22(OH,F)2 M
POTASSICARFVEDSONITE KNa2Fe++4Fe+++Si8O22(OH)2 M
POTASSICECKERMANNITE {K}{Na2}{Mg4Al}(Si8O22)(OH)2 M
POTASSICFERRILEAKEITE [K][Na2][Mg2Fe+++2Li]Si8O22(OH)2 M
POTASSICJEANLOUISITE K(NaCa)(Mg4Ti)Si8O22O2  
POTASSICMAGNESIOARFVEDSONITE KNa2(MgFe++Fe+++)5Si8O22(OH)2 M
POTASSICMANGANILEAKEITE KNa2(Mg2Mn+++2Li)[Si8O22](OH)2 M
RIEBECKITE []Na2(Fe++3Fe+++2)Si8O22(OH)2 M
POTASSICMANGANOMANGANIUNGARETTIITE KNa2(Mn++2Mn+++3)Si8O22O2 M
FERRONYBOITE NaNa2(Fe++3Al2)Si7AlO22(OH)2 M
POTASSICMAGNESIOFLUOROARFVEDSONITE [(K,Na)][Na2][Mg4Fe+++][Si8O22][(F,OH)2] M
CLINOFERROFERRIHOLMQUISTITE []{Li2}{Fe++3Fe+++2}(Si8O22)(OH)2 M
FERRIOBERTIITE NaNa2(Mg3Fe+++Ti)Si8O22O2 M
FERRILEAKEITE [Na][Na2][Mg2Fe+++2Li]Si8O22(OH)2 M
FERRIFLUORONYBOITE NaNa2(Mg3Fe+++2)(AlSi7O22)F2 M
ECKERMANNITE NaNa2(Mg4Al)Si8O22(OH)2 M
CLINOSODICFLUOROHOLMQUISTITE {Na}{Li2}{Mg4Al}(Si8O22)F2 M
FERRIPEDRIZITE [Na][Li2][Mg2Fe+++2Li]Si8O22(OH)2 M
CLINOFERROFLUOROHOLMQUISTITE []{Li2}{Fe++3Al2}(Si8O22)F2 M
CLINOFERROFERRIFLUOROHOLMQUISTITE []{Li2}{Fe++3Fe+++2}(Si8O22)F2 M
OXOMANGANILEAKEITE NaNa2(Mn+++4Li)Si8O22O2 M
CLINOFERRIHOLMQUISTITE []Li2(Mg3Fe+++2)Si8O22(OH)2 M
ARFVEDSONITE NaNa2(Fe++,Mg)4Fe+++Si8O22(OH)2 M
FLUOROARFVEDSONITE [Na][Na2][Fe++4Fe+++]Si8O22F2 M
SODICFERRICLINOFERROHOLMQUISTITE Na0,5{Li2}{Fe++3Fe+++2}(Si8O22)(OH)2 M
LEAKEITE NaNa2(Mg2Al2Li)(Si8O22)(OH)2 M
CLINOFLUOROHOLMQUISTITE []{Li2}{Mg3Al2}(Si8O22)F2 M
FERROGLAUCOPHANE []Na2(Fe++3Al2)Si8O22(OH)2 M
FERROPEDRIZITE NaLi2(Fe++2Al2Li)Si8O22(OH)2 M
CLINOFERRIFLUOROHOLMQUISTITE []{Li2}{Mg3Fe+++2}(Si8O22)F2 M
FERROLEAKEITE NaNa2(Fe++2Fe+++2Li)Si8O22(OH)2 M
FERROECKERMANNITE NaNa2(Fe++Al)Si8O22(OH)2 M
FERROFLUOROPEDRIZITE Na(Li2)(Fe++2Al2Li)[Si8O22]F2 M
FERROFLUOROPEDRIZITE NaLi2(Fe++2Al2Li)Si8O22F2 M
FERROFLUORONYBOITE NaNa2(Fe++3Al2)(AlSi7O22)F2 M
FERROFLUOROLEAKEITE NaNa2(Fe++2Al2Li)(Si8O22)F2 M
FERROFERRINYBOITE NaNa2(Fe++3Fe+++2)(Si7Al)O22(OH)2 M
FERROFLUOROGLAUCOPHANE [][Na2][Fe++3Al2]Si8O22F2 M
FERROFERRILEAKEITE [Na][Na2][Fe++2Fe+++2Li]Si8O22(OH)2 M
FERROFERRIFLUOROPEDRIZITE NaLi2(LiFe++2Fe+++2)(Si8O22)F2 M
FERROFERRIOBERTIITE NaNa2(Fe++3Fe+++Ti++++)Si8O22O2 M
FERROFERRIPEDRIZITE [Na][Li2][Fe++2Fe+++2Li]Si8O22(OH)2 M
FERROFLUOROECKERMANNITE NaNa2(Fe++4Al}Si8O22F2 M
FERROFERRIFLUOROLEAKEITE Na(Na2)(Fe++2Fe+++2Li)(Si8O22)(F)2 M
FERRIFLUOROPEDRIZITE NaLi2(LiMg2Fe+++2)(Si8O22)F2  
FERROFERRIFLUORNYBOITE NaNa2(Fe++3Fe+++2)(AlSi7O22)F2  
FERRINYBOITE (Na,K)Na2(Mg,Fe++)3(Fe+++,Ti)2(Al0,5Si3,5O11)2(OH)2 M
FERRIFERROBARROISITE [](CaNa)Fe++3Fe+++2Si7AlO22(OH)2 M
FERRIFLUOROBARROISITE []{CaNa}{Mg3Fe+++2}(AlSi7O22)F2 M
CLINOSUENOITE []Mn++2Mg5Si8O22(OH)2 M
FERROFERRIFLUORONYBOITE NaNa2(Fe++3Fe+++2)(AlSi7O22)F2 M
SCANDIOWINCHITE [](NaCa)(Mg4Sc)(Si8O22)(OH)2 M
Inosilicates with 2-periodic multiple chains
CHESTERITE (Mg,Fe++)17Si20O54(OH)6 O
JIMTHOMPSONITE (Mg,Fe++)5Si6O16(OH)2 O
CLINOJIMTHOMPSONITE (Mg,Fe++)5Si6O16(OH)2 M
ERSHOVITE Na4K3(Fe++,Mn++,Ti)2Si8O20(OH)4.4H2O A
PARAERSHOVITE Na3K3Fe+++2(Si4O10OH)2(H2O)4 A
TVEDALITE (Ca,Mn++)4Be3Si6O17(OH)4.3H2O O
BAVENITE Ca4Be2Al2Si9O26(OH)2 O
BIGCREEKITE BaSi2O5.4H2O O
BOHSEITE Ca4Be3+xAl1-xSi9O25-x(OH)3+x (x=0-1) O
Inosilicates with 3-periodic single and multiple chains
STEEDEITE NaMn2[Si3BO9](OH)2 A
NOLZEITE NaMn2[Si3BO9](OH)2.2H2O A
PECTOLITE NaCa2Si3O8(OH) A
WOLLASTONITE-7A CaSiO3 A
SERANDITE Na(Mn++,Ca)2Si3O8(OH) A
WOLLASTONITE CaSiO3 M/A
WOLLASTONITE-2M CaSiO3 M
FERROBUSTAMITE Ca(Fe++,Ca,Mn)Si2O6 A
PECTOLITE-M2abc NaCa2Si3O8(OH) M
SCHIZOLITE NaCaMnSi3O8(OH) A
BUSTAMITE Mn2Ca2MnCa(Si3O9)2 R
MURAKAMIITE LiCa2Si3O8(OH) A
TANOHATAITE LiMn2(HSi3O9) A
DALNEGORSKITE Ca5Mn(Si3O9)2 A
WOLLASTONITE-7T = WOLLASTONITE-7A CaSiO3 A
MARSHALLSUSSMANITE = SCHIZOLITE NaCaMn++Si3O8(OH) A
WOLLASTONITE-2M CaSiO3 M
CASCANDITE Ca(Sc,Fe++)Si3O8(OH) A
PLOMBIERITE Ca5Si6O10(OH)2.7H2O O
RIVERSIDEITE [Ca4Si6O17.2H2O].(Ca.3H2O) O
TOBERMORITE [Ca4Si6O17.2H2O].(Ca.3H2O) O
CLINOTOBERMORITE [Ca4Si6O17.2H2O].(Ca.3H2O) M
JUSITE = TOBERMORITE (?) Na2Ca15Al4Si16O54.17H2O  
KENOTOBERMORITE Ca4Si6O15(OH)2(H2O)2.3H2O M
FOSHAGITE Ca4Si3O9(OH)2 A
KAMENEVITE K2TiSi3O9.H2O O
JENNITE Ca9[Si6O18(OH)6].8H2O A
PARAUMBITE K3Zr2HSi6O18.nH2O O
UMBITE K2ZrSi3O9.H2O O
SORENSENITE Na4Sn++Be2(Si3O9).2H2O M
ESCHEITE Ca2NaMnTi5[Si12O34]O2(OH)3.12H2O O
XONOTLITE Ca6Si6O17(OH)2 M/A
HILLEBRANDITE CaSiO3(OH)2 M ps O
CHIVRUAIITE Ca4(Ti,Nb)5[(Si6O17)2[(OH,O)5].13-14H2O O
ZORITE Na2Ti(Si,Al)3O9.nH2O O
PATYNITE NaKCa4[Si9O23] A
HAINEAULTITE (Na,Ca)5Ca(Ti,Nb)5(Si12O34)(OH,F)4.5H2O O
EPIDIDYMITE Na2Be2(Si6O15).H2O O
EUDIDYMITE Na2Be2(Si6O15).H2O M
ELPIDITE Na2ZrSi6O15.3H2O O
WHELANITE Cu2Ca6[Si6O17(OH)](CO3)(OH)3(H2O)2 O
FENAKSITE KNaFe++Si4O10 A
LITIDIONITE KNaCuSi4O10 A
YUSUPOVITE Na2Zr(Si6O15).2,5H2O M
MANAKSITE KNaMn++Si4O10 A
SENKEVICHITE CsKNaCa2TiSi7O19(OH) A
TINAKSITE K2Na(Ca,Fe++,Mn++,Mg)2(Ti,Fe)Si7O19(OH) A
TOKKOITE K2Ca4[Si7O18(OH)](F,OH) A
CANASITE K3Na3Ca5Si12O30(OH,F)4 M
FLUORCANASITE K3Na3Ca5Si12O30F4.H2O M
MISERITE K1,5-x(Ca,Y,REE )5[Si6O15][Si2O7](OH,F)2.yH2O A
FRANKAMENITE K3Na3Ca5(Si12O30)(F,OH)4.H2O A
CHAROITE (K,Sr,Ba,Mn)15-16(Ca,Na)32[(Si70(O,OH)180)](OH,F)4.nH2O M
YUKSPORITE K4(Sr,Ba)2(Ca,Na)14(Mn,Fe)0.5(Ti,Nb)4(Si2O7)3(Si6O17)2(O,OH)4.3(OH,H2O) M
EVESLOGITE (Ca,K,Na,Sr,Ba)48[(Ti,Nb,Fe,Mn)12(OH)12Si48O144](F,OH,Cl)14 M
BARRYDAWSONITE-(Y) Na1,5Y0,5CaSi3O9H M
CALCINAKSITE KNaCa(Si4O10).H2O A
YUZUXIANGITE Sr3Fe+++(Si2O6)2(OH)·3H2O  
PARATOBERMORITE Ca4(Al0,5Si0,5)2Si4O16(OH)(H2O)2.(Ca.3H2O) M
Inosilicates with 4-periodic single chains, Si4O12
LEUCOPHANITE Na2Ca2Be2(Si4O12)F2 A ps O
OHMILITE Sr3(Ti,Fe+++)(Si2O6)2(O,OH).2-3H2O M
SUZUKIITE Ba2(VO2)Si4O12 O
HARADAITE Sr2V++++2O2(Si4O12) O
SHCHERBAKOVITE (K,Na,Ba)3(Ti,Nb)2Si4O14 O
NOONKANBAHITE BaKNaTi2(Si4O12)O2 O
BATISITE (Ba,K,Na)3Ti2Si4O14 O
TAIKANITE (Ba,Sr)2Mn+++2Si4O12 M
KRAUSKOPFITE BaSi2O4(OH)2.2H2O M
BALANGEROITE (Mg,Fe+++,Fe++,Mn++)42Si16O54(OH)40 M
GAGEITE (Mn,Mg,Zn)42Si16O54(OH)40 M
GAGEITE-2M (Mn,Mg,Zn)42Si16O54(OH)40 M
DORRITE Ca2Mg2Fe+++4Si2Al4O20 A
WILKINSONITE Na2Fe++4Fe+++2Si6O20 A
WELSHITE Ca4Mg9Sb+++++3Be3Si6(Fe+++,Al)3O20 A
SERENDIBITE Ca2Mg3Al3Si3Al1,5B1,5O20 A
RHONITE Ca2(Mg,Fe++)4Fe+++Ti++++Si3Al3O20 A
MAKAROCHKINITE Ca2Fe++4Fe+++TiSi4BeAlO20 A
HOGTUVAITE (Ca,Na)2(Fe++,Fe+++,Ti,Mg,Sn,Mn)6(Si,Be,Al)6O20 A
KURATITE Ca2(Fe++5Ti)O2[Si4Al2O18] A
AENIGMATITE Na2Fe++5Ti++++Si6O20 A
KRINOVITE Na2Mg4Cr2Si6O20 A
LEUCORHONITE Ca2(Mg,Fe+++,Al)6(Si,Al)6O20 A
KHESINITE Ca4(Mg3Fe+++9)O4(Fe+++9Si3)O36 A
SAPPHIRINE (Mg,Al)8(Al,Si)6O20 M/A
KHMARALITE Mg5,5Al14Fe2Si5Be1,5O40 M
SURINAMITE (Mg,Fe+++)3(Al,Fe+++)3BeSi3O16 M
DEERITE (Fe++,Mn)6(Fe+++,Al)3Si6O20(OH)5 M ps O
HOWIEITE Na(Fe++,Mn)10(Fe+++,Al)2Si12O31(OH)13 A
TANEYAMALITE Na(Mn++,Mg,Fe++)12Si12(O,OH)44 A
JOHNINNESITE Na2Mn++9(Mg,Mn++)7(OH)8(AsO4)2(Si6O17)2 A
AGRELLITE NaCa2Si4O10F A
BAVSIITE Ba2V2O2[Si4O12] Q
LOUISFUCHSITE Ca2(Mg4Ti2)(Al4Si2)O20 A
DEVILLIERSITE Ca4Ca2Fe+++10O4(Fe+++10Si2)O36 A
Inosilicates with 4-periodic double and triple chains
NARSARSUKITE Na2(Ti,Fe+++)Si4(O,F)11 Q
LAPLANDITE-(Ce) Na4CeTiPSi7O22.5H2O O
CAYSICHITE-(Y) Y4(Ca3REE)(OH)(H2O)5(Si8O20)(CO3)6.2H2O O
SEIDITE-(Ce) Na4(Ce,Sr)2TiSi8O18(O,OH,F)5(OH).5H2O M
CARLOSTURANITE (Mg,Fe++,Ti)21(Si,Al)12O28(OH)34.H2O M
JONESITE Ba4(K,Na)2Ti4Al2Si10O36.6H2O O
Inosilicates with 5-periodic single chains
SCANDIOBABINGTONITE Ca2(Fe++,Mn)ScSi5O14(OH) A
RHODONITE (Mn++,Fe++,Mg,Ca)SiO3 A
NATRONAMBULITE (Na,Li)Mn4Si5O14(OH) A
NAMBULITE (Li,Na)(Mn,Ca)4Si5O14(OH) A
BABINGTONITE Ca2(Fe++,Mn)Fe+++Si5O14(OH) A
MARSTURITE NaCaMn3Si5O14(OH) A
MANGANBABINGTONITE Ca2(Mn,Fe++)Fe+++Si5O14(OH) A
LITHIOMARSTURITE LiCaMn3Si5O14(OH) A
ALLAGITE = a mixture?    
SANTACLARAITE CaMn++4Si5O14(OH)2.H2O A
SANEROITE Na2(Mn++,Mn+++)10Si11VO34(OH)4 A
CIPRIANIITE Ca4[(Th,U)Ca]2Al(Be0,5[]1,5)[B4Si4O22](OH)2 M
HELLANDITE-(Ce) (Ca3REE)4Ce2Al[]2[Si4B4O22](OH)2 M
HELLANDITE-(Y) (Ca3REE)4Y2Al[]2[Si4B4O22](OH)2 M
MOTTANAITE-(Ce) Ca4Ce2Al(Be1,5[]0,5)[B4Si4O22]O2 M
TADZHIKITE-(Ce) Ca4Ce2Ti[]2[Si4B4O22](OH)2 M
HELLANDITE-(Yb) (Ca,Y)4(Yb,Y)2(Al,Fe+++,Ti++++)(Be,Li)2B4Si4O22(O,F,OH)2 (?) M
HELLANDITE-(Gd) (Ca,Y)4(Gd,Y)2(Al,Fe+++,Ti++++)(Be,Li)2B4Si4O22(O,F,OH)2 (?) M
FERRIMOTTANAITE-(Ce) Ca4Ce2Fe+++(Be1,5[]0,5)[Si4B4O22]O2 M
FERRIHELLANDITE-(Ce) (Ca3Ce)Ce2Fe+++[]2B4Si4O22(OH)2 M
FERRORHODONITE CaMn3Fe(Si5O15) A
VITTINKIITE MnMn3Mn[Si5O15] A
Inosilicates with 5-periodic double chains, Si10O28
INESITE Ca2Mn7Si10O28(OH)2.5H2O A
PIERGORITE-(Ce) Ca8Ce2(Al0,5Fe3+++0,5)([],Li,Be)2Si6B8O36(OH,F)2 M
Inosilicates with 6-periodic single chains
STOKESITE CaSnSi3O9.2H2O O
KOMKOVITE BaZrSi3O9.3H2O R
CALCIOHILAIRITE CaZrSi3O9.3H2O R
PYATENKOITE-(Y) Na5(Y,Dy,Gd)(Ti,Nb)Si6O18.6H2O R
HILAIRITE Na2ZrSi3O9.3H2O R
SAZYKINAITE-(Y) (Na,K)5Y(Zr,Ti)Si6018.6H2O R
GAIDONNAYITE Na2ZrSi3O9.2H2O O
GEORGECHAOITE KNaZrSi3O9.2H2O O
CHKALOVITE Na2BeSi2O6 O
VLASOVITE Na2ZrSi4O11 M/A
REVDITE Na2Si2O5.5H2O A
SCHEUCHZERITE Na(Mn,Mg,Zn)9V+++++Si9O28(OH)4 A
TERSKITE Na4Zr(H4Si6O18) O
HYDROTERSKITE Na2ZrSi6O12(OH)6 O
KESEBOLITE-(Ce) CeCa2Mn(AsO4)(SiO3)3 M
Inosilicates with 6-periodic double chains
ZEKTZERITE NaLi(ZrTi,Hf)Si6O15 O
TUHUALITE (Na,K)Fe++Fe+++Si6O15 O
EMELEUSITE Na4Li2Fe+++2Si12O30 O ps H
SEMENOVITE-(Ce) (Ca,Ce,La,Na)10-12(Fe++,Mn)(Si,Be)20(O,OH,F)48 O
ASHCROFTINE-(Y) K5Na5(Y,Ca)12Si28O70(OH)2(CO3)8.8H2O Q
Inosilicates with 7-, 8-, 10-, 12- and 14-periodic chains
PYROXFERROITE (Fe++,Mn,Ca)SiO3 A
PYROXMANGITE MnSiO3 A
PELLYITE Ba2Ca(Fe++,Mg)2Si6O17 O
MEIERANITE Na2Sr3MgSi6O17 O
NORDITE-(La) Na3SrLaZnSi6O17 O
NORDITE-(Ce) Na3SrCeZnSi6O17 O
MANGANONORDITE-(Ce) Na3SrCeMn++Si6O17 O
FERRONORDITE-(La) Na3Sr(La,Ce)Fe++Si6O17 O
FERRONORDITE-(Ce) Na3SrCeFe++Si6O17 O
ALAMOSITE PbSiO3 M
LIEBAUITE Ca3Cu5Si9O26 M
VLADYKINITE Na3Sr4(Fe++Fe+++)Si8O24 M
BRACCOITE NaMn++5[Si5O14(OH)](AsO3)(OH) A
ILLOQITE-(Ce) Na2NaBaCeZnSi6O17 O
Transitional ino-phyllosilicate structures
MELIPHANITE Ca4(Na,Ca)4Be4AlSi7O24(F,O)4 Q
LEUCOSPHENITE BaNa4Ti2B2Si10O30 M
PREHNITE Ca2Al2Si3O10(OH)2 O
AMSTALLITE CaAl(Si,Al)4O8(OH)4.(H2O,Cl) M
KVANEFJELDITE Na4(Ca,Mn)Si6O14(OH)2 O
LEMOYNITE (Na,K)2CaZr2Si10O26.5-6H2O M
NATROLEMOYNITE (Na,K,H3O)4Zr2(Si10O26).9H2O M
HOGARTHITE (Na,K)2CaTi2Si10O26.8H2O M
ALTISITE Na3K6Ti2Al2Si8O26Cl3 M
CHIAPPINOITE-(Y) (Y,Ce)2(Mn++,Ca)(Si3O7)4 O
ESQUIREITE Ba(Si6O13).7H2O M
FERRIPREHNITE Ca2Fe+++(AlSi3)O10(OH)2 O
Modular Inosilicate-Sorosilicate Structures
FUKALITE Ca4Si2O6(CO3)(OH)2 O
Phyllosilicates
Single nets of tetrahedra with 4-, 5-, (6-), and 8-membered rings
CUPRORIVAITE CaCuSi4O10 Q
WESSELSITE (Sr,Ba)Cu++(Si4O10) Q
GILLESPITE BaFe++Si4O10 Q
EFFENBERGERITE BaCuSi4O10 Q
EKANITE ThCa2Si8O20 Q
HYDROXYAPOPHYLLITE-(K) KCa4Si8O20(OH,F).8H2O Q
FLUORAPOPHYLLITE-(Cs) CsCa4(Si8O20)F(H2O)8 Q
FLUORAPOPHYLLITE-(K) (K,Na)Ca4Si8O20(F,OH).8H2O O
FLUORAPOPHYLLITE-(Na) NaCa4Si8O20F.8H2O O
MAGADIITE Na2Si14O29.11H2O M
DAVANITE K2TiSi6O15 A
DALYITE K2ZrSi6O15 A
SAZHINITE-(La) Na3(La,Ce)Si6O15.2H2O O ps Q
SAZHINITE-(Ce) Na2CeSi6O14(OH).nH2O (n = about 5) O
ARMSTRONGITE CaZrSi6O15.2.5H2O M
OKENITE Ca5Si9O23.9H2O A
NEKOITE Ca3Si6O15.7H2O A
PERETTIITE-(Y) Y+++2Mn++4Fe++[Si2B8O24] O?
BADAKHSHANITE-(Y) Y2Mn4Al(Si2B7BeO24) O
SHLYKOVITE KCa[Si4O9(OH)] M
CAVANSITE Ca(VO)Si4O10.4H2O O
DIEGOGATTAITE Na2CaCu2Si8O20.H2O M
YANGITE PbMn++Si3O8.H2O A
PENTAGONITE Ca(VO)Si4O10.4H2O O
TUMCHAITE Na2(Zr,Sn)Si4O11.2H2O M
PENKVILKSITE Na4(Ti++++,Zr)Si8O22.4H2O M
NABESITE Na2BeSi4O10.4H2O O
AJOITE (K,Na)Cu++7AlSi9O24(OH)6.3H2O A
ZERAVSHANITE Cs4Na2Zr3[Si18O45](H2O)2 M
BUSSYITE-(Ce) (Ce,REE)3(Na,H2O)6MnSi9Be5(O,OH)30F4 M
PLUMBOPHYLLITE Pb2Si4O10.H2O O
BUSSYITE-(Y) (Y,REE,Ca)3(Na,Ca)6MnSi9Be5(O,OH,F)34 M
FLUORAPOPHYLLITE-(NH4+) NH4Ca4(Si8O20)F.8H2O Q
HYDROXYMCGLASSONITE-(K) KSr4Si8O20(OH).8H2O Q
Double nets with 4- and 6-membered rings
RHODESITE KHCa2Si8O19.5H2O O
MACDONALDITE BaCa4Si16O36(OH)2.10H2O O
HYDRODELHAYELITE KCa2AlSi7O17(OH)2.6H2O O
DELHAYELITE (Na,K)10Ca5Al6Si32O80(Cl2,F2,SO4)3.18H2O O
MONTEREGIANITE-(Y) KNa2YSi8O19.5H2O M
CARLETONITE KNa4Ca4Si8O18(CO3)4(OH,F).H2O Q
GUNTERBLASSITE (?,??)3-xF?[(Si,?l)13O25(??,O)4].7?2O O
UMBRIANITE K7Na2Ca2[Al3Si10O29]F2Cl2 O
HILLESHEIMITE (K,Ca,[])2(Mg,Fe,Ca,[])2[(Si,Al)13O23(OH)6](OH).8H2O O
FIVEGITE K4Ca2[AlSi7O17(O2-xOHx)][(H2O)2-xOHx]Cl (x = 0-2) O
FLUORCARLETONITE KNa4Ca4Si8O18(CO3)4F.H2O Q
MELANSONITE Na[]KZrSi8O19.5H2O O
Phyllosilicates with mica sheets, composed of tetrahedral and octahedral nets
MINNESOTAITE (Fe++,Mg)3Si4O10(OH)2 M
TALC Mg3Si4O10(OH)2 M/A
WILLEMSEITE (Ni,Mg)3Si4O10(OH)2 M
VOLOSHINITE Rb(LiAl1,5[]0,5)(Al0,5Si3,5)O10F2 M
LUANSHIWEIITE KLiAl1,5(Si3,5Al0,5)O10(OH)2 M
PYROPHYLLITE Al2Si4O10(OH)2 M
MANGANICELADONITE KMgMn+++Si4O10(OH)2 M
FERRIPYROPHYLLITE Fe+++2Si4O10(OH)2 M
GORBUNOVITE CsLi2(Ti,Fe)Si4O10(F,OH,O)2 M
FLUORLUANSHIWEIITE KLiAl1,5[]0,5(Si3,5Al0,5)O10F2 M
GARMITE CsLiMg2(Si4O10)F2  
MUSCOVITE KAl2[]AlSi3O10(OH)2 M ps H
CHROMCELADONITE KCrMgSi4O10(OH)2 M
KREITERITE CsLi2Fe+++Si4O10F2 M
TAINIOLITE KLiMg2Si4O10F2 M
TOBELITE (NH4)Al2[]AlSi3O10(OH)2 M
NANPINGITE CsAl2[]AlSi3O10(OH)2 M
PARAGONITE NaAl2[]AlSi3O10(OH)2 M
MONTDORITE KFe++1,5Mn++0,5Mg0,5[]0,5Si4O10F2 M
ROSCOELITE KV2[]AlSi3O10(OH)2 M
ILLITE K0,65Al2[]Al0,65Si3,35O10(OH)2 M
GANTERITE (Ba,Na,K)(Al,Mg)2(Al,Si)AlSi3O10(OH)2 M
FERROCELADONITE KFe+++(Fe++,Mg)[]Si4O10(OH)2 M
CHERNYKHITE BaV2[]Al2Si2O10(OH)2 M
CELADONITE KFe+++(Mg,Fe++)[]Si4O10(OH)2 M
BOROMUSCOVITE KAl2[]BSi3O10(OH)2 M
ALUMINOCELADONITE KAl(Mg,Fe++)[]Si4O10(OH)2 M
CHROMPHYLLITE KCr2[]AlSi3O10(OH,F)2 M ps H
FERROALUMINOCELADONITE KAl(Fe++,Mg)[]Si4O10(OH)2 M
WONESITE Na0,5[]0,5Mg2,5Al0,5AlSi3O10(OH)2 M
TETRAFERRIANNITE KFe++3Fe+++Si3O10(OH)2 M
PHLOGOPITE KMg3AlSi3O10(OH)2 M
TETRAFERRIPHLOGOPITE KMg3Fe+++Si3O10(OH)2 M
PREISWERKITE NaMg2AlAl2Si2O10(OH)2 M
SHIROKSHINITE KNaMg2Si4O10F2 M
SHIROZULITE K(Mn++,Mg)3AlSi3O10(OH)2 M
SIDEROPHYLLITE KFe++2AlAl2Si2O10(OH)2 M
NORRISHITE KLiMn+++2Si4O12 M
YANGZHUMINGITE (K,Li)Mg2,5Si4O10F2 M
SUHAILITE (NH4)Fe++3AlSi3O10(OH)2 M
SOKOLOVAITE CsLi2AlSi4O10(F,OH)2 M
ORLOVITE KLi2Ti(Si4O10)(OF) M
TRILITHIONITE KLi1,5Al1,5AlSi3O10F2 M
ANNITE KFe++3AlSi3O10(OH)2 M
POLYLITHIONITE KLi2AlSi4O10F2 M
MASUTOMILITE KLiAlMn++AlSi3O10F2 M
ASPIDOLITE NaMg3AlSi3O10(OH)2 M
EASTONITE KMg2AlAl2Si2O10(OH)2 M
EPHESITE NaLiAl2Al2Si2O10(OH)2 M/A
FLUORANNITE KFe++3AlSi3O10(F,OH)2 M
FLUOROPHLOGOPITE KMg3AlSi3O10(F,OH)2 M ps H
FLUOROTETRAFERRIPHLOGOPITE KMg3(Fe+++,Al)Si3O10F2 M
HENDRICKSITE KZn3AlSi3O10(OH)2 M
OXYPHLOGOPITE K(Mg,Ti,Fe)3[(Si,Al)4O10](O,F)2 M
CHLOROFERROKINOSHITALITE (Ba,K)(Fe++,Mg)3(Al2Si2O10)(Cl,OH,F)2  
PIMELITE (Ni,Mg)3Si4O10(OH)2.4H2O H
MARGARITE CaAl2[]Al2Si2O10(OH)2 M
CHLOROPHAEITE (Ca,Mg,Fe)2Fe2Si4O13.10H2O  
ANANDITE BaFe++3Fe+++Si3O10S(OH) M
FLUOROKINOSHITALITE BaMg3Al2Si2O10F2 M
OXYKINOSHITALITE Ba(Mg2Ti++++)(Si2Al2)O10O2 M
FERROKINOSHITALITE Ba(Fe++,Mg)3(Si2Al2)O10(OH,F)2 M
CLINTONITE CaMg2AlAl3SiO10(OH)2 M
BITYITE LiCaAl2(AlBeSi2O10)(OH)2 M
KINOSHITALITE BaMg3(Al2Si2)O10(OH,F)2 M
BEIDELLITE (Na,Ca0,5)0,3Al2(Si,Al)4O10(OH)2.nH2O M
KURUMSAKITE (Zn,Ni,Cu)8Al8V2Si5O35.27H2O (?) O (?)
MONTMORILLONITE (Na,Ca)0,3(Al,Mg)2Si4O10(OH)2.nH2O M
VOLKONSKOITE Ca0,3(Cr+++,Mg,Fe+++)2(Si,Al)4O10(OH)2.4H2O M
YAKHONTOVITE (Ca,Na)0,5(Cu++Fe++Mg)2Si4O10(OH)2.3H2O M
NONTRONITE Na0,3Fe+++2(Si,Al)4O10(OH)2.nH2O M
HECTORITE Na0,3(Mg,Li)3Si4O10(F,OH)2 M
SPADAITE MgSiO2(OH)2.H2O (?) (?)
FERROSAPONITE (Ca,Na)0,3(Fe++,Mg,Fe+++)3(Si,Al)4O10(OH)2.4H2O M
STEVENSITE (Ca,Na)xMg3-x(Si4O10)(OH)2 M
SWINEFORDITE (Ca,Na)0,3(Al,Li,Mg)2(Si,Al)4O10(OH,F)2.2H2O M
ZINCSILITE Zn3Si4O10(OH)2.4H2O (?) M
SAUCONITE Na0,3Zn3(Si,Al)4O10(OH)2.4H2O M
SAPONITE Ca0,25(Mg,Fe)3((Si,Al)4O10)(OH)2.nH2O M
HANJIANGITE Ba2Ca(V+++Al)[Si3AlO10(OH)2]F(CO3)2 M
VERMICULITE (Mg,Fe++,Al)3(Al,Si)4O10(OH)2.4H2O M
TARASOVITE = MICA-SMECTITE   M
DONBASSITE Al4,33(Si3Al)O10(OH)8 M
SUDOITE Mg2(Al,Fe+++)3Si3AlO10(OH)8 M
PENNANTITE Mn++5Al(Si3Al)O10(OH)8 M
NIMITE (Ni,Mg,Fe++)5Al(Si3Al)O10(OH)8 M
GONYERITE (Mn++,Mg)5Fe+++(Si3Fe+++)O10(OH)8 O (?)
FRANKLINFURNACEITE Ca2(Fe+++Al)Mn+++Mn++3Zn2Si2O10(OH)8 M
COOKEITE LiAl4(Si3Al)O10(OH)8 M
CLINOCHLORE (Mg,Fe++)5Al(Si3Al)O10(OH)8 M
BOROCOOKEITE Li1+3xAl4-x(B,Al)Si3O10(OH,F)8 M
BAILEYCHLORE (Zn,Fe++,Al,Mg)6(Si,Al)4O10(OH)8 A
CHAMOSITE (Fe++,Mg,Fe+++)5Al(Si3Al)O10(OH,O)8 M
GLAGOLEVITE NaMg6AlSi3O10(OH,O)8.H2O A
ORTHOCHAMOSITE (Fe++,Mg,Fe+++)5Al(Si3Al)O10(OH,O)8 O
SALIOTITE Li0,5Na0,5Al3AlSi3O10(OH)5 M
RECTORITE (Na,Ca)Al4(Si,Al)8O20(OH)4.2H2O M
LUNIJIANLAITE Li0,72Al6(Si7AlO20)(OH,O)10 M
KULKEITE Na0,35Mg8Al(AlSi7)O20(OH)10 M
KARPINSKITE (Mg,Ni)2Si2O5(OH)2 (?) M (?)
HYDROBIOTITE K(Mg,Fe)6(Si,Al)8O20(OH)4.xH2O M
DOZYITE (Mg7Al2)(Si4Al2)O15(OH)12 M
CORRENSITE (Mg,Fe,Al)9(Si,Al)8O20(OH)10.nH2O O
BRINROBERTSITE Na0,3Al4(Si4O10)2(OH)4.3,5H2O M ps H
ALIETTITE Ca0,2Mg6(Si,Al)8O20(OH)4.4H2O  
TOSUDITE Na0,5(Al,Mg)6(Si,Al)8O18(OH)12.5H2O M (?)
MACAULAYITE (Fe+++,Al)24Si4O43(OH)2 M
BURCKHARDTITE Pb2(Fe+++Te++++++)[AlSi3O8]O6 M ps H
FERRISURITE Pb2Ca(Fe+++,Al)2(Si,Al)4O10(OH,F)2(CO3,OH)3.0,5H2O M
NIKSERGIEVITE [Ba1,33Ca0,67Al(CO3)(OH)4][Al2(AlSi3O10)(OH)2].nH2O M
SURITE Pb2Ca(Al,Mg)2(Si,Al)4O10(OH)2(CO3,OH)3.0,5H2O M
KEGELITE Pb8Al4Si8(SO4)2(CO3)4(OH)8O20 M ps H
GLAUCONITE (K,Na)(Mg,Fe++,Fe+++)(Fe+++,Al)(Si,Al)4O10(OH)2 M
BALESTRAITE KLi2V+++++Si4O12 M
MEIFUITE KFe6(Si7Al)O19(OH)4Cl2 A
Phyllosilicates with kaolinite layers composed of tetrahedral and octahedral nets
ODINITE (Fe+++,Mg,Al,Fe++,Ti,Mn)2,5(SiAl)O5(OH)4 M/R
NACRITE Al2Si2O5(OH)4 M
KAOLINITE Al2Si2O5(OH)4 A
DICKITE Al2Si2O5(OH)4 M
HALLOYSITE-10A = HYDROHALLOYSITE Al2Si2O5(OH)4.2H2O M
HISINGERITE Fe+++2Si2O5(OH)4.2H2O M
HALLOYSITE-7A Al2Si2O5(OH)4 M
HALLOYSITE-10Angstroem Al2Si2O5(OH)4·2H2O M
HYDROHALLOYSITE   M
CRONSTEDTITE Fe++2Fe+++(SiFe+++)O5(OH)4 M
PECORAITE Ni3Si2O5(OH)4 M
NEPOUITE Ni3Si2O5(OH)4 M
MANANDONITE LiAl2(SiAl0,5B0,5)O5(OH)4 O
LIZARDITE Mg3Si2O5(OH)4 R/H
KELLYITE (Mn++,Mg,Al)3(Si,Al)2O5(OH)4 H
GUIDOTTIITE (Mn2Fe+++)(SiFe+++)O5(OH)4 H
FRAIPONTITE (Zn,Al)3(Si,Al)2O5(OH)4 M
CHRYSOTILE Mg3Si2O5(OH)4 M
CARYOPILITE (Mn++,Mg)3Si2O5(OH)4 M
BERTHIERINE (Fe++,Fe+++,Mg)2-3(Si,Al)2O5(OH)4 M
ANTIGORITE (Mg,Fe++)3Si2O5(OH)4 M
AMESITE Mg2Al(SiAl)O5(OH)4 A
BRINDLEYITE (Ni,Mg,Fe++)2Al(SiAl)O5(OH)4 M
GREENALITE (Fe++,Fe+++)2-3Si2O5(OH)4 M
PARACHRYSOTILE Mg3Si2O5(OH)4 O
CHROMAMESITE Mg2(Al,Cr)(AlSiO5)(OH)4  
CHRYSOTILE Mg3Si2O5(OH)4  
NEOTOCITE (Mn,Fe,Mg)SiO3.H2O am. or M
IMOGOLITE Al2SiO3(OH)4 (?)
ALLOPHANE Al2O3(SiO2)1,3-2.2,5-3(H2O) am.
CHRYSOCOLLA (Cu,Al)2H2Si2O5(OH)4.nH2O M
CHAPMANITE Fe+++2Sb+++(Si2O5)O3(OH) M
BISMUTOFERRITE BiFe+++2(SiO4)2(OH) M
PIANLINITE Al2Si2O6(OH)2 O
CLINOCHRYSOTILE Mg3Si2O5(OH)4 M
Single tetrahedral nets of 6-membered rings connected by octahedral nets or octahedral bands
BEMENTITE Mn8Si6O15(OH)10 M
INNSBRUCKITE Mn++33(Si2O5)14(OH)38 M
BROKENHILLITE (Mn++,Fe++)8(Si6O15)(OH,Cl)10 H
PYROSMALITE-(Fe) (Fe++,Mn++)8Si6O15(OH,Cl)10 H
FRIEDELITE Mn8Si6O15(OH,Cl)10 M ps R
PYROSMALITE-(Mn) (Mn++,Fe++)8Si6O15(OH,Cl)10 H
MCGILLITE (Mn,Fe++)8Si6O15(OH)8Cl2 R
NELENITE (Mn++,Fe++)16Si12As+++3O36(OH)17 R
SCHALLERITE (Mn++,Fe++)16Si12As+++3O36(OH)17 R
WINDMOUNTAINITE []Fe+++2Mg2Si8O20(OH)2.8H2O M
YOFORTIERITE (Mn,Mg)5Si8O20(OH)2.8-9H2O M
PALYGORSKITE (Mg,Al)2Si4O10(OH).4H2O M
TUPERSSUATSIAITE NaFe+++3Si8O20(OH)2.8H2O M
WINDHOEKITE (Ca,Mn++)2Fe+++3(Si8O20)(OH)4.10H2O M
SEPIOLITE Mg4Si6O15(OH)2.6H2O O
LOUGHLINITE Na2Mg3Si6O16.8H2O O
KALIFERSITE (K,Na)5Fe+++7(Si20O50)(OH)6.12H2O A ps O
FALCONDOITE (Ni,Mg)4Si6O15(OH)2.6H2O O
TUNGUSITE Ca14(OH)8(Si8O20)Fe++9(OH)14 A (?)
GYROLITE NaCa16AlSi23O60(OH)8.14H2O A ps H
ORLYMANITE Ca4Mn++3Si8O20(OH)6.2H2O R
KODAMAITE Na3(Ca5Na)Si16O36(OH)4F2.(14-x)H2O (x~5) A
TRUSCOTTITE (Ca,Mn)14Si24O58(OH)8.2H2O H
REYERITE (Na,K)4Ca14Si22Al2O58(OH)8.6H2O R
NATROSILITE Na2Si2O5 M
MAKATITE Na2Si4O8(OH)2.4H2O M
VARENNESITE Na8Mn++2Si10O25(OH,Cl)2.12H2O O
RAITE Na3Mn++3Ti++++0,25[Si4O10(OH)]2.10H2O M
INTERSILITE (Na,K)Na5Mn++(Ti,Nb)[Si10O24(OH)4].4H2O M
SHAFRANOVSKITE K2Na3(Mn,Fe,Na)4[Si9(O,OH)27](OH)2.nH2O (n=2,33) R
ZAKHAROVITE Na4Mn++5Si10O24(OH)6.6H2O R
ZEOPHYLLITE Ca4Si3O8(OH,F)4.2H2O A ps H
MINEHILLITE (K,Na)2-3Ca28(Zn4Al4Si40)O112(OH)16 H
FEDORITE (K,Na)2,5(Ca,Na)7Si16O38(OH,F)2.3,5H2O A
MARTINITE (Na,[],Ca)12Ca4(Si,S,B)14B2O38(OH,Cl)2F2.4H2O A ps H
ELLINGSENITE Na5Ca6Si18O38(OH)13.6H2O A
LALONDEITE (Na,Ca)6(Ca,Na)3Si16O38(F,OH)2.3H2O A
CAIRNCROSSITE Sr2Ca7(Si4O10)(OH)2.15H2O A
Single nets with 6-membered rings, connected by M[4], M[8], etc.
PETALITE LiAlSi4O10 M
SANBORNITE BaSi2O5 O
SEARLESITE NaBSi2O5(OH)2 M
SILINAITE NaLiSi2O5.2H2O M
KANEMITE NaSi2O4(OH).3H2O O
YAKOVENCHUKITE-(Y) K3Na(Ca,Na)Y2(Si12O30).3H2O O
Double nets with 6-membered and larger rings
CYMRITE BaAl2Si2(O,OH)8.H2O M ps O
NAUJAKASITE Na6(Fe++,Mn)Al4Si8O26 M
MANGANONAUJAKASITE Na6(Mn++,Fe++)Al4Si8O26 M
DMISTEINBERGITE CaAl2Si2O8 H
KAMPFITE Ba6[(Si,Al)O2]8(CO3)2Cl2.(Cl,H2O)2 H
STRATLINGITE Ca8Al4(Al4Si4)O8(OH)40.10H2O R
VERTUMNITE Ca2Al[(OH)6AlSiO2-3(OH)4-3].2,5H2O M ps H
GANOPHYLLITE (K,Na)2(Mn,Al,Mg)8(Si,Al)12O29(OH)7.8-9H2O M
EGGLETONITE (Na,K,Ca)2(Mn,Fe)8(Si,Al)12O29(OH)7.11H2O M
TAMAITE (Ca,K,Ba,Na)3-4Mn++24(Si,Al)40(O,OH)112.21H2O M
ZUSSMANITE K(Fe++,Mg,Mn)13(Si,Al)18O42(OH)14 R
COOMBSITE K(Mn++,Fe++,Mg)13(Si,Al)18O42(OH)14 R
STILPNOMELANE K(Fe++,Mg,Fe+++,Al)8(Si,Al)12(O,OH)27.2H2O M/A
PARSETTENSITE (K,Na,Ca)7,5(Mn,Mg)49Si72O168(OH)50.nH2O M ps H
LENNILENAPEITE K6-7(Mg,Mn,Fe++,Fe+++,Zn)48(Si,Al)72(O,OH)216.16H2O A
FRANKLINPHILITE (K,Na)4(Mn++,Mg,Zn,Fe+++)48(Si,Al)72(O,OH)216.6H2O A ps H
CHALCODITE   A
LEVANTITE KCa3(Al2Si3)O11(PO4) M
LATIUMITE (Ca,K)8(Al,Mg,Fe)(Si,Al)10O25(SO4) M
TUSCANITE K(Ca,Na)6(Si,Al)10O22(SO4,CO3,(OH)2).H2O M
JAGOITE Pb3Fe+++Si4O12(Cl,OH) H
WICKENBURGITE Pb3CaAl2Si10O27.3H2O R
HYTTSJOITE Pb18Ba2Ca5Mn++2Fe+++2Si30O90Cl.6H2O R
ARMBRUSTERITE K5Na7Mn15(Si9O22)4(OH)10.4H2O M
BRITVINITE Pb8Mg9[Si10O30(OH)8(CO3)3].H2O A
ROYMILLERITE Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 A
BANNISTERITE KCa(Mn,Fe++,Zn)21(Si,Al)32O76(OH)16.12H2O M
Transitional structures between phyllosilicate and other silicate units
MAGNESIONEPTUNITE KNa2Li(Mg,Fe++)2Ti2Si8O24 M
MANGANONEPTUNITE KNa2Li(Mn,Fe++)2Ti2Si8O24 M
NEPTUNITE KNa2Li(Fe++,Mn)2Ti2Si8O24 M
WATATSUMIITE KNa2LiMn++2V++++2Si8O24 M
GRUMANTITE NaHSi2O5.H2O O
SARCOLITE Na4Ca12Al8Si12O46(SiO4,PO4)(OH,H2O)4(CO3,Cl) Q
USSINGITE Na2AlSi3O8(OH) A
TELYUSHENKOITE (Cs,Na,K)Na6Be2Al3Si15O39F2 R
LEIFITE Na2(Si,Al,Be)7(O,OH,F)14 R
EIRIKITE KNa6Be2Al3Si15O39F2 R
NAFERTISITE Na3Fe++10Ti2(Si6O17)2O2(OH)6F(H2O)2 M
VEBLENITE KNa(Fe++5Fe+++4Mn7)Nb4(Si2O7)2(Si8O22)2O6(OH)10(H2O)3 A
Unclassified phyllosilicates
LOURENSWALSITE (K,Ba)2(Ti,Mg,Ca,Fe)4(Si,Al,Fe)6O14(OH)12 H
MIDDENDORFITE K3Na2Mn5Si12(O,OH)36.2H2O M
LIPUITE KNa8Mn+++5Mg0,5[Si12O30(OH)4](PO4)O2(OH)2.4H2O O
ODIGITRIAITE CsNa5Ca5[Si14B2O38]F2 M
Tektosilicates without zeolitic H2O
Tektosilicates without additional non-tetrahedral anions
NEPHELINE Na3K(Al4Si4O16) H
YOSHIOKAITE Ca(Al,Si)2O4 H
PANUNZITE (K,Na)AlSiO4 H
MEGAKALSILITE KAlSiO4 H
KALSILITE KAlSiO4 H
KALIOPHILITE KAlSiO4 H
TRIKALSILITE (K,Na)AlSiO4 H
TRINEPHELINE NaAlSiO4 H
DAVIDSMITHITE (Ca,[])2Na6Al8Si8O32 H
CARNEGIEITE NaAlSiO4 A
MALINKOITE NaBSiO4 H
VIRGILITE LixAlxSi3-xO6 H
LISITSYNITE KBSi2O6 O
BUDDINGTONITE (NH4)AlSi3O8 M
SANIDINE (K,Na)(Si,Al)3O8 M
FERRISANIDINE K[Fe+++Si3O8] M
RUBICLINE (Rb,K)AlSi3O8 A
ORTHOCLASE KAlSi3O8 M
MICROCLINE KAlSi3O8 A
HYALOPHANE (K,Ba)Al(Si,Al)3O8 M
CELSIAN BaAl2Si2O8 M
REEDMERGNERITE NaBSi3O8 A
ANORTHITE CaAl2Si2O8 A
ALBITE NaAlSi3O8 A
ANORTHOCLASE (Na,K)AlSi3O8 A
MONALBITE NaAlSiO4 M
LABRADORITE (a variety of anorthite) (Ca,Na)[Al(Al,Si)Si2O8] A
ANDESINE (Na,Ca)[Al(Si,Al)Si2O8] A
BYTOWNITE (a variety of anorthite) (Ca,Na)[Al(Al,Si)Si2O8] A
OLIGOCLASE (Na,Ca)[Al(Si,Al)Si2O8] A
PARACELSIAN BaAl2Si2O8 M
KUMDYKOLITE NaAlSi3O8 O
SVYATOSLAVITE CaAl2Si2O8 O
SLAWSONITE (Sr,Ca)Al2Si2O8 M
LISETITE Na2CaAl4Si4O16 O
BANALSITE BaNa2Al4Si4O16 O
STRONALSITE SrNa2Al4Si4O16 O
PEKOVITE SrBi2Si2O8 O
MALEEVITE BaBi2Si2O8 O
DANBURITE CaB2(SiO4)2 O
LINGUNITE NaAlSi3O8 Q
STOFFLERITE CaAl2Si2O8 Q
LIEBERMANNITE KAlSi3O8 Q
KOKCHETAVITE KAlSi3O8 H
HEXACELSIAN BaAl2Si2O8 H
WODEGONGJIEITE KCa3(Al7Si9)O32 H
Tektosilicates with additional anions
DEPMEIERITE Na8[Al6Si6O24](PO4,CO3)1-x.3H2O (x smaller than 0,5) H
FANTAPPIEITE [Na82.5Ca33K16.5](Si99Al99O396)(SO4)33.6H2O R
FARNESEITE [(Na,K)46Ca10](Si42Al42O168)(SO4)12.6H2O H
FRANZINITE (Na,K)6Ca2(SO4)2Al6Si6O24.0,5H2O H
GIUSEPPETTITE (Na,K,Ca)7-8(Si,Al)12O24(SO4,Cl)1-2 H
HYDROXYCANCRINITE Na8Al6Si6O24(OH)2.2H2O H
LIOTTITE (Ca,Na,K)8(Si,Al)12O24[(SO4),(CO3),Cl,OH]4.H2O H
KYANOXALITE Na7(Al5-6Si6-7O24)(C2O4)0,5-1.5H2O H
MARINELLITE (Na,K,Ca)48(SO4)8(Al6Si6O24)6Cl2.3H2O H
VISHNEVITE (Na,Ca,K)6(Si,Al)12O24[(SO4),(CO3),Cl2]2-4.nH2O H
DAVYNE (Na,Ca,K)8Al6Si6O24(Cl,SO4,CO3)2-3 H
SACROFANITE (Na,Ca,K)9(Si,Al)12O24[(OH)2,(SO4),(CO3),Cl2)]3.nH2O H
QUADRIDAVYNE [(Na,K)6Cl2](Ca2Cl2)Al6Si6O24 H
PITIGLIANOITE K2Na6Si6Al6O24(SO4).2H2O H
MICROSOMMITE (Na,Ca,K)7-8(Si,Al)12O24(Cl,SO4,CO3)2-3 H
KIRCHERITE [Na90Ca36K18]sigma=144(Si108Al108O432)(SO4)36.6H2O R ps H
TOUNKITE (Na,Ca,K)8Al6Si6O24(SO4)2Cl.H2O H
CARBOBYSTRITE Na8[Al6Si6O24](CO3).4H2O R
AFGHANITE (Na,Ca,K)8(Si,Al)12O24(SO4,Cl,CO3)3.H2O H
ALLORIITE (Na,Ca,K)13Ca2(Al6Si6O24)2(SO4)3Cl2.2H2O R ps H
BALLIRANOITE (Na,K)6Ca2(Si6Al6O24)Cl2(CO3) H
BIACHELLAITE (Na,Ca,K)8Al6Si6O24(SO4)2(OH)0,5.H2O R
BYSTRITE Ca(Na,K)7Si6Al6O24(S--)1,5.H2O R
CANCRINITE Na6Ca2Al6Si6O24(CO3)2 H
CANCRISILITE Na7Al5Si7O24(CO3).3H2O H
SULFHYDRYLBYSTRITE Na5K2Ca[Al6Si6O24](S5)2(SH) R
TSAREGORODTSEVITE N(CH3)4[Si2(Si0,5Al0,5)O6]2 O ps C
GENTHELVITE Zn4Be3(SiO4)3S C
SODALITE Na8Al6Si6O24Cl2 C
NOSEAN Na8Al6Si6O24(SO4).H2O C
LAZURITE Na7Ca(Al6Si6O24)(SO4)(S3).H2O C M A
KAMAISHILITE Ca2Al2SiO6(OH)2 Q
HELVINE Mn4Be3(SiO4)3S C
HAUYNE (Na,Ca,K)8-4(SO4)2-1(AlSiO4)6 C
TUGTUPITE Na4AlBeSi4O12Cl Q
BICCHULITE Ca2Al2SiO6(OH)2 C
VLADIMIRIVANOVITE Na6Ca2[Al6Si6O24](SO4,S3,S2,Cl)2.H2O O
DANALITE Fe++4Be3(SiO4)3S C
MEIONITE Ca4Al6Si6O24(CO3,SO4) Q
SILVIALITE Ca4Al6Si6O24(SO4) Q
MARIALITE Na4Al3Si9O24Cl Q
SCAPOLITE = MARIALITE-MEIONITE    
SULFHYDRYLBISTRITE Na5K2Ca[Al6Si6O24](S5)2(SH) R
STEUDELITE Na3[](K17Ca7)Ca4(Al24Si24O96)(SO3)6F6.4H2O H
BOLOTINAITE (Na7[])(Al6Si6O24)F.4H2O C
SLYUDYANKAITE Na28Ca4(Si24Al24O96)(SO4)6(S6)0,33(CO2).2H2O A
SAPOZHNIKOVITE Na8(Al6Si6O24)(HS)2 C
BETZITE Na6Ca2(Al6Si6O24)Cl4 H
Tektosilicates with zeolitic H2O; zeolite family
Zeolites with T5O10 Units - The Fibrous Zeolites
SCOLECITE Ca[Al2Si3O10].3H2O M
PARANATROLITE Na2[Al2Si3O10].3H2O M ps O
NATROLITE Na2[Al2Si3O10].2H2O O
MESOLITE Na16Ca16[Al48Si72O240].64H2O O
GONNARDITE (Na,Ca)6-8[(Al,Si)20O40].12H2O O
THOMSONITE-Ca Ca2Na[Al5Si5O20].6H2O O
THOMSONITE-Sr (Sr,Ca)2Na[Al5Si5O20].6-7H2O O
KALBORSITE K6[Al4Si6O20]B(OH)4Cl Q
EDINGTONITE Ba[Al2Si3O10].4H2O O/Q
TETRANATROLITE = GONNARDITE (?) (Na,Ca)16[Al19Si21O80].16H2O (?) Q
Chains of single connected 4-membered rings
LEUCITE K[AlSi2O6] Q
LITHOSITE K6Al4Si8O25.2H2O M ps O
ANALCIME Na[AlSi2O6].H2O C Q O M
KIRCHHOFFITE CsBSi2O6 Q
HSIANGHUALITE Li2Ca3[Be3Si3O12]F2 C
AMMONIOLEUCITE (NH4)[AlSi2O6] Q
FABRIESITE Na3Al3Si3O12.2H2O O
POLLUCITE (Cs,Na)[AlSi2O6].nH2O (Cs+n=1) C
WAIRAKITE Ca[Al2Si4O12].2H2O M/Q
LAUMONTITE Ca4[Al8Si16O48].18H2O M
YUGAWARALITE Ca[Al2Si6O16].4H2O M
ROGGIANITE Ca2[Be(OH)2Al2Si4O13].2,5H2O Q
GOOSECREEKITE Ca[Al2Si6O16].5H2O M
MONTESOMMAITE K9[Al9Si23O64].10H2O O ps Q
PARTHEITE Ca2[Al4Si4O15(OH)2].4H2O M
Chains of doubly-connected 4-membered rings
GISMONDINE-Sr Sr4(Si8Al8O32).9H2O M
AMICITE K4Na4[Al8Si8O32].10H2O M
GARRONITE-Ca Ca3(Al6Si10O32).14H2O Q
GISMONDINE-Ca CaAl2Si2O8.4H2O M
GISMONDINE-Ba Ba2Al4Si4O16.4-6H2O M
GOBBINSITE Na5[Al5Si11O32].12H2O O ps Q
MARTINANDRESITE Ba2(Al4Si12O32).10H2O O
FLORKEITE K3NaCa2(Al8Si8O32) A ps M
PHILLIPSITE-Na (Na,K,Ca0,5,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M
PHILLIPSITE-K (K,Na,Ca0,5,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M
HARMOTOME Ba2(Ca0,5,Na)Al6Si10O32.12H2O M
PHILLIPSITE-Ca (Ca0,5,K,Na,Ba0,5)4-7[Al4-7Si12-9O32].12H2O M ps O
MERLINOITE K5Ca2[Al9Si23O64].22H2O O
MAZZITE-Mg (Mg2,5K2Ca1,5)[Al10Si26O72].30H2O H
MAZZITE-Na Na4[Al4Si14O36].15H2O H
PERLIALITE K9Na(Ca,Sr)[Al12Si24O72].15H2O H
BOGGSITE Ca8Na3[Al19Si77O192].70H2O O
PAULINGITE-K (K,Ca0,5,Na)10[Al10Si32O84].27-44H2O C
PAULINGITE-Na (Na2,K2,Ca,Ba)5[Al10Si35O90].45H2O C
PAULINGITE-Ca (Ca0,5,K,Na)10[Al10Si32O84].27-44H2O C
Chains of 6-membered rings - tabular zeolites
GMELINITE-Ca (Ca0,5,Sr0,5,Na,K)4[Al8Si16O48].22H2O H
GMELINITE-Na (Na,K,Ca0,5)4[Al8Si16O48].22H2O H
GMELINITE-K (K,Na,Ca)6[Al7Si17O48].22H2O H
CHABAZITE-Sr (Sr,Ca)[Al2Si4O12].6H2O R
WILLHENDERSONITE K0-1Ca1,5-1[Al3Si3O12].5H2O A
CHABAZITE-Mg Mg0,7K0,5Ca0,5Na0,1)[Al3Si9O24].10H2O R
CHABAZITE-K (K,Na,Ca0,5)4[Al4Si8O24].12H2O R
CHABAZITE-Ca (Ca0,5,K,Na)4[Al4Si8O24].12H2O R ps H/A
CHABAZITE-Na (Na,K,Ca0,5)4[Al4Si8O24].12H2O R
LEVYNE-Ca (Ca0,5,Na,K)6[Al6Si12O36].17H2O R
LEVYNE-Na (Na,Ca0,5,K)6[Al6Si12O36].17H2O R
ERIONITE-Na (Na,K,Ca0,5)10[Al10Si26O72].30H2O H
BELLBERGITE (K,Ba,Sr)2Sr2Ca2(Ca,Na)4[Al18Si18O72].30H2O H
ERIONITE-Ca (Ca0,5,K,Na)10[Al10Si26O72].30H2O H
ERIONITE-K (K,Na,Ca0,5)10[Al10Si26O72].30H2O H
OFFRETITE CaKMg[Al5Si13O36].16H2O H
WENKITE Ba4Ca6(Si,Al)20O41(OH)2(SO4)3.H2O H
FAUJASITE-Na (Na,Ca0,5,Mg0,5,K)3-4[Al3-4Si9-8O24].16H2O C
FAUJASITE-Mg (Mg0,5,Ca0,5,Na,K)3-4[Al3-4Si9-8O24].16H2O C
FAUJASITE-Ca (Ca0,5,Na,Mg0,5,K)3-4[Al3-4Si9-8O24].16H2O C
MARICOPAITE (Pb7Ca2)[Al12Si36(O,OH)100].n(H2O,OH) (n=near 32) O
MORDENITE (Na2,Ca,K2)4[Al8Si40O96].28H2O O
DACHIARDITE-Ca (Ca0,5,K,Na)4-5[Al4-5Si20-19O48].12-13H2O M
DACHIARDITE-Na (Na,K,Ca0,5)4-5[Al4-5Si20-19O48].12-13H2O M
DACHIARDITE-K K4(Si20Al4O48).13H2O M
EPISTILBITE (Ca,Na2)[Al2Si6O16].5H2O M/A
FERRIERITE-NH4 (NH4,Mg0,5)5(Al5Si31O72).22H2O O
FERRIERITE-Mg (Mg0,5,K,Na,Ca0,5)6[Al6Si30O72].18H2O O
FERRIERITE-K (K,Na,Mg0,5,Ca0,5)6[Al6Si30O72].18H2O O
FERRIERITE-Na (Na,K,Mg0,5,Ca0,5)6[Al6Si30O72].18H2O M
BIKITAITE Li[AlSi2O6].H2O M/A
Chains of T10O20 Tetrahedra
HEULANDITE-Na (Na,Ca0,5,K)9[Al9Si27O72].24H2O M
CLINOPTILOLITE-K (K,Na)6[Al6Si30O72].20H2O M
CLINOPTILOLITE-Na (Na,K,Ca0,5)6[Al6Si30O72].20H2O M
HEULANDITE-Sr (Sr0,5,Ca0,5,Na,K)9[Al9Si27O72].24H2O M
HEULANDITE-Ba (Ba,Ca,Sr,K,Na)5Al9Si27O72.22H2O M
CLINOPTILOLITE-Ca (Ca0,5,Na,K)6[Al6Si30O72].20H2O M
HEULANDITE-Ca (Ca0,5,Na,K)9[Al9Si27O72].24H2O M
HEULANDITE-K (K,Ca0,5,Na,Mg0,5,Sr0,5)9[Al9Si27O72].24H2O M
STILBITE-Ca (Ca0,5,Na,K)9[Al9Si27O72].28H2O M
STILBITE-Na (Na,Ca0,5,K)9[Al9Si27O72].28H2O M
BARRERITE Na2[Al2Si7O18].6H2O O
STELLERITE Ca[Al2Si7O18].7H2O O
BREWSTERITE-Sr (Sr,Ba)2[Al4Si12O32].10H2O M/A
BREWSTERITE-Ba (Ba,Sr)2[Al4Si12O32].10H2O M
Other Rare Zeolites
TERRANOVAITE NaCa[Al3Si17O40].7H2O O
GOTTARDIITE Na3Mg3Ca5[Al19Si117O272].93H2O O ps H
LOVDARITE K4Na12[Be8Si28O72].18H2O O
GAULTITE Na4[Zn2Si7O18].5H2O O
FERROCHIAVENNITE Ca1-2FeSi5Be2O13(OH)2.2H2O M ps H
CHIAVENNITE CaMnBeSi5O13(OH)2.2H2O O
TSCHERNICHITE Ca[Al2Si6O16].8H2O Q
MUTINAITE Na3Ca4[Al11Si85O192].60H2O O
TSCHORTNERITE Ca4(K,Ca,Sr,Ba)3Cu3(OH)8(Si12Al12O48).nH2O (n more than 20) C
THORNASITE Na12Th3(Si8O19)4.18H2O R
DIRENZOITE K6Na(Ca,Mg)3(Si,Al)60O120.36H2O O
MEIERITE Ba44Si66Al30O192Cl25(OH)33 C
RONGIBBSITE Pb2(Si4Al)O11(OH) M
Unclassified zeolites
COWLESITE Ca[Al2Si3O10].5,3H2O O
MOUNTAINITE Ca8Si6O19(OH).6H2O M
Unclassified silicates
With Alkali and Alkali-earth Elements
ERTIXIITE Na2Si4O9 C
KENYAITE Na2Si22O41(OH)8.6H2O M
WAWAYANDAITE Ca12Mn++4B2Be18Si12O46(OH,Cl)30 M
MAGBASITE KBaFe+++Mg7Si8O22(OH)2F6 O
AFANASYEVAITE Ca8[Si2O7]OCl2  
DEMAGISTRISITE BaCa2Mn+++4(Si3O10)(Si2O7)(OH)4.3H2O O
DONWILHELMSITE CaAl4Si2O11 H
IGUMNOVITE Ca3Al2(SiO4)2Cl4 C
KASATKINITE Ba2Ca8B5Si8O32(OH)3.6H2O M
PAQUEITE Ca3TiSi2(Al,Ti,Si)3O14 R
RIPPITE K2(Nb,Ti)2(Si4O12)O(O,F) Q
ZAGAMIITE CaAl2Si3,5O11 H
RUDENKOITE Sr3Al3(Si,Al)4O10(OH,O)8Cl2.H2O M
alfa-CARNEGIEITE NaAlSiO4 C
ATHERIASTITE Ca5MgFeAl6Si8O32.5H2O (?)  
BALVRAIDITE    
FOSHALLASITE Ca3Si2O7.3H2O (?) M
BHRECKITE    
BRAVAISITE    
NAGELSCHMIDTITE Ca7(SiO4)2(PO4)2 H
CARYOCHROITE (Na,Sr,Ca,Mn,K)3(Fe+++,Mg,Mn,Fe++)10Ti2Si12O37(H2O,O,OH)17 M
JUANITE Ca10Mg4Al2Si11O39.4H2O (?) O (?)
TACHARANITE Ca12Al2Si18O51.18H2O M
OYELITE Ca10B2Si8O29.12H2O O
DENISOVITE (K,Na)Ca2Si3O8(F,OH) M
TIETTAITE K4Na12Fe+++2Si16O41(OH)4.2H2O O
QELTITE Ca3TiSi2(Fe+++2Si)O14 R
With Ti, V, Cr
ILMAJOKITE-(Ce) Na11KBaCe2Ti12Si37,5O94(OH)30.29H2O M
RILANDITE (Cr+++,Al)6SiO11.5H2O (?) (?)
WAIPOUAITE Ca3V++++5O9[Si2O5(OH)2][Si3O7(OH)2].11H2O M
With Mn, Fe
ERLIANITE (Fe++,Fe+++,Mg)24(Fe+++V)6Si36O90(OH,O)48 O
BOSTWICKITE CaMn+++6Si3O16.7H2O O
ALLOPHITE Mg8Al4Si5O24.H2O  
ALMBOSITE Fe++5Fe+++4V+++++4Si3O27 (?)
AQUACREPTITE    
FARALLONITE    
HOKOITE Mn++Mn+++2SiO6.H2O  
POLYHYDRITE   am
With Co, Ni
With Cu, Zn
GILALITE Cu++5Si6O17.7H2O M
APACHITE Cu9Si10O29.11H2O M
With Nb, Ta, Zr
MONGOLITE Ca4Nb6Si5O24(OH)10.5-6H2O Q
LOUDOUNITE NaCa5Zr4Si16O40(OH)11.8H2O (?)
With REE, Th
UMBOZERITE Na3Sr4ThSi8(O,OH)24 am.
MENDELEEVITE-(Nd) Cs6[(Nd,REE)23Ca7](Si70O175)(OH,F)19(H2O)16 C
MENDELEEVITE-(Ce) (Cs6[]6)([]10K2)(REE22Ca6)(Si70O175)(OH,F)16(H2O)19 C
ROWLANDITE-(Y) Y4Fe++Si4O14F2 am.
With Pb
MACQUARTITE Pb3Cu++(CrO4)SiO3(OH)4.2H2O M
LUDDENITE Pb2Cu2Si5O14.14H2O M
CREASEYITE Pb2Cu2Fe+++2Si5O17.6H2O O
PLUMBOTSUMITE Pb5Si4O8(OH)10 O
MOLYBDOPHYLLITE Pb8Mg9[Si10O30(OH)8(CO3)3].H2O R
Germanates
Silicates, etc. unclassified
ATELISITE-(Y) Y4Si3O8(OH)8 Q
BRIDGMANITE MgSiO3 O
FERRISEPIOLITE (Fe+++,Fe++,Mg)4(Si,Fe+++)6O15(O,OH)2.6H2O O
CRYPTOPHYLLITE K2Ca[Si4O10].5H2O M
COLINOWENSITE BaCuSi2O6 Q
MENDIGITE Mn2Mn2MnCa(Si3O9)2 A
CAYALSITE-(Y) CaY6Al2Si4O18F6 O
BURNETTITE CaVAlSiO6 M
ALFLARSENITE Ca7(SiO4)3(OH)2 M
OTJISUMEITE PbGe4O9 A ps H
LAVINSKYITE-2O K(LiCu)Cu6(Si4O11)2(OH)4 O
AKLIMAITE Ca4[Si2O5(OH)2](OH,F)4.5H2O M
BARTELKEITE PbFeGe3O7(OH)2.H2O M
LAVOISIERITE Mn++8[Al10(Mn+++Mg)][Si11P]O44(OH)12 O
PLUMALSITE Pb4Al2(SiO3)7 (?) O
SPODIOPHYLLITE (Na,K)4(Mg,Fe++)3(Fe+++,Al)2(Si8O24) M (?)
YEGOROVITE Na4[Si2O4(OH)2]2.7H2O M
GARNIERITE = HYDROUS NICKEL SILICATES    
CARBOIRITE Fe++Al2GeO5(OH)2 A
* ORGANIC COMPOUNDS
Salts of organic acids
Formates, Acetates, etc.
FORMICAITE Ca(HCO2)2 Q
DASHKOVAITE Mg(HCO3)2.2H2O M
ACETAMIDE CH3CONH2 R
CALCLACITE Ca(CH3COO)Cl.5H2O M/A
PACEITE CaCu(CH3COO)4.6H2O Q
HOGANITE Cu(CH3COO)2.H2O M
LAZARASKEITE Cu(C2H3O3)2 M
MARCHETTIITE C5H7N5O3 A
Oxalates
LINDBERGITE Mn(C2O4).2H2O M
KATSAROSITE Zn(C2O4).2H2O M
HUMBOLDTINE Fe++(C2O4).2H2O M
GLUSHINSKITE Mg(C2O4).2H2O M
MOOLOOITE Cu++(C2O4).nH2O O
STEPANOVITE NaMgFe+++(C2O4)3.8-9H2O R
MINGUZZITE K3Fe+++(C2O4)3.3H2O M
WHEATLEYITE Na2Cu(C2O4)2.2H2O A
ZHEMCHUZHNIKOVITE NaMg(Al,Fe+++)(C2O4)3.8H2O R
WEDDELLITE Ca(C2O4).2H2O Q
WHEWELLITE Ca(C2O4).H2O M
FIEMMEITE Cu2(C2O4)(OH)2.2H2O M
MIDDLEBACKITE Cu2C2O4(OH)2 M
CAOXITE Ca(C2O4).3H2O A
METAUROXITE (UO2)2(C2O4)(OH)2(H2O)2 R
OXAMMITE (NH4)2(C2O4).H2O O
PHOXITE (NH4)2Mg2(C2O4)(PO3OH)2(H2O)4 M
NATROXALATE Na2C2O4 M
COSKRENITE-(Ce) (Ce,Nd,La)2(SO4)2(C2O4).8H2O A
LEVINSONITE-(Y) (Y,Nd,Ce)Al(SO4)2(C2O4).12H2O M
ZUGSHUNSTITE-(Ce) (Ce,Nd,La)Al(SO4)2(C2O4).12H2O M
NOVGORODOVAITE Ca2(C2O4)Cl2.2H2O M
UROXITE [(UO2)2(C2O4)(OH)2(H2O)2].H2O M
DEVEROITE-(Ce) (Ce,Nd,La)2(C2O4)3.10H2O M
FALOTTAITE Mn(C2O4).3H2O O
Benzine Salts
MELLITE Al2[C6(COO)6].16H2O Q
EARLANDITE Ca3[C(OH)(CH2)2(COO)3]2.4H2O M
PIGOTITE Al4C6H5O10.13H2O (?)  
Cyanates
JULIENITE Na2Co++(SCN)4.8H2O Q
KAFEHYDROCYANITE K4Fe++(CN)6.3H2O Q (?)
Hydrocarbons
Hydrocarbons
FICHTELITE C19H34 M
BRANCHITE C20H34 A
HARTITE = BRANCHITE C20H34 A
DINITE C20H36 O
IDRIALITE C22H14 O
KRATOCHVILITE (C6H4)2CH2 O
CARPATHITE C24H12 M
PHYLLORETINE C18H18 O
RAVATITE C14H10 O
SIMONELLITE C19H24 O
EVENKITE CxH2x+2 (x=19 to 28) O
WAMPENITE C18H16 M
FREITALITE C14H10 M
Miscellaneous Organic Minerals
Miscellaneous Organic Minerals
REFIKITE C19H31COOH O
FLAGSTAFFITE C10H22O3 O
HOELITE (C6H4)2(CO)2 O
ABELSONITE C31H32N4Ni A
KLADNOITE C6H4(CO)2NH M
GUANINE C5H3(NH2)N4O M
UREA CO(NH2)2 Q
URICITE C5H4N4O3 M
CHANABAYAITE CuCl(N3C2H2)(NH3).0,25H2O O
TRIAZOLITE NaCu2(N3C2H2)2(NH3)2Cl3.4H2O O
ERNSTBURKEITE Mg[CH3SO3]2.12H2O R
JOANNEUMITE Cu(C3N3O3H2)2(NH3)2 A
TINNUNCULITE C5H4N4O3.2H2O M
BOJARITE Cu3(N3C2H2)3(OH)Cl2.6H2O C
DOPPLERITE   am.
NATROSULFATOUREA Na2(SO4)[CO(NH2)2] O
ALLANTOIN C4H6N4O3 M
THOLINS (C,H,N)  
Organic minerals unclassified
RHYTHMITE Ca4(SiO4)2.3CaCl2 O
SCHARIZERITE    
ANTIPINITE KNa3Cu2(C2O4)4 A
AMBER [C,H,O] am.
* OTHER MINERAL NAMES
BRONZE = Stanniferous Copper (Cu,Sn)  
CARBORUNDUM = Synthetic MOISSANITE    
LANDSBERGITE = MOSCHELLANDSBERGITE    
FER CARBURE = COHENITE    
FER = IRON    
KUPFER = COPPER    
PLUMBUM NIGRUM = LEAD    
LAITON = BRASS    
PLUMBAGO = GRAPHITE    
KUSUITE = PLOMBOAN WAKEFIELDITE-(Ce)    
KUSTELITE = AUROAN SILVER (Ag,Au) C
PLOMBAGINE = GRAPHITE    
KONGSBERGITE = SILVER-MERCURY amalgam    
PLUMBUM CANDIDUM = TIN    
MERCURE = MERCURY Hg R
NEWJANSKITE = OSMIUM IRIDIAN (Os,Ir)  
SULFUR = SULPHUR    
NEVYANSKITE = iridian OSMIUM    
OR = GOLD    
IRITE = Mixture Chromite, Ir, Os, Rutheniridosmine, Platinum, etc.    
DIAMANT = DIAMOND    
SYSSERTSKITE = OSMIUM with Ir (Os,Ir) H
DIAMANT DE MIRABEAU = QUARTZ    
CARBONADO = BLACK DIAMOND    
MINE DE PLOMB = GRAPHITE    
MESSING = BRASS    
SYSERSKITE = SISERSKITE = iridian OSMIUM    
OURO PRETO = oxygenated Pt, Pd, Au, Cu, Fe, Mn compounds    
SCHERBENKOBALT = ARSENIC    
EISEN = IRON    
ALTMARKITE = artificial LEADAMALGAM (?) HgPb2 Q
ALUMINUM = ALUMINIUM    
ELECTRUM = GOLD with Ag (Au,Ag) C
AMALGAM = SILVER with Hg Ag,Hg C
LUOBOSAITE = LUOBUSAITE Fe3Si7 O
ETAIN = TIN    
SOUFRE = SULPHUR    
PLATINIRIDIUM = IRIDIUM PLATINIAN (Ir,Pt) C
CUIVRE = COPPER    
PLESSITE = KAMACITE-TAENITE    
PLOMB = LEAD    
OSMIRIDIUM = IRIDIUM OSMIAN (Ir,Os) C
SHEPARDITE (of Haidinger) = SCHREIBERSITE (Fe,Ni)3P Q
ISOPLATINOCOPPER = PLATINIAN COPPER or HONGSHIITE    
SCHWEFEL = SULPHUR    
RUTHENOSMIRIDIUM = IRIDIUM OSMIAN RUTHENIAN (Ir,Os,Ru)  
IRIDRHODRUTHENIUM = RUTHENIUM Ru6,38Rh1,7Ir1,2Pt0,68Os0,04  
FERSILICITE = NAQUITE FeSi C
IRIDOSMINE = OSMIUM IRIDIAN (Os,Ir) H
ROZHKOVITE = PALLADIAN AURICUPRIDE    
NICKELIRON = KAMACITE, TAENITE, TETRATAENITE (Fe,Ni)  
SEIFENGOLD = Placer GOLD    
IRIDOSMIUM = OSMIUM IRIDIAN (Os,Ir) H
IKOSAEDRITE = ICOSAHEDRITE    
RHABDITE = SCHREIBERSITE    
BLEI = LEAD    
WOLFRAM = TUNGSTEN W C
BLEIAMALGAM = LEADAMALGAM    
ARGENT = SILVER    
SELENSULPHUR = SULPHUR    
SELENTELLURIUM = SELENIUM + TELLURIUM (Se,Te) R
WISMUT = BISMUTH    
BORT = DIAMOND    
FERDISILICITE (beta) = LINZHIITE FeSi2 O
SILICIUM = SILICON Si C
ARGENTAL = MOSCHELLANDSBERGITE    
JOSEPHINITE = AWARUITE, KAMACITE, TAENITE, TETRATAENITE    
SISERSKITE = iridian OSMIUM    
QUECKSILBER = MERCURY Hg R
FERDISILICITE (alpha) = LINZHIITE FeSi2 Q
ZINN = TIN    
SATURNUS = LEAD    
CLIFTONITE = GRAPHITE C  
JEDVABITE = JEDWABITE Fe7(Ta,Nb)3 H
ARSENOSULVANITE = COLUSITE Cu3(As,V)S4 C
QUIROGUITE = A GALENA ? Pb23Sb6S32 (?)  
CLEIOPHANE = a SPHALERITE variety    
CLEOPHANE = CLEIOPHANE    
PLUMBOSTANNITE = a mixture? Pb2Fe2Sn2Sb2S11  
ANDORITE = ANDORITE IV or ANDORITE VI    
NICKELPYRIT = BRAVOITE = NICKELOAN PYRITE (Fe,Ni,Co)S2 C
ROTHNICKELKIES = NICKELINE    
SAUKOVITE = CADMIAN METACINNABAR (Hg,Cd)S  
ROTHGULTIGERZ = PYRARGYRITE or PROUSTITE    
SCHALENBLENDE = SPHALERITE + WURTZITE    
PANABASE = TETRAHEDRITE    
PATRINITE = AIKINITE    
PENGINITE = PENZHINITE    
CUIVRE VITREUX = CHALCOCITE    
PARAJAMESONITE = Mixture JAMESONITE, TETRAHEDRITE, RAMDOHRITE Pb4FeSb6S14 (?) M
ROTHORKE = A ferric hydroxyde    
RUBY SILVER = PROUSTITE, PYRARGYRITE    
CLINOEULITE = MAGNESIAN CLINOFERROSILITE    
ROTHSPIESGLASERZ = KERMESITE    
ROTNICKELKIES = NICKELINE    
DAYINGITE = COBALTOAN MALANITE (Cu,Co)(Pt,Ir)2S4 C
DANAITE = COBALTOAN ARSENOPYRITE (Fe,Co)AsS  
ROTSPIESSGLANZ = KERMESITE    
ONOFRITE = SELENIAN METACINNABAR Hg(S,Se)  
CUIVRE SPICIFORME = CHALCOCITE    
OR GRAPHIQUE = SYLVANITE    
ROTHSPIESGLANZERZ = KERMESITE    
PRASSOITE = MIASSITE   C
PLINIAN = ARSENOPYRITE    
PLOMB ANTIMONIE SULFURE = BOULANGERITE    
LAZAREVICITE = ARSENOSULVANITE    
COCINERITE = Mixture CHALCOCITE + SILVER    
QUECKSILBERFAHLERZ = SCHWATZITE = MERCURIAN TETRAHEDRITE    
PYRRHOTINE = PYRRHOTITE Fe1-xS (x=0-0,17) M/H
PIRITA AMARILLA = PYRITE    
CORYNITE = ANTIMONIAN GERSDORFFITE Ni(As,Sb)S  
REZBANYITE = Mixture Pb3Cu2Bi10S19 O
P-OURAYITE = OURAYITE-P    
PLUMOSITE = BOULANGERITE Pb2Sb2S5 M (?)
PLUMOSITE = BOULANGERITE (?)    
COVELLINE = COVELLITE    
POLIANITE = PYROLUSITE    
POLYTELITE = FREIBERGITE    
CSIKLOVAITE = TETRADYMITE + GALENOBISMUTHITE + BISMUTHINITE Bi2Te(S,Se)2 R
COCKSCOMB PYRITES = MARCASITE    
COBALTNICKELPYRITE = VAIIETY OF BRAVOITE = NICKELOAN PYRITE (Fe,Ni,Co)S2 C
CUIVRE PYRITEUX HEPATIQUE = BORNITE    
ROTHGILTIGERZ = PYRARGYRITE or PROUSTITE    
CUIVRE PYRITEUX = CHALCOPYRITE    
ROTHES SPIESGLASERZ = KERMESITE    
CUIVRE PANACHE = BORNITE    
CUIVRE JAUNE = CHALCOPYRITE    
ROTHES SPIESGLAS = KERMESITE    
RATHITE-II = LIVEINGITE    
ROSAGRAUER KUPFERGLANZ = CHALCOCITE or DIGENITE    
PLATYNITE = mixture LAITAKARITE and GALENA (Bi,Pb)3(Se,S)4 R
RHOMBISCHER KUPFERGLANZ = CHALCOCITE    
PIRITA BLANCA = MARCASITE    
PIRITA MAGNETICA = PYRRHOTITE    
COBALTOAN GERSDORFFITE = GERSDORFFITE (Ni,Co)AsS  
CUIVRE GRIS = FAHLORE = TETRAHEDRITE-TENNANTITE    
CUIVRE ARSENICAL = DOMEYKITE    
CUIVRE SELENIE = BERZELIANITE    
RADELERZ = BOURNONITE    
ARIZONITE = mixture    
KALLLILITE = ULLMANNITE    
BADENITE = BISMUTH + SAFFLORITE + MODDERITE (Co,Ni,Fe)3(As,Bi)4 (?)  
AURIPIGMENT = ORPIMENT    
HYDROTROILITE = Colloidal HYDROUS FERROUS SULFIDE (?) FeS and H2O  
BOLIDENITE = FALKMANITE    
BOMBOLLAITE = BAMBOLLAITE    
BONCHEVITE = Mixture PEKOITE + GALENOBISMUTITE Pb3Bi2S6 (?) or (Pb,Cu)3Bi11S18 O
ARSENKUPFER = DOMEYKITE, ALGODONITE, WHITNEYITE    
ARSENKOBATKIES = SKUTTERUDITE    
ARSENKOBALT = SAFFLORITE    
BLOCKITE = PENROSEITE    
ISOSTANNITE = KESTERITE-FERROKESTERITE    
BLENDE = SPHALERITE    
ARGYRYTHROSE = PYRARGYRITE    
ARGYROSE = ARGENTITE-ACANTHITE    
ARGENTOTETRAHEDRITE = TETRAHEDRITE (?) Ag10(Fe,Zn)2Sb4S13  
ARGENT SULFURE FRAGILE = STEPHANITE    
KAIYUHITE = BAUMHAUERITE? Pb,Ag,Bi,Sb sulfosalt (?)  
ARGENT SULFURE FLEXIBLE = STERNBERGITE    
ARGENT ROUGE ARSENICAL = PROUSTITE    
ARGENT NOIR = STEPHANITE    
ARGENT MOLYBDIQUE = WEHRLITE = ixture HESSITE, PILSENITE    
ARGENT GRIS ANTIMONIAL = FREIESLEBENITE    
ANTIMONITE = STIBNITE    
ARSENKIES = ARSENOPYRITE    
FRIGIDITE = FAHLORE    
GALENIT = GALENA    
GELPYRIT = PYRITE variety FeS2 and FeS and As  
GALENE = GALENA    
BITEPLATINITE = MONCHEITE    
BITEPLAPALLADITE = MERENSKYITE    
BISMUTHRAMDOHRITE = RAMDOHRITE BISMUTHIAN AgxPb3-x(Sb,Bi)2+xS6 M
BINNITE = TENNANTITE-(Zn)    
GLANZKOBALT = COBALTITE or LINNAEITE    
BESSMERTNOVITE = BEZSMERTNOVITE    
BERTONITE = BOURNONITE    
FEUERBLENDE = PYROSTILPNITE    
BLACKJACK = SPHALERITE    
ARGENT ANTIMONIAL = DYSCRASITE    
BEEGERITE = mixture MATILDITE + SCHIRMERITE ?    
BAYANKHANITE = Mixture Cu and Hg sulfides    
FREIBERGITE = KENOARGENTOTETRAHEDRITE-(Fe) Ag6(Cu4Fe2)Sb4S12[] C
GRUNLINGITE = Mixture JOSEITE + BISMUTHINITE    
GUANGLINITE = ISOMERTIERITE (?) Pd3As Q (?)
GUEJARITE = CHALCOSTIBITE    
HAEGGITE = HAGGITE    
HENGLEINITE = VAIIETY OF BRAVOITE = NICKELOAN PYRITE (Ni,Fe,Co)S2 C
HEXASTANNITE = STANNOIDITE    
BLEIGLANZ = GALENA    
HODRUSHITE = HODRUSITE Cu8Bi12S22 M
GOONGARRITE = HEYROVSKYITE    
BUNTKUPFER = BORNITE    
ARGENT FRAGILE = STEPHANITE    
EISENKIES = PYRITE    
ALLOPALLADIUM = STIBIOPALLADINITE    
EISENGLANZ = HEMATITE    
ALLEMONTITE = STIBARSEN + ARSENIC-ANTIMONY    
MANGANBLENDE = ALABANDITE    
EICHBERGITE = Mixture JASKOLSKIITE and Bismuthian MENEGHINITE    
MANGANESE SHADLUNITE = MANGANOHADLUNITE (Mn,Pb,Cd)(Cu,Fe)8S8 C
ALASKAITE = Mixture of SULFOSALTS    
MARMATITE = FERROAN SPHALERITE (Zn,Fe)S  
MAGNETKIES = PYRRHOTITE Fe1-xS (x=0-0,17) M/H
MAYAKITE = MAJAKITE    
ENDELLION = BOURNONITE PbCuSbS3 O
MELNIKOVITE = GREIGITE   amorphous
MERKURFAHLERZ = SCHWATZITE = MERCURIAN TETRAHEDRITE    
DUNKLES ROTGULTIGERZ = PYRARGYRITE    
MISPICKEL = ARSENOPYRITE    
MOHAWKITE = Mixture Cu3As + Ni + Co  
MOLYBDANGLANZ = MOLYBDENITE    
MONTESITE = PLUMBOAN HERZENBERGITE (?) PbSn4S5 (?)  
MUCHUANITE = Altered MOLYBDENITE (?)    
MUECKEITE = MUCKEITE    
MULLANITE = BOULANGERITE    
NICCOLITE = NICKELINE    
ALABANDINE = ALABANDITE Mn++S C
ANTIMONSILBER = DYSCRASITE    
KEELEYITE = ZINKENITE    
KLAPROTHITE (of Petersen) = WITTICHENITE / EMPLECTITE    
KLERITE = CLERITE    
KOBALTGLANZ = COBALTITE or LINNAEITE    
KOBALTNICKELKIESE = LINNAEITE, CARROLLITE, SIEGENITE, POLYDYMITE, VIOLARITE    
KONDORITE = KONDERITE    
FER ARSENICAL = LOLLINGITE or ARSENOPYRITE    
KUPFERGLANZ = CHALCOCITE or DIGENITE    
FENGLUANITE = ISOMERTIEITE (?) Pd3(As,Sb) O
FEMOLITE = FERRIAN MOLYBDENITE (?)    
EISENNICKELKIES = PENTLANDITE    
KUPFERKIES = CHALCOPYRITE    
NICKEL SKUTTERUDITE = NICKELSKUTTERUDITE (Ni,Co)As3-x C
ANTIMONGLANZ = STIBNITE    
ANTIMONBLENDE = KERMESITE    
BRAVOITE = NICKELOAN PYRITE (Fe,Ni,Co)S2 C
FAHLORE = TETRAHEDRITE-TENNANTITE    
FAHLERZ = FAHLORE = TETRAHEDRITE-TENNANTITE    
ANNIVITE = BISMUTHIAN TETRAHEDRITE-(Fe) Cu10(Fe,Zn)2(Bi,Sb,As)4S13  
LICHTES ROTGULTIGERZ = PROUSTITE    
LINNEITE = LINNAEITE    
LIUJINYINITE = UYTENBOGAARDTITE (?)    
LOELLINGITE = LOLLINGITE    
MACKINSTRYITE = MCKINSTRYITE    
KUPFERINDIG = COVELLITE    
CINABRE = CINNABAR    
CHATHAMITE = FERRIAN SKUTTERUDITE    
ZIGUELINE = Mixture CHALCOPYRITE, CUPRITE, LIMONITE, CINNABAR    
ZINCKENITE = ZINKENITE    
CHLOANTHITE = NICKELSKUTTERUDITE (Ni,Co)As3-x C
PARAJAMESONITE = Mixture JAMESONITE and other sulfosalts Pb4FeSb6S14 O
WOLFSBERGITE = CHALCOSTIBITE    
STERRETTITE = KOLBECKITE    
ANTIMONPEARCEITE = POLYBASITE (Ag,Cu)16(Sb,As)2S11 R
STIBINE = STIBNITE    
CHALCOSINE = CHALCOCITE    
STIBIOLUZONITE = FAMATINITE Cu3SbS4  
SELENQUECKSILBER = TIEMANNITE    
STIBIOPEARCEITE = ANTIMONPEARCEITE    
ZINKBLENDE = SPHALERITE    
SELENKOBELLITE = KOBELLITE    
SELENJOSEITE = LAITAKARITE    
WEHRLITE = Mixture PILSENITE + HESSITE    
BURSAITE = Mixture of Pb and Bi sulfosalts Pb5Bi4S11 (?) M (?)
COBALT PENTLANDITE = COBALTPENTLANDITE Co9S8 C
ARSENPOLYBASITE = PEARCEITE (Ag,Cu)16(As,Sb)2S11 M
BAUMHAUERITE-2a = ARGENTOBAUMHAUERITE Ag1,5Pb22As33,5S72 A
TELLURBISMUTH = TELLUROBISMUTHITE    
TEMISKAMITE = MAUCHERITE    
SPIESGLASERZ = STIBNITE or KERMESITE    
CHALKOPYRRHOTIN = CUBANITE or ISOCUBANITE or mixture CuFeS2 - FeS C
SMALTITE = SKUTTERUDITE (Co,Ni)As3-x C
ZEUXITE = TOURMALINE    
SAKHAROVAITE = JAMESONITE with Bi (Pb,Fe)(Bi,Sb)2S4 O
HASTITE = FERROSELITE (Fe0,99Cu0,01)Se1,99 O
POTOSIITE = poor Sn FRANCKEITE Pb6Sn++++2Fe++Sb+++++2S16 (?) A
SPIESGLAS = ANTIMONY or STIBNITE    
SILBERGLANZ = ARGENTITE, ACANTHITE Ag2S  
VOLTZITE = WURTZITE    
CUIVRE SELENIE ARGENTAL = EUCAIRITE    
SPEISKOBALT = SKUTTERUDITE    
SPIESGLANZ = ANTIMONY    
VOLFSONITE = STANNITE Cu+10Cu++Fe++Fe+++2Sn++++3S16 Q
HORSFORDITE = Artificial product Cu5Sb C (?)
WISMUTGLANZ = BISMUTHINITE    
JEROMITE (?) As(S,Se)2 (?) am.
CHENGBOLITE = MONCHEITE    
INCAITE = Sn rich FRANCKEITE   M
CHALMERSITE = CUBANITE    
SCHULZITE = As free Geocronite    
SCHWATZITE = MERCURIAN TETRAHEDRITE (Cu,Hg)12Sb4S13  
SCHWAZITE = SCHWATZITE = MERCURIAN TETRAHEDRITE (Cu,Hg)12Sb4S13  
SCHWEFELKIES = PYRITE   C
SULRHODITE = BOWIEITE Rh2S3 O
ZINNOBER = CINNABAR    
USONITE = UZONITE    
MATRAITE = SPHALERITE ZnS R
SOLLYITE = DUFRENOYSITE    
KITAIBELITE = PAVONITE PbAg10Bi30S51 (?)
ZINNKIES = STANNITE    
SCLEROCLASE = SARTORITE    
STUETZITE = STUTZITE    
CUMENGÉITE = CUMENGEITE   C
SEL GEMME = HALITE    
BOLÉITE = BOLEITE   C
BOLDYREVITE = RALSTONITE or GEARKSUTITE NaCaMgAl3F14.4H2O am.
ANTOFAGASITE = ERIOCHALCITE    
IODOBROMITE = IODIAN BROMARGYRITE Ag(Br,Cl,I)  
CHLORMANASSEITE = Altered KOENENITE    
HARTSALZ = SYLVINITE    
TRUDELLITE = Mixture CHLORALUMINITE + NATROALUNITE    
FOOTEITE = CONNELLITE    
FLUSSPAT = FLUORITE    
RALSTONITE = HYDROKENORALSTONITE NaxMgxAl2-x(F,OH)6.H2O C
CERARGYRITE = CHLORARGYRITE    
LESUKITE = CADWALADERITE Al5(H2O)3(OH)12.n(Cl,H2O) C
FER MURIATE = LAWRENCITE or MOLYSITE    
YTTROFLUORITE = FLUORITE    
YTTROCERITE = CERIAN FLUORITE    
MERKURKERAT = CALOMEL    
DIABOLÉITE = DIABOLEITE   Q
CHLORSILBER = CHLORARGYRITE    
MERKURSPAT = CALOMEL    
COULSELLITE = FLUORNATROCOULSELLITE (Na,Ca)2(Mg,Al)2F6F R
FEJERITE = CLARINGBULLITE    
PSEUDOBOLÉITE = PSEUDOBOLEITE   Q
ANATACAMITE = CLINOATACAMITE    
PERCYLITE = BOLEITE or PSEUDOBOLEITE PbCuCl2(OH)2 C
CUIVRE MURIATE = ATACAMITE    
HELIOPHYLLITE = ECDEMITE Pb6As2O7Cl4 (?) O
HORNQUICKSILVER = CALOMEL    
MERKURHORNERZ = CALOMEL    
CUMENGITE = CUMENGEITE    
STEINSALZ = HALITE    
TYSONITE = FLUOCERITE    
HORNSILBER = CHLORARGYRITE    
IODYRITE = IODARGYRITE    
ROCK SALT = HALITE    
TALLINGITE = CONNELLITE + PARATACAMITE    
SALMIAC = SALAMMONIAC    
CHUBUTITE = LORETTOITE Pb7O6Cl2 O ps Q
VONDECHENITE = CALUMETITE Cu4CaCl2(OH)8.3,5H2O O
ANARAKITE = PARATACAMITE or HERBERTSMITHITE    
ARGENT CORNE = CHLORARGYRITE    
RADTKEITE (Syntethic) Hg3S2ClI O
SYLVINITE = Mixture HALITE + SYLVITE    
CERULEOFIBRITE = CONNELLITE    
ZAJACITE-(Ce) = GAGARINITE-(Ce)    
BROMYRITE = BROMARGYRITE    
EMBOLITE = BROMIAN CHLORARGYRITE or CHLORIAN BROMARGYRITE Ag(Cl,Br) C
HYDROPHILITE = ANTARCTICITE or SINJARITE (?) CaCl2 (?)  
PARABARIOMICROLITE = HYDROKENOMICROLITE-3R BaTa4O10(OH)2.2H2O R
OBOYERITE = PLUMBOTELLURITE + OTTOITE Pb6H6(Te++++O3)3(Te++++++O6)2.2H2O A
JIXIANITE = HYDROPLUMBOELSMOREITE    
BINDHEIMITE = OXYPLUMBOROMEITE or PLUMBOROMEITE Pb2Sb2O6O C
CEROTUNGSTITE-(Ce) = YTTROTUNGSTITE-(Ce) CeW2O6(OH)3 M
KALIPYROCHLORE = HYDROPYROCHLORE (K,Sr)2-xNb2O6(O,OH).nH2O C
MONGSHANITE = MATTHIASITE (Mg,Cr,Fe++)2(Ti,Zr,Cr,Fe+++)5O12 H
DONATITE = CHROMITE + MAGNETITE    
MARIGNACITE = CERIOPYROCHLORE = HYDROXYCALCIOPYROCHLORE    
CAIRNGORM = Smoky QUARTZ    
TAIYITE = AESCHYNITE-(Y)    
DJALMAITE = URANMICROLITE    
DORNBERGITE = BOTTINOITE Ni3Sb+++++8(OH)46.28H2O R
CACHOLONG = OPAL or CHALCEDONY or NEPHRITE    
CADMOXITE = URANINITE UO2  
CAJUELITE = RUTILE TiO2  
NEMALITE = FERROAN BRUCITE (Mg,Fe++)(OH)2  
NATROBISTANTITE = zero-valent-dominant MICROLITE (Na,Cs)Bi(Ta,Nb,Sb)4O12 C
VREDENBURGITE = Mixture JACOBSITE + HAUSMANNITE    
JASPER = QUARTZ    
JASPE = JASPER = QUARTZ    
OBRUCHEVITE = YTTROPYROCHLORE = HYDROXYKENOPYROCHLORE    
ARKANSITE = BROOKITE    
ABSITE = BRANNERITE    
DELORENZITE = TANTEUXENITE    
CALCEDOINE = CHALCEDONY    
NENADKEVITE = Mixture URANINITE + BOLTWOODITE    
IOZITE = WUSTITE    
WIIKITE = Mixture YTTROPYROCHLORE + EUXENITE    
DELATORREITE = TODOROKITE    
OXYCALCIOMICROLITE Ca2Ta2O7 C
STRUEVERITE = STRUEVERITE (Ti,Ta,Fe+++)3O6 Q
CHEVEUX DE VENUS = QUARTZ + RUTILE    
ISERINE = ILMENITE + RUTILE    
MORION = Black QUARTZ, Smoky QUARTZ    
DIATOMITE = An opaline silica    
MIOMIRITE = PLUMBOAN DAVIDITE    
MAUZELIITE = PLUMBOAN ROMEITE = OXYPLUMBOROMEITE (?)    
TAAFFEITE-9R = MUSGRAVITE = MAGNESIOTAAFFEITE-6N'3S    
MAYENITE = CHLORMAYENITE Ca12Al14O33 C
MOHSITE = PLUMBOAN CRICHTONITE    
NASTURAN = PITCHBLENDE    
ACERDESE = MANGANITE    
MINETTE = IRON HYDROXIDES and OXIDES    
MORMORION = Black QUARTZ, Smoky QUARTZ    
MOSSITE = TANTALITE-TAPIOLITE    
SYCHNODYMITE = CARROLLITE    
MUSGRAVITE = MAGNESIOTAAFFEITE-6N'3S (Mg,Fe++,Zn)2Al6BeO12 R
FER SEDIMENTAIRE = IRON HYDROXIDES AND OXIDES    
MUSHKETOVITE = MAGNETITE pseudomorph on HEMATITE    
NADELEISENERZ = GOETHITE, LIMONITE    
ACHAT = AGATE    
TURJITE = TURGITE    
BROCENITE-BETA = non metamict FERGUSONITE-BETA-(Ce)    
TURGITE = HEMATITE + H2O    
ESCHYNITE = AESCHYNITE    
KUPFERGLAS = CUPRITE    
BROEGGERITE = BROGGERITE = THORIAN URANINITE (U,Th)O2  
EPIIANTHINITE (EPI IANTHINITE) = SCHOEPITE    
BROGGERITE = THORIAN URANINITE (U,Th)O2  
HIBONITE-(Fe) = CHIHUAHUAITE Fe++[Al12]O19 H
TIGER EYE = QUARTZ + CROCIDOLITE    
LUSSATITE = QUARTZ    
TITANEISEN = ILMENITE    
LUTECINE = MOGANITE SiO2  
LYDIAN STONE = QUARTZ    
MACCONNELLITE = MCCONNELLITE    
UFERTITE = DAVIDITE    
KORUND = CORUNDUM    
BARIOPYROCHLORE = zero-valent-dominant pyrochlore (Ba,Sr)2(Nb,Ti)2(O,OH)7 (?) C
HYDROHETAEROLITE Zn2Mn+++4O8.H2O Q
BARIOMICROLITE = HYDROKENOMICROLITE Ba2(Ta,Nb)2(O,OH)7 (?) C
KENNEDYITE = ARMALCOLITE or PSEUDOBROOKITE MgFe+++2TiTi2O10 O
AMPANGABEITE = SAMARSKITE    
TODDITE = Mixture COLUMBITE + SAMARSKITE    
CYANOPHYLLITE = CUALSTIBITE Cu++5Al2(Sb+++++O4)3(OH)7.9H2O O
KYUYGENITE = CHLORKYUYGENITE Ca12Al14O32[(H2O)4Cl2] C
ELBRUZITE-(Zr) = ELBRUSITE {Ca3}[U+++++0,5Zr1,5](Fe+++3)O12 C
BRAUNEISEN = LIMONITE    
CALCIOBETAFITE = a PYROCHLORE group mineral Ca2(Ti,Nb)2(O,OH)7 (?) C
LEPIDOKROKIT = LEPIDOCROCITE    
ELLSWORTHITE = URANPYROCHLORE = OXYNATROPYROCHLORE    
FERRITUNGSTITE = HYDROKENOELSMOREITE (W++++++,Fe+++2)(O,OH)6.pH2O (p = up to 1,75) C
FERROCOLUMBITE = COLUMBITE-(Fe) Fe++Nb2O6 O
ESPINELA = SPINEL    
TOMICHITE BARIAN = TOMICHITE Ba0,5(As2)0,5Ti(V,Fe)5O13(OH) M
FERROTAPIOLITE = TAPIOLITE-(Fe) (Fe++,Mn++)(Ta,Nb)2O6 Q
BREARLEYITE = CHLORMAYENITE Ca6Al7O16Cl C
TITANSCHORL = RUTILE    
FERROTANTALITE = TANTALITE-(Fe) Fe++Ta2O6 O
BINDHEIMITE = OXYPLUMBOROMEITE or PLUMBOROMEITE Pb2Sb2O6O C
LIMONITE = mixture of HYDROUS IRON OXIDES FeO(OH).nH2O  
BROCENITE = FERGUSONITE-BETA-(Ce)    
TITANOMAGNETITE = ILMENITE in MAGNETITE Fe(Fe,Ti)2O4 C/R
TITANOCHROMITE = TITANIAN CHROMITE    
BROSTENITE = BIRNESSITE + TODOROKITE    
LEUCOXENE = Mixture Fe Ti oxydes    
AGATE = Layered CHALCEDONY    
KERSTENITE (of Dana) = MOLYBDOMENITE or OLSACHERITE    
ASHANITE = mixture IXIOLITE, SAMARSKITE-(Y), URANMICROLITE (Nb,Ta,U,Fe,Mn)4O8 O
MANGANOTANTALITE = TANTALITE-(Mn) Mn++Ta2O6 O
PANDAITE = BARIOPYROCHLORE = HYDROXYKENOPYROCHLORE    
FER SPECULAIRE = HEMATITE    
MARTITE = HEMATITE Pseudomorph on MAGNETITE    
KEILHAUITE = YTTRIAN TITANITE    
AKAGANÉITE = AKAGANEITE   M ps Q
AMETHYST = purple QUARTZ    
DURDENITE = EMMONSITE    
FER OOLITHIQUE = IRON HYDROXIDES AND OXIDES    
URANPECHERZ = PITCHBLENDE = URANINITE    
MELACONITE = TENORITE    
MELANOCHALCITE = Mixture TENORITE, CHRYSOCOLLA, MALACHITE    
AREQUIPITE = mixture BINDHEIMITE + QUARTZ    
TAPROBANITE = TAAFFEITE    
MENILITE = OPAL SiO2.nH2O am.
TAPIOLITE = TAPIOLITE-(Mg) or -(Mn) or -(Fe) (Fe,Mn)(Ta,Nb)2O6 Q
MANGANOTAPIOLITE = TAPIOLITE-(Mn) (Mn++,Fe++)(Ta,Nb)2O6 Q
AETITE = LIMONITE concretion    
DYSANALYTE = NIOBIAN PEROVSKITE    
THOROTUNGSTITE = YTTROTUNGSTITE    
IWAKIITE = JACOBSITE-Q Mn++(Fe+++,Mn+++)2O4 Q
ELBRUSITE-(Zr) = ELBRUSITE    
KHINITE = KHINITE-4O Pb++Cu++3Te++++++O6(OH)2 O
ULVITE = ULVOSPINEL    
UNGURSAITE = SODIAN CALCIOTANTITE (?) NaCa5(Ta,Nb)24O65(OH) H
KOPPITE = PYROCHLORE = FLUORCALCIOPYROCHLORE    
BRUEGGENITE = BRUGGENITE    
ANKANGITE = MANNARDITE Ba(Ti,V+++,Cr+++)8O16 Q
FER CHROMATE = CHROMITE    
MANGANOMELANE = Mn oxides    
KNOPITE = PEROVSKITE    
FER OXYDULE = MAGNETITE    
MAGNOCOLUMBITE = COLUMBITE-(Mg) (Mg,Fe++,Mn)(Nb,Ta)2O6 O
MAGNESIOTANTALITE = TANTALITE-(Mg) (Mg,Fe++)(Ta,Nb)2O6 O
FER OLIGISTE = HEMATITE    
MANGANOCOLUMBITE = COLUMBITE-(Mn) (Mn,Fe++)(Nb,Ta)2O6 O
ALUMOTUNGSTITE = HYDROKENOELSMOREITE (W,Al)(O,OH)3 (?) C
ALLCHARITE = GOETHITE    
EIS = ICE H2O H
KHLOPINITE = TANTALIAN SAMARSKITE    
TANTALITE = FERROTANTALITE, MANGANOTANTALITE    
MAGNESIOCOLUMBITE = COLUMBITE-(Mg) (Mg,Fe++,Mn)(Nb,Ta)2O6 O
SITAPARITE = BIXBYITE    
BAUXITE = Hydroxides and oxides of Al and Fe    
HELIOTROPE = CHALCEDONY or PLASMA    
COLUMBITE = COLUMBITE-(Fe) or -(Mg) or -(Mn)    
PYROCHLORE = a PYROCHLORE group mineral    
HATCHETTOLITE = URANPYROCHLORE    
QUARTZ BLEU = QUARTZ    
QUARTZ ENFUME = SMOKY QUARTZ = Brown QUARTZ    
QUARTZ HEMATOIDE = FERRUGINOUS QUARTZ    
CORINDON = CORUNDUM    
QUARTZ ROUGE = QUARTZ HEMATOIDE = QUARTZ    
CORNALINE = CARNEOL = AGATE    
SILEX = FLINT    
QUECKSILBERHORNERZ = CALOMEL    
CHRYSOPRASE = GREEN CHALCEDONY    
SIDEROCHROME = CHROMITE    
YTTROTITANITE = TITANITE    
RESINITE = OPAL    
GUMMITE = Secondary URANIUM OXIDES    
SHEPARDITE (of Brooke) = BRUCITE Mg(OH)2 R
CHROMRUTILE = REDLEDGEITE    
QUARTZ ROSE = QUARTZ    
CARNELIAN = CARNEOL = AGATE    
UHLIGITE (of Hauser) = PEROVSKITE or ZIRKELITE Ca3(Ti,Al,Zr)9O20 (?) C (?)
WESTGRENITE = BISMUTOMICROLITE = HYDROXYKENOMICROLITE    
PLUMBOBETAFITE = zero-valent-dominant PYROCHLORE (Pb,U,Ca)(Ti,Nb)2O6(OH,F) (?) C
WOLFRAMOIXIOLITE = IXIOLITE variety (Nb,W,Ta,Fe,Mn,Nb)2O4 M
YTTROBETAFITE-(Y) = OXYCALCIOBETAFITE or zero-valent-dominant pyrochlore (Y,U,Ce)2(Ti,Nb,Ta)2O6(OH) (?) C
HOGBOMITE = MAGNESIOHOGBOMITE (Mg,Fe++,Ti)Al2O4 H/R
YTTROPYROCHLORE-(Y) = OXYYTTROPYROCHLORE-(Y) or zero-valent-dominant pyrochlore (Y,Na,Ca,U)1-2(Nb,Ta,Ti)2(O,OH)7 (?) C
NIGERITE = FERRONIGERITE   R
PSILOMELANE = ROMANECHITE    
OLIGISTE = HEMATITE    
CHERT = cryptocrystalline QUARTZ    
CARNEOL = Red CHALCEDONY    
HJELMITE = Mixture TAPIOLITE + PYROCHLORE (?)    
SMOKY QUARTZ = Brown QUARTZ    
FORCHERITE = OPAL    
PRASE = Green QUARTZ    
PRIORITE = AESCHYNITE-(Y)    
HEUBACHITE = NICKELIAN HETEROGENITE    
BASANITE = LYDIAN STONE = QUARTZ    
HERKIMER DIAMOND = QUARTZ    
HOEGBOMITE = HOGBOMITE    
SARD = Brown CHALCEDONY    
SHAHOVITE = SHAKHOVITE    
RUBIS = CORUNDUM    
RUBY = CORUNDUM    
RUTILATED QUARTZ = QUARTZ + RUTILE    
SAGENITE = RUTILE    
ZINNSTEIN = CASSITERITE    
GEYSERITE = OPAL    
BITIKLEITE-(SnAl) = BITIKLEITE    
RUBIN = CORUNDUM    
SAPPHIRE = CORUNDUM    
GIRASOL = OPALINE QUARTZ    
SARDOINE = Brown CHALCEDONY    
SCHULZENITE = CUPRIAN HETEROGENITE    
CITRINE = yellow QUARTZ    
CLIACHITE = ALUMOGEL (?) = Mixture (?)    
CHALCEDONY = cryptocrystalline QUARTZ    
SCHAUMBURGER DIAMANT = QUARTZ    
CLEVEITE = URANINITE    
GAMMA-MnO2 = NSUTITE MnO2  
FERROTELLURITE = KEYSTONEITE    
SAPHIR = CORUNDUM    
FULGURITE = Silica glass caused by lightning    
ZINCOHOGBOMITE (16H) = ZINCOHOGBOMITE-2N6S   H
ROMANITE = DESSAUITE-(Y) (Fe++,U,Pb)2(Ti,Fe+++)O12 (?) R
BELMONTITE (of Küstel) = Mixture BINDHEIMITE, CHLORARGYRITE, TETRAHEDRITE, QUARTZ    
ZINCOHOGBOMITE (-8H) = ZINCOHOGBOMITE-2N2S   H
ROTEISEN = HEMATITE    
ROTES KUPFERGLAS = CUPRITE    
ROTHEISENERZ = HEMATITE    
ROTHEISENSTEIN = HEMATITE    
RUBINGLIMMER = LEPIDOCROCITE    
GLOCKERITE = LEPIDOCROCITE    
CUBAITE = QUARTZ    
ROTHKUPFER = CUPRITE    
ROTHKUPFERERZ = CUPRITE    
ZINKIT = ZINCITE    
GLACE = ICE H2O H
ROTHZINKERZ = ZINCITE    
ROTKUPFER = CUPRITE    
ROTKUPFERERZ = CUPRITE    
ROTZINKERZ = ZINCITE    
CEYLONITE = SPINEL (Mg,Fe++)Al2O4 C
BITIKLEITE-(ZrFe) = USTURITE    
WOOD TIN = CASSITERITE    
PARTRIDGEITE = BIXBYITE    
ONYX = Layered CHALCEDONY    
WOLFRAMITE = HÜBNERITE-FERBERITE    
CYMOPHANE = CHRYSOBERYL    
PLUMBOMICROLITE = KENOPLUMBOMICROLITE or zero-valent-dominant MICROLITE (Pb,Ca,U)2Ta2O6(OH) (?) C
BOIS SILICIFIE = QUARTZ    
PLUMBOPYROCHLORE = OXYPLUMBOPYROCHLORE or KENOPLUMBOPYROCHLORE (Pb,Y,U,Ca)2-xNb2O6(OH) (?) C
BOEHMITE = BOHMITE    
AINALITE = TANTALIAN CASSITERITE    
FERRUGINOUS QUARTZ = Q.+ GOETHITE-HEMATITE    
IDDINGSITE = Mixture iron oxides, clay minerals, etc.    
STARINGITE = CASSITERITE + TAPIOLITE (Fe++,Mn)x(Ta,Nb)2xSn6-3xO12 Q
AVENTURINE = QUARTZ + MICA or HEMATITE    
FERUTITE = DAVIDITE    
WUELFINGITE = WULFINGITE    
CUPROCASSITERITE = MUSHISTONITE    
WUESTITE = WUSTITE    
CHRISTENSENITE = TRIDYMITE    
HYALITE = OPAL    
HYACINTHE DE COMPOSTELLE = Red QUARTZ    
BLOODSTONE = CHALCEDONY or PLASMA    
PARTZITE = CUPROROMEITE Cu++2Sb2(O,OH)7 (?) C (?)
NIGERITE-24R = FERRONIGERITE-6N6S   R
NIGERITE-6T = FERRONIGERITE-2N1S   R
NIGRINE = ILMENITE + RUTILE    
PARAKHINITE = KHINITE-3T Pb++Cu++3Te++++++O6(OH)2 R
NIOBITE = COLUMBITE-(Fe) (Fe,Mn)Nb2O6 O
NIOBOZIRCONOLITE = NIOBIAN ZIRKELITE    
ILMENORUTILE = RUTILE variety (Ti,Nb,Fe+++)O2 Q
ARSENOFERRITE = CAFARSITE    
CALTSURANOITE = CALCIOURANOITE    
NUEVITE = SAMARSKITE    
HYDRARGILLITE = GIBBSITE    
OBSIDIAN = Volcanic glass    
OBSIDIENNE = OBSIDIAN    
OCRE JAUNE (Yellow OCHRE) = LIMONITE    
OCTAHEDRITE = ANATASE    
IGDLOITE = LUESHITE    
OEHRLI DIAMANT = QUARTZ    
OEIL DE TIGRE = TIGER EYE = QUARTZ SiO2 R
WOELSENDORFITE = WOLSENDORFITE    
TRIPOLITE = DIATOMITE = An opaline silica    
NOVACULITE = cryptocrystalline QUARTZ    
SPECULARITE = HEMATITE    
SOPHIITE = SOFIITE    
POLYMIGNITE = Metamict ZIRCONOLITE (Ca,Fe,Y,Th)(Nb,Ti,Ta,Zr)O4 O
FLINT = cryptocrystalline QUARTZ    
SPEKULARIT = HEMATITE    
ROMEITE = FLUORNATROROMEITE or FLUORCALCIOROMEITE or OXYCALCIOROMEITE (Ca,Fe++,Mn++,Na)2(Sb+++++,Ti++++)2O6(O,OH,F) C
HORNSTONE = cryptocrystalline QUARTZ    
PENGZHIZHONGITE-6T = MAGNESIONIGERITE-2N1S   R
BITIKLEITE-(SnFe) = DZHULUITE    
FIORITE = OPAL    
HUEBNERITE = HUBNERITE    
STAINIERITE = HETEROGENITE    
PYROCHLORE = FLUORCALCIOPYROCHLORE (Ca,[])2Nb2(O,OH)6F C
RIJKEBOERITE = BARIOMICROLITE = HYDROXYKENOMICROLITE    
PICOTITE = CHROMIAN SPINEL (Mg,Fe++)(Al,Cr)2O4  
PICROCHROMITE = MAGNESIOCHROMITE    
SPARTALITE = ZINCITE    
STRUVERITE = RUTILE variety (Ti,Ta,Fe+++)O2 Q
SUKULAITE = STANNOMICROLITE = OXYSTANNOMICROLITE    
CHROMEISENSTEIN = CHROMITE    
SQUAWCREEKITE = Zincian TRIPUHYITE   Q
PITCHBLENDE = URANINITE UO2 C
CHALCOTRICHITE = CUPRITE    
SAMIRESITE = PLUMBOAN URANPYROCHLORE = OXYPLUMBOPYROCHLORE (?)    
PLEONASTE = FERROAN SPINEL OR MAGNESIAN HERCYNITE (Mg,Fe++)Al2O4 or (Fe++,Mg)Al2O4 C
PECHBLENDE = PITCHBLENDE = URANINITE    
HOLZSTEIN = CHALCEDONY    
PECHERZ = PITCHBLENDE = URANINITE    
PECHURANE = PITCHBLENDE = URANINITE    
PEHRMANITE = FERROTAAFFEITE-6N'3S (Fe++,Zn,Mg)2Al6BeO12 R
SPINELLE = SPINEL    
PENGZHIZHONGITE-24R = MAGNESIONIGERITE-6N6S   R
BISMUTOSTIBICONITE Bi(Sb+++++,Fe+++)2O7 C
HOCHQUARTZ = QUARTZ-beta    
TOUCHSTONE = LYDIAN STONE = QUARTZ    
BLOMSTRANDINE = AESCHYNITE-(Y)    
SPHAEROCOBALTITE = SPHEROCOBALTITE CoCO3 R
PONITE = RHODOCHROSITE variety (Mn,Fe)CO3  
BISMUTHITE = BISMUTITE Bi2(CO3)O2 Q
IGLESIASITE = Mixture CERUSSITE + SMITHSONITE    
KUTNAHORITE = KUTNOHORITE    
FLOS FERRI = ARAGONITE    
KALKSPAT = CALCITE    
KUPFERLASUR = AZURITE    
KNIPOVICHITE = CHROMIAN ALUMOHYDROCALCITE    
BASTNAESITE-(Y) = BASTNASITE-(Y)    
FER CARBONATE = SIDERITE    
BAIYUNEBOITE-(Ce) = CORDYLITE-(Ce) BaNaCe2(CO3)4F H
ZEIRINGITE = ARAGONITE + AURICHALCITE    
APPLELITE = CALCITE    
YOSHIKAWAITE = DYPINGITE (?) Mg5(CO3)4(OH)2.8H2O  
ZINCONINE = HYDROZINCITE    
BASTNAESITE-(Nd) = BASTNASITE-(Nd)    
HUANGHEITE-(Ce) = HUANGHOITE-(Ce)    
BASTNAESITE-(La) = BASTNASITE-(La)    
GIOBERTITE = MAGNESITE    
BASTNAESITE-(Ce) = BASTNASITE-(Ce)    
GLAUCOSPHAERITE = GLAUKOSPHAERITE    
TUCANITE = SCARBROITE    
ZINKSPAT = SMITHSONITE    
CHESSYLITE = AZURITE    
HYDROXYLBASTNAESITE-(Ce) = HYDROXYLBASTNASITE-(Ce)    
HOSHIITE = NICKELOAN MAGNESITE    
CHILE SALTPETER = NITRATINE    
KALKSALTPETER = NITROCALCITE    
GLENDONITE = CALCITE pseudomorph on GLAUBERITE    
SLAVYANSKITE = TUNISITE    
BURATITE = AURICHALCITE    
NITRE = NITER KNO3 O
TARASPITE = A Ni rich DOLOMITE    
NITROKALIT = NITER KNO3 O
NITRONATRITE = NITRATINE    
TARNOWITZITE = PLUMBOAN ARAGONITE (Ca,Pb)CO3  
SPHEROCOBALTITE = SPHAEROCOBALTITE    
ROENTGENITE-(Ce) = RONTGENITE-(Ce)    
MESITITE = FERROAN MAGNESITE (Mg,Fe++)CO3  
MARBLE = often CALCITE    
BUETSCHLIITE = BUTSCHLIITE    
MANGANOCALCITE = CALCITE    
EARDLEYITE = TAKOVITE    
CARBONYTRINE = TENGERITE-(Y)    
MALAQUITA = MALACHITE    
TARNOWSKITE = TARNOWITZITE (Ca,Pb)CO3  
SODA NITER = NITRATINE    
SMITHSONITE COBALTOAN = SMITHSONITE (Zn,Co)CO3 R
CALCITE COBALTOAN = CALCITE    
NATROFAIRCHILDITE = NYEREREITE Na2Ca(CO3)2 O
COUTINITE = LANTHANITE-(Nd)    
DIALOGITE = RHODOCHROSITE    
SYNCHISITE-(Ce) = SYNCHYSITE-(Ce)    
COBALTOCALCITE = SPHAEROCOBALTITE    
KOLWÉZITE = KOLWEZITE   A
PLOMB CARBONATE RHOMBOIDAL = LEADHILLITE    
MONHEIMITE = SMITHSONITE (Zn,Fe++)CO3  
SYNCHISITE-(Y) = SYNCHYSITE-(Y)    
DOVERITE = SYNCHYSITE-(Y)    
CALCIUMOXIDE = LIME    
DAKEITE = SCHROCKINGERITE    
NEOTYPE = BARYTOCALCITE    
CUIVRE CARBONATE BLEU = AZURITE    
SYNCHISITE-(Nd) = SYNCHYSITE-(Nd)    
CHAUX = LIME CaO  
BROMLITE = ALSTONITE    
ROTHSPATH = RHODOCHROSITE or RHODONITE    
SCHROECKINGERITE = SCHROCKINGERITE    
MACKELVEYITE = MCKELVEYITE    
MAGISTRETTIITE-(Y) = MCKELVEYITE-(Y) without U    
MAUESRALZ = NITROCALCITE    
BREUNNERITE = FERROAN MAGNESITE (Mg,Fe++)CO3  
SALPETER = NITER    
OLIGONITE = MANGANOAN SIDERITE (Fe++,Mn)CO3  
EISENSPAT = SIDERITE Fe(CO3)  
TERUELITE = DOLOMITE    
PARAALUMOHYDROCALCITE = PARA-ALUMOHYDROCALCITE    
SALPETRE = NITER KNO3 O
CHALYBITE = SIDERITE    
DIOMIGNITE = ZABUYELITE Li2B4O7 Q
P-VEATCHITE = VEATCHITE-1M    
VEATCHITE-P (P-VEATCHITE) = VEATCHITE-1M Sr2B11O16(OH)5.H2O M
NOCERITE = FLUOBORITE    
PARAHILGARDITE = HILGARDITE-3A    
PAGEITE = VONSENITE    
MONSMEDITE = VOLTAITE H8K2Tl+++2(SO4)8.11H2O C
BORONATROCALCITE = ULEXITE    
ALLENITE = PENTAHYDRITE    
VOLKOVITE = GINORITE (?)    
BREISLAKITE = VONSENITE or LUDWIGITE or fibrous ILVAITE    
STASSFURTITE = BORACITE    
PARAVEATCHITE = VEATCHITE-1M Sr2B11O16(OH)5.H2O M
Cl-TYRETSKITE = HILGARDITE    
ASCHARITE = SZAIBELYITE    
MAGNIOBORITE = SUANITE    
MAGNESIOLUDWIGITE = LUDWIGITE    
BALAVINSKITE Sr2B6O11.4H2O (?)
HINTZEITE = KALIBORITE    
MACALLISTERITE = MCALLISTERITE    
PAIGEITE = HULSITE    
PANDERMITE = PRICEITE    
KRAMERITE = PROBERTITE    
LESSERITE = INDERITE    
STRONTIOHILGARDITE = STRONTIAN TYRETSKITE-1A    
SODA ALUM = ALUM-(Na)    
PATERNOITE = KALIBORITE    
TINCAL = BORAX    
FERGUSONITE-Beta-(Nd) = CLINOFERGUSONITE-(Nd)    
FERGUSONITE-Beta-(Y) = CLINOFERGUSONITE-(Y)    
FERGUSONITE-Beta-(Ce) = CLINOFERGUSONITE-(Ce)    
NATROALUNITE-2R = Synonym of Natroalunite-2c (Na,Ca,K)2Al6(SO4)4(OH)12 R
CHAIDAMUNITE = see CHAIDAMUITE    
CARPHOSIDERITE = HYDRONIUM JAROSITE    
WOODFORDITE = ETTRINGITE    
POTASSIUM ALUM = ALUM-(K) KAl(SO4)2.12H2O C
YE'ELIMITE = YEELIMITE    
SODIUM ALUM = ALUM-(Na) NaAl(SO4)2.12H2O C
HOKUTOLITE = PLUMBOAN BARYTE (Ba,Pb)SO4  
SODIUM-ZIPPEITE = NATROZIPPEITE Na4(UO2)6(SO4)3(OH)10.4H2O O
BLOEDITE = BLODITE    
BARITE = BARYTE    
CUIVRE VELOUTE = CYANOTRICHITE    
METAURANOPILITE = META URANOPILITE (UO2)6(SO4)(OH)10.5H2O O (?)
PISANITE = CUPRIAN MELANTERITE (Fe++,Cu)SO4.7H2O  
CUPROARTINITE = NAKAURIITE (?)    
GIPS = GYPSUM    
SODIUMALUM = ALUM-(Na) NaAl(SO4)2.12H2O C
ROTHER EISEN-VITRIOL = BOTRYOGEN    
ROTHERVITRIOL = BIEBERITE    
ZINCVOLTAITE = ZINCOVOLTAITE   C
ROTHES BLEIERZ = CROCOITE    
SELENOLITE = OLSACHERITE    
GLAUBER'S SALT = MIRABILITE    
GEORGEERICKSENITE = GEORGE-ERICKSENITE Na6CaMg(IO3)6(CrO4,SO4)2.12H2O R
SELENITE = GYPSUM    
COBALT-NICKEL KTENASITE = GOBELINITE (Cu,Co,Ni,Zn)5(SO4)2(OH)6.6H2O M
SCHWERSPAT = BARYTE    
GILPINITE = JOHANNITE    
SCHWEIZERITE = SERPENTINE    
GESSO = GYPSUM    
OBRADOVICITE = OBRADOVICITE-KCu H4(K,Na)Cu++Fe+++2(AsO4)(MoO4)5.12H2O O
SCHEIBEITE = PHOENICOCHROITE    
SCHOENITE = PICROMERITE    
GLASERITE = APHTHITALITE    
GYPSE = GYPSUM    
BASALUMINITE = FELSOBANYAITE Al4(SO4)(OH)10.4H2O H
HERRENGRUNDITE = DEVILLINE   M
COPPERAS = MELANTERITE    
FRAUENEIS = GYPSUM    
CELESTITE = CELESTINE    
ALUMOPHARMACOSIDERITE = PHARMACOALUMITE KAl4(AsO4)3(OH)4.6,5H2O C
COBALTOGORDAITE = THERESEMAGNANITE    
BLANCHARDITE = BROCHANTITE    
HAARSALZ = HALOTRICHITE    
COBALT ZIPPEITE = COBALTZIPPEITE Co2(UO2)6(SO4)3(OH)10.16H2O O
MAGNESIUMZIPPEITE = MAGNESIOZIPPEITE Mg(UO2)2(SO4)O2.3,5H2O M
POTASSIUMALUM = ALUM-(K) KAl(SO4)2.12H2O C
SODIUM ZIPPEITE = NATROZIPPEITE Na5(UO2)8(SO4)4O5(OH)3.12H2O M
RISORITE = FERGUSONITE    
ZINC MELANTERITE = ZINC MELANTERITE (Zn,Cu,Fe++)SO4.7H2O M
ZINC ZIPPEITE = ZINCZIPPEITE Zn2(UO2)6(SO4)3(OH)10.16H2O O
ROEMERITE = ROMERITE    
BARYTINE = BARYTE    
HYDRONIUM JAROSITE = HYDRONIUMJAROSITE (H3O+)2Fe+++6(SO4)4(OH)12 R
META ALUNOGEN = META-ALUNOGEN Al4(SO4)6.27H2O M
DEVILLITE = DEVILLINE    
SCHMEIDERITE = SCHMIEDERITE    
MEGABASITE = WOLFRAMITE    
BOSJEMANITE (?) = BUSHMANITE (?) = APJOHNITE (?)    
MELINOSE = WULFENITE    
URVOLGYITE = DEVILLINE   M
ALABASTER = GYPSUM    
META ALUMINITE = META-ALUMINITE Al2(SO4)(OH)4.5H2O M
TAYLORITE = AMMONIAN ARCANITE    
MINAMIITE = NATROALUNITE-2c (Na,Ca,K)2Al6(SO4)4(OH)12 R
VEGASITE = PLUMBOJAROSITE (?)    
KALI ALAUN = ALUM-(K) KAl(SO4)2.12H2O C
VERNADSKITE = ANTLERITE    
VIBERTITE = BASSANITE    
MOOREITE-DELTA = TORREYITE    
VULPINITE = ANHYDRITE    
KAMAREZITE = BROCHANTITE    
KTENASITE COBALTOAN NICKELOAN = GOBELINITE (Cu,Co,Ni,Zn)5(SO4)2(OH)6.6H2O M
LAPPARENTITE (of ROST) = KHADEMITE (ROSTITE)    
LEONHARDTITE = STARKEYITE    
KUPFERVITRIOL = CHALCANTHITE    
FELSOBANYITE = FELSOBANYAITE Al4(SO4)(OH)11.5H2O O (?)
LETTSOMITE = CYANOTRICHITE    
LOUDERBACKITE = ROMERITE    
KELLERITE = CUPRIAN PENTAHYDRITE    
LYELLITE = DEVILLINE   M
CHILELOEWEITE = HUMBERSTONITE    
KROEHNKITE = KROHNKITE    
CHALLANTITE = FERRICOPIAPITE    
ALUM = hydrous alcali Al sulfates    
MAGNESIUM ZIPPEITE = MAGNESIUMZIPPEITE Mg2(UO2)6(SO4)3(OH)10.16H2O O
TEXASITE Pr2O2SO4 O
CHILUNITE = CHILUITE    
KHUNIITE = IRANITE    
LOWEITE = LOEWEITE    
CARBONATE CYANOTRICHITE = CARBONATECYANOTRICHITE Cu4Al2(CO3,SO4)(OH)12.2H2O O
NICKEL ZIPPEITE = NICKELZIPPEITE Ni2(UO2)6(SO4)3(OH)10.16H2O O
NICKEL HEXAHYDRITE = NICKELHEXAHYDRITE (Ni,Mg,Fe++)(SO4).6H2O M
NICKEL BOUSSINGAULTITE = NICKELBOUSSINGAULTITE (NH4)2(Ni,Mg)(SO4)2.6H2O M
D'ANSITE = DANSITE    
ASTRAKHANITE = BLODITE    
NATRIUM ZIPPEITE = NATROZIPPEITE Na4(UO2)6(SO4)3(OH)10.4H2O O
NITROGLAUBERITE = Mixture DARAPSKITE + NITRATINE    
CARATIITE = PIYPITE K4Cu4O2(SO4)4(Na,Cu)Cl Q
CYANOSE = CHALCANTHITE    
NATRON ALAUN = ALUM-(Na) NaAl(SO4)2.12H2O C
DELTAMOOREITE = TORREYITE    
WEBSTERITE = ALUMINITE    
WATTEVILLITE = WATTEVILLEITE Na2Ca(SO4)2.4H2O (?) O (?)
CUPROHYDROMAGNESITE = NAKAURIITE (?)    
FERROCOPIAPITE = COPIAPITE    
ARNIMITE = ANTLERITE (?) Cu++5(SO4)2(OH)6.3H2O O
CUIVRE SULFATE = CHALCANTHITE    
ELEONORITE = BERAUNITE Fe+++6(PO4)4O(OH)4.6H2O M
MENDOZAVILITE = MENDOZAVILITE-NaFe (Na,K)(Ca,Mg)2Fe+++3(PO4)2(Mo++++++8O28)(OH).9H2O M
BOBDOWNSITE = WHITLOCKITE Ca9Mg(PO4)6(PO3F)  
BETPAKDALITE = BETPAKDALITE-CaCa MgCa2Fe+++3(Mo++++++8O28)(AsO4)2(OH).23H2O M
SMOLIANINOVITE = see SMOLYANINOVITE    
CAMPYLITE = PHOSPHORE MIMETITE    
CIRROLITE ( a Mixture ATTAKOLITE, BEARTHITE, LAZULITE, CYANITE ?) Ca3Al2(PO4)3(OH)3 (?)  
CLINOTIROLITE = CLINOTYROLITE = TANGDANITE    
FER AZURE = VIVIANITE    
CHALCOLITE = TORBERNITE    
DAHLLITE = HYDROXYLAPATITE carbonate rich    
CLINOSTRENGITE = PHOSPHOSIDERITE    
ENDLICHITE = ARSENATIAN VANADINITE    
CLINOHYDROXYLAPATITE = HYDROXYLAPATITE-M    
FER ARSENIATE = PHARMACOSIDERITE    
GAINESITE-(NaCs) = MCCRILLISITE NaCs(Be,Li)Zr2(PO4)4.1-2H2O Q
CHLOROTILE = AGARDITE (?) (Cu,Fe,?)2Cu12[(OH,H2O)12(AsO4)6]6.H2O  
CUPROADAMITE = ADAMITE    
GAINESITE-(NaNa) = GAINESITE Na(Na,K)(Be,Li)(Zr,Zn)2(PO4)4.1-2H2O Q
CLINOBARRANDITE = ALUMINIAN PHOSPHOSIDERITE    
CHERALITE-(Ce) = MONAZITE-(Ce)    
CARBONATEAPATITE = FLUORAPATITE (carbonate-rich)    
BRASILIANITE = BRAZILIANITE    
CHAVESITE = MONETITE    
CUPRODESCLOIZITE = MOTTRAMITE    
BRAUNBLEIERZ = PYROMORPHITE    
CUPRIAN AUSTINITE = AUSTINITE Ca(Zn,Cu)(AsO4)(OH) O
COBALTOADAMITE = ADAMITE    
DENNISONITE = DAVISONITE = APATITE + CRANDALLITE    
FRANCOLITE = CARBONATEFLUORAPATITE    
CALCIOVOLBORTHITE = TANGEITE (Ca,Sr,Pb)(Cu,Mn)(V,As)O4(OH) O
CALCIOVOLBORTHITE = Mixture VESIGNIEITE + other (?) CaCu(VO4)(OH) (?) O
FORBESITE = Mixture ANNABERGITE + ARSENOLITE    
CATHOPHORITE = BRABANTITE (?)    
BORICKITE = DELVAUXITE (?)    
COLLOPHANITE = CARBONATE APATITE    
COLLOPHANE = COLLOPHANITE = CARBONATE APATITE    
COERULEOLACTITE = cuprian PLANERITE + CRANDALLITE (Ca,Cu)Al6(PO4)4(OH)8.4-5H2O A
DELTAITE = Mixture CRANDALLITE + HYDROXYLAPATITE    
CUPROFAUSTITE = FAUSTITE    
BOLIVARITE = EVANSITE (?) Al2(PO4)(OH)3.4-5H2O am.
FER PHOSPHATE = VIVIANITE    
CUIVRE ARSENIATE = OLIVENITE or CHALCOPHYLLITE    
CLINOTYROLITE = TANGDANITE Ca2Cu9[(As,S)O4]4(O,OH)10.10H2O M
CALCIUMPHARMACOSIDERITE (?) Ba0,5(Fe+++)4(AsO4)3(OH)4.5H2O  
DAVISONITE = APATITE + CRANDALLITE Ca3Al(PO4)2(OH)3.H2O H
CABRERITE = MAGNESIAN ANNABERGITE    
FERRO ALLUAUDITE = FERROALLUAUDITE NaCaFe++(Fe++,Mn,Fe+++,Mg)2(PO4)3 M
DELONEITE-(Ce) = DELONEITE    
FREMONTITE = NATROMONTEBRASITE    
DUHAMELITE = MOTTRAMITE BISMUTHIAN (Pb,Bi,Ca)Cu(VO4)(OH,O) O
FREIRINITE = LAVENDULAN    
DEHRNITE = CARBONATE-FLUORAPATITE    
FERRAZITE = GORCEIXITE (Pb,Ba)3(PO4)2.8H2O (?) A
FERRIBERAUNITE = ELEONORITE   M
BRABANTITE = CHERALITE CaTh(PO4)2 M
CUIVRE PHOSPHATE = LIBETHENITE or PSEUDOMALACHITE    
DERNBACHITE = CORKITE PbFe+++3(PO4)(SO4)(OH)6 R
SODIUM BETPAKDALITE = BETPAKDALITE-NaCa (Na,Ca)3Fe+++2(As2O4)(MoO4)6.15H2O M
MANGANESE-HORNESITE = MANGANESEHORNESITE (Mn++,Mg)3(AsO4)2.8H2O M
MANGANESEHORNESITE = MANGANOHORNESITE (Mn++,Mg)3(AsO4)2.8H2O M
MANTIENNÉITE = MANTIENNEITE   O
NATROBETPAKDALITE = BETPAKDALITE-NaCa (Na,Ca)3Fe+++2(As2O4)(MoO4)6.15H2O M
ROSELITE BETA = ROSELITEBETA Ca2Co(AsO4)2.2H2O A
ALUMOCHALCOSIDERITE = CHALCOSIDERITE with Al    
LUN'OKITE = LUNOKITE    
ROESSLERITE = ROSSLERITE    
LUNNITE = PSEUDOMALACHITE    
MAGNIOPHILITE = BEUSITE    
MAGNIOTRIPLITE = WAGNERITE   M
MAHLMOODITE = MALHMOODITE Fe+++Zr(PO4)2.4H2O M
SODIUM PHARMACOSIDERITE = NATROPHARMACOSIDERITE (Na,K)2Fe+++4(AsO4)3(OH)5.7H2O Q ps C
SODIUM URANOSPINITE = NATROURANOSPINITE (Na2,Ca)(UO2)2(AsO4)2.5H2O Q
APATITE-(CaF) = FLUORAPATITE    
MAGNESIUM CHLOROPHOENICITE = MAGNESIOCHLOROPHOENICITE (Mg,Mn)3Zn2(AsO4)(OH,O)6 M
LEWISTONITE = CARBONATEFLUORAPATITE    
KUPFERSCHAUM = TYROLITE    
KURSKITE = FLUORAPATITE or HYDROXYLAPATITE, with CO3    
APATITE-(CaCl) = CHLORAPATITE    
APATITE = CHLORAPATITE or FLUORAPATITE or HYDROXYLAPATITE or FLUORSTROPHITE, etc.    
LEHIITE = Mixture APATITE + CRANDALLITE (Na,K)2Ca5Al8(PO4)8(OH)12.6H2O  
LEUCOCHALCITE = OLIVENITE    
MAGNESIUMCHLOROPHOENICITE = MAGNESIOCHLOROPHOENICITE (Mg,Mn)3Zn2(AsO4)(OH,O)6 M
SALMOITE = TARBUTTITE    
SODIUMAUTUNITE = METANATROAUTUNITE Na2(UO2)2(PO4)2.8H2O Q
ANDREWSITE = HENTSCHELITE + ROCKBRIDGEITE + CHALCOSIDERITE (Cu,Fe++)Fe+++3(PO4)3(OH)2 O
LINGAITUKUANG = BRABANTITE (?)    
LOSSENITE = BEUDANTITE + SCORODITE    
HYDROXYL-HERDERITE = HYDROXYLHERDERITE CaBe(PO4)(OH) M
LAUBMANNITE (of Frondel)= Mixture DUFRENITE, KIDWELLITE, BERAUNITE (Fe++,Mn++,Ca)3Fe+++6(PO4)4(OH)12 O
LUCINITE = VARISCITE    
SALMONSITE = Mixture HUREAULITE + JAHNSITE    
PRIXITE = MIMETITE    
MANGANESE HORNESITE = MANGANESEHOERNESITE (Mn,Mg)3(AsO4)2.8H2O M
PSEUDOWAVELLITE = CRANDALLITE    
NATRIUM PHARMACOSIDERITE = NATROPHARMACOSIDERITE (Na,K)2Fe+++4(AsO4)3(OH)5.7H2O Q ps C
NATRIUM URANOSPINITE = NATROURANOSPINITE (Na2,Ca)(UO2)2(AsO4)2.5H2O Q
NATROMONTEBRASITE = Mixture AMBLYGONITE, LACROIXITE, WARDITE (Na,Li)Al(PO4)(OH,F) (?) A
NEOMESSELITE = MESSELITE    
NATRIUM BETPAKDALITE = BETPAKDALITE-NaCa (Na,Ca)3Fe+++2(As2O4)(MoO4)6.15H2O M
O'DANIELITE = ODANIELITE    
NATRIUM AUTUNITE = SODIUMAUTUNITE Na2(UO2)2(PO4)2.8H2O Q
ORPHEITE = HINSDALITE H6Pb10Al20(PO4)12(SO4)5(OH)40.11H2O (?) R
OXIBERAUNITE = ELEONORITE    
PALAITE = HUREAULITE    
PALLITE = FERRIAN MILLISITE    
PHOSPHORITE = Mixture. Fossile excrements    
PHOSPHOHEDYPHANE-(F) = FLUORPHOSPHOHEDYPHANE Ca2Pb3(PO4)3OH H
PSEUDOLINDACKERITE = ONDRUSITE    
META URANOSPINITE = METAURANOSPINITE Ca(UO2)2(AsO4)2.8H2O Q
VANURANYLITE = VANURALITE (H3O,Ba,Ca,K)1,6(UO2)2V2O8.4H2O (?) O (?)
RASHLEIGHITE = FERRIAN TURQUOISE    
AGARDITE-(Ca) = ZALESIITE CaCu++6(AsO4)3(OH)6.3H2O (?) H
MERRILITE = WHITLOCKITE in METEORITES (?)    
QUERCYITE = CARBONATE APATITE    
META ANKOLEITE = META-ANKOLEITE K2(UO2)2(PO4)2.6H2O Q
GARTRELLITE (ZINCIAN) = GARTRELLITE PbCu(Zn,Fe,Cu)(AsO4)2(OH,H2O)2 A
META URANOCIRCITE = METAURANOCIRCITE Ba(UO2)2(PO4)2.6-8H2O M
LUSUNGITE = BENAUITE (Sr,Pb)Fe+++3(PO4)2(OH)5.H2O R
METASTRENGITE = PHOSPHOSIDERITE    
METAURANOCIRCITE II = METAURANOCIRCITE Ba(UO2)2(PO4).6H2O M
MEURIGITE = MEURIGITE-K KFe+++7(PO4)5(OH)7.8H2O M
MIMETESE = MIMETITE    
ACHREMATITE = MIMETITE + WULFENITE    
MOTTRAMITE CALCIAN = MOTTRAMITE (Pb,Ca)(Cu,Zn)(V,P)O4(OH) O
META AUTUNITE = META-AUTUNITE Ca(UO2)2(PO4)2.2-6H2O Q
TIROLITE = TYROLITE    
HOERNESITE = HORNESITE    
KUPFERGLIMMER = CHALCOPHYLLITE    
TROEGERITE = TROGERITE    
BARIUM PHARMACOSIDERITE = BARIOPHARMACOSIDERITE BaFe+++4(AsO4)3(OH)5.5H2O Q ps C
TRICHLORITE = TYROLITE    
HUEHNERKOBELITE = HUHNERKOBELITE    
HYDROXYAPATITE = HYDROXYLPATITE    
TRICHALCITE = TYROLITE   M
BARRANDITE = STRENGITE-VARISCITE    
THOMETZEKITE (SULFATIAN) = THOMETZEKITE Pb(Cu,Zn)2[As,S)O4]2(OH,H2O)2 M
HYDROGEN AUTUNITE = CHERNIKOVITE    
AVELINOITE = CYRILOVITE    
HYDROHERDERITE = HYDROXYLHERDERITE    
TAVISTOCKITE = APATITE    
ATTACOLITE = ATTAKOLITE (Ca,Sr)Mn++(Al,Fe+++)4[(Si,P)O4]H(PO4)3(OH)4 M
HUHNERKOBELITE = ALLUAUDITE or FERROALLUAUDITE    
WARRENITE = OWYHEEITE or JAMESONITE    
GARTRELLITE ZINCIAN = GARTRELLITE Pb(Zn,Fe,Cu)2(AsO4)2(OH,H2O)2 A
GENEVEITE = THEISITE (?) (Cu,Zn)5(AsO4)(OH)7.H2O H
MERRILLITE-(Na) = MERRILLITE    
ZINCLAVENDULAN = Zincian LAVENDULAN NaCa(Zn,Cu)5(AsO4)4Cl.4-5H2O O
YTTROORTHITE (YTTRO ORTHITE) = ALLANITE-(Y)    
BELLITE = MIMETITE with PO4, SiO4, CrO4   H
MACGOVERNITE = MCGOVERNITE    
WEINSCHENKITE = CHURCHITE-(Y)    
HIGGINSITE = CONICHALCITE    
GRUNBLEIERZ = PYROMORPHITE or MIMETITE    
UTAHLITE = VARISCITE    
BASTINITE = HUREAULITE    
HEMAFIBRITE = SYNADELPHITE    
URANITE = AUTUNITE and META-AUTUNITE groups    
TURNERITE = MONAZITE    
BARIUMZINCALUMOPHARMACOSIDERITE (?) (Ba,K)0,5(Zn,Cu)0,5(Al,Fe)4(AsO4)3(OH)5.5H2O Q
WILKEITE = APATITE or FLUORELLESTADITE    
FERMORITE = JOHNBAUMITE-M (Ca,Sr)5(AsO4,PO4)3(OH) H
KEHOEITE = WOODHOUSEITE + GYPSUM + QUARTZ + SPHALERITE (Zn,Ca)Al2(PO4)2(OH)2.5H2O (?)  
BARIOOLGITE = Ba rich OLGITE Na(Na,Sr)2(Ba,Sr)(PO4)2 H
BARIUMALUMOPHARMACOSIDERITE = inadequately described mineral Ba(Al,Fe+++)4(AsO4)3(OH)5.5H2O Q ps C
KERCHENITE = METAVIVIANITE    
CARBONATEFLUORAPATITE = FLUORAPATITE (carbonate-rich) Ca5(PO4,CO3)3F H
HYDROXYLAPATITE-M = HYDROXYLAPATITE    
ANIYUNWIYAITE = KINGSMOUNTITE Ca3Mn++Fe++Al4(PO4)6(OH)4.12H2O A
CLINOMIMETITE = MIMETITE-M Pb5(AsO4)3Cl M ps H
KERTSCHENITE = Oxidation product of VIVIANITE    
KOBALTBLUTHE = ERYTHRITE    
HURÉAULITE = HUREAULITE   M
KOETTIGITE = KOTTIGITE    
APHANESE = CLINOCLASE    
APATITE-(SrOH) = FLUORSTROPHITE Sr4Ca(PO4)3F H
KULARITE = MONAZITE-(Ce)    
APATITE-(CaOH) = HYDROXYLPATITE    
CARBONATEHYDROXYLAPATITE = HYDROXYLAPATITE carbonate rich Ca5(PO4,CO3)3(OH) H
SPODIOSITE = Mixture FLUORAPATITE, CALCITE, SERPENTINE    
SODIUM META-AUTUNITE = METANATROAUTUNITE Na2(UO2)2(PO4)2.6-8H2O Q
SODIUM AUTUNITE = SODIUMAUTUNITE Na2(UO2)2(PO4)2.8H2O Q
ARROJADITE-(BaFe) = SIGISMUNDITE Na2BaCaFe++14Al(PO4)11(PO3OH)(OH)2 M
SODIUMBETPAKDALITE = BETPAKDALITE-NaCa    
KARAFVEITE = MONAZITE    
ARSENATEBELOVITE = TALMESSITE    
SIDERETINE = PITTICITE    
STAFFELITE = CARBONATEFLUORAPATITE    
TAGILITE = PSEUDOMALACHITE    
ARSENOBISMITE = PREISINGERITE + ATELESTITE Bi2(AsO4)(OH)3 (?)
ARSENDESTINEZITE = BUKOVSKYITE    
FLUOROPOTASSICMAGNESIOARFVEDSONITE = POTASSICMAGNESIOFLUOROARFVEDSONITE KNa2(Mg,Fe++)5Si8O22(F,OH)2 M
POTASSICALUMINOSADANAGAITE = Not valid KCa2Al2(Fe++)3(Si5Al3)O22(OH)2 M
FLUOROFERROLEAKEITE = FERROFERRIFLUOROLEAKEITE NaNa2(Fe++2Al2Li)(Si8O22)F2 M
FLUORTHALENITE-(Y) = THALENITE-(Y) Y3Si3O10F M
FOWLERITE = a variety of RHODONITE (Mn,Zn)SiO3 A
HELVITE = HELVINE    
HYDROSODALITE Na6[AlSiO4]6.8H2O C
HYDROXYLMATTHEDDLEITE Pb5(SiO4)1,5(PO4)1,5OH  
ILMAJOKITE See: ILMAJOKITE-(Ce) Na11KBaCe2Ti12Si37,5O94(OH)31.29H2O M
KOZULITE = MANGANOFERRIECKERMANNITE NaNa2Mn++4(Fe+++,Al)Si8O22(OH)2 M
LIGURIAITE = LAVINSKYITE-1M K(Li,Cu)Cu6(Si4O11)2(OH)4 M
MAGNESIOFERRIKATOPHORITE = FERRIKATOPHORITE Na2Ca(Mg,Fe++)4Fe+++Si7AlO22(OH)2 (?) M
FLUOROFERROLEAKEITE = see FERROFLUOROLEAKEITE NaNa2(Fe++2Fe+++2Li)Si8O22F2 M
MARIANOITE = WOHLERITE Na2Ca4Nb(Nb,Zr)(Si2O7)2(O,F)4 M
FLUOROCLINOHOLMQUISTITE = Uncertain (?)  
POTASSICALUMINOTARAMITE = POTASSICFERROTARAMITE (K,Na)2(Ca,Na)(Fe++,Mg)3(Al,Fe+++)2(AlSi3O11)2(OH)2 M
POTASSICCHLOROFERRIMAGNESIOTARAMITE= CHLOROPOTASSICFERRIMAGNESIOTARAMITE    
POTASSICLEAKEITE = POTASSICFERRILEAKEITE KNa2Mg2Fe+++2LiSi8O22(OH)2 M
POTASSICMAGNESIOSADANAGAITE = POTASSICSADANAGAITE (K,Na)Ca2[Mg3(Al,Fe+++)2]Si5Al3O22(OH)2 M
SODICFERRIPEDRIZITE = see FERROFERRIPEDRIZITE NaLi3(Mg,Fe++)2Fe+++2(Si8O22)(OH,F)2 M
SODICPEDRIZITE = PEDRIZITE ou FERRIPEDRIZITE NaLi2(LiMg2Fe+++Al)(Si8O22)(OH,F)2 M
URANOPHANE-alpha = URANOPHANE   M
VALENCIANITE = A variety of K-Feldspar    
GISMONDINE = GISMONDINE-Ca    
FERRIOTTOLINIITE    
ALUMINOOTTOLINIITE    
MANGANOGRUNERITE = CLINOFERROSUENOITE []Mn2Fe++5Si8O22(OH)2 M
EKMANITE = A Mn rich Stilpnomelane (Fe++,Mg,Mn,Fe+++)3(Si,Al)4O10(OH)2.2H2O (?) O
ALUMINOFERROBARROISITE = FERROBARROISITE [](CaNa)Fe++3Al2Si7AlO22(OH)2 (?) M
ALUMINOFERROTSCHERMAKITE = FERROALUMINOTSCHERMAKITE []Ca2(Fe++3Al2)Si6Al2O22(OH)2 (?) M
ALUMINOMAGNESIOSADANAGAITE NaCa2[Mg3(Al,Fe+++)2]Si5Al3O22(OH)2 M
ALUMINOMAGNESIOTARAMITE Na2Ca(Mg,Fe++)3Al2(AlSi3O11)2(OH)2 M
ALUMINOTSCHERMAKITE = TSCHERMAKITE []Ca2(Mg3Al2)Si6Al2O22(OH)2 (?) M
BAKERITE = DATOLITE Ca4B4(BO3)(SiO4)3(OH)5 M
BARIUMBANNISTERITE (K,H3O)(Ba,Ca)(Mn++,Fe++,Mg)21(Si,Al)32O80(O,OH)16.4-12H2O M
BRAMMALLITE = PARAGONITE, ILLITE Na0,65Al2[]Al0,65Si3,35O10(OH)2 M
CERITE-(La) = FERRICERITE-(La) (La,Ce,Ca)9Fe+++(SiO4)3(SiO3OH)4(OH)3 R
CHLOROPOTASSICFERRIMAGNESIOTARAMITE K(CaNa)(Mg3Fe+++2)(Al2Si6O22)(Cl,OH)2  
FLUOROSODICFERROPEDRIZITE = FERROFLUOROPEDRIZITE NaLi2(Fe++2Al2Li)Si8O22F2 M
EHIMEITE = CHROMIOPARGASITE NaCa2(Mg4Cr)(Si6Al2)O22(OH)2 M
ALUMINOBARROISITE = BARROISITE [](CaNa)Mg3Al2Si7AlO22(OH)2 (?) M
ERICSSONITE-2O = A polytype of Ericssonite BaMn2(Fe+++O)Si2O7(OH) O
FERRICFERRONYBOITE = invalid name NaNa2(Fe++3Fe+++2)Si7AlO22(OH)2 (?) M
FERRICLINOFERROHOLMQUISTITE = see CLINOFERROFERRIHOLMQUISTITE Li2(Fe++,Mg)3(Fe+++,Al)2Si8O22(OH;F)2 M
FERRICLINOHOLMQUISTITE [](Li2Mg3Fe+++2)Si8O22(OH)2 (?) M
FERRIMAGNESIOTARAMITE = Invalid name Na(CaNa)Mg3Fe+++2Si6Al2O22(OH)2 (?) M
FERRINYBOITE NaNa2(Mg3Fe+++2)Si7AlO22(OH)2 (?) M
FERROALUMINOTSCHERMAKITE = FERROTSCHERMAKITE []Ca2Fe++3Al2(Si7Al)O22(OH)2 (?) M
FERROOTTOLINIITE = Uncertain []NaLi(Fe++3Fe+++Al)Si8O22(OH)2 M
FERROWHITTAKERITE = Uncertain Na(NaLi)2(Fe++2AlFe+++Li)(Si8O22)(OH)2 M
FLUOROALUMINOLEAKEITE = FLUOROLEAKEITE NaNa2(Mg2Al2Li)Si8O22F2 M
FLUOROALUMINOMAGNESIOTARAMITE = FLUOROTARAMITE Na2Ca(Mg,Fe++)3Al2(AlSi3O11)2(F,OH)2 M
CLINOSODICFERRIFERROHOLMQUISTITE = see SODICFERRICLINOFERROHOLMQUISTITE (Na,[])Li2(Fe++,Mg)3Fe+++2Si8O22(OH)2 M
FERROAXINITE = AXINITE-(Fe) Ca2Fe++Al2BO3Si4O12(OH) A
DELLAVENTURAITE = MANGANIDELLAVENTURAITE NaNa2(MgMn+++2Ti++++Li)Si8O22O2 M
ELLESTADITE-(F) = FLUORELLESTADITE Ca5(SiO4,PO4,SO4)3(F,OH,Cl) H
ELLESTADITE-(OH) = HYDROXYLELLESTADITE Ca10(SiO4)3(SO4)3(OH,Cl,F)2 M ps H
EPIDOTE-(Pb) = HANCOCKITE (Pb,Ca,Sr)2(Al,Fe+++)3(SiO4)3(OH) M
ELLESTADITE-(Cl) = CHLORELLESTADITE (?) Ca5(SiO4,PO4,SO4)3(Cl,F) (?) O
FERRO-AXINITE = AXINITE-(Fe) Ca2Fe++Al2BO3Si4O12(OH) A
CARYOCERITE = THORIAN MELANOCERITE-(Ce) (?)    
FERROOBERTIITE = FERROFERRIOBERTIITE NaNa2(Fe++3Fe+++Ti++++)Si8O22O2 M
CHLORELLESTADITE (?) Ca5(SiO4,PO4,SO4)3(Cl,F) (?) O
FERROPYROSMALITE = PYROSMALITE-(Fe) (Fe++,Mn++)8Si6O15(OH,Cl)10 H
FLUOROMAGNESIOARFVEDSONITE = MAGNESIOFLUOROARFVEDSONITE (Na,K)Na2(Mg,Fe++)4Fe+++Si8O22(F,OH)2 M
FLUOROMAGNESIOHASTINGSITE = MAGNESIOFLUOROHASTINGSITE NaCa2(Mg4Fe+++)Si6Al2O22F2 M
SODIUMKOMAROVITE = NATROKOMAROVITE Na6Ca(Nb,Ti)6(Si4O12)(O,OH)14(F,OH)2.3-4H2O O
FLUOROPOTASSICHASTINGSITE = POTASSICFLUOROHASTINGSITE KCa2(Fe++4Fe+++)Si6Al2O22F2 M
HYDROXYAPOPHYLLITE = APOPHYLLITE-(KOH) KCa4Si8O20(OH,F).8H2O Q
JUSITE = TOBERMORITE? Na2Ca15Al4Si16O54.17H2O  
LITHIDIONITE = LITIDIONITE KNaCuSi4O10 A
MAGNESIOAXINITE = AXINITE-(Mg) Ca2MgAl2BO3Si4O12(OH) A
FERRIOTTOLINIITE = CLINOFERRIHOLMQUISITE Na0,5(Na,Li)2Li0,5(Mg,Fe++,Zn)3Fe+++2(Si8O22)(OH,F)2 M
CALCIUM CATAPLEIITE = CALCIOCATAPLEIITE CaZrSi3O9.2H2O H
WOLLASTONITE-1T = WOLLASTONITE-1A CaSiO3 A
MAGNESIO-AXINITE = AXINITE-(Mg) Ca2MgAl2BO3Si4O12(OH) A
ANDROSITE-(La) = MANGANIANDROSITE-(La) (Mn++,Ca)(La,Ce,Ca,Nd)AlMn+++Mn++(SiO4)(Si2O7)O(OH) M
APOPHYLLITE-(KF) = FLUORAPOPHYLLITE-(K) (K,Na)Ca4Si8O20(F,OH).8H2O O
ALUMINOTARAMITE = FERROTARAMITE Na2Ca(Fe++,Mg)3Al2(AlSi3O11)2(OH)2 M
CESIUMKUPLETSKITE = KUPLETSKITE-(Cs) (Cs,K)2Na(Mn,Fe,Li)7(Ti,Nb)2Si8O26(OH)4F A
BITIKLEITE-(SnAl) = BITIKLEITE {Ca3}[Sb+++++Sn++++](Al3)O12 C
BITIKLEITE-(SnFe) = DZHULUITE {Ca3}[Sb+++++Sn++++](Fe+++3)O12 C
BITIKLEITE-(ZrFe) = USTURITE {Ca3}[Sb+++++Zr](Fe+++3)O12 C
CHLOROPOTASSICHASTINGSITE = POTASSICCHLOROHASTINGSITE KCa2(Fe++4Fe+++)Si6Al2O22(Cl,OH)2 M
CENOSITE = KAINOSITE-(Y)    
CLINOBARYLITE = BARYLITE-1O BaBe2Si2O7 O
CALCIUMCATAPLEIITE = CALCIOCATAPLEIITE CaZrSi3O9.2H2O H
CHABASIE = CHABAZITE    
CEROLITE = KEROLITE = disodered TALC    
CESIUM KUPLETSKITE = KUPLETSKITE-(Cs) (Cs,K,Na)3(Mn,Fe++)7(Ti,Nb)2Si8O24(O,OH,F)7 A
CHAMELEONITE = TOURMALINE    
AËRINITE = AERINITE   H
CATOPTRITE = KATOPTRITE    
CATGOLD (CAT GOLD) = MUSCOVITE    
CATAPLEIITE-ALPHA = GAIDONNAYITE    
CERITE-(La) = FERRICERITE-(La) (La,Ce,Ca)9Fe+++(SiO4)3(SiO3OH)4(OH)3 R ps H
CENTRALLASITE = GYROLITE    
ANALCITE = ANALCIME    
BRAMMALLITE = a series name (Na,H3O)(Al,Mg,Fe)2(Si,Al)4O10[(OH)2,H2O] (?) M
APYRITE = RUBELLITE = ELBAITE    
BRANDISITE = CLINTONITE    
APOPHYLLITE-(NaF) = FLUORAPOPHYLLITE-(Na)    
APOPHYLLITE-(Na) = FLUORAPOPHYLLITE-(Na)    
APOPHYLLITE-(KOH) = HYDROXYAPOPHYLLITE-(K)    
APOPHYLLITE = APOPHYLLITE-(KF) or -(KOH) or -(NaF)    
APLOME = ANDRADITE    
APHRIZITE = SCHORL    
ALMANDITE = ALMANDINE    
ANOPHORITE = FERRINYBOITE (Na,K)Na2(Mg,Fe++)3(Fe+++,Ti)2(Al0,5Si3,5O11)2(OH)2 M
ARGENT DES CHATS = MUSCOVITE    
AMPHIGENE = LEUCITE    
AMPHIBOLE = AMPHIBOLE group    
AMOSITE = Mainly GRUNERITE    
AMIANTHUS = TREMOLITE, ACTINOLITE, CHRYSOTILE, etc    
AMAZONITE = MICROCLINE    
BRONZITE = FERROAN ENSTATITE (Mg,Fe++)2Si2O6 O
ALVITE = ZIRCON with Hf    
ALUSHTITE = mixture DICKITE + HYDROMICA (Ca,Mg,K,Na)0,3(Al,Mg,Li,Fe)6.87(Si6.76Al1,24O20)(OH)10.3H2O  
ALURGITE = Mg, Fe, Mn MUSCOVITE    
CALCIUMLARSENITE = ESPERITE    
ANTIEDRITE = EDINGTONITE    
BARIUMBREWSTERITE = BREWSTERITE-Ba (Ba,Sr)Al2Si6O16.5H2O M
BISBEEITE = PLANCHEITE-CHRYSOCOLLA (?) CuSiO3.H2O (?)  
BIOTITE (-1M,-2M,-5M1,-6A) = Series name K(Mg,Fe++)3(Al,Fe+++)Si3O10(OH,F)2 (?) M/A
BERYLLOSODALITE = TUGTUPITE    
BENTONITE = Mainly MONTMORILLONITE    
BELORUSSITE-(Ce) = BYELORUSSITE-(Ce)    
BEIJING JADE = RHODONITE    
BECKELITE = BRITHOLITE-(Ce)    
BAUMITE = ZINCIAN CARYOPILITE or ZINCIAN GREENALITE (Mg,Mn++,Fe++,Zn)3(Si,Al)2O5(OH)4 M
BASTONITE = BIOTITE    
BARYTKREUZSTEIN = HARMOTOME    
AQUAMARINE = BERYL    
BARKEVIKITE = FERROHORNBLENDE    
ARDUINITE = MORDENITE    
BARIUM BANNISTERITE = BARIUMBANNISTERITE (K,H3O)(Ba,Ca)(Mn++,Fe++,Mg)21(Si,Al)32O80(O,OH)16.4-12H2O M
BARIO ORTHOJOAQUINITE = BARIO-ORTHOJOAQUINITE (Ba,Sr)4Fe++2Ti2Si8O26.H2O O
BAIKALITE = DIOPSIDE CaMgSi2O6 M
AXINITE = AXINITE-(Fe) or -(Mg) or -(Mn)    
ATTAPULGITE = PALYGORSKITE    
ASHTONITE = MORDENITE    
ASBESTOS = TREMOLITE, ACTINOLITE, CHRYSOTILE, etc.    
ASBEFERRITE = CUMMINGTONITE MANGANOAN (Mg,Fe++,Mn++)7Si8O22(OH)2 M
TSCHERNISCHEWITE = AMPHIBOLE variety, near RICHTERITE    
ALLEVARDITE = RECTORITE    
BARSANOVITE = GEORGBARSANOVITE    
ORTHOERICSSONITE = ERICSSONITE (-2O) BaMn2(Fe+++O)Si2O7(OH) O
STURTITE = HISINGERITE or NEOTOCITE Fe+++(Mn++,Ca,Mg)Si4O10(OH)3.10H2O am.
STRONTIOPIEMONTITE = PIEMONTITE-(Sr) CaSr(Al,Mn+++,Fe+++)3Si3O11O(OH) M
SODICGEDRITE = PAPIKEITE NaMg6AlSi6Al2O22(OH)2 O
SODICFERROGEDRITE = FERROPAPIKEITE NaFe++6AlSi6Al2O22(OH)2 O
CANBYITE = HISINGERITE    
PROTOMANGANOFERROANTHOPHYLLITE = PROTOFERROSUENOITE (Mn++,Fe++)2(Fe++,Mg)5(Si4O11)2(OH)2 O
PLANCHÉITE = PLANCHEITE   O
PARVOWINCHITE = FERRIGHOSEITE Na(Na,Mn++)2Mg4Fe+++Si8O22(OH,F)2 M
PARASPURRITE = SPURRITE Ca5(SiO4)2(CO3) M
BUERGERITE = FLUORBUERGERITE NaFe+++3Al6(Si6O18)(BO3)3O3F R
CARBONATEVISHNEVITE = a variety (?) Na7Al5Si7O24CO3.2,5H2O or Na8(AlSiO4)6CO3.H2O  
SWAMBOITE = SWAMBOITE-(Nd) Nd0.33[(UO2)(SiO3OH)].2,5(H2O) M
CARBONATE-VISHNEVITE = CARBONATEVISHNEVITE    
ORTHOCHRYSOTILE Mg3Si2O5(OH)4 O
NATROAPOPHYLLITE = APOPHYLLITE-(NaF) NaCa4Si8O20F.8H2O O
MELANOCERITE-(Ce) (= TRITOMITE-(Ce)?) (Ce,Ca)5(Si,B)3O12(OH,F).nH2O (?) H
MAUFITE = CLINOCHLORE and LIZARDITE (Mg,Ni)Al4Si3O13.4H2O (?) (?)
MANGANPYROSMALITE = PYROSMALITE-(Mn) (Mn++,Fe++)8Si6O15(OH,Cl)10 H
MANGANOPYROSMALITE = PYROSMALITE-(Mn) (Mn++,Fe++)8Si6O15(OH,Cl)10 H
MANGANOCUMMINGTONITE = CLINOSUENOITE []Mn++2Mg5Si8O22(OH)2 M
MANGANIPIEMONTITE-(Sr) = TWEDDILLITE CaSr(Mn+++,Fe+++)2Al(SiO4)(Si2O7)O(OH) M
MAGNESIUMASTROPHYLLITE = LOBANOVITE K2Na2(Fe++,Fe+++,Mn)4Mg2Ti2Si8O26(OH)4 M
OTTOLINIITE []Na,Li(Mg3Fe+++Al)(Si8O22)(OH)2 M
CALCIOGADOLINITE-(Y) = variety of GADOLINITE-(Y) (YCa)Fe+++Be2Si2O8O2  
ALKALI FELDSPARS = FELDSPARS with K+ and Na+    
ALEXANDRITE = CHRYSOBERYL    
AIGUEMARINE (AIGUE-MARINE) = AQUAMARIN = BERYL    
AGRICOLITE = EULYTITE    
AGALMATOLITE = TALC or PYROPHYLLITE or PINITE    
ADULARIA = ORTHOCLASE    
BYSSOLITE = ACTINOLITE-TREMOLITE    
ADULARE = ORTHOCLASE    
ACMITE = AEGIRINE NaFe+++Si2O6 M
ACHROITE = ELBAITE OR ROSSMANITE    
SURKHOBITE = PERRAULTITE (Ba,K)2CaNa(Mn,Fe++,Fe+++)8Ti4(Si2O7)4O4(F,OH,O)6 M
ABUKUMALITE = BRITHOLITE-(Y)    
CALIFORNITE = VESUVIANITE    
ABKHAZITE = TREMOLITE    
ZINALSITE = FRAIPONTITE Zn2AlSi2O5(OH)4.2H2O (?) M
CALCIUM CATAPLEIITE = CALCIUMCATAPLEIITE CaZrSi3O9.2H2O H
WHITTAKERITE Na(NaLi)(Mg2AlFe+++Li)(Si8O22)(OH)2 M
ADULAIRE = ORTHOCLASE    
VANADIUMDRAVITE = OXYVANADIUMDRAVITE NaV+++3(V4Mg2)(Si6O18)(BO3)3(OH)3O R
URSILITE = MAGNIOURSILITE or CALCIOURSILITE (Mg,Ca)4[(UO2)4(OH)5/(Si2O5)5,5].13H2O O
UNGARETTIITE = MANGANOMANGANIUNGARETTIITE NaNa2(Mn++2Mn+++3)Si8O22O2 M
THOROGUMMITE = THORITE variety Th(SiO4)1-x(OH)4x Q
MAGNESIOSADANAGAITE = SADANAGAITE NaCa2Mg3(Al,Fe++,Ti)2(Al,Si)4(Si2O11)2(OH)2 M
CALAMINE = HEMIMORPHITE    
PERICLINE = ALBITE    
PLAGIOCLASE = FELDSPAR group (Na,Ca)Al(Al,Si)Si2O8  
PISTACITE = EPIDOTE    
PISSITE = OPAL    
PINITE = Altered CORDIERITE    
PIMELITE = NICKELKEROLITE = WILLEMSEITE    
PIAZOLITE = HYDROGROSSULAR    
PHENGITE = a series name K(Mg,Fe)0,5Al1,5(Si3,5Al0,5)O10(OH,F)2 (?) M ps H
PHENACITE = PHENAKITE Be2SiO4 R
PHARAONITE = MICROSOMMITE    
PHACOLITE = CHABAZITE    
PERTHITE = Intergrowth ORTHOCLASE + PLAGIOCLASE    
ORTHOFERROSILITE = FERROSILITE (Fe++,Mg)Si2O6 O
PERIDOT = FORSTERITE    
POLYADELPHITE = ANDRADITE    
PENNINITE = CLINOCHLORE   ps R
PENNINE = CLINOCHLORE   ps R
PAULITE = HYPERSTHENE    
PARAWOLLASTONITE = WOLLASTONITE-2M CaSiO3  
PARAPECTOLITE = PECTOLITE-M2abc    
PARANTHINE = WERNERITE = a SCAPOLITE    
OZARKITE = THOMSONITE    
OXYHORNBLENDE = Volcanic HORNBLENDE (Na,K)0-1Ca2(Mg,Fe++,Fe+++,Al)5(Si,Al)8O22(O,OH)2 M
OUTREMER = ULTRAMARINE = LAZURITE    
ORTHOSE = ORTHOCLASE    
MAGNESIOANTHOPHYLLITE = ANTHOPHYLLITE (Mg,Fe++)7Si8O22(OH)2 O
PERISTERITE = ALBITE    
PTILOLITE = MORDENITE    
RINKOLITE = RINKITE-(Ce)    
RHOENITE = RHONITE    
RHODUSITE = MAGNESIORIEBECKITE    
RANQUILITE = HAIWEEITE    
RAMSAYITE = LORENZENITE Na2Ti2Si2O9 O
RABENGLIMMER = ZINNWALDITE    
PYROXENE = PYROXENE group    
PYROSMALITE = FERROPYROSMALITE-MANGANPYROSMALITE (Fe++,Mn)8Si6O15(OH,Cl)10 H
PYRIBOLE = pyroxene or amphibole OR pyroxene and amphibole    
PYRALSPITE = GARNET subgroup    
PYCNOPHYLLITE = MUSCOVITE or ILLITE    
PLASMA = CHALCEDONY = GREEN QUARTZ    
PUNAHLITE = MESOLITE    
PLAZOLITE = HIBSCHITE = GROSSULAR    
PSEUDOMESOLITE = MESOLITE    
PSEUDOBIOTITE = BIOTITE    
PROTOVERMICULITE = VERMICULITE    
POTSTONE = TALC    
POTASSIUM-FLUOR-MAGNESIO-ARFVEDSONITE = FLUOROPOTASSICMAGNESIOARFVEDSONITE    
POTASSIUMCARPHOLITE = POTASSICCARPHOLITE K0,5-1(Li,Mn++)2Al4(Si2O6)2(OH;F)8 O
POTASSIUM RICHTERITE = POTASSICRICHTERITE (K,Na)(Ca,Na)2(Mg,Fe)5Si8O22(OH,F)2 M
POTASSIUM PARGASITE = POTASSICPARGASITE    
POTASSIUM FLUORRICHTERITE = FLUOROPOTASSICRICHTERITE (K,Na)(Ca,Na)2(Mg,Fe)5Si8O22(F,OH)2 M
POTASSIUM FELDSPAR = MICROCLINE, ORTHOCLASE, SANIDINE    
PORCELAINITE = MULLITE    
ORTHOANTIGORITE = LIZARDITE    
PYCNITE = TOPAZ    
MALACOLITE = DIOPSIDE    
MELINOPHANE = MELIPHANITE    
MELANITE = TITANIAN ANDRADITE    
MEERSCHAUM = SEPIOLITE    
MEDMONTITE = Mixture CHRYSOCOLLA + MICA    
MBOZIITE = TARAMITE    
MASKELYNITE = Glass of PLAGIOCLASE composition    
MASKELYNITE = BYTOWNITE    
MARIPOSITE = CHROMIAN PHENGITE = MUSCOVITE    
MARIENGLAS = MUSCOVITE or GYPSUM    
MANGANOPHYLLITE = MANGANOAN BIOTITE    
MANGANAXINITE = AXINITE-(Mn) Ca2Mn++Al2BO3Si4O12(OH) A
ORTHOPYROXENE = series in PYROXENE group    
MALACON = ZIRCON    
METAHALLOYSITE = HALLOYSITE    
MAITLANDITE = THOROGUMMITE    
MAGNOPHORITE = TITANIAN POTASSIAN RICHTERITE    
MAGNESIUMZINNWALDITE (MAGNESIUM ZINNWALDITE) (?) KLiMgAl2Si3O10F2 (?) M
MAGNESIUM ASTROPHYLLITE = LOBANOVITE (Na,K)4Mg2(Fe++,Fe+++,Mn)5Ti2Si8O24(O,OH,F)7 M
MAGNESIOHOLMQUISTITE = HOLMQUISTITE Li2(Mg,Fe++)3Al2Si8O22(OH)2 O
MAGNESIOHOGBOMITE (8H) = MAGNESIOHOGBOMITE-2N2S   H/R
MAGNESIOHOGBOMITE (24R) = MAGNESIOHOGBOMITE-6N6S    
MAGNESIOHOGBOMITE (10T) = MAGNESIOHOGBOMITE-2N3S   H/R
TSAVORITE = TSAVOLITE = GROSSULAR    
MAGNESIOCUMMINGTONITE = CUMMINGTONITE (Mg,Fe++)7Si8O22(OH)2 M
CHIASTOLITE = ANDALUSITE    
MANGAN NEPTUNITE = MANGANONEPTUNITE KNa2Li(Mn,Fe++)2Ti2Si8O24 M
NATRIUM GEDRITE = SODIUMGEDRITE Na(Mg,Fe++)6Al(Si6Al2)O22(OH)2 O
ORTHITE = ALLANITE-(Ce)    
ORIZITE = EPISTILBITE    
OR DES CHATS = MUSCOVITE    
ONION JADE = SERPENTINE    
OLIVINE = FAYALITE-FORSTERITE or OLIVINE group    
OLIGOCLASE = ALBITE An10-An30 (Na,Ca)[Al(Si,Al)Si2O8]  
OELLACHERITE = BARIAN MUSCOVITE    
NUTTALITE = WERNERITE    
NIMESITE = BRINDLEYITE    
NICKELKEROLITE = WILLEMSEITE    
NEPHRITE = ACTINOLITE    
MEROXENE = BIOTITE    
NATRIUM KOMAROVITE = SODIUMKOMAROVITE (Na,Ca,H)4Nb4Si4O12O8(OH,F)4.2H2O O
MESOTYPE = NATROLITE or MESOLITE or SCOLECITE    
NATRIUM DACHIARDITE = SODIUMDACHIARDITE (Na,K,Ca0,5)4-5(Al4-5Si20-19O48).12-13H2O M
NATRIUM BOLTWOODITE = NATROBOLTWOODITE (H3O)(Na,K)(UO2)SiO4.H2O O
NATRIUM ANTHOPHYLLITE = SODIUMANTHOPHYLLITE Na(Mg,Fe++)7(Si7Al)O22(OH)2 O
NANEKEVITE = BARIO-ORTHOJOAQUINITE    
Na-KOMAROVITE = SODIUM KOMAROVITE    
MORGANITE = BERYL    
MORENCITE = NONTRONITE    
MONREPITE = Ferrian Annite    
MIZZONITE = MARIALITE-MEIONITE    
MINGUETITE = STILPNOMELANE    
MICA = MICA group    
ROTHBRAUNSTEINERZ = RHODONITE    
NATRIUMDACHIARDITE = DACHIARDITE-Na (Na,K,Ca0,5)4-5(Al4-5Si20-19O48).12-13H2O M
TREANORITE = ALLANITE    
UZBEKITE = VOLBORTHITE    
UREYITE = KOSMOCHLOR    
URANOTILE BETA = URANOPHANE BETA    
URANOTILE = URANOPHANE    
URANOTHORITE = THORITE (Th,U)SiO4  
URALITE = AMPHIBOLE pseudomorphous after PYROXENE    
ULTRAMARINE = Syntethic LAZURITE    
UGRANDITE = GARNET subgroup    
TSCHEFFKINITE = CHEVKINITE    
TSAVOLITE = GROSSULAR    
TROOSTITE = MANGANOAN WILLEMITE (Zn,Mn)2SiO4  
RIPIDOLITE = FERROAN CLINOCHLORE    
TRIPHANE = SPODUMENE    
VELARDENITE = GEHLENITE    
TOURMALINE = TOURMALINE group    
TOPAZOLITE = ANDRADITE    
TITANORHABDOPHANE = TUNDRITE    
TITANCLINOHUMITE = CLINOHUMITE variety Mg8TiO2(SiO4)4 M
TITANAUGITE = TITANIAN AUGITE    
TIRODITE = FERRIGHOSEITE Mn++2(Mg,Fe++)5Si8O22(OH)2 M
TIBISCUMITE = ALLOPHANE (Ca,Na,K)(Al,Mg,Fe)4Si8O20(OH)4.H2O M
THURINGITE = FERRIAN CHAMOSITE    
THULITE = a pink ZOISITE manganoan variety   O
TETRAKALSILITE = PANUNZITE    
TERNOVSKITE = MAGNESIORIEBECKITE    
TRIPLOCLASE = THOMSONITE    
WOLCHONSKOITE = VOLKONSKOITE    
BENTONITE = clay with MONTMORILLONITE, etc.    
HIBSCHITE = A GROSSULAR variety    
ZYGADITE = ALBITE    
ZIRKOPHYLLITE = ZIRCOPHYLLITE    
ZINNWALDITE = SIDEROPHYLLITE-POLYLITHIONITE KAl(Fe,Li )(Si3Al)O10F2 M
ZINKKIESELERZ = HEMIMORPHITE    
ZINKGLASERZ = HEMIMORPHITE    
ZEOLITE = ZEOLITE group    
YTTROCERBERYSITE = GADOLINITE-(Y) (Ce,Y)2Be2Si2O8(OH)2  
YTTROCEBERYSITE = HINGGANITE-(Y) (Ce,Y)2Be2Si2O8(OH) M
XINGSAOITE = WILLEMITE COBALTOAN (Zn,Co++)2SiO4 R
VANUXEMITE = Mixture SAUCONITE + HEMIMORPHITE    
XANTHOPHYLLITE = CLINTONITE    
VARAITE = NAMANSILITE NaMn+++(Si2O6) M
WOEHLERITE = WOHLERITE    
WITHAMITE = PIEMONTITE    
WILLIAMSITE = ANTIGORITE    
WERNERITE = MARIALITE-MEIONITE    
WELLSITE = barian PHILLIPSITE-Ca and calcian HARMOTOME   M
VOROBIEVITE = BERYL    
VOLCHONSKOITE = VOLKONSKOITE    
VIRIDINE = MANGANIAN ANDALUSITE (Al,Mn+++)2SiO5  
VIOLAN = DIOPSIDE CaMgSi2O6 M
VERONA EARTH = CELADONITE    
VERDELITE = ELBAITE or SCHORL    
TALTALITE = TOURMALINE    
XINGANITE-(Y) = HINGGANITE-(Y) (Y,Ce)BeSiO4(OH) M
SCHUCHARDTITE = CLINOCHLORE or VERMICULITE    
TAWMAWITE = Cr-EPIDOTE    
SMARAGDITE = Cr ACTINOLITE or Cr OMPHACITE with Tremolite, Talc Cr ACTINOLITE or Cr OMPHACITE with Tremolite, Talc  
SMARAGD = EMERALD = BERYL    
SIBERITE = ELBAITE    
SHERIDANITE = CLINOCHLORE    
SHEPARDITE (of Rose) = ENSTATITE    
SHAFRANOVSKITE FERRIAN = SHAFRANOVSKITE (?) H6(Na,K)6(Fe,Mn)3Si9O27.3H2O  
SEYBERTITE = CLINTONITE    
SERPENTINE = SERPENTINE group A3Si2O5(OH)4 = general formula A = Mg,Fe++,Ni M/O
SERICITE = MUSCOVITE    
SERICITE = Fine grained MUSCOVITE (or PARAGONITE, or ILLITE)    
SMERALDO = EMERALD = BERYL    
SEEBACHITE = CHABAZITE    
SOBOTKITE = ALUMINIAN SAPONITE (?) (K,Ca/2)0.3(Mg2Al)(Si3Al)O10(OH)2.5H2O M
SCHORLITE = SCHORL    
SCHÖRL = SCHORL NaFe++3Al6(Si6O18)(BO3)3(OH)3OH R
SCHEFFERITE = MANGANOAN AEGIRINE (Na,Ca)(Fe+++,Mn++)Si2O6 M
SAUSSURITE = Mixture, mainly ZOISITE, SCAPOLITE, etc.    
SALITE = SAHLITE = DIOPSIDE CaMgSi2O6 M
SAL AMMONIAC = SALAMMONIAC NH4Cl C
SAIMAITE = STRONTIOCHEVKINITE (Sr,REE)4Fe(Ti,Zr)2Ti2Si4O22  
RUBELLITE = ELBAITE    
RUBELLANE = Altered BIOTITE    
ROTHSTEIN = RHODONITE or RHODOCHROSITE    
ROTHOFFITE = ANDRADITE    
MAGNESIOCLINOHOLMQUISTITE = CLINOHOLMQUISTITE Li2(Mg,Fe++)3Al2Si8O22(OH)2 M
SERAPHINITE = CLINOCHLORE    
SPENCITE = TRITOMITE-(Y)    
ROEPPERITE = FAYALITE or TEPHROITE (Fe++,Mn,Zn)2SiO4 O
TAENIOLITE = TAINIOLITE    
TAAFFEITE = MAGNESIOTAAFFEITE-6N'3S Mg2BeAl6O12 H
SWETLOZARITE = SVETLOZARITE (Ca0,5,K,Na)4-5(Al4-5Si20-19O48).12-13H2O O
SVITALSKITE = CELADONITE    
SVETLOZARITE = DACHIARDITE-Ca (Ca0,5,K,Na)4-5(Al4-5Si20-19O48).12-13H2O O
STRONTIO ORTHOJOAQUINITE = STRONTIOORTHOJOAQUINITE Sr2Ba2(Na,Fe++)2Ti2Si8O24(O,OH)2.H2O O
STRAHLSTEIN = ACTINOLITE    
STRAETLINGITE = STRATLINGITE Ca2Al[(OH)6AlSiO2-3(OH)4-3].2,5H2O R
STEATITE = TALC    
STAUROTIDE = STAUROLITE    
SMECTITE = SMECTITE group    
SPESSARTITE = SPESSARTINE    
TANZANITE = ZOISITE    
SORETITE = HORNBLENDE variety 2[NaCa2(Mg,Fe++,Fe+++)5(Si,Al)8O22(OH)2]  
SOMMAITE = LEUCITE    
SODIUMPHLOGOPITE = ASPIDOLITE NaMg3AlSi3O10(OH)2 M
SODIUMDACHIARDITE = DACHIARDITE-Na (Na,K,Ca0,5)4-5(Al4-5Si20-19O48).12-13H2O M
SODIUM PHLOGOPITE = SODIUMPHLOGOPITE NaMg3Si3AlO10(OH)2 M
SODIUM KOMAROVITE = SODIUMKOMAROVITE (Na,Ca,H)4Nb4Si4O12O8(OH,F)4.2H2O O
SODIUM GEDRITE = SODIUMGEDRITE Na(Mg,Fe++)6Al(Si6Al2)O22(OH)2 O
SODIUM DACHIARDITE = SODIUMDACHIARDITE (Na,K,Ca0,5)4-5(Al4-5Si20-19O48).12-13H2O M
SODIUM BOLTWOODITE = NATROBOLTWOODITE (H3O)(Na,K)(UO2)SiO4.H2O O
SODIUM ANTHOPHYLLITE = SODIUMANTHOPHYLLITE Na(Mg,Fe++)7(Si7Al)O22(OH)2 O
SODIC-FERRIPEDRIZITE = SODICFERRIPEDRIZITE   M
SODA FELDSPAR = ALBITE    
SPHENE = TITANITE    
EULYTITE = EULYTINE Bi4(SiO4)3 C
DUPORTHITE =TALC + CHLORITE    
FERRITHORITE = Mixture THORITE + Fe HYDROXIDE    
FERRIPHLOGOPITE (FERRI-PHLOGOPITE) = TETRAFERRIPHLOGOPITE    
FERRIFAYALITE = LAIHUNITE    
FERRIDRAVITE = POVONDRAITE, Fe rich DRAVITE or BUERGERITE (Na,K)(Mg,Fe++)3Fe+++6(BO3)3Si6O18(O,OH)4 R
FERRIDIOPSIDE = FERRIAN DIOPSIDE    
FERRICLINOHOLMQUISTITE = FERRICLINOFERROHOLMQUISTITE (?) Li2(Fe++,Mg)3(Fe+++,Al)2Si8O22(OH,F)2 M
FERRIANNITE (FERRI-ANNITE) = TETRAFERRIANNITE    
FERCHEVKINITE = FERRIAN CHEVKINITE    
FELDSPATH = FELDSPAR group    
FELDSPAR = FELDSPAR group    
FERROELBAITE = SCHORL    
FAROELITE = THOMSONITE    
FERROHYPERSTHENE = FERROSILITE    
EULITE = FERROSILITE    
EUCOLITE = EUDIALYTE    
ESMERALDA = EMERALD = BERYL    
ERRITE = PARSETTENSITE    
EPIDESMINE = STILBITE    
ENIGMATITE = AENIGMATITE    
ENDELLITE = HALLLOYSITE Al2Si2O5(OH)4.2H2O M
EMERAUDE = EMERALD = BERYL    
EMERALD = BERYL    
ELLESTADITE = FLUORELLESTADITE- or HYDROXYLELLESTADITE    
GOSHENITE = BERYL    
FASSAITE = DIOPSIDE or AUGITE Ca(Mg,Fe+++,Al)(Si,Al)2O6 M
FUGGERITE = MELILITE    
GORGYITE = GORGEYITE    
GOETZENITE = GOTZENITE    
MAGNESIOALUMINOKATOPHORITE = MAGNESIOKATOPHORITE Na2Ca(Mg,Fe++)4Al(Si7Al)O22(OH)2 M
GLAUKOLITE = SCAPOLITE = MEIONITE-MARIALITE    
MAGNESIOGEDRITE = GEDRITE (Mg,Fe++)5Al2Si6Al2O22(OH)2 O
GLAGERITE = HALLOYSITE    
GINZBURGITE = ROGGIANITE Ca4Al4Be2Si7O24(OH)4.3H2O Q
GILBERTITE = MUSCOVITE    
GIGANTOLITE = MUSCOVITE + CORDIERITE    
GIBSONITE = THOMSONITE    
GENTHITE = GARNIERITE    
FERROCHIAVENNAITE = FERROCHIAVENNITE Ca1-2FeSi5Be2O13(OH)2.2H2O  
GARNET = GARNET supergroup    
DUPARCITE = VESUVIANITE variety    
FUCHSITE = CHROMIAN MUSCOVITE    
FRAUENGLAS = MUSCOVITE    
FRAUENGLAS = MICA    
FOWLERITE = ZINCIAN RHODONITE (Mn,Zn)SiO3  
FLUORO-NATRUIMPEDRIZITE = FLUOROSODICFERRIPEDRIZITE    
FLUORO-MAGNESIO-ARFVEDSONITE = FLUOROMAGNESIOARFVEDSONITE    
FLUORO-KALIUM-MAGNESIO-ARFVEDSONITE = FLUOROPOTASSICMAGNESIOARFVEDSONITE    
FIBROLITE = SILLIMANITE    
FERROSCHORLITE = SCHORL    
FERROSCHALLERITE = NELENITE    
FERROPUMPELLYITE = PUMPELLYITE-(Fe++) Ca2Fe++Al2(SiO4)(Si2O7)(OH)2.H2O M
GENEVITE = VESUVIANITE    
CLINOPYROXENE = series in PYROXENE group    
EKBERGITE = WERNERITE = a SCAPOLITE variety    
CROMOLITE = TOURMALINE    
CROCIDOLITE = RIEBECKITE    
CRESTMOREITE = Mixture TOBERMORITE + WILKEITE    
COSSYRITE = AENIGMATITE    
CORUNDOPHILITE = CLINOCHLORE    
CORONITE = DRAVITE    
CONNARITE = GARNIERITE (?)    
COMPTONITE = THOMSONITE    
COLOPHONITE = ANDRADITE    
COCKLE = SCHORL    
CRUCITE = CHIASTOLITE = ANDALUSITE    
CLINOZOISITE-(Sr) = NIIGATAITE CaSr(Al,Fe+++)3(Si2O7)(SiO4)O(OH) M
CUIVRE HYDROSILICEUX = CHRYSOCOLLA    
CLINOHYPERSTHENE = CLINOENSTATITE-CLINOFERROSILITE   M
CLINOCHLORE MANGANOAN = CLINOCHLORE Mg3Mn2Al(Si3AlO10)(OH)8 M
CLEAVELANDITE = ALBITE    
CINNAMON STONE = HESSONITE = GROSSULAR    
CHRYSOLITE = OLIVINE    
CHRISTIANITE = ANORTHITE or PHILLIPSITE    
CHLOROPAL = NONTRONITE    
CHLOROMELANITE = JADEITE    
CHLORO-KALIUMHASTINGSITE = CHLORO POTASSICHASTINGSITE    
CHLORITE = CHLORITE group    
CHLORASTROLITE = PUMPELLYITE    
COCCOLITE = DIOPSIDE    
DEMANTOIDE = ANDRADITE    
DUBUISSONITE = MONTMORILOLONITE    
DUBUISSONITE = MONTMORILLONITE    
DROOGMANSITE = KASOLITE    
DISTHENE = KYANITE    
DIPYRE = SCAPOLITE    
DICHROITE = CORDIERITE    
DIALLAGE = DIOPSIDE CaMgSi2O6 M
DIAGONITE = BREWSTERITE    
DIABANTITE = FERROAN CLINOCHLORE    
DEWEYLITE = CLINOCHRYSOTILE-LIZARDITE (?)    
DEWALQUITE = ARDENNITE    
CROSSITE = GLAUCOPHANE or RIEBECKITE Na2(Mg,Fe++)3(Al,Fe+++)2Si8O22(OH)2 M
DESMINE = STILBITE    
GLIMMER = MICA    
DELESSITE = MAGNESIAN CHAMOSITE    
DASHKESANITE = POTASSIAN HASTINGSITE    
DAPHNITE = MAGNESIAN CHAMOSITE    
DANNEMORITE = MANGANOGRUNERITE []Mn2Fe++5Si8O22(OH)2 M
DAMOURITE = MUSCOVITE    
CYRTOLITE = ZIRCON    
CYMATOLITE = Mixture MUSCOVITE + ALBITE    
CYCLOWOLLASTONITE (?) = Artificial product CaSiO3 A
CYANITE = KYANITE    
CUSTERITE = CUSPIDINE    
CUPROHALLOYSITE = HALLOYSITE    
DEUTEROLITE = TOURMALINE    
JARGON = ZIRCON    
IMATRA STONE = a clay concretion    
KALIUM PARGASITE = POTASSICPARGASITE    
KALIUM FLUORRICHTERITE = POTASSIUMFLUORRICHTERITE (K,Na)(Ca,Na)2(Mg,Fe)5Si8O22(F,OH)2 M
KALIFELDSPATH = ORTHOCLASE, MICROCLINE, SANIDINE, ADULARIA    
JURUPAITE = MAGNESIAN XONOTLITE    
JOHNSTRUPITE = MOSANDRITE    
JOAQUINITE = JOAQUINITE group Ba2NaCe2Fe++(Ti,Nb)2Si8O26(OH,F).H2O M
LEUCOPHYLLITE = ALUMINOCELADONITE    
LEVERRIERITE = Mixture KAOLINITE + ILLITE    
JENKINSITE = FERROAN ANTIGORITE    
KALIUM-MAGNESIOHASTINGSITE = POTASSICMAGNESIOHASTINGSITE    
JEFFERISITE = VERMICULITE    
KALKEISENGRANAT = ANDRADITE    
GLAUCOLITE = a SODALITE Na8(Al6Si6O24)Cl2  
LEVYNITE = LEVYNE    
GOTCHENITE = GOTZENITE    
IRON CORDIERITE = SEKANINAITE    
LIEVRITE = ILVAITE    
IOLITE = CORDIERITE    
LITHIONITE = LEPIDOLITE    
IOCHROITE = TOURMALINE    
INYLCHEKITE = HEJTMANITE    
LAVROVITE = DIOPSIDE Ca(Mg,V+++)(Si2O6) M
JELLETITE = ANDRADITE    
LESSINGITE-(Ce) = BRITHOLITE-(Ce) (Ce,Ca)5(SiO4)3(F,OH) M
LEONHARDITE = Partially dehydrated LAUMONTITE    
LEPIDOLITE = TRILITHIONITE K(Li,Al)3(Si,Al)4O10(F,OH)2 M
LAPIS LAZULI = LAZURITE    
KUPFERGRUN = CHRYSOCOLLA    
KUNZITE = SPODUMENE    
KOTSCHUBEITE = CHROMIAN CLINOCHLORE    
KOLSKITE = Mixture LIZARDITE + SEPIOLITE    
LEPIDOMELANE = FERRIAN BIOTITE    
KNEBELITE = MANGANOAN FAYALITE (Fe++,Mg,Mn)2SiO4 O
KLIPSTEINITE = Altered RHODONITE    
KALIUM RICHTERITE = POTASSIUMRICHTERITE (K,Na)(Ca,Na)2(Mg,Fe)5Si8O22(OH,F)2 M
KEROLITE = TALC (Mg,Ni)3Si4010(OH)2.H2O M (?)
ILLITE = a series name (K0,65Al2[]Al0,65Si3,35O10(OH)2 M
KELYPHITE = Mixture 'HORNBLENDE' + 'PICOTITE'    
KATANGITE = PLANCHEITE    
KATANGAITE = PLANCHEITE    
KASOITE = CELSIAN    
KARPINSKYITE = Mixture LEIFITE + CLAY    
LEUCHTENBERGITE = CLINOCHLORE    
KAOLINITE-SMECTITE = Clay minerals Al.Si.O.OH.H2O  
KAMMERERITE = CHROMIAN CLINOCHLORE    
KALKKREUZSTEIN = PHILLIPSITE    
KALKGRANAT = ANDRADITE    
K-FELDSPAR = POTASSIUM FELDSPAR = MICROCLINE or ORTHOCLASE    
HEGAUITE = NATROLITE    
INDICOLITE = INDIGOLITE = ELBAITE or SCHORL    
HOEGTVEITITE = THALENITE    
HIDDENITE = SPODUMENE    
HIBSCHITE = GROSSULAR hydroxyl variety {Ca3}[Al2](Si3-x[]x)O12-4x(OH)4x C
HEXAGONITE = MANGANOAN TREMOLITE    
LUSAKITE = COBALTOAN STAUROLITE (Fe++,Mg,Co)2Al9(Si,Al)4O22(OH)2 O
HETEROPHYLLITE = BIOTITE    
MACGILLITE = MCGILLITE    
HESSONITE = GROSSULAR    
HOGTVEITITE = THALENITE    
HELIODOR = BERYL    
HORNBLENDE = FERROHORNBLENDE, MAGNESIOHORNBLENDE    
HAWAIITE = an OLIVINE    
MACKINTOSHITE = THOROGUMMITE    
HALLERITE = PARAGONITE    
HACKMANITE = SODALITE    
GRUENLINGITE = GRUNLINGITE = Mixture JOSEITE + BISMUTHINITE    
GROVESITE = PENNANTITE    
GRIFFITHITE = FERROAN SAPONITE    
GRANDITE = GROSSULAR-ANDRADITE    
GRAMMATITE = TREMOLITE    
GOUVERNEURITE = DRAVITE    
HERSCHELITE = CHABAZITE-Na   R
HYDROMICA = BRAMMALLITE, HYDROBIOTITE, ILLITE    
LITHIUMMUSCOVITE (LITHIUM MUSCOVITE) = TRILITHIONITE    
IIDATEITE (?) Cu5Al5[(Si,S,As)O4]3OH14.4H2O (?) M
IDOCRASE = VESUVIANITE    
ICOSAEDRITE = ICOSAHEDRITE    
HYPERSTHENE = ENSTATITE-FERROSILITE (Mg,Fe++)2Si2O6 O
LOMBAARDITE = ALLANITE-(Y)   M
HYDROXYLVISHNEVITE = HYDROXYCANCRINITE (?)    
LOTRITE = PUMPELLYITE    
LOVCHORRITE = MOSANDRITE-(Ce)    
HOGAUITE = NATROLITE    
HYDROMUSCOVITE = ILLITE    
JADE = JADEITE or NEPHRITE or SERPENTINE or CHRYSOPRASE or JASPIS or RHODONITE    
HYDROMICA = a mixture    
HYDROHAUSMANNITE = Mixture    
HYDROGROSSULAR = HIBSCHITE-KATOITE Ca3Al2(SiO4)3-x(OH)4x C
HYDROGARNET = GARNET A3B2(SiO4)3-x(OH)4x C
HYDRO UGRANDITE = HYDROUGRANDITE (Ca,Mg,Fe++)3(Fe+++,Al)2(SiO4)3-x(OH)4x C
HYDRATED HALLOYSITE = ENDELLITE (?) = HALLOYSITE    
HYALOSIDERITE = FAYALITE    
HYALOALLOPHANE = ALLOPHANE + HYALITE    
HYACINTH = Orange ZIRCON or GROSSULAR var. HESSONITE    
HUMBOLDTILITE = MELILITE    
HORTONOLITE = MAGNESIAN MANGANOAN FAYALITE (Fe++,Mg,Mn)2SiO4  
HYDROXYL VISHNEVITE = HYDROXYCANCRINITE (?)    
ANTHRACITE = Hard coal variety    
PYROBITUMEN = Hydrocarbon with S, N, also U, etc.   am.
ELATERITE = Mineral caoutchouc    
BERNSTEIN = AMBER    
HATCHETTITE = HYDROCARBONS Mixture    
BITUMEN = Mineral pitch    
FRINGELITE = a mixture of organic fossil pigments    
ASPHALTUM = Mineral pitch    
ASPHALTE = ASPHALTUM    
PENDLETONITE = CARPATHITE    
JAIS = JET (Gemstone from hard black lignite)    
SUCCINITE = AMBER    
COPALITE = a resin    
DYSODILE = a resin    
THUCHOLITE = a PYROBITUMEN    
JET (Gemstone from hard black lignite)    
KARPATITE or KARPATHITE = CARPATHITE    
CURTISITE = IDRIALITE    
KOCHENITE = AMBER [C,H,O] am.
CORONENE = CARPATHITE    
OZOCERITE = HYDROCARBONS Mixture    

mlevy

[Mineral Search]     [Abbreviations]     [Pictures]     [Athena]

mlevy

Send comments on page to mail pp

Copyright © 1986, 1994, 2022 ATHENA - Pierre Perroud. All Rights Reserved.